Fragrance Demo Formulas |
benzyl 3-phenylprop-2-enoate (Click)
IUPAC Name: benzyl 3-phenylprop-2-enoate
Std.InChI: InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2
InChI: InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2
Std.InChIKey: NGHOLYJTSCBCGC-UHFFFAOYSA-N
InChIKey: NGHOLYJTSCBCGC-UHFFFAOYAN
SMILES: C1=CC=C(C=C1)COC(=O)C=CC2=CC=CC=C2
|
CAS Number: | 103-41-3 |
|
Other: | 8014-16-2 |
ECHA EINECS - REACH Pre-Reg: | 203-109-3 |
FDA UNII: | V67O3RO97U |
Beilstein Number: | 2051339 |
MDL: | MFCD00004789 |
CoE Number: | 331 |
XlogP3: | 3.80 (est) |
Molecular Weight: | 238.28598000 |
Formula: | C16 H14 O2 |
NMR Predictor: | Predict (works with chrome or firefox) |
benzyl (E)-3-phenylprop-2-enoate (Click)
IUPAC Name: benzyl (E)-3-phenylprop-2-enoate
Std.InChI: InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+
InChI: InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+
Std.InChIKey: NGHOLYJTSCBCGC-VAWYXSNFSA-N
InChIKey: NGHOLYJTSCBCGC-VAWYXSNFBS
SMILES: C1=CC=C(C=C1)COC(=O)\C=C\C2=CC=CC=C2
|
CAS Number: | 103-41-3 (E) |
|
FDA UNII: | V67O3RO97U |
Nikkaji Web: | J5.016D |
XlogP3: | 3.80 (est) |
Molecular Weight: | 238.28598000 |
Formula: | C16 H14 O2 |
BioActivity Summary: | listing |
NMR Predictor: | Predict (works with chrome or firefox) |
benzyl (Z)-3-phenylprop-2-enoate (Click)
IUPAC Name: benzyl (Z)-3-phenylprop-2-enoate
Std.InChI: InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11-
InChI: InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11-
Std.InChIKey: NGHOLYJTSCBCGC-QXMHVHEDSA-N
InChIKey: NGHOLYJTSCBCGC-QXMHVHEDBT
SMILES: O=C(OCc1ccccc1)/C=C\c2ccccc2
|
CAS Number: | 103-41-3 (Z) |
|
XlogP3: | 3.80 (est) |
Molecular Weight: | 238.28598000 |
Formula: | C16 H14 O2 |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Organoleptic Properties:
Odor Type: | balsamic |
Odor Strength: | low |
| sweet balsamic floral fruity cherry |
Odor Description: at 100.00 %. | sweet balsam floral fruity cherry Luebke, William tgsc, (1983) |
| sweet spicy floral powdery balsamic |
Odor Description:
| Sweet, spicy, floral, with a powdey balsamic nuance Mosciano, Gerard P&F 17, No. 1, 41, (1992) |
| spicy floral fruity balsamic |
Taste Description: at 50.00 ppm. | Spicy, floral, fruity, balsamic Mosciano, Gerard P&F 17, No. 1, 41, (1992) |
Substantivity: | 243 hour(s) at 100.00 % |
| |
Cosmetic Information:
Suppliers:
Alfrebro |
BENZYL CINNAMATE NATURAL
Odor: Sweet, Balsamic |
Apple Flavor & Fragrance |
Benzyl cinnamate
|
Augustus Oils |
Benzyl Cinnamate
|
Services |
Beijing Lys Chemicals |
Benzyl cinnamate
|
BOC Sciences |
For experimental / research use only. |
Benzyl Cinnamate
|
CG Herbals |
Benzyl Cinnamate
|
EMD Millipore |
For experimental / research use only. |
Benzyl Cinnamate
|
Ernesto Ventós |
BENZYL CINNAMATE
Odor: SWEET, BALSAMIC, VERY WEAKLY Flavor: SWEET, FLORAL, COUMARIN, HONEY |
ExtraSynthese |
For experimental / research use only. |
Cinnamic acid benzylester (GC) ≥90%
|
Fleurchem |
benzyl cinnamate natural
|
Indukern F&F |
BENZYL CINNAMATE
Odor: SWEET, FLORAL, BALSAMIC |
CROP CALENDAR |
Inoue Perfumery |
BENZYL CINNAMATE
|
Keva |
BENZYL CINNAMATE
|
Kun Shan P&A |
Benzyl Cinnamate
|
Lluch Essence |
BENZYL CINNAMATE
Odor: BALSAMIC, SWEET, FLORAL |
