|
| Primary (First) - woody |
| FR | | symroxane (Symrise) |
| | odor: woody tobacco old wood ambergris vetiver peppery spicy amber powdery |
| FL/FR | (Z)- | abienol |
| | odor: woody amber |
| FL/FR | | abies alba cone extract |
| | odor: spruce woody |
| FR | | abies amabilis oil canada |
| | odor: fresh fir woody balsam citrus |
| FR | | abies balsamea bark oil |
| FR | | abies grandis oil canada |
| | odor: fresh woody fir pear clean citric |
| FR | | abies lasiocarpa oil canada |
| | odor: fresh woody fir cypress spruce balsam |
| | ar- | abietatriene |
| | odor: woody spicy herbal |
| FR | | acetoxymethyl isolongifolene |
| | odor: woody amber vetiver acetate sandalwood clary sage |
| FR | | acetyl cedrene |
| | odor: warm woody amber musk |
| | 5- | acetyl-2,6-dimethylene-10,10-dimethylbicyclo [7.2.0.sup.1,9 ]undecane |
| | 5- | acetyl-2-((2-furanyl methyl)thio) dihydro-2,5-dimethyl-3(2H)-furanone |
| | odor: woody coffee |
| FR | | agarwood oil |
| | odor: sweet agarwood woody balsam sandalwood leathery fruity smoky animal tobacco |
| FR | | agarwood oil CO2 extract |
| | odor: sweet woody balsam sandalwood |
| FR | | agarwood oil replacer |
| | odor: woody vetiver sweet balsamic animal earthy amber smoky |
| FR | | agarwood specialty |
| | odor: woody vetiver sweet balsamic animal earthy amber spicy smoky |
| FR | alpha- | allyl-alpha-3,3-trimethyl-2-norbornane methanol |
| | odor: sweet woody spruce cedarwood balsamic berry blueberry incense resinous |
| FR | | amber carbinol |
| | odor: woody amber dry fatty soapy raisin |
| FR | | amber decane |
| | odor: woody cedar ambergris dry dusty amber |
| FR | | amber decatriene |
| | odor: ambergris woody cedar dry tobacco musk |
| FR | | amber dodecane |
| | odor: woody celery musk ambergris old wood |
| FR | | amber formate |
| | odor: dry woody amber dusty powdery |
| FR | | amber pentadecane |
| | odor: warm woody dry amber old wood |
| FR | | amber woody specialty |
| | odor: woody amber |
| FR | | ambrene acetal |
| | odor: woody cedar amber dry dusty ambergris |
| CS | | amyl cyclopentenone |
| | odor: woody isojasmone jasmin tuberose |
| FR | | amyris acetate |
| | odor: woody cedar fatty amber vetiver acetate |
| FL/FR | | amyris bark oil |
| | odor: woody sweet creamy sandalwood blackcurrant smoky |
| FL/FR | | angelica archangelica root extract |
| | odor: woody herbal tea |
| FL/FR | | angelica archangelica root oil CO2 extract |
| | odor: woody herbal tea |
| FL/FR | | angelica archangelica root tincture |
| | odor: woody herbal tea |
| FL/FR | | angelica archangelica root water |
| | odor: woody herbal tea |
| FR | | anthocephalus cadamba oil |
| | odor: woody floral sweet minty champaca neroli |
| | (+)- | aromadendrene |
| | allo | aromadendrene |
| FR | mountain | ash fragrance |
| | odor: woody balsamic green cortex earthy |
| FR | | bark fragrance |
| | odor: woody dry balsamic sawdust rooty cortex |
| FL | (E)-alpha- | bergamotene |
| | odor: woody warm tea |
| FL/FR | | bois de rose leaf oil brazil |
| | odor: sweet woody linalool |
| | flavor: bois de rose |
| FL/FR | | bornyl acetate |
| | odor: Woody, camphoreous, mentholic, cedar woody, spicy and gin-like |
| | flavor: Camphoreous, woody, mentholic, berry and seedy with soapy woody nuances |
| FL/FR | | bornyl valerate |
| | odor: Woody oak and sawdust, berry seedy, spicy with a camphoreous nuance |
| | flavor: Woody, sawdust-like, with dry tobacco and tea nuances |
| FL/FR | iso | bornyl isovalerate |
| | odor: woody dry valerian root pine camphoreous oily balsamic forest |
| | flavor: Woody, camphoreous and borneol-like with green nuances |
| FR | | boswellia carteri gum extract |
| | odor: frankincense |
| FR | | boswellia carteri resin extract |
| | odor: frankincense |
| FR | | boswellia carteri tincture |
| | odor: frankincense |
| FL/FR | | boswellia carterii gum oil |
| | odor: frankincense |
| | flavor: frankincense |
| FR | | boswellia serrata gum extract |
| | odor: frankincense |
| FR | | boswellia serrata resin extract |
| | odor: frankincense |
| FL/FR | | boswellia thurifera gum |
| | odor: frankincense |
| | flavor: frankincense |
| FR | | boxwood fragrance |
| FR | | briar wood fragrance |
| FR | | bruyere root absolute |
| | odor: woody green balsam spicy |
| FR | 2-tert- | butyl cyclohexanone |
| | odor: powerful woody camphor orris minty |
| FR | para-tert- | butyl cyclohexanone |
| | odor: woody mint patchouli musk leather |
| | cis-3-tert- | butyl cyclohexyl acetate |
| | odor: woody, iris-like, fresh, flowery, slightly camphor-like |
| FR | iso | butyl ionone |
| | odor: woody vetiver earthy rooty |
| | | cadina-1,4-dien-3-ol |
| | odor: woody spicy |
| FL/FR | | cadinene |
| | odor: fresh woody longifolone |
| | flavor: woody terpenic herbal vetiver patchouli spicy chamomile phenolic |
| | alpha- | cadinene |
| | odor: woody dry |
| | alpha- | calacorene |
| | | calarene epoxide |
| | odor: radiant woody patchouli ambergris |
| FR | | callitris glaucophylla wood oil australia |
| | odor: woody lactonic balsamic resinous dry |
| FR | | callitris intratropica wood oil australia |
| | odor: woody floral earthy fruity balsamic herbal resinous smoky |
| FL/FR | | camphene |
| | odor: woody herbal fir needle camphor terpenic |
| | flavor: Camphoraceous, cooling, minty, with citrus and green spicy nuances |
| FL/FR | (-)- | camphene |
| | odor: fresh woody fir terpene |
| FL/FR | (+)- | camphene |
| | odor: fresh herbal woody fir camphor |
| | flavor: Minty cooling, woody pine and resinous, medicinal Vicks VapoRub, citrus lime-like and eucalyptus |
| FL | alpha- | campholene acetate |
| | odor: sweet woody ionone |
| FR | | camphor tree wood oil |
| | odor: woody spicy herbal medicinal powdery |
| CS | iso | caryophyllene |
| | odor: woody spicy |
| FL/FR | alpha- | caryophyllene alcohol |
| | odor: woody spicy earthy |
| FL/FR | beta- | caryophyllene alcohol |
| | odor: warm woody moss spicy earthy |
| FL/FR | beta- | caryophyllene alcohol acetate |
| | odor: woody dry earthy amber fruity spicy |
| FL/FR | | caryophyllene formate |
| | odor: woody spicy peppery camphoreous |
| FL/FR | beta- | caryophyllene oxide |
| | odor: sweet fresh dry woody spicy |
| | flavor: dry woody cedar old wood carrot ambrette amber |
| FR | | cedanol |
| | odor: woody cedar balsamic pine |
| FR | | cedar cyclododecatriene |
| | odor: warm woody cedar amber vetiver |
| FR | | cedar fragrance |
| FR | | cedar specialty |
| | odor: cedar woody cedarwood amber |
| FR | | cedarleaf oil replacer |
| | odor: cedar woody spicy aromatic camphoreous thujonic herbal green hay |
| FR | atlas | cedarwood absolute |
| | odor: dry woody old wood phenolic spicy |
| FL/FR | | cedarwood essence texas |
| | odor: cedarwood |
| FL/FR | | cedarwood essence virginia |
| | odor: cedarwood |
| FR | | cedarwood fragrance |
| FR | epoxidized | cedarwood oil |
| | odor: clean woody dry cedar earthy |
| FR | terpeneless atlas | cedarwood oil |
| | odor: cedar woody |
| FR | | cedarwood oil atlanta |
| | odor: cedarwood |
| FR | | cedarwood oil china |
| | odor: woody burnt musty cedar |
| FR | | cedarwood oil himalaya |
| | odor: cedar like atlis cedar |
| FR | | cedarwood oil lebanon |
| | odor: cedarleaf grassy |
| FR | | cedarwood oil port orford |
| | odor: sweet woody pine fennel herbal |
| FR | | cedarwood oil replacer |
| | odor: woody cedar aromatic sandalwood floral perfume |
| FL/FR | | cedarwood oil terpenes |
| | odor: woody cedar floral |
| | flavor: Woody, cedar, dry, sandalwood-like with floral nuances |
| FR | | cedarwood oil texas |
| | odor: cedar woody |
| FR | | cedarwood oil virginia |
| | odor: cedar woody oily balsam |
| FR | | cedarwood oil western red |
| | odor: woody aromatic lime spicy cumin peppery nutmeg almond |
| FR | | cedarwood oil white |
| | odor: woody cedar aromatic sandalwood floral perfume |
| | flavor: woody cedar dry sandalwood floral |
| FR | (R)- | cedralone |
| | odor: woody cedar |
| FR | | cedrelopsis grevei bark oil |
| | odor: woody dry green balsamic |
| FL/FR | alpha- | cedrene |
| | odor: woody cedar sweet fresh |
| FR | alpha- | cedrene epoxide |
| | odor: woody amber tobacco sandalwood fresh linalyl acetate patchouli |
| FR | | cedrenone |
| | odor: soft woody cedar |
| FL/FR | | cedrol |
| | odor: cedarwood woody dry sweet soft |
| | flavor: woody amber floral cedar ambrette musk powdery |
| FR | | cedrol methyl ether |
| | odor: woody dry cedar ambergris earthy vetiver |
| FL/FR | | cedryl acetate |
| | odor: sharp dry woody cedar |
| | flavor: woody cedar dry amber old wood powdery |
| FR | | chamaecyparis nootkatensis wood oil |
| | odor: fresh woody oily orris styrax balsamic powdery resinous |
| FR | | chamaecyparis obtusa wood oil |
| FR | | chloranthus spicatus absolute |
| | odor: woody floral boronia sweet balsam |
| FL/FR | | cinnamyl tiglate |
| | odor: woody cinnamyl green herbal |
| FL/FR | | cistus ladaniferus absolute resin |
| | odor: sweet old wood incense amber ambergris resinous musty dry |
| | flavor: woody old wood amber resinous ambergris phenolic burnt |
| FR | | cistus ladaniferus gum |
| | odor: sweet dry woody old wood amber ambergris resinous balsamic |
| | flavor: woody old wood amber resinous phenolic burnt balsamic |
| FL/FR | | cistus ladaniferus resinoid |
| | odor: sweet dry woody old wood amber ambergris balsamic gourmand |
| | flavor: woody old wood amber resinous phenolic burnt balsamic |
| FR | | cistus ladaniferus twig extract |
| | odor: cistus |
| FR | | cistus leaf oil |
| | odor: woody balsamic |
| FR | | cistus twig/leaf absolute |
| | odor: sweet old wood amber balsamic ambergris animal resinous phenolic leathery |
| FL/FR | | cistus twig/leaf oil |
| | odor: warm old wood amber balsamic ambergris chamomile animal spicy phenolic |
| | flavor: old wood amber balsamic spicy phenolic hay |
| FL/FR | | cistus twig/leaf oil molecular distilled |
| | odor: woody old wood burnt wood ambergris animal phenolic smoky balsamic cedar |
| | flavor: woody burnt wood animal smoky old wood amber spicy resinous |
| FR | | clearwood (Firmenich) |
| | odor: patchouli woody clean creamy amber |
| FR | (Z)- | coconut decanone methyl |
| | odor: rich woody lactone |
| FR | | convolvulus scoparius wood oil |
| | odor: sweet woody floral nerol nerolidol rhodinol linalool |
| | alpha- | copaene |
| | odor: woody spicy honey |
| FL/FR | | copaiba balsam |
| | odor: woody balsam labdanum |
| | flavor: copaiba |
| FR | | costus specialty |
| | odor: soft old precious wood animal sebaceous |
| FL/FR | | curcuma zedoaria bark extract |
| | odor: zedoary |
| | flavor: zedoary |
| FL/FR | | cycloionone |
| | odor: woody cedarwood raspberry orris root |
| | flavor: woody cedarwood fruity floral raspberry orris |
| FR | | cyperus root oil (cyperus rotundus) |
| | odor: woody cassie boronia violet tea mossy balsamic |
| FR | | cyperus root oil (cyperus scariosus) |
| | odor: woody earthy cinnamon olibanum dry spicy cedar |
| FR | terpeneless | cypress oil |
| | odor: woody |
| FR | | cypriol oil (cyperus scariosus) |
| | odor: woody earthy dry spicy patchouli vetiver |
| FR | | dacrydium franklinii wood oil |
| | odor: sweet woody spicy cedarwood |
| FR | | dalbergia sissoo leaf oil |
| | odor: woody herbal green spicy |
| FR | 2- | decalinyl acetate |
| | odor: woody floral fruity herbal dusty |
| FL | 8,9- | dehydrotheaspirone |
| FR | | diethyl dimethyl-2-cyclohexenone |
| | odor: dry woody chrysanthemum phenolic powdery orris |
| FL | iso | dihydrocarveol |
| | odor: woody spice |
| FL/FR | | dihydro-beta-ionol |
| | odor: woody floral amber |
| FL/FR | | dihydro-gamma-ionone |
| | odor: warm woody earthy ambergris tobacco amber violet |
| FL/FR | | dihydro-alpha-ionone |
| | odor: woody floral berry orris powdery violet raspberry fruity |
| | flavor: creamy berry floral woody orris earthy violet powdery tropical |
| FL/FR | | dihydro-beta-ionone |
| | odor: earthy woody mahogany orris dry amber |
| | flavor: woody, seedy, berry raspberry, with leafy, spicy nuances |
| FL/FR | 6,7- | dihydrolinalool |
| | odor: woody citrus camphoreous |
| | | dillapiol (dill) |
| | odor: wood spice |
| | 3',4'- | dimethoxyacetophenone |
| | odor: sweet woody floral |
| | 1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl) cyclohex-3-ene carbaldehyde |
| | odor: woody, weak, and slightly animalic notes |
| FR | 4-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-1-methyl-2-oxabicyclo(2.2.2)octane |
| | odor: woody, animalic, phenolic in water, leather, amber, sweet, and slightly fruity notes |
| | 4-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-1,5-dimethyl-2-oxabicyclo(2.2.2)octane |
| | odor: woody and onion |
| FR | 4-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-oxabicyclo(2.2.2)octane |
| | odor: woody, cedar-like, creamy, and earthy notes |
| | 1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2,4-dimethyl cyclohex-3-ene carbaldehyde |
| | odor: woody and smoky notes |
| FR | 4-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-5-methyl-2-oxabicyclo(2.2.2)octane |
| | odor: woody, fresh, dry, and amber notes |
| FR | 1,4- | dimethyl bicyclo(3.2.1)octan-3-one |
| | odor: woody, fresh, minty, and menthol notes |
| FR | | dimethyl cyclormol (IFF) |
| | odor: camphor earthy patchouli woody herbal |
| FR | | dimethyl ionone |
| | odor: woody orris violet berry powdery |
| FL/FR | (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol |
| | odor: woody pine lemon lime citronellol |
| | 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol |
| | odor: weak woody, weak earthy, green, and slightly camphoraceous notes |
| | 3,7- | dimethyl-1-octene |
| | odor: woody, piney, herbaceous |
| | 1,5- | dimethyl-3-n-pentyl-2-oxabicyclo(2.2.2)octane |
| | odor: woody, spicey and black pepper aroma |
| | flavor: black pepper flavor |
| FL/FR | (3S,5R,8S)-3,8- | dimethyl-5-prop-1-en-2-yl-3,4,5,6,7,8-hexahydro-2H-azulen-1-one |
| | odor: woody peppery agarwood |
| FR | | dogwood fragrance |
| FR | | dogwood specialty |
| | odor: woody dry patchouli vetiver warm spicy fern |
| FR | | dryopteris filix-mas oleoresin |
| | odor: sweet woody earthy floral |
| FL | | elecampane root absolute |
| | odor: woody rooty fatty sweet oily |
| FL | | elecampane root oil |
| | odor: woody rooty dry sweet amber costus |
| FR | (E)- | ethyl geranate |
| | odor: woody rose green |
| FR | alpha- | ethyl-2,2,6-trimethyl cyclohexane propanol |
| | odor: woody cedarwood ambergris sandalwood |
| | 7-epi-alpha- | eudesmol |
| | beta- | eudesmol |
| | odor: woody green |
| | 10-epi-gamma- | eudesmol |
| | odor: sweet woody floral |
| FL/FR | alpha- | farnesene |
| | odor: citrus herbal lavender bergamot myrrh neroli green |
| | flavor: Fresh green vegetative, with celery and hay nuances and somewhat fatty and tropical fruity afternotes |
| FL/FR | (E)-beta- | farnesene |
| | odor: woody citrus herbal sweet |
| FL/FR | alpha- | farnesene isomer |
| | odor: citrus herbal lavender bergamot myrrh neroli green |
| | flavor: Fresh green vegetative, with celery and hay nuances and somewhat fatty and tropical fruity afternotes |
| FR | douglas | fir oil |
| | odor: fresh woody fir citric oily carrot seed balsam |
| FR | woody | floral fragrance |
| FL | | frangula alnus bark extract |
| FL/FR | | frankincense absolute |
| | odor: woody terpenic incense balsamic herbal |
| | flavor: Medicinal, woody, mentholic, herbal and spicy |
| FL/FR | | frankincense gum |
| | odor: olibanum old wood fresh woody |
| | flavor: frankincense |
| FL/FR | | frankincense gum (boswellia serrata) |
| | odor: frankincense |
| | flavor: frankincense |
| FL/FR | | frankincense oil (boswellia serrata) |
| | odor: frankincense |
| | flavor: frankincense |
| FL/FR | | frankincense oil CO2 extract |
| | odor: terpene incense old wood woody |
| | flavor: frankincense |
| FL/FR | | frankincense oil CO2 extract (boswellia serrata) |
| | odor: frankincense |
| | flavor: frankincense |
| FL/FR | | frankincense resin |
| | odor: old wood incense amber |
| | flavor: frankincense |
| FL/FR | | frankincense resinoid (boswellia serrata) |
| | odor: frankincense |
| | flavor: frankincense |
| FL/FR | | furfural |
| | odor: sweet woody almond fragrant baked bread |
| | flavor: Brown, sweet, woody, bready, nutty, caramellic with a burnt astringent nuance |
| | | furfuryl thenyl ether |
| | odor: woody, green, elderberry-like |
| FR | | gardenia amide |
| | odor: fresh woody citrus oily natural cedar grapefruit |
| FR | | georgywood |
| | odor: woody amber floral |
| | | germacrene B |
| | odor: woody earthy spicy |
| FL/FR | (E)- | germacrene D |
| | odor: woody spice |
| FL/FR | | guaiacum officinale gum extract |
| | odor: woody guaiacwood |
| | flavor: guaiacwood woody |
| | | guaiacum officinale wood |
| | odor: woody guaiacwood |
| FL/FR | | guaiacum officinale wood extract |
| | odor: woody guaiacwood |
| | flavor: guaiacwood |
| FR | | guaiacum officinale wood tincture |
| | odor: woody guaiacwood |
| FR | | guaiacwood acetates |
| | odor: sweet woody guaiacwood |
| FR | | guaiacwood extract acetate |
| | odor: woody vetiver balsamic tea rose |
| | flavor: aromatic burnt fruity meaty woody smoky astringent vanilla coumarinic |
| FL/FR | | guaiacwood oil |
| | odor: sweet dry woody spicy powdery balsamic tea rose oriental copaiba |
| | flavor: woody balsamic spicy peppery powdery oily bitter resinous |
| FL/FR | | guaiacyl acetate |
| | odor: sweet woody spice dry clove powdery smoky |
| | flavor: Woody, guaiacol, smoky, astringent and phenolic with vanillin and coumarin nuances |
| FL/FR | | guaiene |
| | odor: sweet woody dry guaiacwood spicy powdery |
| | flavor: woody guaiacwood balsamic spicy cascarilla myrrh powdery |
| FL/FR | alpha- | guaiene |
| | odor: sweet woody balsam peppery |
| FR | | gurjun balsam |
| | odor: sweet woody balsamic copaiba amyris |
| FR | alpha- | gurjunene |
| | odor: wood balsam |
| FR | | hay leaf oil |
| | odor: hay |
| FR | | hedychium spicatum root oil |
| | odor: woody fresh spicy camphor ginger minty eucalyptus |
| | 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
| | odor: woody, camphoreous odor and is quite similar to patchouli alcohol |
| | 1,3,3,4,5,6,7- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: warm, woody |
| | 1,3,3,4,5,6,8- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: warm, woody |
| FR | | herbal norbornane |
| | odor: sweet fresh woody earthy patchouli vetiver herbal |
| FR | 3a,3b,5,6,7,8a- | hexahydro-2,2,3a,3b,7,7-hexamethyl-4H-indeno[1,2-D]-1,3-dioxole |
| | odor: strong, woody ambery |
| | 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole |
| | odor: woody earthy green patchouli cashmeran moldy cucumber aldehydic moss amber |
| FR | | hexahydrotetramethyl methanonaphthalen-8-one |
| | odor: woody patchouli |
| | 1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one |
| | odor: woody, pine cone, warm |
| | 1,3,3,4,5,6- | hexamethyl-2-ethyl bicyclo(2.2.2)-5-octen-2-ol |
| | odor: woody, camphoraceous |
| FR | | ho wood oil |
| | odor: sweet linalool woody floral |
| FL | alpha- | humulene |
| | odor: woody |
| FL/FR | | humulus lupulus extract |
| | odor: woody green citrus malt tagette |
| | flavor: hops |
| FR | | hydroxyambran |
| | odor: woody amber musk |
| FR | | hydroxycitronellal diisotridecyl acetal |
| | odor: fresh sweet woody hydroxycitronellal milky |
| | (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one |
| | odor: woody herbaceous camphor |
| | (1R,4R)-1- | hydroxy-1,4,7,7,9,9-hexamethyl spiro(4.5)decan-2-one |
| | odor: woody patchouli |
