|
| Primary (First) - camphoreous |
| FR | | achillea tenuifolia lam. flower oil iran |
| FR | | artemisia diffusa krasch. ex poljak oil iran |
| | odor: camphoreous herbal |
| FL/FR | | bornyl isobutyrate |
| | odor: camphor nutty pine needle |
| | | bornyl ethyl ether |
| | odor: camphoreous woody cedarwood eucalyptus blueberry |
| | | bornyl methyl ether |
| | odor: camphoreous herbal rosemary lavender borneol-like carrot parsley earthy |
| | flavor: carrot earthy celery herbal parsley biting fresh woody caraway basil |
| FL/FR | tert- | butanol |
| FL/FR | | butyrophenone |
| | odor: camphor cherry walnut hazelnut |
| FR | | camphene carbinol |
| | odor: camphoreous patchouli woody |
| | | camphenilone |
| FL/FR | alpha- | campholenic alcohol |
| | odor: sweet berry camphor |
| FL/FR | (±)- | camphor |
| | odor: camphoreous |
| | flavor: camphoreous |
| FL/FR | dextro- | camphor |
| | odor: camphor minty phenolic herbal woody |
| | flavor: Medicinal, camphoreous, mentholic and woody |
| FL/FR | laevo- | camphor |
| | odor: camphor |
| FL/FR | | camphor tree bark oil |
| | odor: camphor aromatic cooling minty herbal balsamic pine |
| | flavor: camphoreous cooling balsamic minty |
| FR | | camphor tree leaf oil |
| | odor: camphoreous cooling herbal eucalyptus spicy |
| FR | | cinnamomum camphora wood extract |
| FR | | clary alcohol |
| | odor: camphor citrus spicy |
| FR | | cyclademol |
| | odor: camphoreous minty |
| FL/FR | beta-homo | cyclocitral |
| | odor: camphoreous cooling woody medicinal oily berry orris soapy |
| | flavor: cooling woody terpenic weedy soapy citrus berry orris |
| FL/FR | | cyclohexanol |
| | odor: camphor menthol phenol |
| FL | (S)-8,9- | dehydrotheaspirone |
| | odor: camphor woody |
| | 2,5- | dimethyl-2,5-hexane diol |
| FL | 2,6- | dimethyl-1,5,7-octatrien-3-ol |
| | odor: camphoreous lime |
| FR | (E)-2,6- | dimethyl-1,5,7-octatrien-3-ol |
| | odor: camphoreous lime terpenic |
| FR | 2,6- | dimethyl-3-oxatricyclo(4.2.1.0*2,4*)nonane |
| | odor: camphor, woody, fresh, sweet, minty, and thujone-like notes |
| FL | | epoxyoxophorone |
| | odor: sweet camphor |
| | | eucalyptus phellandra oil |
| | odor: strong sweet camphor fresh cooling |
| FR | | eucalyptus polybractea oil |
| | odor: strong sweet camphor fresh cooling |
| | alpha- | fenchene |
| | odor: camphor |
| FL/FR | | fenchol |
| | odor: camphor borneol pine woody dry sweet lemon |
| | flavor: camphoreous cooling medicinal minty earthy humus |
| FL/FR | dextro- | fenchone |
| | odor: camphor thuja cedarleaf herbal earthy woody |
| | flavor: Cooling, camphoreous, sweet and minty with a musty, earthy nuance |
| FL/FR | laevo- | fenchone |
| | odor: camphor herbal earthy woody |
| | flavor: cooling camphoreous minty medicinal earthy humus |
| | | feverfew leaf oil belgium |
| FL/FR | | galangal root oil |
| | odor: fresh camphor spicy woody laurel leaf cardamom ginger |
| | flavor: galanga |
| FR | | herbal ethanone |
| | odor: camphor herbal minty woody apple |
| FR | | hinoki leaf oil |
| | odor: strong camphor fresh pine green |
| FL/FR | 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| | odor: Camphoreous, piney, earthy, green, cooling and woody |
| | flavor: Camphoreous, woody, green, cooling and minty with a fenchyl and tropical nuance |
| FR | spike | lavender oil replacer |
| | odor: lavender |
| FL/FR | spike | lavender oil spain |
| | odor: camphor eucalyptus fresh herbal lavandin rosemary woody |
| | flavor: spike lavender |
| FL/FR | | melaleuca leucadendron var. cajuputi leaf oil |
| | odor: sweet fresh camphor rosemary eucalyptus herbal green |
| FR | | melaleuca linariifolia oil |
| | odor: camphor eucalyptus terpene |
| FL/FR | 2- | methyl-3-butanone |
| FL/FR | 6- | methyl-2-heptanone |