M&U International |
BENZYL CINNAMATE, Kosher
|
M&U International |
NAT. BENZYL CINNAMATE
|
Moellhausen |
BENZYL CINNAMATE
Odor: balsamic, floreal, spicy Flavor: sweet, honey, coumarin |
Pearlchem Corporation |
Benzyl Cinnamate
|
Penta International |
BENZYL CINNAMATE FCC, Kosher
|
Penta International |
BENZYL CINNAMATE NATURAL, Kosher
|
PerfumersWorld |
Benzyl Cinnamate
Odor: sweet aromatic-spicy-floral balsamic-cinnamic coumarin honey-note Mild sweet-balsamic Use: BLENDS WITH - Balsams Gums |
Prodasynth |
BENZYL CINNAMATE > 98,5
Odor: SWEET, BALSAMIC, VERY WEAKLY Flavor: SWEET, FLORAL, COUMARIN, HONEY |
Reincke & Fichtner |
Benzyl Cinnamate
|
Shanghai Vigen Fine Chemical |
Benzyl Cinnamate
|
Sigma-Aldrich |
Benzyl cinnamate, ≥98%
Odor: apricot; cherry; chocolate; floral; peach; pineapple |
Certified Food Grade Products |
Silverline Chemicals |
Benzyl Cinnamate
|
Sunaux International |
Benzyl Cinnamate
|
Symrise |
Benzyl cinnamate
Odor: very weakly, sweet, balsamic Flavor: sweet, cinnamon, coumarin, balsamic Useful in: brown nuts, brown cocoa, brown others, vanilla, fruity red, fruity yellow, fruity others, sweet others. |
Taytonn |
Benzyl Cinnamate
Odor: Balsamic, Floral, Sweet |
TCI AMERICA |
For experimental / research use only. |
Benzyl Cinnamate >98.0%(GC)
|
The Good Scents Company |
benzyl cinnamate
Odor: sweet balsam floral fruity cherry |
The John D. Walsh Company |
Benzyl Cinnamate
|
The Lermond Company |
Benzyl Cinnamate
|
The Perfumers Apprentice |
Benzyl Cinnamate
Odor: Faintly sweet balsamic, with floral background |
Treatt |
Benzyl Cinnamate
|
Vigon International |
Benzyl Cinnamate Natural
|
Vigon International |
Benzyl Cinnamate
Odor: Very weakly, sweet, balsamic |
WEN International |
BENZYL CINNAMATE Natural
|
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xi N - Irritant, Dangerous for the environment. |
R 36/38 - Irritating to skin and eyes. R 43 - May cause sensitisation by skin contact. R 51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
Acute toxicity, Oral (Category 4), H302
|
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Signal word | Warning |
Hazard statement(s) |
H302 - Harmful if swallowed
|
Precautionary statement(s) |
P264 - Wash skin thouroughly after handling. P270 - Do not eat, drink or smoke when using this product. P301 + P312 - IF SWALLOWED: call a POISON CENTER or doctor/physician IF you feel unwell. P330 - Rinse mouth. P501 - Dispose of contents/ container to an approved waste disposal plant.
|
Human Experience: |
8 % solution: no irritation or sensitization. |
Oral/Parenteral Toxicity: |
gavage-rat LD50 [sex: M,F] 3280 mg/kg Confidence limits of 2620-4100 mg/kg bw, 4 doses (2000-5000 mg/kg bw) were given to groups of 5 M and 5 F. (Wolven & Levenstein, 1972)
oral-rat LD50 5530 mg/kg Jenner et al. (1964)
oral-guinea pig LD50 3760 mg/kg BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)
GASTROINTESTINAL: GASTRITIS Food and Cosmetics Toxicology. Vol. 2, Pg. 327, 1964.
oral-rat LD50 5530 mg/kg BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)
BEHAVIORAL: COMA Food and Cosmetics Toxicology. Vol. 2, Pg. 327, 1964.
|
Dermal Toxicity: |
skin-rabbit LD50 > 3000 mg/kg Food and Cosmetics Toxicology. Vol. 2, Pg. 327, 1964.