| FR | | hydroxymethyl isolongifolene 50% in dpg |
| | odor: warm woody amber animal clary dry |
| | (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one |
| | odor: Strong, powerful, and characteristic of natural patchouli oil, with rich woody-ambery and tobacco-like facets |
| | 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one |
| | odor: woody, dry, tobacco character |
| | 8- | hydroxy-5-isopropyl-nonan-2-one |
| FL/FR | alpha- | ionone |
| | odor: sweet woody floral violet orris tropical fruity |
| | flavor: floral violet powdery berry raspberry tropical blackberry blueberry |
| FL/FR | gamma- | ionone |
| | oxo-beta- | ionone |
| FR | alpha- | ionyl acetate |
| | odor: sweet woody floral violet berry |
| FR | | jatamansi root oil |
| | odor: heavy sweet woody spicy animal |
| FL/FR | | juniper berry oleoresin |
| | odor: juniperberry woody spicy celery coffee toffee |
| | flavor: sweet woody toffee celery earthy coffee |
| FR | | juniper fragrance |
| FR | | juniper needle oil |
| | odor: woody juniper fir spicy pine |
| FR | | juniper oil replacer |
| | odor: juniper |
| FL/FR | | juniperus communis wood extract |
| | odor: juniper |
| | flavor: juniper |
| FR | | juniperus communis wood oil |
| | odor: juniper |
| FR | | juniperus deppeana wood oil |
| | odor: cedarwood woody |
| FR | | juniperus virginiana wood extract |
| | odor: cedar woody |
| FL/FR | | kaempferia galanga rhizome oil |
| | odor: sweet woody warm balsam spicy |
| | flavor: camphoreous burning rich aromatic |
| | | khusimone |
| | odor: vetiver woody |
| FL/FR | | labdanum absolute |
| | odor: amber ambergris woody old wood sweet musty gourmand |
| | flavor: labdanum |
| FR | | labdanum concrete |
| | odor: sweet dry old wood amber ambergris balsam |
| FL/FR | | labdanum oil |
| | odor: woody old wood amber ambergris incense balsamic labdanum spicy |
| | flavor: woody old wood amber resinous ambergris phenolic burnt incense |
| FL/FR | | labdanum oleoresin |
| | odor: labdanum |
| | flavor: labdanum |
| FR | | labdanum twig oil |
| | odor: cistus |
| FR | | laitone |
| | odor: woody herbal celery lactone |
| FR | | laminaria absolute |
| | odor: woody dry musty green vegetable |
| FR | | leptospermum scoparium branch/leaf oil new zealand |
| | odor: woody animal musty dry grassy urine valerian root floral |
| FL/FR | | linalool oxide |
| | odor: floral herbal earthy green |
| | flavor: Green, floral, fatty, woody, fermented, herbal, fruity and berry |
| FL/FR | | litsea cubeba oil terpenes |
| | odor: fresh woody grassy dry sweet |
| FL/FR | | longifolene |
| | odor: sweet woody rose medical fir needle |
| | flavor: woody amber herbal medicinal pine ambergris |
| FR | (-)-iso | longifolene |
| | odor: woody dusty amber incense |
| FR | iso | longifolene epoxide |
| | odor: dry woody citrus linalyl and nopyl acetate |
| FR | iso | longifolene ketone |
| | odor: dry woody patchouli cedar earthy tobacco incense |
| FR | | manevoro oil |
| | odor: sweet woody herbal patchouli orris costus atlas cedar cistus |
| FR | | marine formate |
| | odor: fresh woody herbal seashore fruity apple |
| FR | | melaleuca bracteata leaf oil |
| | odor: sweet woody herbal dry tea leaf |
| FR | | melozol acetate |
| | odor: sandalwood woody fruity floral amber |
| FL/FR | trans-para- | menthan-2-one |
| | odor: woody minty spearmint cooling green |
| | flavor: minty |
| | 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methanoindene |
| | odor: weak woody, piney, camphoraceous, and clay notes |
| FR | | methyl anthranilate / isocyclocitral schiff's base |
| | odor: sweet woody indole orange blossom dry |
| FL/FR | | methyl cedryl ketone |
| | odor: woody vetiver amber leather musk cedar |
| | flavor: woody old wood phenolic cedar powdery cistus dry |
| FR | (R,S)- | methyl cedryl ketone |
| | odor: woody vetiver |
| FR | | methyl cedryl ketone replacer |
| | odor: woody cedar mossy |
| FR | 3- | methyl-6-cyclohexadecen-1-one |
| | odor: woody musk powdery creamy warm |
| FR | alpha-iso | methyl ionol |
| | odor: woody vetiver acetate |
| FL/FR | beta-iso | methyl ionone |
| | odor: woody ambergris waxy orris floral |
| FL/FR | delta- | methyl ionone |
| | odor: musk patchouli oakmoss |
| | | methyl ionone terpenes |
| | odor: sweet woody violet citrus |
| FR | | methyl methylene tricyclodecanol |
| | odor: woody spicy ginger cardamom |
| FR | | methyl methylene tricyclodecanol acetate |
| | odor: woody amber vetiver |
| FR | 3- | methyl pentyl angelate |
| | odor: woody floral celery seed chamomile |
| | 6- | methyl-3-isopropyl-hepta-4,6-dien-1-ol |
| | 2- | methyl-3-isopropyl pyrazine |
| | odor: enhanced the woody and coffee grounds notes |
| | flavor: earthy; green; sulfury; mouthfeel |
| FR | | methyl sandal |
| | odor: woody autumn sweet sandalwood sawdust |
| FR | iso | methyl tetrahydroionyl acetate |
| | odor: woody vetiver acetate powdery |
| FR | 2- | methyl-1-(5',5',6'-trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-ol |
| | odor: woody, mossy, tree bark, and patchouli notes |
| FR | | methyl 2,6,10-trimethyl cyclododeca-2,5,9-trienyl ketone |
| | odor: woody ambergris musk vetiver tobacco |
| FR | | methyl vetivate |
| | odor: dry woody peppery citrus |
| FL/FR | | mimosa concrete morocco |
| | odor: sweet woody fatty floral |
| | flavor: mimosa |
| FR | | moss naphthaleneol |
| | odor: woody green mossy fir balsamic patchouli |
| FR | woody | musk fragrance |
| FL | (-)-alpha- | muurolene |
| FR | | myoporum crassifolium wood oil |
| | odor: woody pine balsam cedar |
| FR | | myrrh fragrance |
| FR | | myrrh resinoid replacer |
| | odor: warm woody balsamic spicy |
| FL/FR | | myrtenol |
| | odor: woody pine balsam sweet mint medical |
| | flavor: Cooling, minty, camphoreous, green with a medicinal nuance |
| | (-)- | myrtenol |
| | odor: woody pine balsam sweet mint medical |
| | flavor: fir needle camphoreous minty woody |
| FL/FR | (1S,5R)- | myrtenyl acetate |
| | odor: herbal fresh sweet fruity citrus |
| | flavor: Woody, cedar-like, with fruity and floral nuances |
| FL/FR | | myrtenyl formate |
| | odor: woody pine oily |
| FR | | nonisyl formate |
| | odor: woody green herbal |
| FR | | nopyl aldehyde |
| | odor: woody pine linseed |
| FR | | oak wood specialty |
| | | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol |
| | odor: weak woody, weak patchouli, and camphoraceous notes |
| | | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one |
| | odor: weak woody, weak earthy, and camphoraceous notes |
| FR | (4aR,5R,7aS,9R)- | octahydro-2,2,5,8,8,9a-hexamethyl-4h-4a,9-methanoazuleno(5,6-d)-1,3-dioxole |
| | odor: woody amber agarwood |
| | 2-( | octahydro-4,7-methanoinden-5-yl)-ethanol + (6-methyloctahydro-4,7-methanoinden-5-yl)-methanol |
| | odor: very weak and woody notes |
| FR | | opoponax wood specialty |
| | odor: opoponax woody |
| | | origanum vulgare ssp. vulgare oil himalaya |
| | odor: woody herbal |
| FR | | orris hexanone |
| | odor: woody dry orris earthy camphor |
| FL/FR | | orris on essential oils |
| | odor: orris woody |
| FL/FR | | orris rhizome concrete butter (iris pallida) |
| | odor: woody fatty violet fruity sweet floral warm (8% irone) |
| | flavor: orris woody floral earthy violet soapy fatty |
| FR | | orris rhizome concrete replacer |
| | odor: woody fatty violet fruity sweet floral warm |
| FR | | orris rhizome fractions |
| | odor: woody cocoa |
| FR | | patchouli absolute |
| | odor: sweet herbal spicy woody fruity |
| FL/FR | | patchouli essence |
| | odor: patchouli |
| | flavor: patchouli |
| FR | | patchouli ethanone |
| | odor: woody dry ambergris cedar old wood ketonic phenolic |
| FR | | patchouli extract acetylated |
| | odor: woody patchouli |
| FR | | patchouli fractions |
| | odor: patchouli |
| FR | | patchouli fragrance |
| FR | | patchouli hexanol |
| | odor: woody musty patchouli camphor mint leather |
| FL/FR | (±)-trans- | patchouli hexanol |
| | odor: woody patchouli |
| FR | | patchouli leaf water |
| | odor: patchouli |
| FL/FR | | patchouli oil |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| | flavor: woody earthy weedy balsamic spicy camphoreous |
| FL/FR | terpeneless | patchouli oil |
| | odor: woody earthy |
| | flavor: patchouli |
| FL/FR | | patchouli oil china |
| | odor: woody earthy |
| | flavor: patchouli |
| FL/FR | | patchouli oil CO2 extract |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| | flavor: patchouli |
| FL/FR | | patchouli oil decolorized |
| | odor: old wood woody balsamic weedy earthy |
| | flavor: woody earthy weedy balsamic spicy camphoreous |
| FL/FR | | patchouli oil molecular distilled |
| | odor: patchouli |
| | flavor: woody earthy weedy balsamic spicy camphoreous |
| FR | | patchouli oil replacer |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| FR | | patchouli residues |
| | odor: patchouli |
| FR | | patchouli specialty |
| | odor: patchouli woody old wood dry earthy weedy balsamic spicy minty |
| FL/FR | | pepper tree berry absolute |
| | odor: fresh woody peppery warm spicy dry smoky |
| | flavor: peppery |
| | | perillene |
| FL/FR | | petroselinum crispum seed oil CO2 extract |
| | odor: warm woody spicy sweet green herbal |
| | flavor: parsley |
| FR | | picea mariana bark oil |
| FR | | picea mariana wood oil |
| FR | | pinacol |
| | odor: woody earthy patchouli warm bread |
| FL/FR | | pineapple hydroxyhexanoate |
| | odor: Sweet, woody, overripe, fruity, estry and pineapple-like with woody tropical nuances |
| | flavor: Sweet, fruity, overripe, pineapple and tropical with woody nuances |
| | iso | pinocarveol |
| | odor: woody warm balsam |
| | laevo- | pinocarveol |
| | odor: warm woody balsamic fennel |
| FR | | pistacia lentiscus leaf oil |
| | odor: woody resinous green |
| FL/FR | | pock wood oil |
| | odor: guaiacwood |
| | flavor: guaiacwood |
| FR | | pogostemon cablin leaf oil |
| | odor: woody patchouli |
| FL/FR | | polylimonene |
| | odor: woody herbal terpenic petroleum phenolic aromatic resinous painty |
| | 2-((3-iso | propenyl-1-methyl-2-methylene cyclopentyl)carbonyl) cyclopentan-1-one |
| | odor: strongly woody, cedarous |
| | 2-N- | propoxy-3(5)-methyl pyrazine |
| | odor: woody fruity green |
| | 1-(2-iso | propyl-5-methyl-6,8-dioxa-bicyclo[3.2.1.] octan-7-yl)-ethan-1-ol |
| | 2 -(2-iso | propyl-5-methyl-6,8-dioxa-bicyclo[3.2.1.] octan-7yl)-propan-2-ol |
| | odor: woody, green |
| | 5-iso | propyl-nonane-2,8-diol |
| | odor: woody, animal |
| | 5-iso | propyl-nonane-2,8-dione |
| | odor: woody, animal |
| FL/FR | 4-iso | propyl phenol |
| | odor: woody warm spicy medicinal |
| | flavor: burnt phenolic |
| FL/FR | iso | pulegyl acetate |
| | odor: woody sweet peppermint tropical |
| | flavor: Woody, berry, green and camphoreous with a fruity nuance |
| FL | | quassia amara bark extract |
| | odor: woody phenolic animal bitter chemical burnt medicinal balsamic |
| | flavor: bitter astringent medicinal fruity herbal green earthy |
| FL | | quercus alba chips extract |
| | odor: Woody, alcoholic, brown, smoky, whiskey and brandy with a spicy nuance |
| | flavor: Alcoholic, woody, oak, smoky, whiskey and rum |
| FR | | redwood fragrance |
| FR | | rhubarb oxirane |
| | odor: fresh woody spicy floral fruity rhubarb zesty |
| FL/FR | | sabinene |
| | odor: Woody, spicy, citrus and terpy with green, oily and camphoreous nuances |
| | flavor: Woody, spicy and camphoreous |
| FL/FR | (E)- | sabinene hydrate |
| | | salvia atropatana bunge oil iran |
| FR | | sandal glycol acetal |
| | odor: woody sandalwood camphor methyl acetophenone sweet |
| FR | | sandal hexanol |
| | odor: sandalwood clean sweet woody |
| FR | (R)- | sandal hexanol |
| | odor: sandalwood clean sweet woody balsamic |
| FR | | sandal pentenone |
| | odor: woody methyl ionone 4-t-butyl cyclohexyl acetate sandalwood |
| FL/FR | | sandalwood essence |
| | odor: sandalwood |
| | flavor: sandalwood |
| FR | | sandalwood fragrance |
| FL/FR | | sandalwood oil |
| | odor: sweet woody balsamic cashew terpene herbal spicy |
| | flavor: Woody, sandalwood, balsamic and floral with a terpy nuance |
| FR | | sandalwood oil acetylated |
| | odor: woody sandalwood |
| FR | | sandalwood oil replacer |
| | odor: sweet woody balsamic cashew terpenic herbal spicy |
| FL/FR | | sandalwood resinoid |
| | odor: woody sandalwood |
| | flavor: sandalwood |
| FR | | sandalwood specialty |
| | odor: sandalwood |
| FR | | sandela |
| | odor: sandalwood clean sweet woody cashew creamy |
| FL/FR | alpha- | santalol |
| | odor: woody sandalwood |
| FL/FR | beta- | santalol |
| FR | | santalum album extract |
| | odor: woody sandalwood |
| FR | | santalum album wood extract |
| | odor: sandalwood |
| FL/FR | | santalyl acetate |
| | odor: woody floral cashew nutty powdery orris |
| | flavor: Woody, ionone and berry like |
| FL/FR | (+)-alpha- | santalyl acetate |
| | odor: woody sandalwood powdery |
| FL/FR | | santalyl butyrate |
| | odor: woody balsam fruity rose nutty |
| FR | | santol pentenol |
| | odor: woody sandalwood herbal tropical |
| FR | | sap fragrance |
| FL/FR | | schinus terebinthifolius oil CO2 extract |
| | odor: woody peppery terpenic citrus spicy powdery green resinous |
| FD | | shellac |
| FR | | siam wood oil |
| | odor: woody balsam opoponax cedar floral |
| FL/FR | | spicy pentanone |
| | odor: sweet woody fruity spice burnt sugar |
| | flavor: sweet fruity spicy |
| FL/FR | | spikenard oil |
| | odor: sweet woody spicy animal valerian ginger cardamom |
| FR | | spikenard oil replacer |
| | odor: sweet woody spicy animal valerian ginger cardamom |
| FR | | spruce fragrance |
| FR | | sugi wood oil |
| | odor: woody cedar peppery atractylis |
| CS | | symphytum officinale leaf extract |
| | odor: mild woody rooty |
| | | symphytum officinale leaf tincture |
| | odor: mild woody rooty |
| FR | | teak fragrance |
| FR | | tectona grandis wood extract |
| FL/FR | alpha- | terpinene |
| | odor: woody terpene lemon herbal medicinal citrus |
| | flavor: Terpy, woody, piney, citrus lemon and lime with spice and mint nuances |
| FR | | tetrahydrolinalyl acetate |
| | odor: fresh woody bergamot citrus floral |
| FR | | tetrahydromugol |
| | odor: woody herbal pine |
| | 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene |
| | odor: woody, camphoraceous, minty, and floral |
| FR | beta,2,2,3- | tetramethyl-delta-methylene-3-cyclopentene-1-butanol |
| | odor: natural sandalwood |
| FR | | tetramethyl-4-methylene-2-heptanol |
| | odor: clean dry woody amber vetiver |
| | 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-ene-6-ol |
| | odor: woody balsamic patchouli |
| | 2,6,10,10- | tetramethyl-1-oxa-spiro[4.5]dec-3-en-6-yl acetate |
| | 1-(2- | thienyl)-1,2-propane dione |
| | odor: praline woody |
| | flavor: praline-like |
| FL/FR | | thuja occidentalis leaf oil |
| | odor: cedar woody spicy aromatic camphoreous thujonic herbal green hay |
| | flavor: woody spicy camphoreous thujonic herbal aromatic old wood |
| | alpha- | thujene |
| | odor: woody green herb |
| FR | | thyme oil portuguese |
| | odor: woody herbal |
| | flavor: thyme |
| FL/FR | | thymyl methyl ether |
| | odor: woody smoky burnt |
| | flavor: musty green earthy coffee beany |
| FR | | tobacco nonene |
| | odor: dry woody tobacco-leaf thuja |
| FR | | treemoss absolute |
| | odor: woody dry forest seaweed herbal green |
| FR | | treemoss absolute replacer |
| | odor: woody dry forest seaweed herbal green |
| FR | | treemoss concrete |
| | odor: woody tar |
| FR | | treemoss extract |
| | odor: woody tar |
| FR | | treemoss resinoid |
| | odor: woody resinous |
| FR | | treemoss resinoid replacer |
| | odor: woody mossy resinous |
| FR | 1-(5',5',6'- | trimethyl bicyclo(2.2.1)hept-2'-yl) propan-2-one |
| | odor: woody, ionone, and powdery notes |
| FR | 1-(5',5',6'- | trimethyl bicyclo(2.2.1)hept-2'-ylidene) propan-2-one |
| | odor: woody, fruity, fresh, resin, and apple notes |
| FR | | trimethyl cyclohexyl acetyl cyclopentanone |
| | odor: intensively woody, animal-like; extremely diffusive, excellent tenacity |
| | 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol |
| | odor: weak woody, weak earthy, and camphoraceous notes |
| | 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-yl acetate |
| | odor: weak woody, creamy, amber sweet, and cedar notes |
| FR | 4,6,11- | trimethyl-5-oxatricyclo(6.2.2.0*4,9*)dodec-6-ene |
| | odor: woody, powdery, floral, and sweet notes |
| FR | 4,6,11- | trimethyl-5-oxatricyclo(6.2.2.0*4,9*)dodecane |
| | odor: woody and green notes |
| FR | 2,3,5- | trimethyl phenol |
| | flavor: burnt coffee woody |
| FL/FR | 1,3,5,7- | undecatetraene |
| | odor: woody earthy leafy galbanum |
| FL/FR | 10- | undecenoic acid |
| FL/FR | | valeriana officinalis root extract |
| | odor: sweet woody dry powdery musky amber |
| | flavor: valerian root |
| FR | | vanilla cresol |
| | odor: vanilla woody spicy guaiacol |
| FR | | verdoxan |
| | odor: old wood earthy fruity green herbal sawen wood |
| FL/FR | | vetiver essence |
| | odor: vetiver |
| | flavor: vetiver |
| FR | | vetiver fragrance |
| FR | | vetiver oil acetylated |
| | odor: sweet woody root earthy sandal |
| FL/FR | | vetiver oil bourbon |
| | odor: woody rooty balsam |
| | flavor: vetiver |
| FL/FR | | vetiver oil brazil |
| | odor: woody rooty balsam |
| | flavor: vetiver |
| FL/FR | | vetiver oil CO2 extract |
| | odor: woody earthy rooty balsam amber |
| | flavor: woody green earthy smoky |
| FR | | vetiver oil fractions |
| | odor: woody earthy rooty spicy fruity |
| FL/FR | | vetiver oil haiti |
| | odor: woody earthy rooty balsam amber |
| | flavor: Musky, woody, vegetative with woody pine and sandalwood notes and perfume rosy geranium nuances |
| FL/FR | | vetiver oil haiti MD |
| | odor: woody earthy rooty balsamic amber guaiacwood weedy powdery |
| | flavor: woody rooty balsamic sandalwood vegetable old wood earthy powdery |
| FL/FR | | vetiver oil india |
| | odor: woody rooty balsam |
| | flavor: vetiver |
| FR | | vetiver oil replacer |
| | odor: vetiver |
| FR | | vetiver resinoid |
| | odor: sweet woody rooty balsam |
| FR | | vetiver specialty |
| | odor: woody vetiver powdery |
| FR | | vetiveria zizanioides root extract |
| | odor: vetiver |
| FL/FR | | vetiveria zizanioides root oil |
| | odor: woody earthy rooty balsam amber |
| | flavor: vetiver |
| FL/FR | | vetiverol |
| | odor: sweet balsam woody root sandalwood |
| | flavor: sweet woody balsamic floral powdery guaiacwood sawdust sage clary sage earthy |
| FL/FR | | vetiveryl acetate |
| | odor: woody powdery root vetiver sweet dry sandal |
| FR | | vetiveryl formate |
| | odor: sandalwood fresh woody |
| FR | | vetylbois |
| | odor: rich woody vetiver forest |
| FR | | violet propanol |
| | odor: woody violet cedar floral ambergris |
| FR | | warburgia ugandensis wood oil |
| | odor: woody balsamic smoky |
| FR | | woody acetate |
| | odor: woody cedar floral oily herbal balsam green fruity |
| FR | trans- | woody acetate |
| FR | | woody aldehydic fragrance |
| FR | | woody amber fragrance |
| FR | | woody amber specialty |
| | odor: woody amber |
| FR | (Z)- | woody amylene |
| | odor: woody floral pine balsam violet methyl ionone |
| FR | | woody bouquet fragrance |
| FR | | woody carboxylate |
| | odor: woody dry clean mahogany dank sawdust |
| FR | | woody cyclohexanone |
| | odor: woody old wood amber tobacco hot herbal |
| FR | | woody dodecane |
| | odor: woody cedar patchouli ambergris |
| FR | | woody epoxide |
| | odor: sweet dry woody powdery amber cedar patchouli sandalwood |