| | 1,2,3,3,4,5,6,7- | octamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: camphoreous |
| | 1,2,3,3,4,5,6,8- | octamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: camphoreous |
| FR | | picea glauca branch/leaf oil |
| | odor: camphoreous |
| | (+)-iso | pinocamphone |
| | odor: camphoreous borneol spruce needle terpineol like |
| FL/FR | | pinocarveol |
| | odor: Camphoreous, woody pine-like with fresh, cooling minty undernotes |
| | flavor: Camphoreous, woody pine-like with a green thymol borneol nuance |
| | | piper matico leaf oil |
| | odor: camphor peppery minty woody |
| | 5- and 6-iso | propyl-2,3,3-trimethyl bicyclo(2.2.2)octan-2-ol |
| | odor: camphoreous |
| FL/FR | | rosemary oil africa |
| | odor: fresh strong camphoreous woody balsamic herbal minty |
| | flavor: rosemary |
| FL/FR | | rosemary oil egypt |
| | odor: camphoreous rosemary |
| | flavor: rosemary |
| FL/FR | | rosemary oil tunisia |
| | odor: fresh strong camphor woody balsamic herbal minty |
| | flavor: rosemary |
| CS | | sagebrush oil america |
| | odor: powerful camphor stinging lachrymatory |
| FL/FR | | verbenone |
| | odor: camphor menthol celery |
| | | xanthoxylin |
|
| Secondary (Second) - camphoreous |
| FL/FR | dextro- | borneol |
| | odor: pine camphor earthy |
| FL/FR | dextro,laevo-iso | borneol |
| | odor: balsam camphor herbal woody |
| | flavor: camphoreous minty herbal earthy woody |
| FL/FR | laevo- | borneol |
| | odor: pine woody camphor |
| | flavor: earthy minty camphoreous herbal woody musty |
| | dextro- | bornyl acetate |
| | odor: pine needle camphor herbal balsamic |
| FL/FR | iso | bornyl acetate |
| | odor: balsam camphor herbal woody sweet |
| | flavor: Woody, camphoraceous, terpy and piney with a spicy, herbal and slightly citrus nuance |
| FL/FR | iso | bornyl formate |
| | odor: camphor musty medical woody |
| | flavor: Woody, cooling, musty, floral, camphoreous and minty |
| FL/FR | iso | bornyl propionate |
| | odor: pungent pine camphor woody lavender |
| | flavor: fir balsamic herbal sweet camphoreous woody |
| FL/FR | (-)- | bornyl isovalerate |
| | odor: valerian camphor tropical |
| FR | 2-tert- | butyl cyclohexanone |
| | odor: powerful woody camphor orris minty |
| FR | | camphene carbinyl acetate |
| | odor: pine camphoreous patchouli lavender bergamot |
| FR | | cardamom oil replacer |
| | odor: warm spicy camphor medicinal eucalyptus balsam woody |
| FR | | cedarleaf oil terpeneless |
| | odor: cedar woody thujone camphoreous woody |
| FL/FR | | chamomile absolute |
| | odor: herbal camphoreous balsamic woody |
| | flavor: chamomile |
| FR | | chamomile oil morocco |
| | odor: fresh herbal camphoreous sweet cistus balsamic |
| | flavor: chamomile |
| FL/FR | 1,8- | cineole |
| | odor: eucalyptus herbal camphor medicinal |
| | flavor: minty camphoreous cooling eucalyptus medicinal |
| FL/FR | | curcuma amada roxb. rhizome oil CO2 extract |
| | odor: mango resinous camphoreous vanilla ginger tropical |
| | flavor: mango |
| FR | | dimethyl cyclormol (IFF) |
| | odor: camphor earthy patchouli woody herbal |
| FL/FR | | elettaria cardamomum seed oil |
| | odor: warm spicy camphor medicinal eucalyptus balsam woody |
| | flavor: spicy herbal camphoreous medicinal eucalyptus balsamic woody |
| FL/FR | | elettaria cardamomum seed oil guatemala |
| | odor: warm spicy camphor medical eucalyptus balsam woody |
| | flavor: cardamom |
| FL/FR | | eucalyptus globulus oil |
| | odor: herbal eucalyptol camphor |
| | flavor: eucalyptus |
| FR | | eucalyptus radiata leaf/stem oil |
| | odor: herbal eucalyptol camphor rosemary minty tropical terpenic |
| FR | bitter | fennel seed oil spain |
| | odor: sharp peppery camphor spicy sweet |
| | 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
| | odor: woody, camphoreous odor and is quite similar to patchouli alcohol |