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
IFRA Critical Effect: | Sensitization |
IFRA: | View Standard |
Fragrance usage is IFRA RESTRICTED. View Standard for complete information. |
Please review all IFRA documents for complete information. |
IFRA categories: limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) |
Category 1: See Note (1) | 0.10 % (1) |
Category 2: | 0.20 % |
Category 3: | 0.70 % |
Category 4: | 2.10 % |
Category 5: | 1.10 % |
Category 6: See Note (1) | 3.40 % (1) |
Category 7: | 0.40 % |
Category 8: | 2.00 % |
Category 9: | 5.00 % |
Category 10: | 2.50 % |
Category 11: | See Note (2) |
| Notes: |
| (1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). |
| (2) Category 11 includes all non-skin contact or incidental skin contact products. Due to the negligible skin contact from these types of products there is no justification for a restriction of the concentration of this fragrance ingredient in the finished product. |
use level in formulae for use in cosmetics: | | 0.0854 %
|
Dermal Systemic Exposure in Cosmetic Products: | | 0.0022 mg/kg/day (IFRA, 2001)
|
|
Maximised Survey-derived Daily Intakes (MSDI-EU): | 38.00 (μg/capita/day) |
Maximised Survey-derived Daily Intakes (MSDI-USA): | 69.00 (μg/capita/day) |
Structure Class: | I |
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | - | 6.60000 |
beverages(nonalcoholic): | - | 1.40000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 5.30000 | 120.00000 |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | 2.50000 |
fruit ices: | - | 2.50000 |
gelatins / puddings: | 3.00000 | 5.00000 |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | 6.70000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | 5.00000 |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
Flavor & Extract Manufacturers Association (FEMA) reference(s): |
The FEMA GRAS assessment of cinnamyl derivatives used as flavor ingredients.View pdf |
European Food Safety Athority(efsa): | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
European Food Safety Authority (EFSA) reference(s): |
Opinion of the Scientific Panel on food additives, flavourings, processing aids and materials in contact with food (AFC) related to Flavouring Group Evaluation 15 (FGE.15): Aryl-substituted saturated and unsaturated primary alcohol/aldehyde/acid/ester derivatives from chemical group 22 (Commission Regulation (EC) No 1565/2000 of 18 July 2000) View page or View pdf |
Flavouring Group Evaluation 55 (FGE.55): Consideration of phenyl-substituted aliphatic alcohols and related aldehydes and esters evaluated by JECFA (63rd meeting) structurally related to phenethyl alcohol, aldehyde, esters and related phenylacetic acid esters evaluated by EFSA in FGE.14 (2005) and aryl-substituted saturated and unsaturated primary alcohol/aldehyde/acid/ester derivatives evaluated by EFSA in FGE.15 (2005) (Commission Regulation (EC) No 1565/2000 of 18 July 2000) - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in contact with Food (AFC) View page or View pdf |
Flavouring Group Evaluation 15, Revision 1 (FGE.15Rev1) - Aryl-substituted saturated and unsaturated primary alcohol/aldehyde/acid/ester derivatives from chemical group 22 - Opinion of the Scientific Panel on Food Additives, Flavourings, Processing Aids and Materials in contact with Food (AFC) View page or View pdf |
Scientific Opinion on Flavouring Group Evaluation 68 (FGE.68): Consideration of cinnamyl alcohol and related flavouring agents evaluated by JECFA (55th meeting) evaluated by EFSA in FGE.15Rev1 (2008) View page or View pdf |
EPI System: | View |
NLM Hazardous Substances Data Bank: | Search |
Env. Mutagen Info. Center: | Search |
EPA Substance Registry Services (TSCA): | 103-41-3 |
EPA ACToR: | Toxicology Data |
EPA Substance Registry Services (SRS): | Registry |
Laboratory Chemical Safety Summary : | 7652 |
National Institute of Allergy and Infectious Diseases: | Data |