| FL/FR | (E)- | woody epoxide |
| | odor: woody amber |
| FR | | woody ether |
| | odor: cedar woody dry musk amber patchouli tobacco |
| FR | | woody fragrance |
| FR | | woody fruity fragrance |
| FR | | woody furan |
| | odor: dry dusty woody amber animal |
| FR | | woody heptene |
| | odor: fresh woody ozone clean outdoor |
| FR | | woody herbal fragrance |
| FR | | woody musk fragrance |
| FR | | woody nonane (ethoxy) |
| | odor: woody amber orris tobacco |
| FR | | woody octene |
| | odor: woody clean spicy balsam |
| FR | | woody oriental fragrance |
| FR | | woody powdery fragrance |
| FR | | woody propanol |
| | odor: warm woody dry amber powdery |
| FR | | woody specialty |
| | odor: woody frankincense incense forest amber cedar |
| FR | | wormseed oil replacer |
| FL | | wormseed oil spain |
| FR | | xanthoxylum alatum roxb. oil |
| | odor: warm woody green peppery spicy cubeb guaiacwood |
| FR | | zdravetz absolute |
| | odor: sweet woody floral herbal clary sage tobacco genet |
| FL/FR | | zdravetz oil |
| | odor: sweet woody floral herbal clary sage tobacco broom |
| FL/FR | | zedoary bark oil |
| | odor: warm woody spicy camphor cineole sweet |
| | flavor: zedoary |
| FL/FR | | zedoary root oil |
| | odor: zedoary |
| | flavor: zedoary |
| FL/FR | | zedoary root oil CO2 extract |
| | odor: zedoary |
| | flavor: zedoary |
|
| Secondary (Second) - woody |
| FR | | abies alba cone oil |
| | odor: fresh pine bitter orange peel |
| FR | | abies pectinata needle oil |
| | odor: woody pine |
| FR | | acetyl longifolene |
| | odor: sweet woody |
| FR | | agarwood oil (aetoxylon sympetalum) |
| | odor: aromatic woody umami mossy earthy mushroom smoky animal |
| FL/FR | | allspice berry absolute |
| | odor: Sweet, warm, spicy, woody with clove eugenol nuances |
| | flavor: Sweet, spicy, aromatic, warm with eugenol and cinnamon notes |
| FR | | allspice fragrance |
| FR | 1- | allyl-2,2,7,7-tetramethyl cycloheptanol |
| | odor: woody camphor patchouli earthy rooty |
| FR | | amber acetate |
| | odor: woody amber dry ambrette |
| FR | | amber butanol |
| | odor: woody amber ambrette |
| FR | | amber carane |
| | odor: amber woody spicy aldehydic green seaweed |
| FR | | amber cyclohexanol |
| | odor: woody amber dry guaiacwood |
| FR | | amber oil CO2 extract |
| | odor: resinous woody leathery |
| FR | | amber specialty |
| | odor: amber |
| FR | | amber spirolene |
| | odor: dry woody vetiver amber powdery musk fruity |
| FR | | ambermax 50 (Givaudan) |
| | odor: amber woody cedarwood ambergris |
| FR | | ambreine fragrance |
| FL/FR | | ambrette seed absolute |
| | odor: dry woody musk amber hay tobacco |
| | flavor: Woody, hay, dried fruit like, with musk and floral nuances |
| FL/FR | | ambroxan |
| | odor: ambergris old paper sweet labdanum dry |
| | flavor: Woody and fresh, with a piney and nutty nuance |
| FL/FR | | amyris wood oil |
| | odor: sweet balsam woody guaiacwood peppery cubeb |
| | flavor: burning woody balsamic spicy amber cascarilla orris resinous |
| FR | | amyris wood oil replacer |
| | odor: sweet balsamic woody guaiacwood peppery cubeb |
| FL/FR | | angelica archangelica seed extract |
| | odor: sweet woody herbal tea |
| | flavor: angelica |
| FR | | anona squamosa leaf oil |
| | odor: spicy woody cedar cubeb cardamom |
| FL | | apple essence concentrate |
| | odor: sweet fresh juicy apple woody brown fusel oil |
| | flavor: fresh sweet green juicy apple cider fusel |
| FR | | aromatic woody citrus floral fragrance |
| FR | | artemisia vestita wall. leaf oil |
| | odor: fresh herbal slightly sweet woody balsam sage davana oil |
| | | atractylodes lancea root |
| | odor: strong peppery woody spicy warm dry elemi ginger galanga |
| FR | | ayou wood oil |
| | odor: fresh spice borneol bacon woody |
| FR | | bergoxane |
| | odor: pyrazine green weedy woody vetiver |
| | | bicyclogermacrene |
| | odor: green woody weedy |
| FL/FR | beta- | bisabolene |
| | odor: balsamic woody |
| FL/FR | | bois de rose oil peru |
| | odor: sweet bois de rose woody camphor |
| | flavor: bois de rose |
| FL/FR | dextro,laevo- | borneol |
| | odor: pine woody camphor balsamic |
| FL/FR | laevo- | bornyl acetate |
| | odor: sweet balsamic woody fresh pine needle herbal |
| | flavor: balsamic herbal floral soapy woody spicy powdery |
| FL/FR | | bornyl butyrate |
| | odor: herbal woody |
| | | bornyl ethyl ether |
| | odor: camphoreous woody cedarwood eucalyptus blueberry |
| FL/FR | | bornyl 2-methyl butyrate |
| | odor: herbal woody |
| FL/FR | iso | bornyl methyl ether |
| | odor: pine woody camphor borneol |
| FL/FR | | boswellia rivae oil |
| | odor: resinous woody terpenic incense pine spicy camphoreous lemon |
| | flavor: frankincense |
| FL/FR | beta- | bourbonene |
| | odor: herbal woody floral balsamic |
| FR | | brachyleana hutchinsii wood oil |
| | odor: balsam woody sweet floral vetiver sandalwood |
| FL/FR | | brandy extract |
| | odor: fruity woody fusel winey cognac |
| | flavor: brandy |
| FR | | bruyere root oil |
| | odor: heather woody undergrowth earthy |
| FR | | bulnesia sarmienti extract |
| | odor: guaiacwood |
| FR | 4-tert- | butyl cyclohexane carboxaldehyde |
| | 8-tert- | butyl-1-oxaspiro[4.5]decan-2-one |
| | beta- | cadinene |
| | odor: green woody |
| | (R)-gamma- | cadinene |
| | odor: herbal woody |
| FL/FR | alpha- | cadinol |
| | odor: herb wood |
| FR | | calamintha clinopodium oil |
| | odor: pungent herbal woody sweet spicy |
| FR | | callitropsis araucarioides wood oil |
| | odor: balsamic woody floral rose fruity |
| FR | | cardamom liquid resin |
| | odor: warm woody orange citrus balsam |
| FL/FR | 4- | carvomenthenol |
| | odor: pepper woody earth musty sweet |
| | flavor: cooling mentholic woody weedy earthy herbal spicy citrus |
| FL/FR | | caryophyllene |
| | odor: sweet woody spice clove dry |
| | flavor: Spicy pepper-like, woody, camphoraceous, with a citrus background |
| FR | | caryophyllene alcohol acetate |
| | odor: fresh sharp cedar woody spicy |
| FL/FR | | cascarilla oil replacer |
| | odor: spicy woody peppery herbal anise |
| | flavor: spicy woody peppery cinnamon ginger nutmeg clove smoky |
| FL/FR | | cassia leaf oil |
| | odor: woody sweet cinnamon spicy |
| | flavor: cinnamon |
| FR | | cedar forest fragrance |
| FR | | cedarleaf oil western red |
| | odor: fresh sharp woody cedarleaf redwood herbal thujone |
| FR | | cedarwood acetate |
| | odor: cedarwood woody balsamic amber cedar resinous |
| FR | atlas | cedarwood oil |
| | odor: dry woody spicy old wood cistus |
| FL/FR | | cedarwood oil alcohols |
| | odor: fresh pencil cedar red cedar woody dry |
| FR | | cedrela wood oil |
| | odor: dry woody cedar cubeb clove carrot seed |
| FL/FR | | cedrenol |
| | odor: cedarwood woody sweet soft |
| | flavor: woody cedar old wood sawdust amber rooty resinous ambergris |
| FR | | cedrenyl acetate |
| | odor: sharp dry woody cedar peanut waxy vetiver |
| FR | | cedryl formate |
| | odor: amber wood vetiver acetate |
| FR | | cedryl methyl ether |
| | odor: dry ambergris woody dusty |
| FR | | cestrum nocturnum flower absolute |
| | odor: isoeugenol carnation warm woody floral clove |
| FL/FR | | cinnamon leaf oil ceylon |
| | odor: deep spicy woody clove fatty oily rancid cinnamon powdery |
| | flavor: spicy aromatic woody aldehydic resinous oily cinnamyl weedy |
| FR | | cinnamon leaf oil replacer |
| | odor: spicy woody clove fatty oily rancid cinnamon powdery |
| FL/FR | | cinnamon oleoresin ceylon |
| | odor: spice woody cinnamon |
| | flavor: cinnamon |
| FR | | cistus ladaniferus gum |
| | odor: sweet dry woody old wood amber ambergris resinous balsamic |
| | flavor: woody old wood amber resinous phenolic burnt balsamic |
| FR | | cistus ladaniferus resin |
| | odor: sweet old wood amber ambergris musty dry |
| FL/FR | | cistus ladaniferus resinoid |
| | odor: sweet dry woody old wood amber ambergris balsamic gourmand |
| | flavor: woody old wood amber resinous phenolic burnt balsamic |
| FL/FR | | cistus twig/leaf oil molecular distilled |
| | odor: woody old wood burnt wood ambergris animal phenolic smoky balsamic cedar |
| | flavor: woody burnt wood animal smoky old wood amber spicy resinous |
| FR | | citral / diisotridecyl acetal |
| | odor: fresh green woody lemon fruity |
| FR | | citrus woody floral fragrance |
| FR | | citrus woody fragrance |
| FR | | conifer acetate |
| | odor: balsam woody sweet fir balsam raspberry jam |
| FL/FR | | copaifera reticulata extract |
| | odor: copaiba |
| | flavor: copaiba |
| FL/FR | | croton glabellus bark extract |
| | odor: balsam woody spice terpene herbal |
| FR | | cypress essence |
| | odor: cypress |
| FR | | cypress oil replacer |
| | odor: fresh pine woody earthy olibanum dry spicy cedar |
| FR | | daniellia oliveri bark oil CO2 extract |
| | odor: resinous woody floral mossy coumarinic |
| FR | 2- | decalinyl formate |
| | odor: sandalwood woody dry oily floral |
| FL | (S)-8,9- | dehydrotheaspirone |
| | odor: camphor woody |
| FR | | dihydro-alpha-terpinyl acetate |
| | odor: fresh herbal woody lime cologne soapy |
| FL/FR | | dill seed oil |
| | odor: sweet herbal woody spicy |
| | flavor: dill |
| FL/FR | | dill seed oil CO2 extract |
| | odor: sweet herbal woody spicy |
| | flavor: dill |
| FL/FR | 2',4'- | dimethyl acetophenone |
| | odor: floral woody sweet mimosa minty |
| FR | 1-(3,3- | dimethyl bicyclo(2.2.1)hept-2-yl)-2-methyl cyclohex-3-ene carbaldehyde |
| | odor: fruity, woody, and dry notes |
| FR | 1,4- | dimethyl bicyclo(3.2.1)oct-3-yl acetate |
| | odor: fruity, woody, and fresh |
| FR | 1,2- | dimethyl butyl 2-butenoate |
| | odor: strong and complex with fruity and sweet combination, woody winey, creamy, and spicy with cumin curry notes |
| FR | 2,4- | dimethyl cyclohexyl methyl acetate |
| | odor: floral woody carvone sweet cortex grapefruit |
| FR | 4- | dimethyl ionone |
| | odor: sweet floral violet woody |
| FR | 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane |
| | odor: camphor, woody, fresh, sweet, minty, and thujone-like notes |
| | | dithenyl ether |
| | odor: fruity, woody |
| FR | | dragons blood fragrance |
| FR | | elder flower wood specialty |
| | odor: floral woody |
| | (-)-gamma- | elemene |
| | odor: green woody oily |
| FL/FR | alpha- | elemol |
| | odor: green woody spicy rose |
| | | epoxylinalyl acetate |
| | odor: fresh floral woody linalyl acetate |
| FR | | eremophila mitchelli wood oil australia |
| | odor: balsamic woody mossy |
| FL/FR | trans-1- | ethyl-2-methyl propyl 2-butenoate |
| | odor: very powerful and complex with unique fruity and woody combination. Toppy and rich with sugary feel, sweet, and fresh |
| | 1- | ethyl-2-methyl propyl chrysanthemumate |
| | odor: fruity, woody, aldehydic, winey, green, herbaceous, spicy, but fatty |
| | 1- | ethyl-2-methyl propyl tiglate |
| | odor: fruity, woody, chemical, metallic, sour, and kerosene |
| FL/FR | | eugenyl acetate |
| | odor: fresh sweet woody clove floral carnation malt spice |
| | flavor: spicy warm clove allspice sweet carnation |
| FL/FR | | fir balsam oleoresin canada |
| | odor: sweet fir needle woody |
| FL/FR | | fir needle oil canada |
| | odor: fresh balsam woody fir needle |
| FR | | floral woody fragrance |
| FR | | forest fragrance |
| FR | | formoxymethyl isolongifolene |
| | odor: woody amber cedar vetiver clary sage dry |
| FR | | fougere woody fragrance |
| FR | | frankincense fragrance |
| FL/FR | | frankincense gum |
| | odor: olibanum old wood fresh woody |
| | flavor: frankincense |
| FL/FR | | frankincense gum papyrifera |
| | odor: woody incense woody terpenic resinous |
| | flavor: bitter |
| FL/FR | | frankincense oil CO2 extract |
| | odor: terpene incense old wood woody |
| | flavor: frankincense |
| FL/FR | | frankincense resinoid |
| | odor: incense old wood terpenic balsamic spicy pine resinous |
| | flavor: woody spicy terpenic balsamic incense herbal resinous medicinal |
| FR | | frankincense resinoid replacer |
| | odor: incense old wood terpenic balsamic spicy pine resinous |
| FR | | fresh nitrile |
| | odor: green woody ozone |
| FL/FR | | fusel oil |
| | odor: Sweet, alcoholic, woody, with an etherial brown fruity nuance |
| | flavor: Fruity, alcoholic, sweet, apple with a brown fermented nuance |
| FL/FR | | galbanum oleoresin |
| | odor: green woody balsam resin leafy green pepper |
| | flavor: galbanum |
| FL/FR | | galbanum resinoid |
| | odor: rich green woody balsam dry green pepper foliage |
| | flavor: galbanum |
| FR | | galbanum resinoid replacer |
| | odor: rich green woody balsamc dry green pepper foliage |
| FL/FR | | ginger oleoresin africa |
| | odor: woody spice herbal ginger terpene earthy citrus |
| | flavor: spicy citrus herbal terpenic peppery woody oily |
| FL/FR | | ginger root oil brazil |
| | odor: spicy woody terpene warm ginger citrus |
| | flavor: ginger |
| | (10)- | gingerol |
| FL/FR | | grains of paradise oil |
| | odor: spicy woody sweet peppery cardamom |
| FR | | green acetate |
| | odor: fruity woody green apple herbal |
| FR | | green oxane |
| | odor: spicy woody fruity |
| FL/FR | | guaiyl acetate |
| | odor: tea rose woody spicy green fatty |
| FR | | hay absolute |
| | odor: sweet hay woody tobacco moss tonka |
| FR | | hemlock western oil (tsuga heterophylla) canada |
| | odor: balsamic woody cedar aromatic peppery weedy green |
| | 1,3,3,4,5,6,7- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| | odor: patchouli aroma |
| | 1,3,3,4,5,6,8- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| | odor: patchouli aroma nuances |
| FL/FR | | heptyl isovalerate |
| | odor: fruity woody animal |
| FR | | herbal undecanone |
| | odor: natural herbal woody fruity absinthe pine juniperberry cedar raspberry |
| | 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: chocolate, basic woody, camphoraceous aroma |
| FR | | hinoki root oil |
| | odor: dry woody camphor sweet spicy |
| FR | | homalomena rubescens root oil |
| | odor: sweet woody floral pine |
| FL | 2- | hydroxyisophorone |
| | odor: phenolic woody dry nutty tobacco spicy clean powdery |
| | flavor: phenolic burnt tobacco smoky nut skin |
| FL/FR | | immortelle flower oil |
| | odor: sweet warm herbal woody floral coumarin fruit dried fruit |
| | flavor: immortelle |
| FL/FR | beta- | ionone |
| | odor: floral woody sweet fruity berry tropical beeswax |
| | flavor: Woody, berry, floral, green and fruity |
| | alpha- | ionyl ethyl ether |
| | odor: dry woody fruity ethereal |
| FR | | juniparome (Takasago) |
| | odor: herbal woody rosemary juniper |
| FL/FR | | juniper absolute |
| | odor: woody juniper balsamic |
| FL/FR | | juniper berry absolute |
| | odor: balsam woody terpene |
| | flavor: juniper |
| FR | | juniperus mexicana extract |
| | odor: cedar woody |
| FR | | labdanum ethanone |
| | odor: strong dry woody labdanum rose musk orangeflower |
| FR | | labdanum gum extract ethyl ester |
| | odor: ambergris old wood musty cistus fecal animal |
| FL/FR | | labdanum oil |
| | odor: woody old wood amber ambergris incense balsamic labdanum spicy |
| | flavor: woody old wood amber resinous ambergris phenolic burnt incense |
| FR | | labdanum oil replacer |
| | odor: dry old wood amber ambergris balsamic spicy resinous |
| FR | | labdanum resinoid replacer |
| | odor: dry old wood amber ambergris balsamic |
| FR | | labdanum specialty |
| | odor: labdanum amber old wood |
| FL/FR | | lavandin water absolute |
| | odor: woody dry lavender |
| | flavor: lavandin |
| FR | | leather woody fragrance |
| FL/FR | laevo- | linalool |
| | odor: fresh floral woody natural deep lavender |
| | flavor: citrus bois de rose orange blueberry floral berry tropical |
| FR | | linalool terpenes |
| | odor: fresh citronellol sweet rose woody dusty |
| | | longiborneol |
| | odor: strong moss woody |
| FR | | louro brasileiro wood oil |
| | odor: dry woody oily green cumin cedar cubeb |
| FL/FR | | mace absolute |
| | odor: nutmeg sweet woody |
| | flavor: mace |
| FR | | machilus kusanoi leaf oil |
| | odor: spicy woody cigarbox tobacco earthy |
| FR | | machilus kusanoi wood oil |
| | odor: spicy woody tobacco cedar box earthy |
| | | mastic fruit oil |
| | odor: spicy woody |
| FR | | mcp acetate |
| | odor: oily woody amber patchouli hot |
| FR | | melaleuca ericifolia leaf oil |
| | odor: sweet floral woody green herbal medicinal |
| FL/FR | para- | menth-3-en-1-ol |
| | odor: dry woody musty |
| FL/FR | 2- | methyl butyl salicylate |
| | odor: herbal woody orchid floral green balsamic |
| FR | | methyl hydrogenated rosinate |
| | odor: balsamic woody amber peppery |
| FL/FR | (E)-alpha- | methyl ionone (44-50%) |
| | odor: floral woody orris violet |
| FL/FR | alpha-iso | methyl ionone (60% min.) |
| | odor: woody violet floral |
| FL/FR | alpha-iso | methyl ionone (70% min.) |
| | odor: woody orris violet floral |
| | flavor: floral orris woody fruity berry violet raspberry |
| FL/FR | alpha-iso | methyl ionone (80% min.) |
| | odor: orris woody floral dried fruit violet jammy powdery tea |
| | flavor: floral orris powdery woody berry tea jammy waxy |
| FL/FR | beta- | methyl ionone |
| | odor: orris woody powdery floral violet tropical tobacco creamy |
| | flavor: sweet floral orris woody tobacco powdery berry violet creamy |
| FR | 4- | methyl-2-(2-methyl-1-propenyl)-1,3-dioxane |
| | odor: floral woody chemical fruity berry green gooseberry |
| FL/FR | 2- | methyl naphthalene |
| | odor: sweet floral woody |
| | flavor: oily aromatic |
| FL/FR | | methyl (Z)-5-octenoate |
| | odor: sweet fruity woody creamy |
| | flavor: creamy dairy coconut tropical guava |
| FL | 1- | methyl pyrrole |
| | odor: powerful smoky woody herbal |
| | 2-( | methyl thio) benzothiazole |
| | odor: fatty woody smoky |
| FL/FR | | mimosa concrete france |
| | odor: sweet woody fatty floral |
| | flavor: mimosa |
| FL/FR | | mimosa tenuiflora leaf extract |
| | odor: floral woody |
| | flavor: mimosa |
| FR | | moss fragrance |
| FR | | moss specialty |
| | odor: moss |
| FR | | moss wood specialty |
| | odor: mossy woody |
| FR | | musk decanolide |
| | odor: musk woody sweet brassylate fruity |
| FR | | musk fragrance |
| FR | | musk specialty |
| | odor: musk |
| | gamma- | muurolene |
| | odor: herbal woody spice |
| FL/FR | | myristica fragrans fruit extract |
| | odor: spicy woody balsam green waxy floral |
| | flavor: spicy |
| FL/FR | | myristica fragrans seed tincture |
| | odor: spicy woody balsam green waxy floral |
| | flavor: spicy nutmeg |
| FL/FR | | myrrh absolute |
| | odor: balsamic woody musty amber spicy toffee gourmand |
| | flavor: balsamic old wood brown resinous amber musty smoky |
| FL/FR | | myrrh gum |
| | odor: woody balsam |
| | flavor: myrrh |
| FL/FR | | myrrh resin |
| | odor: woody balsam incense sweet old wood |
| | flavor: myrrh |
| FR | | myrrh resinoid |
| | odor: warm woody balsam spicy |
| | | myrtenyl isobutyrate |
| | odor: fruity woody pine |
| FR | | nutmeg fragrance |
| FL/FR | | nutmeg oil |
| | odor: spicy woody nutmeg powdery terpene |
| | flavor: spicy woody terpenic aromatic peppery nut skin resinous anisic |
| FR | | nutmeg oil replacer |
| | odor: spicy aromatic |
| FL/FR | | nutmeg oleoresin |
| | odor: spicy woody terpenic powdery pine |
| | flavor: spicy aromatic woody citrus rind peppery nut skin resinous |
| FR | | oak wood specialty |
| FR | | oakmoss concrete |
| | odor: phenolic woody tar seashore forest bark wood green foliage |
| FL/FR | | octanal propylene glycol acetal |
| FL/FR | | octyl propionate |
| | odor: sweet fruity mushroom floral raspberry jammy green |