| | 1,3,3,4,5,6- | hexamethyl-2-ethyl bicyclo(2.2.2)-5-octen-2-ol |
| | odor: woody, camphoraceous |
| FD | butylated | hydroxytoluene |
| | odor: mild phenolic camphor |
| FL/FR | | hyssopus officinalis extract |
| | odor: herbal camphor |
| | flavor: hyssop |
| FL/FR | | hyssopus officinalis leaf tincture |
| | odor: herbal camphor |
| | flavor: hyssop |
| | | laurel bark oil |
| | odor: fresh strong sweet camphor spicy |
| FL/FR | | laurel berry absolute |
| | odor: spicy camphoreous |
| | | laurel stem oil |
| | odor: fresh strong sweet camphor spicy |
| FL/FR | | laurus nobilis fruit oil |
| | odor: fresh spicy camphor |
| FL/FR | | lavandin absolute |
| | odor: herbal sweet camphoreous lavandin flower |
| | flavor: lavandin |
| FL/FR | | lavandin absolute decolorized |
| | odor: herbal sweet camphoreous lavandin flower |
| FL/FR | | lavandin concrete |
| | odor: herbal camphor woody floral |
| | flavor: lavandin |
| FL/FR | spike | lavender absolute |
| | odor: camphor herbal lavandin rosemary woody |
| | flavor: spike lavender |
| FL/FR | spike | lavender oil |
| | odor: camphor eucalyptus fresh herbal lavandin rosemary woody floral |
| | flavor: Cooling, mentholic, woody, herbal and spicy with a green nuance |
| FR | | leather cyclohexanol |
| | odor: leather red rose green dusty weedy metallic |
| FR | | leucosidea sericea leaf oil |
| | odor: medicinal camphoreous terpenic peppery astringent earthy resinous chamomile |
| | | marjoram absolute spain |
| | odor: sweet spicy camphor |
| FR | | melaleuca quinquenervia water |
| | odor: sweet camphor eucalyptus sickly |
| FR | | melaleuca viridiflora leaf oil |
| | odor: eucalyptus camphoreous medicinal |
| FL/FR | ortho- | methyl anisole |
| | odor: sweet nutty floral earthy walnut |
| | flavor: Camphoreous, earthy, woody and salicylate with minty, spicy nuances |
| FL | 3- | methyl cyclohexanone |
| | odor: minty camphor medicinal |
| FR | | niaouli oil |
| | odor: sweet camphor eucalyptus sickly aromatic |
| FL | (Z,Z)- | photocitral A |
| | odor: minty camphor herbal |
| FR | | pine hexanol |
| | odor: pine camphor minty phenolic patchouli |
| FL/FR | iso | pinocamphone |
| | odor: cedar camphoreous |
| | 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)-5,7-octadien-2-one |
| | odor: minty, camphoraceous, woody aroma with a spicy (peppery) fragrance note |
| | 5- and 6-iso | propyl-1,3,3-trimethyl bicyclo(2.2.2)octan-2-one |
| | odor: minty, camphoraceous |
| FL/FR | | rosemary absolute |
| | odor: fresh strong camphor woody balsam herbal minty |
| | flavor: rosemary |
| FL/FR | | rosemary oil |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FL/FR | | rosemary oil CO2 extract |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FL/FR | | rosemary oil morocco |
| | odor: herbal camphoreous woody balsamic minty medicinal phenolic |
| | flavor: herbal camphoreous minty woody aromatic balsamic phenolic medicinal |
| FR | | rosemary oil replacer |
| | odor: herbal camphoreous woody balsamic minty |
| FL/FR | | rosemary oil spain |
| | odor: herbal camphoreous woody aromatic minty balsamic medicinal phenolic |
| | flavor: herbal camphoreous minty aromatic woody balsamic medicinal phenolic |
| FL/FR | | sage absolute spain |
| | odor: herbal sage camphoreous eucalyptus rosemary |
| | flavor: sage |
| FL/FR | | sage oil (salvia lavandulifolia vahl.) spain |
| | odor: herbal eucalyptus camphoreous balsamic rosemary terpenic woody |
| | flavor: herbal lavender eucalyptus camphoreous minty balsamic floral woody |
| FL/FR | | salvia lavandulifolia herb oil |
| | odor: herbal camphoreous green fir needle pine forest |
| FL/FR | white | sassafras oil |
| | odor: sweet spicy fresh camphor woody floral rootbeer |
| | 1,3,3,5- | tetramethyl-7 and 8-cyanobicyclo(2.2.2)oct-5-ene |