SCCNFP: | opinion |
WISER: | UN 3077 |
WGK Germany: | 2 |
| benzyl 3-phenylprop-2-enoate |
Chemidplus: | 0000103413 |
RTECS: | GD8400000 for cas# 103-41-3 |
| benzyl (E)-3-phenylprop-2-enoate |
| benzyl (Z)-3-phenylprop-2-enoate |
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
alpha- | acorenol | |
|
(E)- | sabinene hydrate | FL/FR |
acidic |
| cyclohexyl acetic acid | FL/FR |
amber |
| amber powdery floral fragrance | FR |
animal |
| civet absolute | FL/FR |
| costus valerolactone | FR |
anisic |
ortho- | acetanisole | FL/FR |
para- | acetanisole | FL/FR |
| ambrette seed oil | FL/FR |
para- | anisaldehyde | FL/FR |
ortho- | anisaldehyde | FL/FR |
para- | anisyl phenyl acetate | FL/FR |
balsamic |
iso | amyl benzoate | FL/FR |
| amyris wood oil | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzophenone | FL/FR |
| benzyl benzoate | FL/FR |
alpha- | bisabolene | FL/FR |
iso | butyl benzoate | FL/FR |
iso | butyl cinnamate | FL/FR |
(E)- | cinnamyl alcohol | FL/FR |
| cinnamyl alcohol | FL/FR |
(E)- | cinnamyl butyrate | FL/FR |
| cinnamyl formate | FL/FR |
| ethyl cinnamate | FL/FR |
| fir balsam absolute | FR |
| guaiacyl phenyl acetate | FL/FR |
| methyl (E)-cinnamate | FL/FR |
| methyl cinnamate | FL/FR |
alpha- | methyl cinnamyl alcohol | FR |
| myrrh resinoid | FR |
| peru balsam oil | FL/FR |
2- | phenoxyethyl formate | FR |
3- | phenyl propyl acetate | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| pine needle absolute | FL/FR |
| prenyl benzoate | FL/FR |
iso | propyl cinnamate | FL/FR |
| terpinyl butyrate | FL/FR |
berry |
| raspberry ketone | FL/FR |
| raspberry ketone methyl ether | FL/FR |
buttery |
| acetoin | FL/FR |
camphoreous |
| butyrophenone | FL/FR |
chocolate |
iso | amyl phenyl acetate | FL/FR |
| cocoa oleoresin | FL/FR |
| cocoa pentenal | FL/FR |
citrus |
| lemongrass oil | FL/FR |
coumarinic |
| phthalide | FL/FR |
creamy |
para- | vanillic acid | FL/FR |
ethereal |
| cyclohexyl formate | FL/FR |
floral |
alpha- | amyl cinnamaldehyde | FL/FR |
alpha- | amyl cinnamyl acetate | FL/FR |
iso | amyl salicylate | FL/FR |
para- | anisaldehyde / methyl anthranilate schiff's base | FR |
| anisyl propanal / methyl anthranilate schiff's base | FR |
| azalea fragrance | FR |
| benzyl acetate | FL/FR |
| benzyl alcohol | FL/FR |
| benzyl isobutyrate | FL/FR |
| bois de rose oil brazil | FL/FR |
iso | butyl salicylate | FL/FR |
| cananga oil | FL/FR |
| cananga oil china | FL/FR |
| cardamom absolute | FL/FR |
| carnation concrete | FR |
| cestrum nocturnum flower oil | FR |
| citronellyl acetate | FL/FR |
| citronellyl acetone | FL/FR |
| citronellyl anthranilate | FL/FR |
| coffee flower absolute | FR |
| coriander seed oil | FL/FR |
| cyclamen aldehyde | FL/FR |
| cyclohexyl salicylate | FR |
| daffodil fragrance | FR |
| dihydrogeranyl linalool | FR |
| dimethyl alpha-ionone | FR |
| dimethyl anthranilate | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
iso | eugenyl ethyl acetal | FR |
| floral pyranol | FR |
| floral undecenone | FR |
| gardenia oxide | FR |
| geraniol | FL/FR |
| geranium oil bourbon | FL/FR |
(E)- | geranyl acetone | FL/FR |
| geranyl phenyl acetate | FL/FR |
| ginger lily fragrance | FR |
| hawthorn specialty | FR |
| heliotropin | FL/FR |
| heliotropyl acetone | FL/FR |
beta- | ionol | FL/FR |
(E)-beta- | ionone | FL/FR |
alpha- | irone | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
| jonquil absolute replacer | FR |
| lavender oil | FL/FR |
ortho- | methoxybenzyl ethyl ether | FR |
ortho- | methyl acetophenone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
beta-iso | methyl ionone | FL/FR |
alpha-iso | methyl ionone (50% min.) | FL/FR |
alpha-iso | methyl ionone (70% min.) | FL/FR |
alpha-iso | methyl ionone (80% min.) | FL/FR |
alpha-iso | methyl ionone (90% min.) | FL/FR |
| methyl ionyl acetate | FL/FR |