| | flavor: Sweet, estry, fruity and berry with a tropical, jammy nuance |
| FL/FR | | opoponax absolute (commiphora erythraea var. glabrescens engle) |
| | odor: sweet balsamic woody incense amber old wood toffee vanilla animal |
| | flavor: opoponax |
| FR | | opoponax absolute replacer |
| | odor: balsamic woody incense amber old wood toffee vanilla animal |
| FL/FR | | opoponax resin (commiphora erythraea var. glabrescens engler) |
| | odor: sweet incense woody amber old wood |
| | flavor: opoponax |
| FR | | opoponax resinoid (commiphora erythraea var. glabrescens engle) |
| FR | | opoponax resinoid replacer |
| | odor: sweet incense woody amber old wood caramellic |
| FR | bitter | orangeflower concrete |
| | odor: strong floral sweet woody breadcrust |
| FL/FR | 2(1)- | orris butanal |
| | odor: orris woody leather tobacco animal |
| | | orthodon dianthera maxim. oil vietnam |
| FR | | patchouli ethanol |
| | odor: dry sawdust woody patchouli camphor mint |
| FR | | patchouli fragrance |
| FL/FR | | patchouli oil CO2 extract |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| | flavor: patchouli |
| FL/FR | | patchouli oil molecular distilled |
| | odor: patchouli |
| | flavor: woody earthy weedy balsamic spicy camphoreous |
| FR | | patchouli oil replacer |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| FR | | patchouli specialty |
| | odor: patchouli woody old wood dry earthy weedy balsamic spicy minty |
| FR | | patchouli woody amber fragrance |
| FL/FR | black | pepper absolute |
| | odor: Fresh ground black pepper, spicy, woody and pungent with an herbal nuance |
| | flavor: Ground pepper, woody and spicy with a slight heat and bite |
| FL | white | pepper oleoresin |
| | odor: peppery woody piney |
| | flavor: peppery |
| FL/FR | | pepper tree berry oil |
| | odor: peppery woody spicy aromatic juniper mace tropical pine balsamic resinous |
| | flavor: peppery spicy woody juniper mace aromatic balsamic resinous seedy |
| FL/FR | | pepper tree berry oil CO2 extract |
| | odor: spicy woody peppery fruity |
| | flavor: peppery |
| FL/FR | | peru balsam absolute |
| | odor: balsamic woody amber vanilla powdery |
| | flavor: balsamic woody amber |
| FL/FR | | petitgrain cedrat oil |
| | odor: sweet fresh floral woody leafy petitgrain |
| | flavor: petitgrain |
| FR | | petitgrain oil terpenes |
| | odor: sweet allo-ocminol woody floral |
| | beta- | phenethyl angelate |
| | odor: rose woody orris |
| FL | iso | phorone |
| | odor: Cooling, woody, sweet, green, camphoreous, fruity and musty |
| | flavor: Sweet, green, waxy, woody, cooling pulpy mouthfeel and citrus |
| FL/FR | ketoiso | phorone |
| | odor: Musty, woody, sweet, tea, citrus lemon with sI. brown nuances |
| | flavor: Citrus, floral, musty, tea like with green sweet fruity nuances |
| FR | | picea glauca branch/leaf oil |
| | odor: camphoreous |
| FR | cis-2- | pinanol |
| | odor: pine woody fir needle camphor incense |
| FL/FR | white | pine bark oil |
| | odor: sweet pine woody balsam anisic |
| FR | lariciu | pine needle oil |
| | odor: terpenic woody sawdust fruity apple green |
| FR | | pine oil |
| | odor: pine herbal woody hay green terpenic resinous |
| FR | scotch | pine wood/needles resinoid |
| | odor: balsamic woody fruity black currant forest |
| FL/FR | alpha- | pinene |
| | odor: fresh camphor sweet pine earthy woody |
| | flavor: Intense woody, piney and terpy with camphoraceous and turpentine note. It has herbal, spicy and slightly tropical nuances |
| FL/FR | beta- | pinene |
| | odor: dry woody resinous pine hay green eucalyptus camphoreous |
| | flavor: pine terpenic woody resinous minty camphoreous balsamic spicy |
| FL/FR | laevo-beta- | pinene |
| | odor: dry woody fresh pine hay green resinous |
| FR | | pinus pinaster twig leaf oil |
| | odor: terpene woody |
| FL/FR | | piper longum fruit oil |
| | odor: warm spicy woody cineole lemon |
| | flavor: peppery |
| FR | | pistacia lentiscus gum water |
| | odor: woody balsamic resinous green |
| FR | | pogostemon cablin leaf extract |
| | odor: earthy woody |
| FR | | primrose fragrance |
| FL/FR | | propenyl guaethol |
| | odor: sweet vanilla woody tobacco spicy phenolic powdery |
| | flavor: Sweet vanilla-like, with a creamy anisic note |
| FL/FR | para-iso | propyl acetophenone |
| | odor: spicy woody herbal orris |
| | flavor: warm spicy |
| | 5- and 6-iso | propyl-1,2,3,3-tetramethyl bicyclo(2.2.2)octan-2-ol |
| | odor: buttery, woody aroma |
| FL | | prosopis juliflora wood extract |
| | odor: Spicy, smoky phenolic, savory, woody, ashy, with a cooked meaty afternote |
| | flavor: Smoky, tar, phenolic, creosote, woody, savory with a meaty and nutty nuance |
| FL/FR | | pyroligneous acids |
| | odor: Smoky, woody/casky, slightly phenolic with a bacon and smoked salmon fattiness |
| | flavor: Sweet hickory smoky, with burnt and charred woody notes, smoked meaty and bacon-like |
| FL | | quercus alba chips extract |
| | odor: Woody, alcoholic, brown, smoky, whiskey and brandy with a spicy nuance |
| | flavor: Alcoholic, woody, oak, smoky, whiskey and rum |
| FR | | quercus robur oil |
| | odor: balsamic woody fruity rummy raisin vanilla |
| FL/FR | | raspberry ketone methyl ether |
| | odor: sweet dried raspberry rose cherry fruity cassie absolute |
| | flavor: Floral, woody, ionone, raspberry, fruity, spice and berry |
| FL | | rosa canina seed extract |
| | odor: caramel woody cocoa |
| | flavor: floral tart tangy sweet hibiscus |
| CS | | rose hips seed oil |
| | odor: bland oily woody |
| FR | | rose woody fragrance |
| FL/FR | | rosemary oil africa |
| | odor: fresh strong camphoreous woody balsamic herbal minty |
| | flavor: rosemary |
| FL/FR | | rosemary oil tunisia |
| | odor: fresh strong camphor woody balsamic herbal minty |
| | flavor: rosemary |
| FL/FR | | rum ether |
| | odor: Empyromatic, acidic, woody, burnt, with meaty and whiskey notes |
| | flavor: Burnt, smoky, woody, caramellic with rum and brandy notes |
| CS | | safrole |
| | odor: sweet warm spicy woody floral sassafrass anise |
| FR | | sandal butenol |
| | odor: sandalwood creamy woody milky waxy greasy musk |
| FR | | sandal cyclohexanol |
| | odor: sandalwood clean sweet woody balsamic |
| FL/FR | | sandal cyclopropane |
| | odor: tropical woody fatty sandalwood herbal cologne floral |
| | flavor: amber musk woody clean herbal floral clary sage sandalwood |
| FR | | sandal pentanol |
| | odor: sweet sandalwood woody waxy greasy creamy amyris |
| FL/FR | | sandal pentenol |
| | odor: sandalwood woody musk |
| FL/FR | | sandalwood oil CO2 extract |
| | odor: sweet woody balsamic cashew terpene herbal spicy |
| | flavor: sandalwood |
| FR | | sandalwood oil west australia (santalum spicatum) |
| | odor: dry soft woody balsam sweet myrrh creamy |
| FR | | sandel |
| | odor: sweet oily sandalwood woody |
| FR | | santal penten-2-ol |
| | odor: oily woody spicy powdery sandal |
| FL/FR | | santalol |
| | odor: deep sweet sandalwood woody |
| FR | | santalum paniculatum wood oil |
| | odor: balsamic woody creamy spicy |
| FL/FR | | santalyl phenyl acetate |
| | odor: honey floral sandal |
| FR | | spicy carbonate |
| | odor: spice woody floral grocery store |
| FL/FR | | spikenard oil CO2 extract |
| | odor: sweet woody spicy animal valerian ginger cardamom |
| FL/FR | | spruce needle oil canada |
| | odor: fir needle woody thujone herbal terpenic aldehydic amber |
| | flavor: woody herbal green aromatic terpenic thujonic minty amber |
| FL/FR | | styrax absolute (liquidambar orientalis) |
| | odor: storax balsamic |
| | flavor: storax |
| FL/FR | | styrax absolute (liquidambar styraciflua) |
| | odor: balsamic storax |
| | flavor: storax |
| FL/FR | | styrax resin (liquidambar orientalis) |
| | odor: balsamic styrene |
| | flavor: storax |
| FR | | styrax resinoid (liquidambar orientalis) |
| | odor: balsamic styrene |
| FR | | styrax speciality |
| | odor: sweet balsam styrax woody |
| FR | | sugandha kokila berry oil |
| | odor: spicy woody resinous herbal camphoreous |
| FL/FR | | syringaldehyde |
| | odor: mild plastic woody tonka sweet |
| | flavor: sweet cocoa chocolate creamy dairy nutty |
| FL/FR | beta- | terpineol |
| | odor: pungent earthy woody |
| FL/FR | | terpineols (unspec.) (mixed isomers) |
| | odor: fresh clean woody pine floral lime |
| FL/FR | (±)- | tetrahydronootkatone |
| | odor: dusty woody fresh green sour spicy herbal fruity animal |
| | 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene |
| | odor: fruity, woody aroma with a camphoraceous fragrance note |
| | 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)octane |
| | odor: warm, fruity, woody with minty nuances |
| FR | 2,4,4,6- | tetramethyl cyclohexa-2,5-diene-1-one |
| | odor: warm sweet slightly minty woody natural green hay |
| | 6,6,10,10- | tetramethyl-5,7,8,9,10,10a-hexahydro-6H-6a,9-methanobenzo[H]quinazoline |
| | odor: musky, woody, and ambery notes |
| FR | beta- | thujaplicin |
| | odor: phenolic woody mossy |
| FR | | thujopsis dolabrata wood oil |
| | odor: fresh sweet cedarwood woody dry cedar sawdust dusty phenolic earthy |
| | flavor: woody cedar dry earthy sawdust spicy resinous incense |
| FL/FR | | thyme oil wild or creeping |
| | odor: fresh sharp terpene woody herbal |
| | flavor: thyme |
| FL/FR | (E)- | tiglic acid |
| | odor: sweet dry spicy woody caramel |
| | flavor: Sweet, brown, fruity, with ripe and jammy nuances |
| FR | | timber propanol |
| | odor: dry sawdust woody powdery amber sandalwood |
| | | tricyclene-9-butenone |
| | odor: green, woody, slightly sweaty |
| FR | | tricyclo(5.2.1.02,6)dec-3-enyl acetate |
| | odor: green woody cedar pine licorice |
| FL/FR | | tridecanoic acid |
| | odor: waxy woody |
| FR | 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol |
| | odor: strong patchouli, strong woody, strong earthy, and camphoraceous notes |
| | 2,2,4- | trimethyl-1,3-oxathiane |
| | odor: green, woody, terpenes, powerful fruity, tropical, green |
| FL | 2,4,4- | trimethyl-1,3-oxathiane |
| | odor: green woody terpenic |
| FL | | turmeric oleoresin |
| | odor: soft spicy woody earthy |
| | flavor: turmeric |
| FL/FR | | turmeric root absolute |
| | odor: spicy woody warm |
| | flavor: turmeric |
| FL/FR | | valencene |
| | odor: sweet fresh citrus grapefruit woody orange asprin dry green oily |
| | flavor: orange citrus fruity juicy citrus peel peely woody |
| FR | | valeriana wallichii root oil |
| | odor: balsam woody spicy rooty valerian |
| FR | | vanilla bean tincture |
| | odor: sweet vanilla toffee woody |
| | flavor: vanilla balsamic almond rummy phenolic |
| FL/FR | | veratraldehyde |
| | odor: Sweet, creamy, vanillin, powdery, herbal with a slight phenolic nuance |
| | flavor: Sweet creamy vanilla-like |
| FL/FR | | vetiver oil china |
| | odor: woody balsamic |
| | flavor: vetiver |
| FR | | vetiver pentanone |
| | odor: floral woody vetiver waxy |
| FR | | vetiveryl propionate |
| | odor: rooty woody cedar |
| FL/FR | | wine lactone |
| | odor: sweet spicy woody |
| FR | | woody dioxolane |
| | odor: dry amber woody powdery musk |
| FL/FR | | woody ketone |
| | odor: woody herbal cedarleaf thujone minty |
| FL | dextro- | xylose |
| | odor: smoky woody sweet caramel |
| | flavor: smoky sweet salty coffee |
| FL/FR | | zingiber officinale root extract |
| | odor: sweet ginger spice warm woody |
| | flavor: ginger |
| FL/FR | | zingiber officinale root tincture |
| | odor: sweet ginger spice warm woody |
| | flavor: ginger |
|
| Tertiary (Third) - woody |
| FR | | symroxane (Symrise) |
| | odor: woody tobacco old wood ambergris vetiver peppery spicy amber powdery |
| FR | | abies alba leaf extract |
| | odor: balsamic pine |
| FR | | abies sibirica needle extract |
| | odor: pine balsamic woody |
| FR | | acetyl ethyl tetramethyl tetralin replacer |
| | odor: sweet clean musk amber |
| FR | | acorn acetate |
| | odor: natural acorn dry oak leaves hay woody immortelle herbal |
| FR | | agarospirol |
| | odor: spicy peppery woody |
| FL/FR | | allspice leaf oil |
| | odor: sweet spicy clove woody phenolic dirty fatty cinnamon aldehydic |
| | flavor: Spicy, woody, clove and eugenol with a dirty, phenolic, weedy nuance |
| FR | | amber dioxane |
| | odor: dry dusty woody mahogany amber resinous earthy floral |
| FR | | amber fragrance |
| FR | sports | amber fragrance |
| FR | | amber pentadecane |
| | odor: warm woody dry amber old wood |
| FR | | ambergris fragrance |
| FL/FR | | ambergris tincture |
| | odor: ambergris sweet dry amber woody mossy |
| FR | | ambergris tincture replacer |
| | odor: dry amber ambergris animal old wood |
| FR | | ambrene specialty |
| | odor: amber balsamic |
| FR | | amyris specialty |
| | odor: musk floral woody |
| FR | | angel essence fragrance |
| FL/FR | | angelica oil |
| | odor: spicy terpenic |
| | flavor: angelica |
| FL/FR | | angelica oil |
| | odor: spicy terpenic |
| | flavor: angelica |
| FL/FR | | angelica root absolute |
| | odor: powerful pungent herbal musk |
| | flavor: angelica |
| FR | | anise indene |
| | odor: floral anise fruity woody herbal |
| FR | | asarum europaeum oil |
| | odor: sharp peppery spicy woody warm |
| FR | | atractylis root oil |
| | odor: strong peppery woody spicy warm dry elemi ginger galanga |
| FL/FR | | balsam fir oleoresin |
| | odor: sweet fir woody fir needle |
| FR | | balsam fragrance |
| FR | | bamboo fragrance |
| FL/FR | | beech wood creosote |
| | odor: smoky |
| | flavor: smoky burnt |
| FL/FR | siam | benzoin absolute |
| | odor: sweet vanilla balsam woody |
| | flavor: Spicy, balsamic, resinous, fruity, with an herbal nuance |
| FL/FR | siam | benzoin resin |
| | odor: sweet vanilla balsam woody powdery |
| | flavor: benzoin |
| FR | siam | benzoin resin oil |
| | odor: benzoin |
| FL/FR | siam | benzoin resinoid |
| | odor: sweet vanilla balsamic woody powdery resinous |
| | flavor: benzoin |
| FR | | benzoin resinoid replacer |
| | odor: sweet vanilla balsamic woody powdery resinous |
| FL/FR | 1- | benzoyl acetone |
| | odor: acetophenone balsam woody dry opoponax vanilla |
| FL/FR | | bergamot oil italy |
| | odor: citrus woody orange linalyl acetate |
| | flavor: citrus bergamot |
| FL/FR | | bergamot oil ivory coast |
| | odor: citrus woody orange linalyl acetate |
| | flavor: bergamot |
| FL/FR | | bergamot oil terpeneless |
| | odor: sweet citrus linalyl acetate |
| | flavor: bergamot |
| FL/FR | | betula pubescens bud oil |
| | odor: woody green balsam |
| FL/FR | | birch tar oil |
| | odor: smoky burnt wood leathery phenolic |
| FL/FR | | bois de rose oil terpeneless |
| | odor: sweet woody linalool |
| | flavor: bois de rose |
| FL/FR | laevo- | borneol |
| | odor: pine woody camphor |
| | flavor: earthy minty camphoreous herbal woody musty |
| FR | | bornyl salicylate |
| | odor: green fresh woody salicylate pine needle bisabolene |
| FL/FR | | boswellia neglecta resin oil |
| | odor: resinous greasy woody pine terpenic cedar leathery |
| | flavor: frankincense |
| FL/FR | | buchu wood specialty |
| | odor: fruity woody |
| FR | 3- | butyl bicyclo[3.2.1]octan-2-one |
| | odor: strong coconut, lactonic, woody, minty, jasmine cis like, anisic, and tuberose notes |
| FL/FR | sec- | butyl ethyl ether |
| FR | 2-iso | butyl quinoline |
| | odor: animal leather woody rooty oakmoss tobacco |
| FR | | cabreuva wood oil |
| | odor: dry sweet woody floral |
| FL | delta- | cadinene |
| | odor: thyme herbal woody dry |
| FR | | calendula officinalis flower oil CO2 extract |
| | odor: herbal floral woody balsamic |
| FR | | callitris columellaris wood oil australia |
| | odor: fruity balsamic woody camphoreous resinous |
| FR | | camphene carbinol |
| | odor: camphoreous patchouli woody |
| FL/FR | (+)-alpha- | campholenic aldehyde |
| | odor: herbal green woody amber leafy |
| | flavor: green spicy herbal chrysanthemum leafy cilantro woody |
| FL/FR | | cananga oil china |
| | odor: floral balsam woody leather |
| | flavor: cananga |
| FR | | cedarleaf oil terpeneless |
| | odor: cedar woody thujone camphoreous woody |
| FR | atlas | cedarwood absolute |
| | odor: dry woody old wood phenolic spicy |
| FR | atlas | cedarwood oil |
| | odor: dry woody spicy old wood cistus |
| FR | | cedarwood oil texas fractions |
| | odor: clean amber woody balsamic powdery dry |
| FR | | cedrene |
| | odor: cedarwood woody |
| FD | red | cinchona bark |
| | odor: brown maple woody botanical rooty |
| | flavor: bitter astringent maple brown tea woody |
| FL/FR | | cinnamon acrolein |
| | odor: Spicy, cassia, cinnamon and woody with herbal, medicinal nuances |
| | flavor: Spicy, cinnamon, cassia and woody with a red-hot candy naunce |
| FL/FR | | cinnamon bark oil (cinnamomum zeylanicum) india |
| | odor: sweet cinnamic spicy warm woody aromatic |
| | flavor: cinnamon spicy woody warm heat slightly fruity |
| FL/FR | | cistus twig/leaf oil molecular distilled |
| | odor: woody old wood burnt wood ambergris animal phenolic smoky balsamic cedar |
| | flavor: woody burnt wood animal smoky old wood amber spicy resinous |
| FL/FR | | citronella oil |
| | odor: fresh sweet geraniol weedy woody |
| | flavor: citronella |
| FR | | citrus ocimenol |
| | odor: fresh sweet citrus lime floral lily |
| FR | | clary acetate |
| | odor: warm herbal clary woody |
| FL/FR | | clary sage oil france |
| | odor: fresh herbal green tea woody weedy dry spicy sage powdery |
| | flavor: herbal green spicy tea hay sage woody powdery |
| FR | | clary sage oil replacer |
| | odor: fresh herbal green tea woody weedy dry spicy sage powdery |
| FL/FR | | clary sage oil russia |
| | odor: fresh herbal green tea woody weedy dry spicy sage powdery |
| | flavor: herbal spicy green tea hay sage powdery woody |
| FR | | clary specialty |
| | odor: clary herbal woody tea |
| FL/FR | | clove bud oil CO2 extract |
| | odor: Sweet, clean clove spicy, eugenol, woody, with cooling phenolic nuances |
| | flavor: Sweet with clove, spicy, woody, euganol and medicinal nuances |
| FL/FR | | clove leaf oil |
| | odor: spicy aromatic woody balsamic minty peppery phenolic powdery |
| | flavor: spicy woody aromatic balsamic minty peppery medicinal waxy |
| FL/FR | | clove stem oil |
| | odor: spicy aromatic woody minty fatty powdery phenolic |
| | flavor: spicy woody aromatic oily minty phenolic |
| FL/FR | | croton eluteria bark oil |
| | odor: fresh spice woody black pepper sweet anise |
| | flavor: Spicy, woody, peppery, cola like, with cinnamon, ginger, nutmeg and clove notes and a smoky nuance |
| FL/FR | beta-homo | cyclocitral |
| | odor: camphoreous cooling woody medicinal oily berry orris soapy |
| | flavor: cooling woody terpenic weedy soapy citrus berry orris |
| FR | | cyclododecyl formate |
| | odor: fresh clean cloths sweet woody |
| FL/FR | para- | cymene |
| | odor: fresh citrus terpene woody spice |
| | flavor: Terpy and rancid with slightly woody oxidized citrus notes. It has spice nuances of green pepper and oregano |
| FR | 1,4- | dibutyl-6,8-dioxabicyclo(3.2.1)octane |
| | odor: Fruity, green, and woody |
| FR | | dicyclopentadiene propionate |
| | odor: fruity herbal woody jasmin oily basil |
| FL/FR | dextro- | dihydrocarvone |
| | odor: warm powerful herbal spearmint |
| | flavor: Green, spicy, minty and woody with a camphoreous nuance |
| FL/FR | iso | dihydrolavandulal |
| | odor: herbal lavender woody green blueberry tomato |
| | flavor: herbal woody green clary sage minty musty |
| FR | (Z)-iso | dihydrolavandulyl acetate |
| | odor: fresh herbal mint woody |
| FL/FR | | dihydrolinalool |