| | odor: woody, camphoraceous, minty, and floral |
| FL/FR | white | thyme oil |
| | odor: thyme herbal camphoreous medicinal phenolic terpenic spicy |
| | flavor: herbal woody camphoreous aromatic green medicinal phenolic spicy |
| FR | white | thyme oil replacer |
| | odor: herbal camphoreous medicinal phenolic terpenic spicy |
| FL | | thyme oleoresin |
| | odor: fresh herbal thyme |
| | flavor: thyme |
| FR | 3,5,5- | trimethyl-2-methylene hexanal |
| | odor: Minty camphoreous |
|
| Tertiary (Third) - camphoreous |
| FR | 1- | allyl-2,2,7,7-tetramethyl cycloheptanol |
| | odor: woody camphor patchouli earthy rooty |
| FR | | armoise oil |
| | odor: fresh cedarleaf minty camphor sage herbal bitter-sweet |
| FR | | artemisia deserti krasch. oil iran |
| | odor: minty herbal camphoreous |
| FL/FR | 3- | benzylidene-2-butanone |
| | odor: fruity berry camphor |
| FL/FR | | bois de rose oil peru |
| | odor: sweet bois de rose woody camphor |
| | flavor: bois de rose |
| FL/FR | dextro,laevo- | borneol |
| | odor: pine woody camphor balsamic |
| FL/FR | iso | bornyl methyl ether |
| | odor: pine woody camphor borneol |
| | | camphene hydrate |
| | odor: menthol musty camphor |
| FR | | cardamom fragrance |
| | odor: herbal spicy camphoreous cardamom |
| FL | | cubeb oleoresin |
| | odor: warm spicy peppery camphor herbal |
| | flavor: cubeb |
| FL/FR | 6,7- | dihydrolinalool |
| | odor: woody citrus camphoreous |
| FR | 1,4- | dimethyl bicyclo(3.2.1)octan-3-dioxolane |
| | odor: fruity, fresh, and camphor notes |
| | | eucalyptus australiana var. "b" oil |
| | odor: fresh peppery camphor |
| FR | | eucalyptus oil replacer |
| | odor: eucalyptus |
| FR | | hedychium spicatum root oil |
| | odor: woody fresh spicy camphor ginger minty eucalyptus |
| FR | | herbal dioxane |
| | odor: fresh green herbal camphor woody |
| | 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol |
| | odor: chocolate, basic woody, camphoraceous aroma |
| FR | | hinoki root oil |
| | odor: dry woody camphor sweet spicy |
| | (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one |
| | odor: woody herbaceous camphor |
| FL/FR | | hyssop oil |
| | odor: herbal clary camphor green pine terpene woody |
| | flavor: Herbal, green, cooling, woody and pine-like |
| FR | | juniper berry oil terpenes |
| | odor: pine citrus camphor woody juniper |
| FR | | lavandin fragrance |
| FL/FR | abrialis | lavandin oil |
| | odor: herbal spicy camphoreous soapy floral balsamic woody algae |
| | flavor: herbal spicy aromatic camphoreous soapy balsamic woody amber |
| FR | | lavandin oil replacer |
| | odor: lavandin |
| FR | | lavandin specialty |
| | odor: lavandin |
| FR | | lavandula stoechas oil |
| | odor: herbal rosemary camphoreous |
| FL/FR | | marjoram oil (thymus mastichina) spain |
| | flavor: marjoram |
| | 6- | methoxy-1,6,7-trimethyl octahydro-4,7-methanoindene + 5-methoxy-2,4,5-trimethyl octahydro-4,7-methanoindene |
| | odor: weak woody, piney, camphoraceous, and clay notes |
| FL/FR | | methyl ethyl ketone |
| | odor: acetone-like ethereal fruity camphor |
| | flavor: Chemical-like and slightly fruity green |
| FL/FR | | murraya koenigii leaf oil india |
| | odor: green spicy camphoreous cedar woody |
| | flavor: curry |
| | | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-ol |
| | odor: weak woody, weak patchouli, and camphoraceous notes |
| | | octahydro-3(or 2),4-dimethyl-4,7-methanoinden-5-one |
| | odor: weak woody, weak earthy, and camphoraceous notes |
| FL/FR | | origanum majorana oil CO2 extract |
| | odor: spicy herbal camphor sweet |
| | flavor: marjoram |
| FR | | orris hexanone |
| | odor: woody dry orris earthy camphor |
| FR | | patchouli alcohol |
| | odor: patchouli earthy camphor powdery |
| FL/FR | | piperitone |