| methyl jasmonate | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
| mimosa absolute replacer | FR |
| nerol | FL/FR |
| nerolidol | FL/FR |
(E)- | nerolidol | FL/FR |
| neryl isovalerate | FL/FR |
| ocean propanal | FL/FR |
bitter | orangeflower absolute morocco | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| osmanthus concrete | FL/FR |
| papaya isobutyrate | FL/FR |
2- | pentadecanone | FL/FR |
| petitgrain mandarin oil terpeneless | FL/FR |
| phenethyl butyrate | FL/FR |
| phenethyl hexanoate | FL/FR |
| phenethyl isobutyrate | FL/FR |
| phenethyl phenyl acetate | FL/FR |
1- | phenyl propyl alcohol | FL/FR |
3- | phenyl propyl propionate | FL/FR |
4- | phenyl-3-buten-2-ol | FL/FR |
| phytol | FL/FR |
(Z,E)- | phytol | FL/FR |
iso | propyl phenyl acetate | FL/FR |
| rhodinol | FL/FR |
| rhodinyl acetate | FL/FR |
| rhodinyl phenyl acetate | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose butanoate | FL/FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) bulgaria | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| rose oil replacer | FR |
para- | tolualdehyde propylene glycol acetal | FL/FR |
(E)-2,5,9- | trimethyl-4,9-decadien-1-al | FR |
| tuberose absolute (from pommade) | FL/FR |
| tuberose absolute chassis | FL/FR |
| tuberose absolute replacer | FR |
| ylang ylang flower absolute | FL/FR |
| ylang ylang flower oil | FL/FR |
fruity |
| acetyl methyl anthranilate | FL/FR |
| allyl (E)-cinnamate | FL/FR |
| allyl 2-ethyl butyrate | FL/FR |
| allyl benzoate | FR |
| allyl cinnamate | FL/FR |
| allyl isovalerate | FL/FR |
| almond fragrance | FR |
bitter | almond oil | FL/FR |
| almond specialty | FR |
iso | amyl 2-methyl butyrate | FL/FR |
| amyl butyrate | FL/FR |
para- | anisyl propionate | FL/FR |
| balsam specialty | FR |
| benzaldehyde | FL/FR |
| benzaldehyde / methyl anthranilate schiff's base | FR |
| benzaldehyde glycrol acetal | FL/FR |
| benzyl isovalerate | FL/FR |
| benzyl propionate | FL/FR |
| bisabolene | FL/FR |
| bread thiophene | FL/FR |
| cherry oxyacetate | FL/FR |
| cherry pentenoate | FL/FR |
| cherry propanol | FL/FR |
(E)- | cinnamyl propionate | FL/FR |
| cyclohexyl cinnamate | FL/FR |
| cyclohexyl crotonate | FR |
gamma- | decalactone | FL/FR |
4- | ethyl benzaldehyde | FL/FR |
| ethyl benzoyl acetate | FL/FR |
| ethyl methyl-para-tolyl glycidate | FL/FR |
| green acetate | FR |
| heptyl isobutyrate | FL/FR |
| linalyl isobutyrate | FL/FR |
| marigold absolute (tagetes glandulifera) | FR |
3- | methyl-2-butenal | FL/FR |
| neryl propionate | FL/FR |
| osmanthus flower absolute | FL/FR |
| peach pivalate | FR |
3- | phenyl propyl isobutyrate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
meta- | tolualdehyde | FL/FR |
para- | tolualdehyde | FL/FR |
| tolualdehyde glyceryl acetal | FL/FR |
| tolualdehydes (mixed o,m,p) | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| vanilla carboxylate | FL/FR |
green |
| acetaldehyde ethyl phenethyl acetal | FL/FR |
alpha- | allyl-4,6-dimethyl-3-cyclohexene-1-methanyl acetate | |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| leafy acetal | FL/FR |
| marigold pot absolute | FL/FR |
| marigold pot flower | CS |
para- | methyl hydratropaldehyde | FL/FR |
| neryl butyrate | FL/FR |
(Z)-2- | penten-1-ol | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| picea glauca leaf absolute | FR |
| valerian rhizome oil CO2 extract china | FL/FR |
| violet leaf absolute | FL/FR |
herbal |
| agate fragrance | FR |
| anthemis nobilis flower oil roman | FL/FR |
| canarium luzonicum gum | FL/FR |
| clary sage absolute | FL/FR |
| coriander seed absolute | FL/FR |
american | elder flower absolute | FR |
| elemi resinoid | FL/FR |
| hop oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
(1S,5R)- | myrtenyl acetate | FL/FR |
laevo- | perillaldehyde | FL/FR |
| rose oil (rosa centifolia) morocco | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