| | odor: bois de rose woody citrus blueberry weedy |
| | flavor: floral tropical bois de rose blueberry berry fruity herbal woody |
| FL/FR | | dihydroterpinyl acetate |
| | odor: pine citrus woody lime cologne |
| FR | 2,5- | dimethyl bicyclo(3.2.1)oct-2-ene |
| | odor: green, terpineol, woody, and black pepper notes |
| | 1,5- | dimethyl-4-hexen-1-yl 2-butenoate |
| | odor: fruity, slightly nutty and woody, but dirty, chemical, and slightly harsh |
| | 2,6- | dimethyl-2,18-nonadecadien-8-one |
| | odor: aldehydic, musky, woody, floral, fruity, minty, and clean notes |
| FL/FR | 3,6- | dimethyl-3-octanol |
| | odor: fresh linalool woody blueberry sweet rose |
| | flavor: sweet herbal bois de rose blueberry berry coriander floral |
| | 1,2- | dimethyl propyl 2-butenoate |
| | odor: fruity, winey, woody, green, slightly dirty and animalic |
| FL/FR | delta- | elemene |
| | odor: sweet herbal woody |
| FL/FR | | elemol |
| | odor: spicy citrus woody resinous |
| FR | | estragon absolute |
| | odor: sweet anise spice woody |
| | 2- | ethyl butyl 2-butenoate |
| | odor: fruity, sweet, woody, floral, green, and weak |
| FL/FR | | ethyl 3-hydroxyhexanoate |
| | odor: fruity grape burnt wood hay spicy pineapple cranberry dusty woody |
| | flavor: sweet fruity tropical grape grassy hay cranberry citrus |
| FL/FR | | eugenol |
| | odor: sweet spicy clove woody |
| | flavor: spicy clove allspice aromatic phenolic woody oriental |
| FL/FR | iso | eugenol |
| | odor: sweet spicy clove woody allspice carnation floral |
| | flavor: spicy clove allspice woody aromatic pimenta nutmeg phenolic |
| FL/FR | | eugenyl formate |
| | odor: warm woody orris dry |
| FL/FR | | fenchol |
| | odor: camphor borneol pine woody dry sweet lemon |
| | flavor: camphoreous cooling medicinal minty earthy humus |
| FL/FR | (-)-alpha- | fenchol |
| | odor: Clean cooling camphoraceous, piney with a woody eucalyptol and slight green herbal minty nuances |
| | flavor: Intense camphoraceous, cooling, piney with an earthy nuance. It has minty-citrus lime and spicy notes |
| FR | | fennel fragrance |
| | odor: sweet anise fennel woody earthy green spicy caraway |
| FR | | fir balsam absolute |
| | odor: fir balsam berry woody sweet green pine mossy floral |
| | flavor: Woody, pine, floral, mossy, with herbal nuances |
| FR | | fir balsam absolute (abies balsamea) |
| | odor: fir needle |
| FL/FR | | fir needle oil terpeneless canada |
| | odor: fresh balsamic woody fir needle |
| | flavor: fir needle |
| FR | | fir tree fragrance |
| FR | | frankincense wood specialty |
| | odor: incense woody resinous |
| FL/FR | | freesia heptanol |
| | odor: fresh dihydrolinalool floral woody citrus herbal |
| | flavor: citrus green blueberry bois de rose floral berry |
| FL/FR | | galangal root oil |
| | odor: fresh camphor spicy woody laurel leaf cardamom ginger |
| | flavor: galanga |
| FL/FR | | geranic oxide |
| | odor: fresh camphor herbal rosemary |
| | flavor: Sweet, camphoreous, woody, cooling, with floral nuances |
| FR | | geranium nitrile |
| | odor: rich rose geranium woody sandalwood |
| FL/FR | | geranyl acetoacetate |
| | odor: green sweet rose woody fruity |
| | flavor: musty slightly floral berry |
| FL/FR | | ginger root absolute |
| | odor: Woody with fresh sweet notes |
| | flavor: Fresh pungent, and woody |
| FR | | guaiacwood oil 20% in gurjun balsam oil |
| | odor: balsam woody spicy sweet pepper |
| FR | (-)- | guaiol |
| | odor: mild guaiacwood tea rose |
| FR | | guava leaf oil cuba |
| | odor: watery citrus woody earthy herbal |
| FR | | gurjun balsam oil |
| | odor: balsamic spicy woody guaiacwood patchouli copaiba pine animal |
| | flavor: spicy woody powdery clove copaiba guaiacwood cascarilla cypress |
| FR | | habuba fragrance |
| FR | | herbal carene |
| | odor: herbal dry woody clary sage thyme petitgrain lavender |
| | flavor: herbal spicy woody clary sage lavender bergamot soapy |
| FR | | herbal undecane |
| | odor: herbal eucalyptus woody |
| FR | (cis+trans)-6,6a,7,8,9,9a- | hexahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline |
| | odor: ambery, musky, and woody notes |
| | (S)-gamma- | hexalactone |
| | odor: sweet creamy coconut woody |
| FR | | hinoki oil replacer |
| | odor: terpenic aromatic woody |
| FR | | hydroxycitronellal nitrile |
| | odor: lily nitrile woody fresh |
| FR | | incense fragrance |
| FR | | incense specialty |
| | odor: olibanum old wood amber |
| FR | | indisan (IFF) |
| | odor: sandalwood clean sweet woody |
| FL/FR | beta- | ionone epoxide |
| | odor: fruity sweet berry woody violet orris powdery |
| FR | | iris specialty |
| | odor: floral wax woody violet fruity tropical |
| FL/FR | beta- | irone |
| | odor: fresh sweet violet berry woody powdery |
| | flavor: floral berry fruity jammy tropical violet woody powdery |
| FR | | juniper berry fragrance |
| FR | | juniper berry oil replacer |
| | odor: terpenic aromatic |
| FR | | juniper branch oil |
| | odor: terpenic green woody spicy |
| FL/FR | | juniperus communis fruit oil |
| | odor: fresh balsam terpene woody carrot fir peppery |
| | flavor: juniper |
| FR | | karo karounde absolute |
| | odor: floral herbal woody green |
| FR | | karo karounde absolute replacer |
| | odor: floral herbal woody green waxy oriental |
| FL/FR | | labdanum absolute |
| | odor: amber ambergris woody old wood sweet musty gourmand |
| | flavor: labdanum |
| FR | | labdanum concrete |
| | odor: sweet dry old wood amber ambergris balsam |
| FR | | laurel leaf oil replacer |
| | odor: spicy medicinal woody aromatic terpenic camphoreous eucalyptus cinnamyl |
| FL/FR | | lavandula angustifolia flower oil |
| | odor: lavender floral herbal woody |
| | flavor: lavender |
| FL/FR | | lavender oil greece |
| | odor: lavender floral herbal woody |
| | flavor: lavender |
| FL/FR | (Z)- | linalool oxide (furanoid) |
| | odor: earthy floral sweet woody |
| FL/FR | | linalool oxide acetates |
| | odor: warm fruity woody |
| FL/FR | 2,6- | lutidine |
| | odor: Nutty, amine, woody, bready and vegetable-like |
| | flavor: Nutty, coffee, cocoa, musty, bready and meaty |
| FL/FR | | marigold pot flower oil |
| | odor: herbal floral woody balsamic |
| | flavor: marigold |
| FL/FR | dextro,laevo- | menthol |
| | odor: peppermint cool woody |
| | flavor: cooling mentholic minty |
| FL | iso | menthol |
| | odor: mentholic musty woody camphoreous |
| | flavor: cooling |
| FL/FR | para- | methyl hydratropaldehyde |
| | odor: Floral, green, sweet, with woody herbal powdery nuances |
| | flavor: Green, woody, waxy and musty |
| FL/FR | | methyl ionyl acetate |
| | odor: Powdery, perfumey, woody with fruity and floral nuances. It has an interesting floral character on dry down |
| | flavor: Woody, powdery, floral with ionone and berry nuances. It has a lingering cherry-red licorice-candy aftertaste |
| FL/FR | | methyl linoleate |
| | odor: oily fatty woody |
| FL/FR | (E)-2- | methyl-2-pentenoic acid |
| | odor: fruity strawberry woody |
| FR | | midnight passion fragrance |
| FR | | muguet propanol |
| | odor: floral lily of the valley woody |
| FR | | musk indenofuran |
| | odor: animal musk woody spicy |
| FR | | myrcene |
| | odor: peppery terpene spicy balsam plastic |
| | flavor: Woody, vegetative, citrus, fruity with a tropical mango and slight leafy minty nuances |
| FR | | nepeta cataria herb oil |
| | odor: minty herbal woody spicy |
| FR | iso | nonyl acetate |
| | odor: sweet herbal cumin woody |
| FR | | nopyl acetate |
| | odor: herbal linalyl acetate woody pine lavender |
| FL/FR | | nutmeg absolute |
| | odor: spicy balsamic woody terpene |
| | flavor: nutmeg |
| FR | | oakmoss oil |
| | odor: oakmoss dry woody earthy bark leather tar |
| | | ocotea cymbarum oil |
| | odor: sassafras safrole |
| | 1-( | octahydro-4,7-methanoinden-5-yl)-propan-2-one + 1-(6-methyloctahydro-4,7-methanoinden-5-yl)-ethanone |
| | odor: floral, fruity, woody, but weak notes with additional metallic character |
| FL/FR | 2- | octanol |
| | odor: fresh spicy green woody herbal earthy |
| | flavor: herbal spicy green nasturtium earthy unripe banana mushroom |
| FL/FR | | opoponax absolute (balsamodendron kafal) |
| | odor: sweet balsamic aromatic woody spicy |
| | flavor: opoponax balsamic |
| FR | bitter | orangeflower concrete morocco |
| | odor: strong floral sweet woody breadcrust |
| FL/FR | curled | parsley seed oil |
| | odor: warm woody spicy sweet green herbal |
| | flavor: Spicy, fresh, green, herbal, vegetative and woody |
| FR | | pelargonium radula oil |
| | odor: bitter leafy woody earthy palmarosa |
| | (cis+trans)-1,1,2,3,3- | pentamethyl-2,3,3a,4,5,9b-hexahydro-1H-7,9-diazacyclopenta[a]naphthalene |
| | odor: ambery, musky, and woody notes |
| FL/FR | | pentanoic acid, 3-methyl-2-oxo-, ethyl ester |
| | odor: nutty black walnut aroma, accompanied by woody nuances and a subtle herbaceousness |
| | flavor: fresh nutty notes of walnut, dry, woody |
| FR | | pepper hexanone |
| | odor: deep peppery woody rose absolute |
| FL/FR | white | pepper oil |
| | odor: peppery |
| | flavor: peppery |
| FL/FR | black | pepper oil CO2 extract |
| | odor: Black pepper, fresh, herbal, spicy and woody with a slight, green, terpy nuance |
| | flavor: Fresh ground black pepper, herbal and woody with a clean, biting, spicy nuance |
| FL/FR | black | pepper oleoresin |
| | odor: fresh ground black pepper |
| | flavor: black pepper |
| FL | | peru balsam |
| | odor: sweet balsamic vanilla woody powdery resinous |
| | flavor: balsamic bitter woody resinous |
| FR | | peru balsam replacer |
| | odor: sweet balsamic vanilla woody powdery resinous |
| FL/FR | | petitgrain bigarade oil |
| | odor: fresh floral sweet orangflower woody herbal |
| | flavor: petitgrain |
| | beta-sesqui | phellandrene |
| | odor: herbal fruity woody |
| FR | | philodendron solimoesense specialty |
| | odor: citrus grapefruit woody |
| | | phoebe oil brazil |
| | odor: smoky greasy woody |
| FR | | picea pungens leaf oil |
| | odor: balsamic resinous woody |
| FL/FR | D-(+)-beta- | pinene |
| | odor: sweet fresh pine woody hay green |
| FL/FR | | pinocarveol |
| | odor: Camphoreous, woody pine-like with fresh, cooling minty undernotes |
| | flavor: Camphoreous, woody pine-like with a green thymol borneol nuance |
| | | piper matico leaf oil |
| | odor: camphor peppery minty woody |
| FR | black | poplar bud oil |
| | odor: balsamic sweet coumarinic woody labdanum amber |
| FL/FR | iso | propyl alcohol |
| | odor: alcohol musty woody |
| | flavor: dry alcoholic woody musty |
| FL/FR | iso | propyl decanoate |
| | odor: green vegetable woody oily fruity |
| FD | | propyl paraben |
| | odor: sweet smoky burnt woody hawthorn |
| | 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one |
| | odor: minty, camphoraceous, woody aroma with a spicy (peppery) fragrance note |
| FR | | rose concrete (rosa centifolia) |
| | odor: warm floral woody sweet spicy honey |
| FL/FR | | rosemary absolute |
| | odor: fresh strong camphor woody balsam herbal minty |
| | flavor: rosemary |
| FL/FR | | rosemary oil |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FL/FR | | rosemary oil CO2 extract |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FL/FR | | rosemary oil morocco |
| | odor: herbal camphoreous woody balsamic minty medicinal phenolic |
| | flavor: herbal camphoreous minty woody aromatic balsamic phenolic medicinal |
| FR | | rosemary oil replacer |
| | odor: herbal camphoreous woody balsamic minty |
| FL/FR | | rosemary oil spain |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FR | | rosemary specialty |
| | odor: fresh strong clean herbal rosemary eucalyptus woody |
| FL/FR | | saffron resinoid |
| | odor: Sweet, hay, tobacco, with a woody ionone depth, and a rum honey nuance |
| | flavor: Sweet, tobacco, rum, brown, woody and slightly spicy |
| FL/FR | | salvia sclarea distillates |
| | odor: clary sage |
| | flavor: clary sage |
| FR | | sambucus nigra flower oil CO2 extract |
| | odor: floral herbal woody anisic waxy honey |
| FR | | sandal octanol |
| | odor: sweet sandalwood soapy floral woody |
| FL/FR | | sandalwood oil west australia |
| | odor: sweet creamy balsamic woody milky |
| FR | | santall |
| | odor: woody clean sandalwood balsam |
| FR | | sarcocaulon mossamedense wood resinoid |
| | odor: amber peppery woody coumarinic |
| FL/FR | white | sassafras oil |
| | odor: sweet spicy fresh camphor woody floral rootbeer |
| FL/FR | | sclareolide |
| | odor: Intense, aromatic, woody and moss like with a cedar and tobacco nuance |
| | flavor: Intense aromatic, woody, cedar like, tobacco with a mushroom and earthy nuance. It has a vague perfumey oak moss note |
| FL/FR | | styralyl formate |
| | odor: green floral woody mimosa gardenia |
| FL/FR | | styrax oil (liquidambar styraciflua) |
| | odor: sweet balsamic styrene woody |
| | flavor: storax |
| FR | | styrax oil replacer |
| | odor: sweet balsamic styrene woody |
| FL/FR | | styrax resin (liquidambar styraciflua) |
| | odor: sweet balsam styrene woody amber |
| | flavor: storax |
| FL/FR | | styrax resinoid (liquidambar styraciflua) |
| | odor: sweet balsamic styrene woody amber |
| | flavor: storax balsamic spicy woody |
| FR | | styrax resinoid replacer |
| | odor: sweet balsamic styrene woody amber |
| FL/FR | | sunflower oil |
| | odor: orris oily woody waxy spicy floral dusty acacia |
| | flavor: orris oily spicy woody floral dusty waxy herbal |
| FR | common | tansy leaf oil dutch |
| | odor: cedarleaf herbal woody spicy |
| FL/FR | | terpinolene |
| | odor: fresh woody sweet pine citrus |
| | flavor: Woody, terpy, lemon and lime-like with a slight herbal and floral nuance |
| FL/FR | | terpinyl propionate |
| | odor: herbal green old wood citrus geranium tropical |
| | flavor: green woody citrus bergamot balsamic herbal fir needle |
| FR | | tetrahydroionol |
| | odor: mild floral violet woody leathery |
| FR | | thuja occidentalis leaf extract |
| | odor: cedarleaf |
| FR | beta- | thujone |
| | odor: cedarleaf |
| FR | | tobacarol (IFF) |
| | odor: dusty amber woody nutmeg tobacco |
| FL/FR | | tolu balsam absolute |
| | odor: sweet balsam cinnamyl woody |
| | flavor: tolu balsam |
| FL/FR | | tolu balsam resinoid |
| | odor: sweet balsam cinnamyl woody |
| | flavor: tolu balsam |
| FR | | tricyclodecenyl propionate |
| | odor: fruity herbal woody jasmin oily basil |
| FL/FR | | tropical ionone |
| | odor: green floral woody orris tropical weedy waxy leather |
| | flavor: Floral, sweet, fruity, woody and orris-like nuance |
| FL/FR | | turpentine oil |
| | odor: fresh balsam woody terpene |
| FL/FR | | valerian rhizome oil |
| | odor: fresh green warm woody balsam rooty animal musk |
| | flavor: valerian root overripe fruit animal |
| FL/FR | | valerian rhizome oil china |
| | odor: green warm woody balsam rooty animal musk |
| | flavor: valerian root |
| FL/FR | | valerian rhizome oil CO2 extract china |
| | odor: fresh green warm woody balsamic rooty animal musk |
| | flavor: valerian root |
| FR | | veramoss (IFF) |
| | odor: mossy oakmoss woody phenolic earthy |
| | flavor: mossy dry earthy woody phenolic oakmoss spicy powdery |
|
| Quaternary (Fourth) - woody |
| FL/FR | | abies alba needle oil |
| | odor: fresh terpene dry pine woody rooty weedy green forest |
| | flavor: terpenic balsamic pine woody |
| FL/FR | | allspice berry oil |
| | odor: sweet spicy clove phenolic woody nutmeg powdery |
| | flavor: Spicy, sweet, clove and woody with a slightly warm phenolic nuance |
| FL/FR | | allspice berry oil terpeneless |
| | odor: sweet clove spicy nutmeg |
| | flavor: allspice |
| FL/FR | | amber naphthofuran |
| | odor: dry woody amber ambergris musk sweet |
| | flavor: amber old wood tobacco powdery dry ambergris animal |
| FR | | amber oxepin |
| | odor: dry amber powdery woody musk |
| FR | | ambergris naphthol |
| | odor: amber musk animal old wood earthy |
| FR | | ambrain |
| | odor: labdanum amber balsamic resinous woody musk old wood |
| FR | | ambrein |
| | odor: amber ambergris labdanum woody |
| FL/FR | | ambroxide |
| | odor: dry amber ambergris paper musk woody cedar pine green seedy |
| FL/FR | | angelica seed absolute |
| | odor: peppery terpene sweet woody amber |
| | flavor: angelica |
| FR | | animal specialty |
| | odor: animal musk costus woody tabic aldehydic |
| FL/FR | | anthemis nobilis flower extract |
| | odor: Green, herbal, hay, tea, woody and floral with a tropical, fruity undernote |
| | flavor: Green, herbal, floral, tea and woody with a tropical, fruity nuance |
| FL/FR | | anthemis nobilis flower oil roman |
| | odor: sweet herbal green cognac spicy woody |
| | flavor: Sweet, floral, spice-like with a warm herbal green tea nuance |
| FL/FR | | apium graveolens seed oil |
| | odor: fresh herbal green phenolic woody aromatic spicy balsamic |
| | flavor: herbal green aromatic cortex balsamic phenolic spicy nasturtium |
| FL/FR | | apium graveolens seed oil india |
| | odor: fresh herbal green phenolic woody |
| | flavor: celery herbal |
| FR | | arnica flower absolute |
| | odor: herbal sweet tea chamomile woody earthy |
| FL/FR | | artemisia dracunculus herb oil |
| | odor: sweet anise spice licorice woody basil |
| | flavor: sweet licorice anise sassafrass spicy terpenic root beer green basil |
| FL/FR | | benzaldehyde |
| | odor: strong sharp sweet bitter almond cherry |
| | flavor: fruity cherry maraschino cherry oily nutty woody tropical fruit |
| FR | | benzoin resin replacer |
| | odor: balsamic vanilla powdery woody |
| FR | | bigarade oxide |
| | odor: petitgrain neroli grapefruit woody herbal cranberry |
| FR | | bornane-3,1-cyclopenta-2-one |
| | odor: new car woody clary vetiver |
| FL/FR | dextro,laevo-iso | borneol |
| | odor: balsam camphor herbal woody |
| | flavor: camphoreous minty herbal earthy woody |
| FL/FR | iso | bornyl formate |
| | odor: camphor musty medical woody |
| | flavor: Woody, cooling, musty, floral, camphoreous and minty |
| FL/FR | | boronia absolute |
| | odor: cassie violet warm sweet woody fresh fruity green |
| | flavor: Fruity, citrus, tutti-frutti, pulpy and honey |
| FL/FR | | boronia absolute replacer |
| | odor: floral cassie violet woody fruity green |
| FR | | boronia fragrance |
| FR | | boswellia serrata wood tar oil |
| | odor: smoky resinous balsamic woody |
| | | bursera graveolens wood |
| | odor: balsamic citrus fruity woody coumarinic |
| FL/FR | | bursera graveolens wood oil |
| | odor: balsamic citrus fruity woody coumarinic |
| FL/FR | iso | butyl furyl propionate |
| | odor: fruity floral winey woody pineapple |
| | 2- | butyl-4-methyl-1,3-oxathiane |
| | odor: powerful, green, spicy, leafy, woody, pepper, oily fruity, tropical, grapefruit, cantaloupe, banana |
| FL/FR | (S)- | campholene acetate |
| | odor: sweet fresh lavender, floral, berry note with fine woody undertone |
| | flavor: jammy raspberry |
| FR | | camphor wood oil decamphorised |
| | odor: herbal eucalyptus balsamic woody medicinal |
| FR | | cananga fruit oil |
| | odor: herbal floral balsam woody leather |
| FR | | cananga leaf oil |
| | odor: spicy floral balsamic woody leather |
| FL/FR | | canarium luzonicum gum |
| | odor: fresh terpene peppery lemony woody balsam dill |
| | flavor: elemi |
| FL/FR | beta- | caryophyllene |
| | odor: sweet woody spice clove dry |
| | flavor: spicy clove woody nut skin powdery peppery |
| FL/FR | | cassie absolute |
| | odor: fresh sweet spice clove violet green weedy woody |
| | flavor: Spicy, sweet, fruity and honey with a woody, herbal nuance |
| FR | | celery seed oil replacer |