| | odor: herbal minty camphor medicinal |
| | flavor: minty cooling mentholic spicy peppermint peppery |
| FR | (R)-(+)- | pulegone |
| | odor: peppermint camphor fresh herbal buchu |
| | flavor: Minty sulfuraceous, fruity blackcurrant and raspberry, with fresh green leafy nuances |
| FL/FR | iso | pulegyl acetate |
| | odor: woody sweet peppermint tropical |
| | flavor: Woody, berry, green and camphoreous with a fruity nuance |
| FL/FR | | rosemary oleoresin |
| | odor: fresh herbal leafy camphoreous medicinal phenolic rosemary |
| | flavor: rosemary |
| FR | | sandal glycol acetal |
| | odor: woody sandalwood camphor methyl acetophenone sweet |
| FR | | tarchonanthus camphoratus oil |
| | odor: herbal floral camphoreous woody minty spicy medicinal |
| | 1,3,3,5- | tetramethyl-7 and 8-acetyl bicyclo(2.2.2)oct-5-ene |
| | odor: fruity, woody aroma with a camphoraceous fragrance note |
| FL/FR | | thujyl alcohol |
| | odor: spicy minty camphoreous |
| FL/FR | | thyme oil CO2 extract |
| | odor: herbal phenolic camphoreous medicinal |
| | flavor: herbal camphoreous aromatic medicinal phenolic spicy |
| FR | | thymus mastichina flower oil |
| | odor: herbal aromatic camphoreous eucalyptus |
| | 3(or 2),4,5- | trimethyl-3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-5-ol |
| | odor: weak woody, weak earthy, and camphoraceous notes |
| FL/FR | laevo- | verbenone |
| | odor: spicy mint camphor |
| FL/FR | | zedoary bark oil |
| | odor: warm woody spicy camphor cineole sweet |
| | flavor: zedoary |
| FR | | zingiber cassumunar rhizomes oil |
| | odor: spicy rooty camphoraceous |
|
| Quaternary (Fourth) - camphoreous |
| FL/FR | | barosma betulina leaf oil |
| | odor: sulfurous green minty camphoreous black currant bud tropical fruity mango peach skin |
| | flavor: green minty camphoreous phenolic sulfurous black currant bud tropical mango peach |
| FL/FR | | benzoin |
| | odor: balsamic vanilla medicinal camphoreous |
| FR | | cajuput oil replacer |
| | odor: herbal rosemary eucalyptus camphoreous green minty fruity woody |
| FR | | callitris columellaris wood oil australia |
| | odor: fruity balsamic woody camphoreous resinous |
| FL/FR | | camphene |
| | odor: woody herbal fir needle camphor terpenic |
| | flavor: Camphoraceous, cooling, minty, with citrus and green spicy nuances |
| FL/FR | (+)- | camphene |
| | odor: fresh herbal woody fir camphor |
| | flavor: Minty cooling, woody pine and resinous, medicinal Vicks VapoRub, citrus lime-like and eucalyptus |
| FL/FR | | caryophyllene formate |
| | odor: woody spicy peppery camphoreous |
| FR | | cedarleaf oil replacer |
| | odor: cedar woody spicy aromatic camphoreous thujonic herbal green hay |
| FR | | croton catatii leaf oil |
| | odor: herbal green pine camphoreous |
| | 3(or 2),4- | dimethyl-5-vinyl octahydro-4,7-methanoinden-5-ol |
| | odor: weak woody, weak earthy, green, and slightly camphoraceous notes |
| FR | 2,10- | epoxypinane |
| | odor: rosemary sage herbal camphor |
| FL/FR | (-)-alpha- | fenchol |
| | odor: Clean cooling camphoraceous, piney with a woody eucalyptol and slight green herbal minty nuances |
| | flavor: Intense camphoraceous, cooling, piney with an earthy nuance. It has minty-citrus lime and spicy notes |
| FL/FR | | geranic oxide |
| | odor: fresh camphor herbal rosemary |
| | flavor: Sweet, camphoreous, woody, cooling, with floral nuances |
| FR | | herbal undecanol |
| | odor: herbal rosemary mint camphor thujone tropical |
| FL/FR | | lavandin oil |
| | odor: floral herbal lavender camphor soapy |
| | flavor: lavandin |
| FL/FR | | lavender absolute france |
| | odor: sweet floral herbal spicy camphoreous balsamic hay honey woody mossy |
| | flavor: herbal spicy aromatic mossy camphoreous hay woody amber |
| FR | | lavender absolute replacer |