alpha- | terpinyl acetate | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
melon |
| watermelon ketone | FR |
minty |
| ethyl salicylate | FL/FR |
| methyl 5-methyl salicylate | FR |
mossy |
| veramoss (IFF) | FR |
musk |
| cyclohexadecanone | FR |
| ethylene brassylate | FL/FR |
| exaltone (Firmenich) | FR |
dextro,laevo- | muscone | FL/FR |
| musk amberol | FR |
| musk dec-7(8)-enone | FR |
| musk indane | FR |
| musk indanone | FR |
| musk tetralin | FR |
omega- | pentadecalactone | FL/FR |
6,7,8,9- | tetrahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline | FR |
musty |
| cocoa butenal | FL/FR |
naphthyl |
2,4- | dimethyl benzaldehyde | FL/FR |
para- | methyl anisole | FL/FR |
beta- | naphthyl ethyl ether | FL/FR |
nutty |
| nutty cyclohexenone | FL/FR |
2,3,5- | trimethyl pyrazine | FL/FR |
phenolic |
2'- | hydroxyacetophenone | FL/FR |
powdery |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
alpha- | methyl ionone | FL/FR |
spicy |
| acacia fragrance | FR |
homo | anisaldehyde | FL/FR |
| cananga leaf oil | FR |
| carnation absolute replacer | FR |
| cassia bark oil china | FL/FR |
| cinnamaldehyde / methyl anthranilate schiff's base | FR |
| cinnamyl acetate | FL/FR |
(E)- | cinnamyl acetate | FL/FR |
(Z)- | cinnamyl acetate | FL/FR |
| cinnamyl isovalerate | FL/FR |
| cinnamyl propionate | FL/FR |
iso | eugenyl acetate | FL/FR |
| floral spice fragrance | FR |
star | jasmine specialty | FL/FR |
| mace oleoresin | FL/FR |
| maja fragrance | FR |
para- | methoxy-alpha-methyl cinnamaldehyde | FL/FR |
para- | methoxycinnamaldehyde | FL/FR |
(E)-para- | methoxycinnamaldehyde | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| spicy acetoacetate | FL/FR |
sweet |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
tobacco |
| honey absolute | FL/FR |
| methyl benzoxole | FL/FR |
tonka |
| mint lactone | FL/FR |
vanilla |
| ethyl vanillin | FL/FR |
| heliotropyl alcohol | FL/FR |
| vanilla specialty | FR |
| vanillyl acetate | FL/FR |
| vanillylidene acetone | FL/FR |
waxy |
| phytyl acetate | FL/FR |
woody |
| agarwood oil | FR |
| amber formate | FR |
| cedarwood oil texas fractions | FR |
| copaiba balsam | FL/FR |
| cycloionone | FL/FR |
| guaiacwood oil | FL/FR |
alpha- | guaiene | FL/FR |
alpha- | gurjunene | FR |
4- | hydroxybenzaldehyde | FL/FR |
| patchouli oil | FL/FR |
| rhubarb oxirane | FR |
| sandal pentenone | FR |
| sandalwood oil | FL/FR |
| sandalwood oil west australia (santalum spicata) | FR |
| santall | FR |
(+)-alpha- | santalyl acetate | FL/FR |
| santalyl butyrate | FL/FR |
| timber propanol | FR |
4,6,11- | trimethyl-5-oxatricyclo(6.2.2.0*4,9*)dodec-6-ene | FR |
| vetiveryl acetate | FL/FR |
| woody epoxide | FR |
|
For Flavor |
|
No flavor group found for these |
| acetyl methyl anthranilate | FL/FR |
alpha- | acorenol | |
| allyl (E)-cinnamate | FL/FR |
| allyl 2-ethyl butyrate | FL/FR |
| allyl cinnamate | FL/FR |
alpha- | allyl-4,6-dimethyl-3-cyclohexene-1-methanyl acetate | |
| ambrette seed oil | FL/FR |
homo | anisaldehyde | FL/FR |
para- | anisyl phenyl acetate | FL/FR |
para- | anisyl propionate | FL/FR |
alpha- | bisabolene | FL/FR |
| butyrophenone | FL/FR |
(Z)- | cinnamyl acetate | FL/FR |
(E)- | cinnamyl acetate | FL/FR |
(E)- | cinnamyl alcohol | FL/FR |
(E)- | cinnamyl butyrate | FL/FR |
(E)- | cinnamyl propionate | FL/FR |
| citronellyl acetone | FL/FR |
| cyclohexyl cinnamate | FL/FR |
| ethyl 2-phenyl-3-furoate | FL |
4- | ethyl benzaldehyde | FL/FR |
5- | ethyl-2-thiophene carboxaldehyde | FL |
alpha- | guaiene | FL/FR |
| heliotropyl alcohol | FL/FR |
2- | heptyl cyclopropane carboxylic acid | FL |
pseudo | ionone | FL |
star | jasmine specialty | FL/FR |
para- | methoxy-alpha-methyl cinnamaldehyde | FL/FR |
(E)-para- | methoxycinnamaldehyde | FL/FR |
| methyl (E)-cinnamate | FL/FR |
ortho- | methyl acetophenone | FL/FR |
| methyl benzoxole | FL/FR |
| methyl furfuracrylate | FL |
beta-iso | methyl ionone | FL/FR |