| | odor: fresh herbal green phenolic woody aromatic spicy balsamic |
| FR | | celery specialty |
| | odor: herbal green phenolic woody aromatic spicy balsamic |
| FR | | cestrum nocturnum flower oil |
| | odor: spicy floral carnation woody |
| FL/FR | | chamomile absolute |
| | odor: herbal camphoreous balsamic woody |
| | flavor: chamomile |
| FL/FR | | cilantro herb oil egypt |
| | odor: Green, herbaceous, sweet, citrus-Iike with a woody aldehydic nuance |
| | flavor: Herbal, spice, green, aldehydic, with a sweet woody and waxy nuance |
| FL/FR | | cinnamon bark oil (cinnamomum zeylanicum) sri lauka |
| | odor: sweet cinnamon spicy allspice woody |
| | flavor: spicy aromatic aldehydic fruity honey woody |
| FR | | cistus ladaniferus resin |
| | odor: sweet old wood amber ambergris musty dry |
| FR | | citronella oil ceylon replacer |
| FR | | citronellone |
| | odor: fresh citrus citronella floral ionones |
| FL/FR | | citronellyl acetone |
| | odor: sweet floral balsam rose woody |
| FL/FR | | clove bud absolute |
| | odor: spicy sweet warm aromatic fruity woody floral phenolic |
| | flavor: Spicy, eugenol, warm and woody |
| FL/FR | | clove bud oil |
| | odor: spicy aromatic balsamic woody fruity minty phenolic powdery |
| | flavor: spicy woody aromatic balsamic minty medicinal |
| FR | | clove bud oil replacer |
| | odor: spicy aromatic balsamic woody fruity minty phenolic powdery |
| FR | | clove fragrance |
| FL | | costus root absolute |
| | odor: orris green hairy woody unripe melons |
| FL | | costus root oil |
| | odor: orris green hairy woody unripe melons |
| | flavor: costus |
| FL | | costus root oil CO2 extract |
| | odor: orris green hairy woody unripe melons |
| | flavor: costus |
| FL | | costus root resinoid |
| | odor: orris green hairy woody unripe melons |
| FR | meta- | cresol |
| | odor: medicinal woody leather phenolic |
| FR | homo | cuminic aldehyde |
| | odor: green sap foliage wood privet |
| FL/FR | iso | cyclocitral (IFF) |
| | odor: green aldehydic earthy woody herbal leaf |
| | flavor: green woody amber dry balsamic old wood ambergris sawdust powdery |
| FL/FR | | cyclohexanone diethyl acetal |
| | odor: fruity liquor rum tobacco woody |
| FR | 4- | cyclohexyl cyclohexanone |
| | odor: floral orris cyclamen woody ozone fresh |
| FL/FR | delta- | damascone |
| | odor: fruity sweet rose natural petal cassis black currant tobacco |
| | flavor: Woody, astringent, berry with a slight spice nuance |
| FL/FR | | davana flower oil |
| | odor: fruity ripe fruit berry woody animal |
| FR | N,N- | diethyl octanamide |
| | odor: spice sweet mint fresh tobacco woody fruity cigar box |
| FR | iso | dihydrolavandulol |
| | odor: fresh herbal mint rosemary woody |
| FL/FR | alpha- | dihydroterpineol |
| | odor: sweet pine terpenic lime woody |
| | flavor: woody terpenic lime astringent herbal earthy humus rooty |
| FR | 1,4- | diisopropyl-6,8-dioxabicyclo(3.2.1)octane |
| | odor: Fruity, lactonic, green, woody, floral, and waxy |
| FR | 2,5- | dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate + 1,4-dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate |
| | odor: spicy, fruity, green, woody, and sweet notes with some fruitate characteristics |
| FR | | dimethyl alpha-ionone |
| | odor: floral violet sweet powdery woody |
| FL/FR | (E+Z)-4,8- | dimethyl-3,7-nonadien-2-yl acetate |
| | odor: lemon rind citrus earthy woody |
| FL/FR | (R)-gamma- | dodecalactone |
| | odor: fruity sweet bloomy aldehydic woody |
| FL/FR | | elemi resinoid |
| | odor: fresh terpenic peppery lemon woody balsamic |
| | flavor: elemi |
| | 2- | ethyl decanoic acid |
| | odor: soapy waxy slight citrus slight woody |
| FL/FR | | ethylene brassylate |
| | odor: powdery sweet floral ambrette musk woody |
| | flavor: Musky, sweet, powdery, floral, vanilla and perfumey |
| FR | | eucalyptus macarthurii oil |
| | odor: fresh fruity rose sweet woody balsamic |
| FR | | evergreen fragrance |
| FL/FR | laevo- | fenchone |
| | odor: camphor herbal earthy woody |
| | flavor: cooling camphoreous minty medicinal earthy humus |
| FL/FR | | fir balsam absolute replacer |
| | odor: fir balsam |
| | flavor: fir needle |
| FR | | fir balsam concrete |
| | odor: fir balsam berry woody sweet green pine |
| FR | | fir carboxylate |
| | odor: natural pine fir green fruity woody |
| FL/FR | | fir needle oil siberia |
| | odor: fresh dry fir forest earthy woody |
| | flavor: fir needle |
| FR | | florida soap fragrance |
| FL | 2- | furfurylidene butyraldehyde |
| | odor: spicy cinnamon leather |
| FL | | galangal root oleoresin |
| | odor: spicy balsam fresh woody |
| | flavor: galanga |
| FL/FR | | galbanum absolute |
| | odor: green balsam earthy woody metallic |
| | flavor: galbanum |
| FR | | ginger fragrance |
| FL/FR | | ginger root oil china |
| | odor: spicy ginger citrus woody terpenic camphoreous earthy |
| | flavor: spicy citrus terpenic aldehydic floral aromatic tropical woody |
| FR | | ginger root oil replacer |
| | odor: fresh spice ginger root |
| FR | | ginger specialty |
| | odor: ginger |
| FR | | glycoacetal |
| | odor: floral rose green woody |
| FR | cis- | green acetate |
| | odor: fruity bergamot lime woody camphoreous fir needle spicy marjoram |
| FR | | guaethol allyl ether |
| | odor: clean deep spicy carnation sweet woody |
| FR | | herbal dioxane |
| | odor: fresh green herbal camphor woody |
| FR | | herbal ethanone |
| | odor: camphor herbal minty woody apple |
| FL/FR | | hexyl benzoate |
| | odor: fresh balsam sappy clean woody |
| | flavor: sweet green fruity balsamic orchid metallic cilantro |
| FL/FR | alpha- | ionol |
| | odor: ionone tropical sweet floral violet woody |
| | flavor: Woody ionone-like with a sweet perfume berry nuance |
| FL/FR | (E)-beta- | ionone |
| | odor: dry powdery floral woody orris berry seedy |
| | flavor: woody floral waxy berry fruity powdery |
| FR | beta- | ionyl ethyl ether |
| | odor: fruity apricot and raspberry woody cedarous flowery |
| FL/FR | | iris germanica florentina root extract |
| | odor: powdery floral green woody violet |
| | flavor: orris |
| FL/FR | | juniper berry oil CO2 extract |
| | odor: green resinous balsamic juniper |
| | flavor: juniper |
| FR | | juniper berry oil terpenes |
| | odor: pine citrus camphor woody juniper |
| FR | | khella oil |
| | odor: sweet balsamic herbaceous coumarinic woody spicy |
| FR | | lavandula stoechas oil |
| | odor: herbal rosemary camphoreous |
| FL/FR | | lavender oil australia |
| | odor: lavender |
| | flavor: lavender |
| FL/FR | | lavender oil CO2 extract |
| | odor: herbal lavender |
| | flavor: lavender |
| FR | | lawsonia inermis leaf oil CO2 extract |
| | odor: green leafy tea woody earthy |
| FR | | lime octadienal |
| | odor: waxy citrus lime floral |
| FL/FR | | linaloe wood oil mexico |
| | odor: soft floral woody |
| FR | | mace fragrance |
| FL/FR | | mace oil |
| | odor: nutmeg sweet spicy aromatic peppery woody nut skin mastic incense |
| | flavor: mace nutmeg |
| FL | para- | menthatriene |
| | odor: Oily, chemical, cooling, woody, pine, camphoreous and thymol-like with an herbal and tropical nuance |
| | flavor: Oily, terpy, camphoreous, cooling, thymol, herbal, woody and pine with a slight citrus nuance |
| FL/FR | | menthyl isovalerate |
| | odor: Fruity, cooling, sweet and woody |
| | flavor: Fruity, sweet, with a tutti frutti background |
| FL/FR | ortho- | methoxycinnamaldehyde |
| | odor: sweet cinnamon cassia oily woody paper |
| | flavor: Sweet, spicy, woody, cinnamon bark with medicinal and phenolic nuances |
| FR | | methyl cyclogeranate (Firmenich) |
| | odor: natural herbal floral fruity woody camphor |
| FL/FR | 4- | methyl-2,6-dimethoxyphenol |
| | odor: Phenolic, smokey, medicinal, woody, spicy, eugenol-like and rooty with a caramellic nuance |
| | flavor: Phenolic, medicinal, musty and guaiacol with a smoky nuance |
| FL/FR | | methyl heptadienone |
| | odor: cinnamon coconut spice woody sweet weedy |
| | flavor: Green, sweet, with a brown herbal aftertaste |
| FR | N- | methyl ionone |
| | odor: orris violet powdery woody |
| | flavor: floral orris tea powdery dry woody |
| FL | | methyl phenyl sulfide |
| | odor: Toluene solvent, spicy, pungent, woody sawdust |
| | flavor: Solventy, woody, roasted coffee |
| FR | | monarda fistulosa oil |
| | odor: green herbal resinous woody |
| FR | | musk ether |
| | odor: sweet macrocylic musk powdery woody |
| FR | | myristicin |
| | odor: spicy warm balsamic woody |
| FL/FR | | myrrh oil yemen |
| | odor: balsamic incense resinous woody lemon |
| FL/FR | | myrrh resin |
| | odor: woody balsam incense sweet old wood |
| | flavor: myrrh |
| FR | | neroli ketone |
| | odor: cortex leafy green woody herbal phenolic floral |
| FL/FR | (E)- | nerolidol |
| | odor: floral green citrus woody waxy |
| | flavor: green floral woody fruity citrus melon |
| FR | | nonisyl propionate |
| | odor: floral lavender herbal woody |
| FL/FR | | oakmoss absolute color reduced |
| | odor: mossy oakmoss green earthy woody seaweed |
| | flavor: oakmoss |
| FL/FR | beta- | ocimene |
| | odor: Tropical, green, terpy and woody with vegetable nuances |
| | flavor: Green, tropical, woody with floral and vegateble nuances |
| FL/FR | | octanal diethyl acetal |
| | odor: Green, citrus, oily and fatty with a woody, spicy and fruity nuance |
| | flavor: Green, waxy and vegetative with a citrus and melon nuance |
| FL/FR | bitter | orange peel oil brazil |
| | odor: citrus orange dry woody mandarin cognac terpenic aromatic |
| | flavor: Bitter, fruity, Madeira, cognac and woody with aromatic nuances |
| FR | | orris butenone |
| | odor: velvety floral orris violet ionone woody |
| FL/FR | | orris rhizome absolute (iris pallida) |
| | odor: sweet floral berry violet fresh wet wood (80-85% irone) |
| | flavor: sweet woody berry raspberry earthy sandy powdery fatty |
| FL/FR | | orris rhizome oil (iris germanica) |
| | odor: sweet floral berry violet fresh wet wood |
| | flavor: orris |
| FR | | patchouli oil terpenes |
| | odor: herbal aromatic spicy |
| FL/FR | | peppermint cyclohexanone |
| | odor: fresh mint peppermint woody camphor |
| | flavor: Cooling, peppermint and spearmint-like |
| FR | | petitgrain oil replacer |
| | odor: fresh floral sweet orangeflower neroli woody herbal |
| FL/FR | | petitgrain oil terpeneless |
| | odor: floral citrus peel clary sage sweet woody bitter |
| | flavor: sweet citrus peel clary sage floral bergamot herbal citrus rind tropical woody |
| FL/FR | | phenethyl hexanoate |
| | odor: sweet honey floral waxy woody sweaty green banana pineapple |
| | flavor: Sweet, waxy, floral with fruity notes |
| FL/FR | | pine needle oil dwarf |
| | odor: pine balsam sweet woody spicy cypress juniperberry |
| | flavor: pine, camphoraceous, herbaceous |
| FR | | pine oil 85 |
| | odor: herbal pine citrus woody green |
| FR | | pine specialty |
| | odor: fir needle |
| FL/FR | | piper longum fruit oil CO2 extract |
| | odor: spicy balsamic cinnamyl woody capers resinous amber animal |
| | flavor: fruity tutti frutti spicy balsamic peppery woody amber castoreum |
| FL/FR | 4-iso | propyl-2-cyclohexenone |
| | odor: spice cumin caraway woody herbal |
| FL/FR | (-)-iso | pulegol |
| | odor: minty cooling medicinal woody |
| | flavor: minty cooling mentholic peppermint grassy herbal tropical |
| FL/FR | | raspberry ketone |
| | odor: sweet berry jam raspberry ripe floral |
| | flavor: Fruity, jammy, berry, raspberry and blueberry with seedy, cotton candy nuances |
| FR | | romanal |
| | odor: dry sweet lavender rosemary woody amber herbal |
| FR | | rum fragrance |
| FR | | saffron stigmates absolute |
| | odor: saffron oriental spicy woody |
| FR | | sandal cyclopentane |
| | odor: herbal sandalwood waxy nutty woody |
| | | sclarene |
| | odor: powerful green terpenic woody amber clary sage |
| FL/FR | | sclareol |
| | odor: sweet balsam clary amber woody weedy |
| | flavor: sweet woody balsamic clary sage amber weedy brothy cascarilla |
| FL/FR | | seaweed absolute (fucus vesiculosus et serratus) |
| | odor: green herbal phenolic woody dry seaweed |
| FR | 1-oxa | spiro-4,7-dodecane |
| | odor: animal indole ethyl saferanate cistus woody |
| FL | | styrax gum (liquidambar styraciflua) |
| | odor: sweet balsam amber woody storax |
| | flavor: Balsamic, honey, sweet, waxy with a spicy resinous nuance |
| FR | common | tansy flower oil |
| | odor: wormwood herbal mint woody spicy |
| FL/FR | common | tansy flower oil argentina |
| | odor: cedarleaf herbal woody |
| | flavor: tansy |
| FR | common | tansy flower oil dutch |
| | odor: wormwood herbal mint woody spicy |
| FR | | tarchonanthus camphoratus oil |
| | odor: herbal floral camphoreous woody minty spicy medicinal |
| FL/FR | | tarragon oil replacer |
| | odor: sweet anise spicy licorice woody basil |
| | flavor: licorice anise sassafrass spicy terpenic root beer green basil |
| FL/FR | | tea leaf absolute |
| | odor: dry herbal sweet woody |
| | flavor: tea |
| FR | | tetrahydromyrcenyl acetate |
| | odor: fresh citrus herbal mossy woody lavender |
| FR | | tonka undecanone |
| | odor: sweet spicy balsam tonka woody tobacco green |
| FR | 5- | tricyclodecenyl acetate |
| | odor: floral green herbal |
| FL/FR | | valerian rhizome absolute |
| | odor: balsam green sweet woody sour |
| | flavor: valerian root |
| FL/FR | gamma- | valerolactone |
| | odor: herbal sweet warm tobacco cocoa woody |
| | flavor: sweet tonka coumarinic tobacco cocoa dark chocolate coconut |
| FL | | vitispirane |
| | odor: floral fruity earthy woody |
|
| Quinary (Fifth) - woody |
| FL/FR | 3- | acetyl pyridine |
| | odor: sweet nutty dry hawthorn phenolic woody popcorn |
| | flavor: nutty roasted corn chip nut skin corn popcorn |
| FR | | acorus calamus rhizome oil |
| | odor: fresh sweet herbal citrus spicy woody |
| FR | 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane |
| | odor: fruity, green, dirty, harsh, metallic, slight woody, camphor, juicy, acetophenone-like, and fenchol-like notes |
| FR | | amber dodecane |
| | odor: woody celery musk ambergris old wood |
| FR | | ambergris specialty |
| | odor: ambergris old wood musty cistus fecal animal |
| FR | | autumn fragrance |
| FR | | autumn specialty |
| | odor: autumn leaves dry green woody |
| FR | | balsam specialty |
| | odor: sweet fruity balsam amber |
| FL/FR | sweet | basil absolute |
| | odor: Herbal, green, leafy, sweet, spice-like with a soupy nuance |
| | flavor: Green, herbal, sweet, spicy, with a warm woody nuance |
| FL/FR | holy | basil leaf oil |
| | odor: green spicy herbal balsamic woody |
| FR | | bayberry fragrance |
| FL/FR | | benzaldehyde propylene glycol acetal |
| | odor: bitter narcissus sweet naphthalic woody |
| | flavor: fruity maraschino cherry medicinal phenolic |
| FR | | blue grass fragrance |
| FL/FR | iso | bornyl propionate |
| | odor: pungent pine camphor woody lavender |
| | flavor: fir balsamic herbal sweet camphoreous woody |
| FR | | boxwood blossom fragrance |
| FL/FR | | bread thiophene |
| | odor: Sweet, almond, cherry, furfural, woody and acetophenone |
| | flavor: Sweet, almond, fruity, heliotropine and nutty |
| FL/FR | iso | butyl angelate |
| | odor: herbal green spicy cooling woody caraway celery sweet |
| | flavor: Green, sweet and spicy |
| FR | | calamus oil replacer |
| | odor: calamus herbal citrus spicy woody |
| FL/FR | green | camellia sinensis leaf extract |
| | odor: Tea, green, hay, mate, herbal, alfalfa, mossy, with a dry woody fermented Iovage nuance |
| | flavor: Green tea, astringent, herbel, tobacco, leafy, alfalfa, mate with a slight woody nuance |
| FL/FR | | canarium luzonicum oil |
| | odor: fresh lemony peppery balsam green woody sweet spicy |
| | flavor: elemi |
| FL/FR | | cassia bark oil china |
| | odor: sweet spicy aldehydic aromatic cinnamyl woody resinous honey gourmand powdery |
| | flavor: spicy sweet aromatic aldehydic honey cinnamyl woody resinous |
| FL/FR | | cassia bark oil replacer |
| | odor: cinnamon sweet spicy aldehydic aromatic cinnamyl woody resinous honey gourmand powdery |
| | flavor: cinnamon spicy sweet aromatic aldehydic honey cinnamyl woody resinous |
| FR | | cassia fragrance |
| | odor: spicy aldehydic aromatic cinnamyl woody resinous honey gourmand powdery |
| FR | | cassis specialty |
| | odor: cassis |
| FL/FR | | castoreum absolute |
| | odor: leathery smoky animal phenolic old wood burnt resinous |
| | flavor: leathery animal resinous smoky old wood phenolic burnt |
| FR | | castoreum absolute replacer |
| | odor: leathery smoky animal phenolic old wood burnt resinous |
| FR | | castoreum fragrance |
| FR | | cigar fragrance |
| FR | | cinnamomum culilawan bark oil |
| | odor: spicy clove balsamic woody |
| FL/FR | | cinnamon bark oil |
| | odor: sweet spicy aldehydic aromatic cinnamyl woody resinous honey powdery |
| | flavor: spicy sweet aromatic aldehydic honey cinnamyl woody resinous |
| FR | | cinnamon bark oil replacer |
| | odor: sweet spicy aldehydic aromatic cinnamyl woody resinous honey gourmand powdery |
| FR | | cinnamon fragrance |
| FL/FR | | citronella oil ceylon |
| | odor: citrus lemony grassy woody rose fresh wet leaves weedy |
| | flavor: citrus lemon fatty woody grassy terpenic tropical dewy |
| FR | | citronellal / methyl anthranilate schiff's base |
| | odor: fresh citrus weedy grassy sharp woody |
| FR | | citrus ocimenol acetate |
| | odor: herbal citrus weedy cologne woody |
| FL/FR | | copaiba balsam oil |
| | odor: warm balsam spicy peppery metallic woody creamy labdanum |
| | flavor: balsamic woody sawdust spicy herbal cedar juniper patchouli |
| FR | | copaiba balsam oil replacer |
| | odor: balsamic spicy peppery metallic woody creamy labdanum |
| FL/FR | | coriander seed oil terpeneless |
| | odor: coriander |
| | flavor: coriander |
| FR | | costus root oil replacer |
| | odor: costus |
| FR | iso | cyclogeraniol (IFF) |
| | odor: spice floral carnation herbal green woody |
| | flavor: camphoraceous and bitter flavor |
| FR | | cyclohexyl crotonate |
| | odor: fruity, sweet, floral, green, woody, and weak |
| FR | 2- | cyclohexyl cyclohexanone |
| | odor: cyclamen sweet herbal cumin mint woody orris ozone |
| | 2- | cyclohexyl-4-methyl-1,3-oxathiane |
| | odor: citrus, onion, herbaceous, dry wood slight tropical, slight onion |
| FL/FR | 2- | cyclopentyl cyclopentanone |
| | odor: fruity green minty aldehydic woody |
| FR | | decahydrocyclododecaoxazole |
| | odor: green herbal terpenic earthy woody |
| FL/FR | | dehydro beta-linalool |
| | odor: sweet musk waxy ambrette dry woody |
| FR | | elemi resinoid replacer |
| | odor: fresh herbal terpenic peppery lemon woody balsamic |
| FL/FR | 2- | ethyl-3,5(or 6)-dimethyl pyrazine |
| | odor: burnt coffee nutty roasted woody |
| FL/FR | iso | eugenyl formate |
| | odor: orris green sweet woody clove |
| FL/FR | dextro- | fenchone |
| | odor: camphor thuja cedarleaf herbal earthy woody |
| | flavor: Cooling, camphoreous, sweet and minty with a musty, earthy nuance |
| | | fern absolute |
| | odor: sweet woody earthy green bark |
| FR | | fir balsam fragrance |
| FR | | fir balsam oregon |
| | odor: fresh sweet pine fir needle balsamic resinous woody |
| FR | | fir needle oil replacer |
| | odor: fir needle |
| FR | | floral undecenone |
| | odor: sweet floral balsam rose woody dry |
| | flavor: fruity apple peach |
| FL/FR | | frankincense oil |
| | odor: terpenic incense peppery spicy old wood woody pine resinous |
| | flavor: incense woody peppery spicy terpenic citrus rind resinous |
| FR | | frankincense oil replacer |