| | odor: floral herbal aromatic |
| FL/FR | | linalool oxide (furanoid) |
| | odor: musty camphor fenchyl alcohol |
| FL/FR | | melaleuca leucadendron cajaputi oil |
| | odor: sweet fresh herbal rosemary eucalyptus camphoreous green minty fruity woody |
| | flavor: herbal camphoreous fruity eucalyptus minty rosemary winey woody |
| | (R)-(+)- | menthofuran |
| | odor: mint leafy herbal camphoreous |
| | (1S,2R,5R)-(+)-iso | menthol |
| | odor: musty sweet herbal earthy camphor hay |
| FL | iso | menthol |
| | odor: mentholic musty woody camphoreous |
| | flavor: cooling |
| FL/FR | (-)- | menthone |
| | odor: deep menthol peppermint herbal camphor |
| | flavor: Cooling, peppermint, fresh green, minty with an herbal nuance |
| FL/FR | (±)-iso | menthone |
| | odor: minty cool peppermint sweet |
| | flavor: Minty, cooling and refreshing mentholic |
| FL/FR | 1- | methyl naphthalene |
| | odor: Naphthyl-like with a chemical medicinal and camphor-like nuance |
| | flavor: Naphthyl-like with a medicinal nuance |
| FL/FR | | myrtle oil morocco |
| | odor: fruity spicy allspice camphor floral herbal |
| FR | | myrtle oil replacer |
| | odor: fresh fruity spicy allspice camphor floral herbal |
| FL/FR | | origanum oil greece |
| | odor: thyme green herbal camphor woody |
| | flavor: origanum |
| FR | | patchouli ethanol |
| | odor: dry sawdust woody patchouli camphor mint |
| FR | cis-2- | pinanol |
| | odor: pine woody fir needle camphor incense |
| FR | | pogostemon cablin leaf oil |
| | odor: woody patchouli |
| FR | | ravensara aromatica leaf oil |
| | odor: herbal spicy terpenic camphoreous medicinal woody |
| FR | | sage fragrance |
| FL/FR | | thuja occidentalis leaf oil |
| | odor: cedar woody spicy aromatic camphoreous thujonic herbal green hay |
| | flavor: woody spicy camphoreous thujonic herbal aromatic old wood |
| FL/FR | | thyme oil (thymus zygis gracillis) spain |
| | odor: thyme herbal camphor |
| | flavor: thyme |
| FL/FR | red | thyme oil india |
| | odor: herbal spicy phenolic camphoreous medicinal aromatic terpenic |
| | flavor: herbal medicinal camphoreous aromatic phenolic spicy soapy |
| FR | red | thyme oil replacer |
| | odor: herbal spicy phenolic camphoreous medicinal aromatic terpenic |
| FL/FR | red | thyme oil spain |
| | odor: herbal spicy phenolic camphoreous medicinal aromatic terpenic |
| | flavor: herbal medicinal camphoreous aromatic phenolic spicy resinous |
| FL/FR | | thymol |
| | odor: herbal thyme phenolic medicinal camphor |
| | flavor: Phenolic, medicinal, woody and spicy |
| FR | 3(or 2),4,5- | trimethyl octahydro-4,7-methanoinden-5-ol |
| | odor: strong patchouli, strong woody, strong earthy, and camphoraceous notes |
|
| Quinary (Fifth) - camphoreous |
| FL/FR | | agathosma crenulata leaf oil |
| | odor: minty green phenolic sulfurous camphoreous black currant bud catty tropical mango peach skin |
| | flavor: green minty camphoreous sulfurous phenolic black currant bud mango tropical peach |
| FL/FR | iso | bornyl isovalerate |
| | odor: woody dry valerian root pine camphoreous oily balsamic forest |
| | flavor: Woody, camphoreous and borneol-like with green nuances |
| | cis-3-tert- | butyl cyclohexyl acetate |
| | odor: woody, iris-like, fresh, flowery, slightly camphor-like |
| FL/FR | | cardamom oleoresin |
| | odor: cardamom medicinal soapy herbal orange rind camphoreous weedy hay |
| | flavor: cardamom herbal spicy balsamic camphoreous floral woody orange rind ginger |
| FL/FR | | carvacrol |
| | odor: spice woody camphor thymol |
| | flavor: Spicy, herbal, phenolic, medicinal and woody |
| FL/FR | | cherry propanol |
| | odor: Sweet, fruity, cherry, coumarin, floral, camphoreous, cooling |
| | flavor: Fruity, cherry, sweet, hay-like with cereal and bread-like nuances |
| FL/FR | 1,4- | cineole |