alpha-iso | methyl ionone (90% min.) | FL/FR |
| osmanthus flower absolute | FL/FR |
3- | phenyl propyl propionate | FL/FR |
| phytol | FL/FR |
(Z,E)- | phytol | FL/FR |
| phytyl acetate | FL/FR |
| pine needle absolute | FL/FR |
| prenyl benzoate | FL/FR |
(E)- | sabinene hydrate | FL/FR |
(+)-alpha- | santalyl acetate | FL/FR |
| santalyl butyrate | FL/FR |
| terpinyl butyrate | FL/FR |
meta- | tolualdehyde | FL/FR |
| tolualdehyde glyceryl acetal | FL/FR |
para- | tolualdehyde propylene glycol acetal | FL/FR |
| vetiveryl acetate | FL/FR |
animal |
| civet absolute | FL/FR |
anisic |
para- | acetanisole | FL/FR |
ortho- | anisaldehyde | FL/FR |
aromatic |
| leafy acetal | FL/FR |
laevo- | perillaldehyde | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl benzoate | FL/FR |
iso | butyl cinnamate | FL/FR |
| ethyl cinnamate | FL/FR |
| peru balsam oil | FL/FR |
3- | phenyl propyl acetate | FL/FR |
1- | phenyl propyl alcohol | FL/FR |
iso | propyl cinnamate | FL/FR |
| vanillylidene acetone | FL/FR |
berry |
| heliotropyl acetone | FL/FR |
| heptyl isobutyrate | FL/FR |
| raspberry ketone | FL/FR |
| raspberry ketone methyl ether | FL/FR |
burnt |
| ethyl 2-furoate | FL |
cherry |
| heliotropin | FL/FR |
para- | methoxycinnamaldehyde | FL/FR |
chocolate |
| cocoa oleoresin | FL/FR |
citrus |
| bisabolene | FL/FR |
| lemongrass oil | FL/FR |
| nerol | FL/FR |
coconut |
6- | methyl coumarin | FL |
cooling |
iso | butyl salicylate | FL/FR |
coumarinic |
| phthalide | FL/FR |
creamy |
| acetoin | FL/FR |
para- | anisaldehyde | FL/FR |
4- | hydroxybenzaldehyde | FL/FR |
| mint lactone | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
para- | vanillic acid | FL/FR |
earthy |
alpha- | amyl cinnamyl acetate | FL/FR |
fatty |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
2- | pentadecanone | FL/FR |
floral |
iso | amyl phenyl acetate | FL/FR |
| bois de rose oil brazil | FL/FR |
| cananga oil | FL/FR |
| cananga oil china | FL/FR |
| cardamom absolute | FL/FR |
| cinnamyl propionate | FL/FR |
| citronellyl acetate | FL/FR |
| cocoa pentenal | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
| geraniol | FL/FR |
| geranium oil bourbon | FL/FR |
(E)- | geranyl acetone | FL/FR |
| geranyl phenyl acetate | FL/FR |
beta- | ionol | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
| linalyl isobutyrate | FL/FR |
| methyl dihydrojasmonate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
alpha-iso | methyl ionone (50% min.) | FL/FR |
alpha-iso | methyl ionone (70% min.) | FL/FR |
alpha-iso | methyl ionone (80% min.) | FL/FR |
| methyl jasmonate | FL/FR |
| ocean propanal | FL/FR |
bitter | orangeflower absolute morocco | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| rhodinol | FL/FR |
| rhodinyl acetate | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) bulgaria | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| tuberose absolute (from pommade) | FL/FR |
| tuberose absolute chassis | FL/FR |
| ylang ylang flower absolute | FL/FR |
| ylang ylang flower oil | FL/FR |
| allyl isovalerate | FL/FR |
bitter | almond oil | FL/FR |
iso | amyl 2-methyl butyrate | FL/FR |
iso | amyl benzoate | FL/FR |
| amyl butyrate | FL/FR |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
| benzaldehyde | FL/FR |
| benzaldehyde glycrol acetal | FL/FR |
| benzyl acetate | FL/FR |
| benzyl alcohol | FL/FR |
| benzyl isobutyrate | FL/FR |
| benzyl isovalerate | FL/FR |
| benzyl propionate | FL/FR |
| bread thiophene | FL/FR |
iso | butyl benzoate | FL/FR |
| cherry oxyacetate | FL/FR |
| cherry pentenoate | FL/FR |
| cherry propanol | FL/FR |
| cinnamyl isovalerate | FL/FR |
| citronellyl anthranilate | FL/FR |
gamma- | decalactone | FL/FR |
| dimethyl anthranilate | FL/FR |
| ethyl benzoyl acetate | FL/FR |
| ethyl methyl-para-tolyl glycidate | FL/FR |
3- | methyl-2-butenal | FL/FR |
| neryl isovalerate | FL/FR |