| | odor: terpenic incense old wood woody |
| FL/FR | 3-(2- | furyl) acrolein |
| | odor: green grassy fruity spicy vanilla nutty woody cinnamon |
| FL/FR | | galbanum oil |
| | odor: fresh green cortex earthy rooty woody balsamic metallic |
| | flavor: green rooty weedy earthy balsamic juniper woody |
| FR | | galbanum oil replacer |
| | odor: galbanum |
| FR | | gardenia pentyl acetate |
| | odor: fresh green oily gardenia grapefruit woody balsamic |
| FR | | genet concrete |
| | odor: sweet honey rose hay woody |
| FL/FR | | gentian absolute |
| | odor: bitter vegetable herbal dry woody |
| FR | red | ginger rhizome oil |
| | odor: earthy spicy rooty dry woody aromatic |
| FL/FR | | ginger root oil cochin |
| | odor: citrus spicy terpenic herbal woody |
| | flavor: spicy citrus aromatic terpenic floral oily woody |
| FR | | grapefruit acetal |
| | odor: fresh citrus grapefruit peel soapy woody green violet |
| FR | iso | green methanoindene |
| | odor: green weedy oily sweet woody floral gardenia jasmin tuberose |
| FL/FR | | guaiacyl phenyl acetate |
| | odor: heavy balsam phenolic spice floral woody powdery honey smoked sausage |
| | flavor: Sweet, phenolic, spicy anisic, with clover honey and vanilla nuances |
| FR | | guaiyl butyrate |
| | odor: rose plum animal balsamic woody |
| | flavor: plum |
| FR | cis- | herbal cyclohexane |
| | odor: fresh green herbal natural citrus woody |
| | flavor: green herbal woody spicy floral chrysanthemum |
| FL/FR | | hexahydrofarnesyl acetone |
| | odor: oily herbal jasmin celery woody |
| | flavor: sweet green melon rind artichoke tropical watermelon rind kiwi starfruit winey |
| FR | (E)-2- | hexen-1-yl salicylate |
| | odor: green woody floral |
| FR | alpha- | hexyl cinnamaldehyde dimethyl acetal |
| | odor: fresh green fatty foliage woody |
| FR | | ho leaf oil |
| | odor: sweet floral linalool coriander woody herbal camphoreous |
| | flavor: spicy floral bois de rose coriander camphoreous herbal berry tropical |
| FL/FR | | ionone mixed isomers |
| | odor: violet sweet floral woody |
| FL/FR | beta- | ionyl acetate |
| | odor: sweet berry raspberry violet jam woody |
| | flavor: Woody, slightly floral ionone raspberry/berry-like character with jammy floral nuances |
| FL/FR | alpha- | irone |
| | odor: orris floral berry violet woody powdery |
| | flavor: Woody, fruity, raspberry, orris and berry with seedy nuances |
| FL/FR | iso | jasmone |
| | odor: sweet floral herbal woody jasmin celery fresh dry waxy |
| | flavor: green spicy floral lactonic herbal celery waxy creamy |
| FL/FR | spike | lavender absolute |
| | odor: camphor herbal lavandin rosemary woody |
| | flavor: spike lavender |
| FR | | leerall |
| | odor: floral muguet cyclamen rhubarb woody |
| FR | | lime oil fractions |
| | odor: lime marine metallic green woody lemon |
| FL/FR | | linalool |
| | odor: citrus floral sweet bois de rose woody green blueberry |
| | flavor: Citrus, orange, lemon, floral, waxy, aldehydic and woody |
| FL/FR | dextro- | linalool |
| | odor: sweet floral petitgrain lavender |
| FL/FR | | linalyl anthranilate |
| | odor: fresh linalool orange blossom herbal gardenia woody |
| | flavor: floral terpenic citrus petitgrain mandarin orangeflower |
| FL/FR | | linalyl isobutyrate |
| | odor: light fruity lavender woody bergamot |
| | flavor: Floral, fruity, sweet, berry, citrus |
| FL/FR | | mango thiol |
| | odor: Sulfureous, green, tropical, terpy and weedy, cooling, berry and seedy, buchu-like |
| | flavor: Sulfureous, metallic, tropical, woody, fresh, green, cooling |
| FR | | mastic gum resin |
| | odor: balsam resinous incense amber woody olibanum greasy |
| FR | | melon carboxaldehyde |
| | odor: green melon fresh air aldehydic |
| FR | | methyl cyclocitrone (IFF) |
| | odor: green floral earthy dry woody |
| FL/FR | | methyl isoeugenol |
| | odor: spicy clove blossom carnation woody |
| | flavor: spicy warm clove resinous galanga smoky woody powdery |
| FL/FR | (E)-alpha- | methyl ionone (50-60%) |
| | odor: floral violet orris powdery woody |
| FL/FR | alpha-iso | methyl ionone (90% min.) |
| | odor: floral fruity powdery violet woody tea |
| | flavor: floral fruity berry orris woody violet jammy tea |
| FR | alpha- | methylene citronellal |
| | odor: petitgrain bergamot citrus fresh green woody |
| FL/FR | | mimosa absolute |
| | odor: floral green grassy waxy woody spicy |
| | flavor: waxy woody floral fruity spicy hay |
| FL/FR | | mimosa absolute france |
| | odor: floral green grassy waxy woody spicy |
| | flavor: Waxy, woody, floral and fruity with a spicy nuance |
| FL/FR | | mimosa absolute india |
| | odor: floral green grassy waxy woody spicy |
| | flavor: waxy woody floral fruity spicy hay |
| FR | | mimosa absolute replacer |
| | odor: floral green grassy waxy woody spicy |
| FR | | mimosa fragrance |
| FR | | mimosa specialty |
| | odor: mimosa |
| FR | | mint fragrance |
| FR | | mint specialty |
| | odor: minty |
| FR | | mistletoe fragrance |
| FL/FR | | murraya koenigii leaf oil india |
| | odor: green spicy camphoreous cedar woody |
| | flavor: curry |
| FR | | musk propanoate |
| | odor: musk ambrette fruity pear woody floral |
| FL/FR | | myrcenyl acetate |
| | odor: citrus bergamot lavender floral woody nutmeg |
| | flavor: citrus aldehydic weedy herbal woody rosemary |
| FL/FR | | nerolidol |
| | odor: floral green waxy citrus woody |
| | flavor: Green, floral, woody with fruity-citrus and melon nuances |
| FL/FR | | nerolidyl acetate |
| | odor: fresh sweet citrus waxy freesia woody |
| FR | | nonisyl acetate |
| | odor: sweet orris cumin woody fruity spicy |
| | flavor: woody fruity floral violet orris tropical melon lavender |
| FL/FR | (+)- | nootkatone |
| | odor: grapefruit peel citrus gardenia woody |
| | flavor: Grapefruit, citrus, orange and bitter |
| FR | | oakmoss phenol |
| | odor: oakmoss fruity iodine woody hay |
| FL/FR | 2- | octanone |
| | odor: Musty, ketonic, bleu and parmesan cheese-like with earthy and dairy nuances |
| | flavor: Dairy, waxy, cheese, woody, mushroom and yeast |
| | (Z)-5- | octen-1-yl 3-methyl butyrate |
| | odor: fruit flesh melon ripe banana smooth sour woody |
| FR | | olibanum specialty |
| | odor: frankincense |
| FL/FR | | opoponax absolute (commiphora erythraea var. glabrescens engle) |
| | odor: sweet balsamic woody incense amber old wood toffee vanilla animal |
| | flavor: opoponax |
| FR | | opoponax absolute replacer |
| | odor: balsamic woody incense amber old wood toffee vanilla animal |
| FL/FR | | opoponax resin (commiphora erythraea var. glabrescens engler) |
| | odor: sweet incense woody amber old wood |
| | flavor: opoponax |
| FR | | opoponax resinoid (commiphora erythraea var. glabrescens engle) |
| FR | | opoponax resinoid replacer |
| | odor: sweet incense woody amber old wood caramellic |
| FL/FR | bitter | orange peel oil terpeneless |
| | odor: Sweet, juicy, floral, aldehydic orange with woody citron nuances |
| | flavor: Sweet, juicy, peely, with aldehydic and floral nuances |
| FL | | oregano oleoresin |
| | odor: fresh oregeno spicy herbal green earthy woody |
| | flavor: herbal spicy peppery green camphoreous thyme phenolic |
| FL/FR | | origanum oil greece |
| | odor: thyme green herbal camphor woody |
| | flavor: origanum |
| FR | | orris fragrance |
| FL/FR | | orris rhizome absolute (iris germanica) |
| | odor: sweet floral berry violet green wet wood |
| | flavor: orris |
| FR | | orris rhizome absolute replacer |
| | odor: floral berry violet earthy woody |
| FL/FR | | orris rhizome oil CO2 extract |
| | odor: Waxy, ionone, sweet floral, with berry, woody and fruity nuances |
| | flavor: Woody, ionone, berry-like with sweet green floral and powdery fruity nuances |
| FL/FR | | orris rhizome resinoid (iris pallida) |
| | odor: sweet powdery floral waxy cocoa woody violet berry balsamic |
| | flavor: waxy floral violet berry balsamic herbal earthy woody |
| FR | | orris rhizome resinoid replacer |
| | odor: sweet powdery floral waxy cocoa woody violet berry |
| FR | | orris specialty |
| | odor: orris |
| FR | | outdoors specialty |
| | odor: outdoors |
| FR | | patchouli ethanone |
| | odor: woody dry ambergris cedar old wood ketonic phenolic |
| FR | | patchwood |
| | odor: tropical autumn fresh ozone orris woody earthy |
| FL/FR | 2- | pentanone |
| | odor: sweet fruity ethereal wine banana woody |
| | flavor: Sweet, fruity and banana-like with a fermented nuance |
| FL/FR | black | pepper oil |
| | odor: warm spicy terpenic herbal peppery woody |
| | flavor: spicy woody earthy terpenic peppery herbal |
| FR | black | pepper oil replacer |
| | odor: warm spicy terpenic herbal peppery woody |
| FL/FR | | perilla alcohol |
| | odor: green cumin spicy aromatic woody cardamom floral waxy violet |
| | flavor: woody aromatic cumin spicy green cardamom waxy floral oily earthy |
| FR | | petitgrain combava oil |
| | odor: fresh leafy sweet lemon petitgrain eucalyptus citriodora |
| FR | | petitgrain oil fractions |
| | odor: floral orangeflower green tropical woody |
| FL/FR | alpha- | phellandrene |
| | odor: citrus herbal terpene green woody peppery |
| | flavor: Terpenic, citrus lime with a fresh green note |
| FL/FR | L-(-)-alpha- | pinene |
| | odor: sharp warm resinous fresh pine |
| FR | | pinus cembra leaf twig oil |
| | odor: green resinous fruity balsamic woody |
| FR | | pinus nigra twig leaf oil |
| | odor: terpenic balsamic pine woody |
| FL/FR | | prenyl salicylate |
| | odor: floral herbal green orchid woody metallic |
| | flavor: herbal green waxy orchid metallic oily greasy |
| FL/FR | 2-iso | propyl phenol |
| | odor: solvent like, phenolic, smoky with toasted woody and burnt rubber nuances |
| | flavor: solvent like, shoe polish, woody smoky, aged scotch and whiskey like with tar and burnt rubber nuances |
| FL | 3- | propyl pyridine |
| | odor: sweet musty beany earthy woody |
| FL/FR | iso | pulegol |
| | odor: minty cooling eucalyptus medicinal woody green grassy herbal |
| | flavor: minty cooling herbal eucalyptus grassy peppermint weedy earthy |
| FR | | rain forest specialty |
| | odor: rain forest |
| FR | | rhubarb pyran |
| | odor: floral fruity rhubarb costus woody rooty |
| FL/FR | | rose leaf absolute (rosa centifolia) |
| | odor: green leafy sweet woody freshly cut leaves |
| | flavor: rose petitgrain |
| FR | | sandalrome |
| | odor: woody sandalwood greasy oily waxy |
| FL/FR | | sesame absolute |
| | odor: sesame nutty roasted peanut coffee gourmand woody balsamic |
| | flavor: nutty sesame |
| FL/FR | | sesame absolute CO2 extract |
| | odor: sesame nutty roasted peanut coffee gourmand woody balsamic cereal |
| | flavor: nutty sesame |
| FR | | spicewood oil |
| | odor: spicy citrus herbal green woody |
| | flavor: peppery |
| FR | common | tansy oil canada |
| | odor: wormwood thujonic herbal minty woody spicy |
| FL/FR | | tansy oil replacer |
| | odor: wormwood thujonic herbal minty woody spicy |
| FL/FR | green | tea leaf absolute |
| | odor: sweet leathery herbal floral balsamic woody |
| | flavor: green tea |
| FL/FR | alpha- | terpineol |
| | odor: pine terpene lilac citrus woody floral |
| | flavor: Citrus woody with a lemon and lime nuance. It has a slight soapy mouth feel |
| FL/FR | (-)-alpha- | terpineol |
| | odor: lilac floral terpenic |
| FR | | terpinyl benzoate |
| | odor: fir tree balsamic ylang niobe cypress woody floral |
| | 1,3,3,5- | tetramethyl-7-carbomethoxybicyclo(2.2.2)octane |
| | odor: fruity, green, minty, fig-like, and woody |
| | 1,3,3,5- | tetramethyl-8-carbomethoxybicyclo(2.2.2)octane |
| | odor: fruity, green, minty, fig-like, and woody |
| FL/FR | | thymyl methyl ether |
| | odor: woody smoky burnt |
| | flavor: musty green earthy coffee beany |
| FR | | tobacco absolute replacer |
| | odor: sweet hay tobacco moss leafy herbal old wood dried fruit tea honey |
| FR | | tobacco fragrance |
| FL/FR | | tobacco leaf absolute |
| | odor: sweet hay tobacco moss leafy herbal old wood dried fruit tea honey |
| | flavor: grassy leafy tea astringent hay tobacco brown dried fruit resinous |
| FL/FR | | tolu balsam resin |
| | odor: sweet balsam woody |
| | flavor: tolu balsam |
| FR | | tolu balsam specialty |
| | odor: tolu balsam |
| FR | | tombacco absolute |
| | odor: rich deep sweet floral herbal fruity prune woody tobacco hay |
| | 1,3,4- | trimethyl-2-methylene pentyl 2-butenoate |
| | odor: fruity with dry hay quality, winey, woody, slightly oily, chemical with aldehydic fatty note |
| FR | 2,4,8- | trimethyl-5-oxatricyclo(6.2.1.0*2,6*)undecane |
| | odor: green, earthy, fruity, fresh, and woody notes |
| FL/FR | | zingerone |
| | odor: sweet spicy phenolic ginger vanilla woody |
| | flavor: Spicy with a biting, lingering heat |
|
| Senary (Sixth) - woody |
| FR | | aglaia odorata absolute |
| | odor: green floral leathery fruity herbal woody spicy |
| FL | 4- | allyl-2,6-dimethoxyphenol |
| | odor: smoky, meaty, phenolic, sweet, ham and woody |
| | flavor: Meaty, phenolic, smoky and bacony, with creamy vanilla nuances |
| FR | | ambrain |
| | odor: labdanum amber balsamic resinous woody musk old wood |
| FL/FR | | ambrette seed oil |
| | odor: fresh musk amber powdery weedy dried fruit woody |
| | flavor: ambrette |
| FR | | ambrette seed oil replacer |
| | odor: fresh musk amber powdery weedy dried fruit |
| FL/FR | | anethum graveolens herb oil |
| | odor: herbal green spicy caraway |
| | flavor: Dill, minty, woody, vegetative, camphoreous, herbal |
| FL/FR | para- | anisyl phenyl acetate |
| | odor: anise honey balsam woody |
| | flavor: sweet anisic balsamic licorice honey powdery medicinal |
| FL/FR | | apple ketal |
| | odor: sweet fruity apple green tropical plum woody |
| | flavor: sweet fruity tropical apple apricot plum winey |
| FL/FR | | benzyl isobutyrate |
| | odor: jasmin oily fruity sweet rose tropical |
| | flavor: Fruity and sweet with ripe berry nuances |
| FL/FR | iso | bornyl acetate |
| | odor: balsam camphor herbal woody sweet |
| | flavor: Woody, camphoraceous, terpy and piney with a spicy, herbal and slightly citrus nuance |
| FL/FR | iso | bornyl isobutyrate |
| | odor: balsam herbal fir needle spicy earthy woody |
| | flavor: fir needle balsamic spicy herbal camphoreous woody soapy |
| FL/FR | dextro- | camphor |
| | odor: camphor minty phenolic herbal woody |
| | flavor: Medicinal, camphoreous, mentholic and woody |
| FL/FR | | cananga oil |
| | odor: sweet floral balsam green spicy animal woody waxy leather |
| | flavor: cananga floral woody balsamic spicy oily herbal green |
| FR | | cardamom oil replacer |
| | odor: warm spicy camphor medicinal eucalyptus balsam woody |
| FL/FR | | cardamom seed oil CO2 extract |
| | odor: spicy aromatic balsamic floral herbal woody camphoreous |
| | flavor: cardamom |
| FR | | cassie perfume base |
| | odor: spice clove violet green weedy woody |
| FL/FR | | celery seed oil CO2 extract |
| | odor: herbal green anisic aromatic phenolic woody |
| | flavor: celery |
| FR | | chamomile oil replacer |
| | odor: herbal green cognac spicy green tea woody |
| FR | | citronella fragrance |
| FL/FR | | citronellyl acetate |
| | odor: floral green rose fruity citrus woody tropical fruit |
| | flavor: Floral, waxy, aldehydic, with green fruity nuances. Fruity pear and apple like |
| FR | | cognac fragrance |
| FL/FR | | cognac oil replacer |
| | odor: yeasty alcoholic fusel whiskey fermentedwoody |
| | flavor: alcoholic fatty fusel whiskey fermented bready yeasty |
| FL/FR | | coriander oil fractions |
| | odor: coriander marine |
| | flavor: coriander |
| FR | | costus specialty |
| | odor: soft old precious wood animal sebaceous |
| FL/FR | | cubeb oil |
| | odor: fresh spicy bois de rose herbal woody smokey |
| | flavor: cubeb |
| FR | | cypress leaf oil |
| | odor: fresh pine woody earthy olibanum dry spicy cedar |
| FL/FR | 2,6- | dimethoxyphenol |
| | odor: smoky phenolic balsamic bacon powdery woody |
| | flavor: Sweet, medicinal, creamy, meaty, vanilla, spice |
| FR | | elemi oil replacer |
| | odor: elemi |
| FR | | elemi specialty |
| | odor: elemi |
| FL/FR | | elettaria cardamomum seed oil |
| | odor: warm spicy camphor medicinal eucalyptus balsam woody |
| | flavor: spicy herbal camphoreous medicinal eucalyptus balsamic woody |
| FL/FR | | elettaria cardamomum seed oil guatemala |
| | odor: warm spicy camphor medical eucalyptus balsam woody |
| | flavor: cardamom |
| FR | | eremophila mitchelli wood oil CO2 extract |
| | odor: leathery creamy mossy whiskey balsamic woody |
| FL | 1- | ethyl-2-acetyl pyrrole |
| | odor: nutty roasted |
| | flavor: pungent dusty, somewhat nutty |
| FL/FR | 4- | ethyl guaiacol |
| | odor: spicy smoky bacon phenolic clove |
| | flavor: Woody, smokey and spicy with a sweet vanilla background |
| FR | | ethyl safranate |
| | odor: fresh natural herbal damascon rose apple woody |
| FR | | floral methanol |
| | odor: floral minty earthy leather |
| FL/FR | | frankincense oil |
| | odor: terpenic incense peppery spicy old wood woody pine resinous |
| | flavor: incense woody peppery spicy terpenic citrus rind resinous |
| FR | | frankincense oil replacer |
| | odor: terpenic incense old wood woody |
| FR | | fruity butanate |
| | odor: fruity green peach orchid balsam woody |
| FR | | gardenia decalone |
| | odor: gardenia green grapefruit rhubarb vetiver woody |
| FL/FR | | geranic acid |
| | odor: dry weedy acidic green moldy feet woody |
| | flavor: dry weedy musty green woody |
| FL/FR | (E)- | geranyl acetone |
| | odor: fresh green fruity waxy rose woody magnolia tropical |
| | flavor: floral fruity green tropical pear banana ylang fatty |
| FR | | gingergrass oil |
| | odor: fatty sweet herbal grassy rose woody spicy |
| | flavor: spicy grassy aldehydic herbal citrus ginger geranium woody |
| FL/FR | | grapefruit mercaptan |
| | odor: sulfury aromatic grapefruit naphthyl resinous woody |
| | flavor: Grapefruit, fresh, tropical, juicy and mango |
| FR | | hawthorn ethanol |
| | odor: floral rose jasmin muguet lilac woody |
| FR | | hexyl pivalate |
| | odor: sweet floral fatty musty green fruity woody |
| FL/FR | 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| | odor: Camphoreous, piney, earthy, green, cooling and woody |
| | flavor: Camphoreous, woody, green, cooling and minty with a fenchyl and tropical nuance |
| FL/FR | beta- | ionol |
| | odor: sweet herbal floral violet tropical balsam woody |
| | flavor: Floral violet-like, fruity, woody, berry with powdery nuances |
| FR | | ivy dioxolane |
| | odor: floral green milky privet cortex woody |
| FL/FR | | juniper berry oil terpeneless |
| | odor: fresh earthy balsam carrot seed terpenic fir needle woody carrot caryophyllene |
| | flavor: woody earthy juniper carrot spicy balsamic |
| FL/FR | spike | lavender oil |
| | odor: camphor eucalyptus fresh herbal lavandin rosemary woody floral |
| | flavor: Cooling, mentholic, woody, herbal and spicy with a green nuance |
| FR | spike | lavender oil replacer |
| | odor: lavender |
| FL/FR | spike | lavender oil spain |
| | odor: camphor eucalyptus fresh herbal lavandin rosemary woody |
| | flavor: spike lavender |
| FR | | lily pentanal |
| | odor: aldehydic lily green fresh waxy woody |
| FL/FR | | linalyl acetate |
| | odor: sweet green citrus bergamot lavender woody |
| | flavor: Floral, green, terpy, waxy, citrus, woody, herbal and spicy nuances |
| FL/FR | | linalyl propionate |
| | odor: fresh bergamot lily woody rose rum |
| | flavor: bergamot herbal floral woody citrus fruity |
| FR | | maja fragrance |
| FR | | maple fragrance |