| | odor: Minty, cooling piney, camphoraceous, eucalyptol-like |
| | flavor: Cooling, minty, menthol-like, green and herbal, with a terpy and camphoraceous nuance |
| FL/FR | | dihydrocarveol |
| | odor: minty menthol spearmint herbal |
| | flavor: Green mint with sweet weedy spicy nuances |
| FL/FR | | dihydrocarvyl acetate |
| | odor: floral rose cuminseed sweet minty |
| | flavor: Floral, vegetative and minty with cooling, rose and bean nuances |
| FL/FR | | dipentene |
| | odor: citrus herbal terpene camphor |
| | flavor: herbal citrus aromatic terpenic pine minty woody tropical |
| | 5- | ethyl-3(or 2),4-dimethyl octahydro-4,7-methanoinden-5-ol |
| | odor: weak earthy, piney, green, resinous, and camphoraceous notes |
| FR | bitter | fennel seed oil CO2 extract |
| | odor: sharp peppery camphor spicy sweet |
| FR | | ginger fragrance |
| FL/FR | | ginger root oil china |
| | odor: spicy ginger citrus woody terpenic camphoreous earthy |
| | flavor: spicy citrus terpenic aldehydic floral aromatic tropical woody |
| FR | | ginger root oil replacer |
| | odor: fresh spice ginger root |
| FR | | ginger specialty |
| | odor: ginger |
| FR | cis- | green acetate |
| | odor: fruity bergamot lime woody camphoreous fir needle spicy marjoram |
| FL/FR | | laurus nobilis leaf oil |
| | odor: herbal eucalyptus spicy terpenic camphoreous medicinal aromatic woody |
| | flavor: herbal spicy minty aromatic eucalyptus camphoreous woody pimenta pennyroyal |
| FL/FR | | lavender absolute bulgaria |
| | odor: sweet floral herbal aromatic spicy camphoreous tropical woody mossy |
| | flavor: herbal floral spicy aromatic mossy camphoreous woody amber |
| FR | | lavender fragrance |
| FL/FR | | lavender oil |
| | odor: herbal floral spicy aromatic camphoreous balsamic eucalyptus woody |
| | flavor: herbal spicy aromatic camphoreous balsamic soapy grassy woody |
| FL/FR | | lavender oil bulgaria |
| | odor: herbal floral spicy aromatic camphoreous balsamic rosemary woody |
| | flavor: herbal spicy grassy aromatic camphoreous balsamic woody |
| FL/FR | | lavender oil france |
| | odor: herbal floral spicy aromatic camphoreous balsamic eucalyptus woody |
| | flavor: herbal spicy aromatic camphoreous balsamic soapy grassy woody |
| FR | | lavender oil replacer |
| | odor: herbal floral spicy camphoreous balsamic eucalyptus woody |
| FR | | lavender specialty |
| | odor: sweet lavender herbal fresh linalool |
| FR | | methyl cyclogeranate (Firmenich) |
| | odor: natural herbal floral fruity woody camphor |
| FL/FR | | myrtenal |
| | odor: sweet cinnamon tonka spicy terpene camphor jam |
| | flavor: Minty, green and cooling with powdery spicy notes |
| FL | (1R)-(-)- | myrtenal |
| | odor: sweet cinnamon tonka spicy terpene camphor jam |
| | flavor: minty green camphor pine spicy balsamic mossy woody |
| FL/FR | | myrtle oil |
| | odor: fresh fruity spicy allspice camphoreous floral herbal |
| | flavor: spicy terpenic camphoreous citrus peel eucalyptus medicinal |
| FR | | oregano oil replacer |
| | odor: thyme green herbal spicy camphor phenolic woody |
| FR | | oregano specialty |
| | odor: thyme green herbal spicy camphor phenolic woody |
| FL/FR | | origanum oil |
| | odor: thyme green herbal spicy camphor phenolic woody |
| | flavor: herbal spicy peppery green camphoreous thyme phenolic |
| FR | | patchouli hexanol |
| | odor: woody musty patchouli camphor mint leather |
| FL/FR | | peppermint cyclohexanone |
| | odor: fresh mint peppermint woody camphor |
| | flavor: Cooling, peppermint and spearmint-like |
| FL | iso | phorone |
| | odor: Cooling, woody, sweet, green, camphoreous, fruity and musty |
| | flavor: Sweet, green, waxy, woody, cooling pulpy mouthfeel and citrus |
| FL/FR | alpha- | pinene |
| | odor: fresh camphor sweet pine earthy woody |