| osmanthus concrete | FL/FR |
| petitgrain mandarin oil terpeneless | FL/FR |
| phenethyl butyrate | FL/FR |
3- | phenyl propyl isobutyrate | FL/FR |
| rose butanoate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| tolualdehydes (mixed o,m,p) | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
| valerian rhizome oil CO2 extract china | FL/FR |
| vanilla carboxylate | FL/FR |
geranium |
| benzophenone | FL/FR |
green |
| acetaldehyde ethyl phenethyl acetal | FL/FR |
iso | amyl salicylate | FL/FR |
| canarium luzonicum gum | FL/FR |
| cinnamyl alcohol | FL/FR |
| clary sage absolute | FL/FR |
| cocoa butenal | FL/FR |
| cyclamen aldehyde | FL/FR |
| cyclohexyl formate | FL/FR |
| elemi resinoid | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
| marigold pot absolute | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
| nerolidol | FL/FR |
(E)- | nerolidol | FL/FR |
| neryl butyrate | FL/FR |
| neryl propionate | FL/FR |
| papaya isobutyrate | FL/FR |
(Z)-2- | penten-1-ol | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| violet leaf absolute | FL/FR |
herbal |
| anthemis nobilis flower oil roman | FL/FR |
| coriander seed absolute | FL/FR |
| coriander seed oil | FL/FR |
| hop oil | FL/FR |
| lavender absolute bulgaria | FL/FR |
| lavender oil | FL/FR |
| rose oil (rosa centifolia) morocco | FL/FR |
| rosemary absolute | FL/FR |
| rosemary oil morocco | FL/FR |
| rosemary oil spain | FL/FR |
honey |
| honey absolute | FL/FR |
| phenethyl isobutyrate | FL/FR |
| phenethyl phenyl acetate | FL/FR |
iso | propyl phenyl acetate | FL/FR |
meaty |
ortho- | thioguaiacol | FL |
minty |
| ethyl salicylate | FL/FR |
musk |
| ethylene brassylate | FL/FR |
dextro,laevo- | muscone | FL/FR |
musty |
2,3,5- | trimethyl pyrazine | FL/FR |
naphthyl |
2,4- | dimethyl benzaldehyde | FL/FR |
2'- | hydroxyacetophenone | FL/FR |
para- | methyl anisole | FL/FR |
nutty |
2- | acetyl-1-methyl pyrrole | FL |
| nutty cyclohexenone | FL/FR |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
powdery |
ortho- | acetanisole | FL/FR |
beta- | naphthyl ethyl ether | FL/FR |
| powdery ketone | FL |
spicy |
| cassia bark oil china | FL/FR |
| cinnamyl acetate | FL/FR |
| cinnamyl formate | FL/FR |
iso | eugenyl acetate | FL/FR |
| mace oleoresin | FL/FR |
4- | methyl biphenyl | FL |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl cinnamate | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| spicy acetoacetate | FL/FR |
para- | tolualdehyde | FL/FR |
sweet |
| cyclohexyl acetic acid | FL/FR |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
tropical |
alpha- | amyl cinnamaldehyde | FL/FR |
vanilla |
| ethyl vanillin | FL/FR |
omega- | pentadecalactone | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
alpha- | methyl ionone | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
| phenethyl hexanoate | FL/FR |
4- | phenyl-3-buten-2-ol | FL/FR |
| rhodinyl phenyl acetate | FL/FR |
woody |
| amyris wood oil | FL/FR |
| copaiba balsam | FL/FR |
| cycloionone | FL/FR |
| guaiacwood oil | FL/FR |
(E)-beta- | ionone | FL/FR |
alpha- | irone | FL/FR |
| methyl ionyl acetate | FL/FR |
(1S,5R)- | myrtenyl acetate | FL/FR |
| patchouli oil | FL/FR |
| sandalwood oil | FL/FR |
alpha- | terpinyl acetate | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| benzyl 3-phenyl propenoate | | benzyl 3-phenylprop-2-enoate | | benzyl alcohol cinnamate | | benzyl alcohol cinnamic ester | | benzyl alcohol, cinnamate | | benzyl beta-phenyl acrylate | (E)- | benzyl cinnamate | trans- | benzyl cinnamate | | benzyl cinnamate FCC | | benzyl cinnamate natural | | benzyl gamma-phenyl acrylate | | benzyl-3-phenyl propenoate | | cinnamein | (E)- | cinnamic acid benzyl ester | trans- | cinnamic acid benzyl ester | | cinnamic acid, benzyl ester | | phenyl methyl 3-phenyl-2-propenoate | 3- | phenyl-2-propenoic acid phenyl methyl ester | | phenylmethyl 3-phenylprop-2-enoate |
Articles:
|