| | odor: maple |
| FL/FR | | mastic oil |
| | odor: terpene fresh balsam |
| | flavor: mastic |
| FR | | mastic oil replacer |
| | odor: mastic balsamic |
| FL/FR | laevo- | menthyl acetate |
| | odor: mentholic minty herbal tea fruity woody floral earthy |
| | flavor: cooling mentholic minty herbal old wood balsamic clove tropical floral |
| FL/FR | | mesityl oxide |
| | odor: musty, mildew, earthy, chemical, card board like with nutty, chocolate and woody nuances |
| | flavor: potato bin, raw and baked potato, jimica with raw vegetative, nutty and dirt like nuances |
| FL/FR | (E)-alpha- | methyl ionone (74-80%) |
| | odor: sweet floral fruity powdery violet orris woody |
| | flavor: floral waxy orris violet woody tea jammy powdery |
| FL/FR | alpha-iso | methyl ionone (50% min.) |
| | odor: violet sweet orris powdery floral woody |
| | flavor: floral violet powdery dry tea herbal berry woody |
| FR | | millefleurs fragrance |
| FL/FR | | musk dimethyl indane |
| | odor: animal musk cedar ambergris woody |
| | flavor: sweet waxy musk animal powdery |
| FR | | musk indanone |
| | odor: rich spicy musk woody clean |
| FL | 2- | naphthyl mercaptan |
| | odor: sulfurous rubbery meaty roasted woody creamy artichoke |
| | flavor: Sulfureous, meaty, brown, roasted, chicken, eggy with a slight nutty nuance |
| FR | | nerolidyl isobutyrate |
| | odor: fruity green oily bergamot pear woody |
| FR | | niaouli oil |
| | odor: sweet camphor eucalyptus sickly aromatic |
| FR | | oakmoss absolute replacer |
| | odor: oakmoss |
| FR | | oakmoss concrete |
| | odor: phenolic woody tar seashore forest bark wood green foliage |
| FR | | ocean carboxaldehyde |
| | odor: fresh sea breeze watery floral ozone |
| FR | | olibanum specialty |
| | odor: frankincense |
| FL/FR | | orange leaf absolute |
| | odor: floral green petitgrain herbal peppery woody weedy powdery fatty |
| | flavor: floral green herbal lavender leafy petitgrain weedy woody |
| FL/FR | bitter | orange peel oil |
| | odor: citrus orange dry terpenic aldehydic woody fresh leaf |
| | flavor: citrus orange terpenic tangerine aldehydic pulpy juicy |
| FL/FR | | origanum majorana leaf oil |
| | odor: spicy floral herbal bois de rose cardamom woody |
| FR | | orris pyridine 25% IPM |
| | odor: orris floral violet leather fresh wood |
| FL/FR | curled | parsley leaf oil |
| | odor: fresh green herbal spicy leafy phenolic woody |
| | flavor: green spicy herbal woody leafy phenolic grassy metallic |
| FL | curled | parsley oleoresin |
| | odor: green herbal spicy leafy phenolic woody |
| | flavor: green spicy herbal woody leafy phenolic grassy metallic |
| FL/FR | | pennyroyal oil |
| | odor: peppermint mentholic minty rosemary herbal woody phenolic |
| | flavor: minty cooling mentholic herbal cortex rosemary phenolic |
| FL/FR | | perillyl acetate |
| | odor: fruity dried fruit phenolic green geranium woody spicy herbal floral |
| | flavor: green geranium phenolic fruity herbal berry floral tropical |
| FL/FR | | peru balsam resinoid |
| | odor: sweet balsamic cinnamyl vanilla amber powdery woody resinous |
| | flavor: bitter warm balsam cinnamon woody vanilla leather |
| FR | | peru balsam resinoid replacer |
| | odor: sweet balsamic cinnamyl vanilla amber powdery woody resinous |
| FL/FR | | petitgrain lemon oil |
| | odor: fresh sweet oily floral citrus lemon tomato woody bitter |
| | flavor: citrus lemon lemongrass aldehydic tomato green citrus peel floral |
| FL/FR | | phenyl acetate |
| | odor: phenolic medicinal animal resinous castoreum woody smoky burnt |
| | flavor: phenolic animal resinous castoreum smoky burnt fecal |
| FR | | pine forest fragrance |
| FR | | pine fragrance |
| FL/FR | scotch | pine needle oil |
| | odor: earthy dry weedy green pine woody resinous |
| FL/FR | scotch | pine needle oil estonia |
| | odor: earthy dry weedy green pine woody |
| FL/FR | scotch | pine needle oil yugoslavia |
| | odor: earthy dry weedy green pine woody |
| FR | | pistachio fragrance |
| FL/FR | | propyl decanoate |
| | odor: waxy fruity fatty green vegetable woody oily fruity |
| FR | | ravensara aromatica leaf oil |
| | odor: herbal spicy terpenic camphoreous medicinal woody |
| FL/FR | | rose absolute (rosa centifolia) morocco |
| | odor: rich sweet deep rose spicy honey balsam amber woody animal |
| | flavor: floral tropical spicy waxy fatty amber resinous animal |
| FR | | rose carboxylate |
| | odor: rose oxide warm spicy fruity berry damascone |
| FL/FR | | rum extract |
| | odor: rum fusel fruity raisin floral woody balsamic |
| | flavor: rummy |
| FL/FR | | salvia officinalis leaf oil CO2 extract |
| | odor: thujonic cedar herbal eucalyptus rosemary minty woody |
| FL/FR | | tolu balsam absolute replacer |
| | odor: sweet balsamic cinnamyl amber spicy fruity woody |
| | flavor: tolu balsam |
| FR | | tolu balsam replacer |
| | odor: sweet balsamic amber fruity woody |
|
| Septenary (Seventh) - woody |
| FL/FR | | allspice oleoresin |
| | odor: sweet fresh spicy clove bay fatty aldehydic nutmeg woody |
| | flavor: spicy clove cinnamon nutmeg bay phenolic woody |
| FL/FR | iso | amyl salicylate |
| | odor: floral herbal woody orchid metallic |
| | flavor: herbal green floral seaweed oily nasturtium waxy soapy |
| FL/FR | | angelica seed oil |
| | odor: strong fresh terpenic peppery earthy spicy anisic ambrette woody musk soapy powdery |
| | flavor: fresh herbal terpenic ambrette peppery musk woody powdery carrot seed |
| FL/FR | | angelica seed oil CO2 extract |
| | odor: gin pepper spicy ambrette musk herbal woody |
| | flavor: Gin, herbal, ambrette, musky and peppery with a fresh, woody nuance |
| FR | | boronia butenal |
| | odor: dry sweet tobacco nutty violet boronia dry leaves hay wood acorns |
| FL/FR | | boronia concrete |
| | odor: floral green cassis hay fruity freesia woody |
| FR | | botanical fragrance |
| FL/FR | | clary sage oil america |
| | odor: fresh herbal dry green tea spicy weedy woody powdery |
| | flavor: herbal spicy green tea hay sage powdery woody |
| FL/FR | white | cognac oil |
| | odor: winey fermented green grape fusel |
| | flavor: Alcoholic, fatty, fusel, whiskey, fermented, bready and yeasty |
| FL/FR | | cyclohexyl anthranilate |
| | odor: mild neroli orange blossom |
| | flavor: grape |
| FR | | frankincense fragrance |
| FL/FR | 3- | hepten-2-one |
| | odor: Sweet, fruity, ketonic, cheesy, with a green woody nuance |
| | flavor: Creamy, coconut, cheesy |
| FL/FR | | heptyl acetate |
| | odor: fresh green rum ripe fruit pear apricot woody |
| | flavor: Green, fatty, spicy, citrus, soapy and aldehydic with a floral nuance |
| FL/FR | | hexyl 2-methyl butyrate |
| | odor: green waxy fruity apple spicy tropical |
| | flavor: Green, waxy, unripe fruity, apple and banana with a fresh, fleshy nuance |
| FR | | hop fragrance |
| FL/FR | | hop oil |
| | odor: sharp green spicy sweet beer herbal |
| | flavor: floral fruity herbal woody citrus terpenic beer tropical |
| FL/FR | | hyssop oil |
| | odor: herbal clary camphor green pine terpene woody |
| | flavor: Herbal, green, cooling, woody and pine-like |
| FR | | lavandin fragrance |
| FL/FR | abrialis | lavandin oil |
| | odor: herbal spicy camphoreous soapy floral balsamic woody algae |
| | flavor: herbal spicy aromatic camphoreous soapy balsamic woody amber |
| FR | | lavandin oil replacer |
| | odor: lavandin |
| FR | | lavandin specialty |
| | odor: lavandin |
| FL/FR | | lavender absolute bulgaria |
| | odor: sweet floral herbal aromatic spicy camphoreous tropical woody mossy |
| | flavor: herbal floral spicy aromatic mossy camphoreous woody amber |
| FR | | lime fragrance |
| FL/FR | | lime oil distilled mexico |
| | odor: fresh lime sweet floral aldehydic terpene cologne tart woody |
| | flavor: Lime, waxy, candy peely with a citral and terpy nuance |
| FR | | lime oil replacer |
| | odor: lime terpenic |
| FR | | lime specialty |
| | odor: citrus lime |
| FL/FR | 2- | methoxy-4-vinyl phenol |
| | odor: sweet spicy clove carnation phenolic peppery smoky woody powdery |
| | flavor: spicy powdery clove phenolic woody smoky balsamic amber |
| FL/FR | 4- | methyl guaiacol |
| | odor: spicy clove vanilla phenolic medicinal leathery woody smoky burnt |
| | flavor: spicy clove woody leathery smoky coffee phenolic cocoa burnt |
| FL/FR | alpha- | methyl ionone |
| | odor: sweet powdery fruity floral violet beeswax orris woody |
| | flavor: fruity waxy berry orris floral violet jammy woody |
| FL/FR | 2- | methyl-2-pentenoic acid |
| | odor: dry acid sweaty strawberry woody fruity jam |
| | flavor: Sour, acidic, sweaty, berry- and fruit-like |
| | 4- | methyl-2-(1-propenyl)-1,3-oxathiane |
| | odor: garlic, green, starchy, pepper, balsamic, mossy, woody cabbage, sulfur |
| FR | | musk fragrance |
| FR | | musk specialty |
| | odor: musk |
| FR | | nutmeg fragrance |
| FL/FR | | nutmeg oil |
| | odor: spicy woody nutmeg powdery terpene |
| | flavor: spicy woody terpenic aromatic peppery nut skin resinous anisic |
| FR | | nutmeg oil replacer |
| | odor: spicy aromatic |
| FL/FR | | nutty cyclohexenone |
| | odor: Sweet, nutty, phenolic, walnut, fruity, almond and benzoin |
| | flavor: Nutty, musty, phenolic and woody with grain-like nuances |
| FL/FR | | ocimene quintoxide |
| | odor: sweet citrus herbal green celery spicy minty woody |
| | flavor: Green, woody, terpy, citrus, lime, with a fresh and cooling nuance |
| FR | | octahydro-4,7-methano-1H-indene-5-acetaldehyde + 6-methyl-octahydro-4,7-methano-indene-5-carbaldehyde |
| | odor: floral, muguet, aldehydic, green, freesia, sweet, and slightly woody notes |
| FL/FR | 3- | octanol |
| | odor: Earthy, mushroom, dairy, musty, creamy, waxy with a slight fermented green minty nuance |
| | flavor: Musty, mushroom, earthy, creamy dairy |
| FR | | oregano oil replacer |
| | odor: thyme green herbal spicy camphor phenolic woody |
| FR | | oregano specialty |
| | odor: thyme green herbal spicy camphor phenolic woody |
| FL/FR | | origanum oil |
| | odor: thyme green herbal spicy camphor phenolic woody |
| | flavor: herbal spicy peppery green camphoreous thyme phenolic |
| FR | | petitgrain fragrance |
| FL/FR | | petitgrain oil paraguay |
| | odor: sweet floral neroli herbal terpenic green citrus woody |
| | flavor: herbal floral lavender terpenic green citrus woody |
| FR | | petitgrain specialty |
| | odor: sweet floral neroli herbal terpenic green citrus woody |
| FL/FR | | petitgrain tangerine oil |
| | odor: floral neroli herbal terpenic green citrus woody phenolic |
| | flavor: herbal citrus lavender terpenic green floral mandarin woody |
| FL/FR | 2- | phenyl propyl tetrahydrofuran |
| | odor: fruity green fatty cucumber skin nasturtium galbanum woody nut skin |
| | flavor: fatty fruity green nasturtium privet radish sappy cortex tea |
| FR | | pine bouquet fragrance |
| FR | | pine hexanol |
| | odor: pine camphor minty phenolic patchouli |
| FR | 3- | propyl bicyclo(3.2.1)-6-octen-2-one |
| | odor: strong green, herbaceous, fresh, clean, natural, floral, and woody notes |
| FR | | rhubafuran |
| | odor: green rhubarb grapefruit citrus herbal eucalyptus woody |
| FL/FR | | rice bran absolute |
| | odor: cooked rice hay spicy toasted grain creamy custard nut skin woody powdery |
| | flavor: toasted grain hay nut skin spicy oily custard creamy woody |
| FR | | rosa damascena leaf absolute |
| | odor: green leafy herbal honey waxy rose woody |
| FL/FR | | saffron indenone |
| | odor: herbal leather saffron iodine phenolic tobacco woody |
| | flavor: herbal dry saffron tobacco sage spicy phenolic leathery |
| FR | | sage fragrance |
| FL/FR | | sage oil (salvia lavandulifolia vahl.) spain |
| | odor: herbal eucalyptus camphoreous balsamic rosemary terpenic woody |
| | flavor: herbal lavender eucalyptus camphoreous minty balsamic floral woody |
| FL/FR | | satinaldehyde |
| | odor: fresh cyclamen orange dry sweet aldehydic amber woody costus |
| | flavor: Orangeflower, sweet, floral, melon-like with a green fruity nuance |
| FL/FR | beta- | sinensal |
| | odor: orange sweet fresh waxy juicy |
| FL/FR | | terpinyl formate |
| | odor: floral lavender citrus fruity cypress herbal woody |
| | flavor: dry fruity herbal terpenic spicy woody green |
| FL/FR | | tetrahydrolinalool |
| | odor: floral lily bois de rose woody lilac tea oily |
| | flavor: Clean and fresh, floral, tea-like with citrus and herbal nuances |
| FL/FR | | theaspirane |
| | odor: tea herbal green wet tobacco leaf metallic woody spicy |
| | flavor: Cooling minty, camphoraceous, with an herbal and piney nuance |
| FR | | verdyl acetate |
| | odor: floral green soapy cedar pine woody |
|
| Octonary (Eighth) - woody |
| FR | | acacia fragrance |
| FR | | alpine bouquet fragrance |
| | odor: heavy herbal minty thyme lavender rosemary camphoreous balsamic woody |
| FL/FR | | arachis hypogaea oil CO2 extract |
| | odor: nutty peanut roasted peanut peanut butter caramellic praline nut skin woody |
| | flavor: nutty peanut peanut butter roasted peanut nut skin nut flesh oily caramellic |
| FR | | benzoinett specialty |
| | odor: floral rose tuberose mossy balsamic vanilla oriental woody |
| FR | | blue mist fragrance |
| FR | | bois de rose fragrance |
| FL/FR | | bois de rose oil brazil |
| | odor: sweet floral linalool herbal citrus rose terpenic balsamic waxy woody |
| | flavor: bois de rose |
| FR | | bois de rose oil replacer |
| | odor: sweet floral linalool herbal citrus rose terpenic balsamic waxy woody |
| FR | | cajuput oil replacer |
| | odor: herbal rosemary eucalyptus camphoreous green minty fruity woody |
| FL/FR | | carvacrol |
| | odor: spice woody camphor thymol |
| | flavor: Spicy, herbal, phenolic, medicinal and woody |
| FL/FR | | cinnamon bark absolute |
| | odor: sweet spicy aromatic fruity aldehydic cinnamyl honey resinous woody |
| | flavor: spicy sweet aromatic aldehydic fruity honey woody |
| FL/FR | | cinnamon bark oil ceylon |
| | odor: sweet spicy aromatic fruity aldehydic cinnamyl honey resinous woody |
| | flavor: spicy sweet aromatic aldehydic fruity honey woody |
| FR | | citronella oil java |
| | odor: fresh sweet citrus powdery geraniol weedy green dewy tomato woody |
| | flavor: citrus aldehydic citrus peel floral green terpenic lemon weedy |
| FR | | citronella oil java replacer |
| | odor: fresh sweet citrus powdery geraniol weedy green dewy tomato woody |
| FR | | dianthus ethone |
| | odor: sweet floral spicy carnation clove powdery vanilla custard burnt wood balsamic |
| FL/FR | | dihydroactinidolide |
| | odor: ripe apricot fruity plum berry grape tropical fruit woody |
| | flavor: fruity apricot woody mango cooling berry cherry grape |
| FL/FR | | dimethyl octanol |
| | odor: waxy soapy aldehydic leathery musty citrus green |
| | flavor: Fatty, waxy, soapy with floral rosy and fresh citrus woody nuances |
| FL/FR | | diosphenol |
| | odor: minty buchu leaves black currant bud phenolic cornmint mentholic herbal woody |
| | flavor: minty cornmint buchu black currant bud phenolic mentholic herbal earthy |
| FR | | foliage specialty |
| | odor: green weedy cortex hay leafy grassy earthy woody |
| FR | | galbanum oxyacetate |
| | odor: green herbal galbanum fruity pineapple leafy spicy woody |
| FL/FR | ortho- | guaiacol |
| | odor: phenolic smoke spice vanilla woody |
| | flavor: Woody, phenolic, bacon, savory, smoky and medicinal |
| FR | | hazelnut fragrance |
| FR | | heather fragrance |
| FL/FR | 1- | heptanol |
| | odor: musty leafy violet herbal green sweet woody peony |
| | flavor: Solvent-like, fermented with oily nutty and fatty notes, and a slight green aldehydic under note |
| FR | | herbal fragrance |
| FR | | herbal specialty |
| | odor: herbal |
| FL/FR | | hexanal (aldehyde C-6) |
| | odor: fresh green fatty aldehydic grass leafy fruity sweaty |
| | flavor: Green, woody, vegetative, apple, grassy, citrus and orange with a fresh, lingering aftertaste |
| FR | | jonesia specialty |
| | odor: floral lilac balsamic bois de rose citrus herbal neroli woody |
| FL/FR | | laurus nobilis leaf oil |
| | odor: herbal eucalyptus spicy terpenic camphoreous medicinal aromatic woody |
| | flavor: herbal spicy minty aromatic eucalyptus camphoreous woody pimenta pennyroyal |
| FL/FR | | lavender absolute france |
| | odor: sweet floral herbal spicy camphoreous balsamic hay honey woody mossy |
| | flavor: herbal spicy aromatic mossy camphoreous hay woody amber |
| FR | | lavender absolute replacer |
| | odor: floral herbal aromatic |
| FR | | lavender fragrance |
| FL/FR | | lavender oil |
| | odor: herbal floral spicy aromatic camphoreous balsamic eucalyptus woody |
| | flavor: herbal spicy aromatic camphoreous balsamic soapy grassy woody |
| FL/FR | | lavender oil bulgaria |
| | odor: herbal floral spicy aromatic camphoreous balsamic rosemary woody |
| | flavor: herbal spicy grassy aromatic camphoreous balsamic woody |
| FL/FR | | lavender oil france |
| | odor: herbal floral spicy aromatic camphoreous balsamic eucalyptus woody |
| | flavor: herbal spicy aromatic camphoreous balsamic soapy grassy woody |
| FR | | lavender oil replacer |
| | odor: herbal floral spicy camphoreous balsamic eucalyptus woody |
| FR | | lavender specialty |
| | odor: sweet lavender herbal fresh linalool |
| FR | | leather fragrance |
| FR | russian | leather fragrance |
| FR | | leather specialty |
| | odor: leather |
| FR | russian | leather specialty |
| | odor: cuir leather |
| FL/FR | | linalyl formate |
| | odor: citrus herbal bergamot lavender soapy fatty green woody |
| | flavor: citrus green herbal bergamot lavender nasturtium rooty floral tropical |
| FL | | massoia bark oil |
| | odor: oily creamy waxy buttery lactonic coconut balsamic woody |
| | flavor: herbal celery waxy lactonic coconut buttery creamy woody |
| FL | | massoia bark oil CO2 extract |
| | odor: coconut lactonic sweet creamy fatty coumarin |
| | flavor: coconut creamy sweet lactonic waxy milky |
| FL/FR | | melaleuca leucadendron cajaputi oil |
| | odor: sweet fresh herbal rosemary eucalyptus camphoreous green minty fruity woody |
| | flavor: herbal camphoreous fruity eucalyptus minty rosemary winey woody |
| FL/FR | ortho- | methyl anisole |
| | odor: sweet nutty floral earthy walnut |
| | flavor: Camphoreous, earthy, woody and salicylate with minty, spicy nuances |
| FR | (E)-3- | methyl-5-cyclotetradecen-1-one |
| | odor: musk animal powdery fatty laundered cloth ambergris anisic woody |
| FL | 4- | methyl-2-pentenal |
| | odor: ethereal spicy green grassy aldehydic cooked apple cognac woody |
| | flavor: Green, fruity, apple skin, brandy and cider-like |
| FL/FR | | oakmoss absolute |
| | odor: green woody earthy musty mossy oily wood |
| | flavor: Green, herbal, woody, earthy and tobacco with a slight fishy nuance |
| FR | | osmanthus absolute replacer |
| | odor: sweet fruity plum berry ripe fruit waxy leather honey woody |
| FL/FR | | osmanthus flower absolute |
| | odor: sweet fruity plum berry ripe fruit waxy leather honey woody |
| | flavor: sweet fruity berry jammy waxy herbal earthy orris |
| FR | | osmanthus fragrance |
| FR | | osmanthus specialty |
| | odor: sweet fruity plum berry ripe fruit waxy leather honey woody |
| FL | | peanut oxazole |
| | odor: musty nutty vegetable cocoa nut skin bread crust phenolic woody |
| | flavor: musty nutty vegetable cocoa coffee bready nut skin beany |
| FR | | rain fragrance |
| FR | | windsor soap fragrance |
| FL/FR | | yarrow oil |
| | odor: herbal green tea chamomile rosemary floral creamy fatty woody weedy |
| | flavor: herbal woody tea tobacco hay weedy grassy beeswax |