| | flavor: Intense woody, piney and terpy with camphoraceous and turpentine note. It has herbal, spicy and slightly tropical nuances |
| FL/FR | | rosmarinus officinalis extract |
| | odor: Green, herbal, leafy, spicy and camphoreous with a vegetative nuance |
| | flavor: Herbal, green, fresh, floral and fatty with mate-like nuances |
| FL/FR | | styralyl alcohol |
| | odor: fresh sweet acetophenone gardenia hyacinth |
| | flavor: Chemical, medicinal, with a balsamic vanilla woody nuance |
| FR | | sugandha kokila berry oil |
| | odor: spicy woody resinous herbal camphoreous |
| FR | | zvoulimba leaf oil |
| | odor: peppery terpene dillweed elemi camphor phellandrene |
|
| Senary (Sixth) - camphoreous |
| FR | 3- | allyl oxy-1,4-dimethyl bicyclo(3.2.1)octane |
| | odor: fruity, green, dirty, harsh, metallic, slight woody, camphor, juicy, acetophenone-like, and fenchol-like notes |
| FR | | alpine bouquet fragrance |
| | odor: heavy herbal minty thyme lavender rosemary camphoreous balsamic woody |
| FL/FR | | bornyl valerate |
| | odor: Woody oak and sawdust, berry seedy, spicy with a camphoreous nuance |
| | flavor: Woody, sawdust-like, with dry tobacco and tea nuances |
| FR | | herbal fragrance |
| FR | | herbal specialty |
| | odor: herbal |
| FR | | ho wood oil |
| | odor: sweet linalool woody floral |
| FR | | laurel leaf oil replacer |
| | odor: spicy medicinal woody aromatic terpenic camphoreous eucalyptus cinnamyl |
| FR | sweet | marjoram oil replacer |
| | odor: spicy herbal green minty tropical camphoreous tea |
| FL | para- | menthatriene |
| | odor: Oily, chemical, cooling, woody, pine, camphoreous and thymol-like with an herbal and tropical nuance |
| | flavor: Oily, terpy, camphoreous, cooling, thymol, herbal, woody and pine with a slight citrus nuance |
| FL/FR | para- | methyl anisole |
| | odor: naphthyl cresol ylang powdery nutty |
| | flavor: Naphthyl, phenolic, camphoraceous, cooling and woody |
| FL/FR | | methyl salicylate |
| | odor: wintergreen mint |
| | flavor: Sweet, salicylate and root beer with aromatic and balsamic nuances |
| FL/FR | | origanum majorana oil |
| | odor: spicy herbal green minty tropical camphoreous tea |
| | flavor: Herbal, tea, spice, minty, with a green curry note |
| FL/FR | | patchouli oil |
| | odor: woody old wood dry earthy weedy balsamic spicy minty |
| | flavor: woody earthy weedy balsamic spicy camphoreous |
|
| Septenary (Seventh) - camphoreous |
| FL/FR | | boswellia rivae oil |
| | odor: resinous woody terpenic incense pine spicy camphoreous lemon |
| | flavor: frankincense |
| FL/FR | | cardamom seed oil CO2 extract |
| | odor: spicy aromatic balsamic floral herbal woody camphoreous |
| | flavor: cardamom |
| FL/FR | 2- | ethyl fenchol |
| | odor: earthy ground rooty damp musty camphor |
| | flavor: earthy minty fir needle rooty humus mushroom potato tea |
| FR | | ho leaf oil |
| | odor: sweet floral linalool coriander woody herbal camphoreous |
| | flavor: spicy floral bois de rose coriander camphoreous herbal berry tropical |
| FL/FR | laevo- | menthol |
| | odor: peppermint cooling mentholic minty |
| | flavor: cooling camphoreous minty clean spicy |
| FL/FR | (Z)- | rose oxide |
| | odor: green red rose spicy fresh geranium |
| | flavor: Green, vegetative and herbal with a citrus nuance |
| FL/FR | | sabinene |
| | odor: Woody, spicy, citrus and terpy with green, oily and camphoreous nuances |
| | flavor: Woody, spicy and camphoreous |
|
| Octonary (Eighth) - camphoreous |
| FL/FR | dextro- | dihydrocarvone |
| | odor: warm powerful herbal spearmint |
| | flavor: Green, spicy, minty and woody with a camphoreous nuance |
| FL/FR | beta- | pinene |
| | odor: dry woody resinous pine hay green eucalyptus camphoreous |
| | flavor: pine terpenic woody resinous minty camphoreous balsamic spicy |