| 41820-22-8 | allyl thiopropionate | |
| FEMA: 3329 JECFA: 490 FLAVIS: 12.101 Use(s): flavoring agents | ||
| 41847-86-3 | citronellyl oxyacetaldehyde dimethyl acetal | |
| EC: 255-564-2 Use(s): flavor and fragrance agents | ||
| 41847-88-5 | phenethyl oxyacetaldehyde | |
| EC: 255-565-8 Use(s): fragrance agents | ||
| 41853-05-8 | 4- | hydroxypiperitone |
| Use(s): natural substances and extractives | ||
| 41859-67-0 | bezafibrate | |
| EC: 255-567-9 Use(s): pharmaceuticals / chemical synthisis | ||
| 41873-74-9 | para- | cresyl crotonate |
| Use(s): information only not used for fragrances or flavors | ||
| 41890-92-0 | sandal octanol | |
| EC: 255-574-7 Use(s): fragrance agents | ||
| 41892-32-4 | methyl propanesulfinate | |
| Use(s): information only not used for fragrances or flavors | ||
| 41892-36-8 | decyl methanesulfinate | |
| Use(s): information only not used for fragrances or flavors | ||
| 41903-81-5 | 5- | hexadecanone |
| EC: 255-583-6 Use(s): information only not used for fragrances or flavors | ||
| 41917-45-7 | 5-(3,4- | methylenedioxyphenyl)pentanoic acid |
| Use(s): natural substances and extractives | ||
| 41927-69-9 | myristyl decanoate | |
| EC: 255-588-3 Use(s): natural substances and extractives | ||
| 41927-71-3 | decyl myristate | |
| EC: 255-589-9 Use(s): solvents/deluents for cosmetic and fragrance agents | ||
| 41929-05-9 | zonarene | |
| Use(s): natural substances and extractives | ||
| 41929-21-9 | withaphysacarpin | |
| Use(s): natural substances and extractives | ||
| 41981-67-3 | 2- | ethyl-4-propylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 41981-68-4 | 4- | ethyl-2-propylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 41981-69-5 | 4- | butyl-2-methylthiazole |
| Use(s): natural substances and extractives | ||
| 41981-71-9 | 2,5- | diethyl-4-methyl thiazole |
| FLAVIS: 15.050 Use(s): flavoring agents | ||
| 41981-72-0 | 4,5- | dimethyl-2-propyl thiazole |
| EC: 255-604-9 Use(s): flavoring agents | ||
| 41981-73-1 | 2,5- | dipropylthiazole |
| Use(s): natural substances and extractives | ||
| 41981-74-2 | 2,4- | dipropylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 41981-75-3 | 4- | ethyl-2-methyl-5-propyl thiazole |
| Use(s): natural substances and extractives | ||
| 41981-77-5 | 4- | butyl-2,5-dimethyl thiazole |
| Use(s): natural substances and extractives | ||
| 41983-91-9 | glabranin | |
| Use(s): natural substances and extractives | ||
| 42070-92-8 | (R)- | hawthorn carbinol |
| Use(s): information only not used for fragrances or flavors | ||
| 42072-39-9 | (S)-3- | methyl-1-pentanol |
| Use(s): flavor and fragrance agents | ||
| 42075-42-3 | methyl thioisobutyrate | |
| FEMA: 4586 JECFA: 1937 Use(s): flavoring agents | ||
| 42075-43-4 | S- | methyl pentane thioate |
| Use(s): natural substances and extractives | ||
| 42075-45-6 | S- | tropical 2-thiobutyrate |
| EC: 255-648-9 FEMA: 3708 JECFA: 486 FLAVIS: 12.086 Use(s): flavor and fragrance agents | ||
| 42078-65-9 | phenethyl senecioate | |
| EC: 255-649-4 FEMA: 2869 JECFA: 998 FLAVIS: 09.407 Use(s): flavor and fragrance agents | ||
| 42079-78-7 | 5- | methoxyflavone |
| EC: 255-652-0 Use(s): natural substances and extractives | ||
| 42125-10-0 | (Z)-2- | penten-1-yl acetate |
| EC: 255-666-7 Use(s): natural substances and extractives | ||
| 42125-13-3 | (Z)-2- | penten-1-yl butyrate |
| EC: 255-667-2 Use(s): natural substances and extractives | ||
| 42125-17-7 | (E)-4- | hexen-1-yl acetate |
| FLAVIS: 09.572 Use(s): flavoring agents | ||
| 42125-28-0 | (E)-2- | penten-1-yl acetate |
| EC: 255-668-8 Use(s): information only not used for fragrances or flavors | ||
| 42125-30-4 | (E)-2- | penten-1-yl butyrate |
| EC: 255-669-3 Use(s): information only not used for fragrances or flavors | ||
| 42125-34-8 | (Z)-4- | hexen-1-yl acetate |
| FLAVIS: 09.572 Use(s): flavoring agents | ||
| 42131-28-2 | iso | stearyl lactate |
| EC: 255-674-0 Use(s): emollients, skin conditioning | ||
| 42134-50-9 | 2,3- | epoxyoctanal |
| FEMA: 4657 JECFA: 2147 Use(s): flavoring agents | ||
| 42172-35-0 | 3- | methyl hexadecanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 42175-36-0 | oleyl lactate | |
| Use(s): emollients, emulsifiers | ||
| 42175-41-7 | benzyl decanoate | |
| EC: 255-696-0 FLAVIS: 09.835 Use(s): flavor and fragrance agents | ||
| 42185-47-7 | 2,3,6- | trimethyl cyclohexanone |
| Use(s): information only not used for fragrances or flavors | ||
| 42186-33-4 | methyl 3-oxo-2-propyl cyclopentane acetate | |
| EC: 255-700-0 Use(s): information only not used for fragrances or flavors | ||
| 42220-80-4 | 2,3- | dimethoxy-2'-hydroxychalcone |
| Use(s): information only not used for fragrances or flavors | ||
| 42222-50-4 | neo | pentyl glycol dioleate |
| EC: 255-713-1 Use(s): cosmetic agents | ||
| 42231-40-3 | undecyl octanoate | |
| EC: 255-717-3 Use(s): information only not used for fragrances or flavors | ||
| 42231-48-1 | nonyl decanoate | |
| EC: 255-718-9 Use(s): information only not used for fragrances or flavors | ||
| 42231-50-5 | dodecyl decanoate | |
| EC: 255-719-4 Use(s): fragrance agents | ||
| 42231-74-3 | nonyl laurate | |
| EC: 255-721-5 Use(s): information only not used for fragrances or flavors | ||
| 42231-99-2 | hexyl myristate | |
| EC: 255-722-0 FLAVIS: 09.582 Use(s): flavor and fragrance agents | ||
| 42232-25-7 | hexyl palmitate | |
| EC: 255-723-6 Use(s): information only not used for fragrances or flavors | ||
| 42232-27-9 | decyl palmitate | |
| EC: 255-724-1 Use(s): solvents/deluents for cosmetic and fragrance agents | ||
| 42232-29-1 | lauryl palmitate | |
| EC: 255-725-7 Use(s): antistatic, emollient agents | ||
| 42233-07-8 | lauryl behenate | |
| Use(s): cosmetic agents | ||
| 42233-08-9 | tridecyl behenate | |
| Use(s): emollients | ||
| 42233-11-4 | cetyl behenate | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 42233-14-7 | arachidyl behenate | |
| EC: 255-728-3 Use(s): emollients, viscosity controlling | ||
| 42233-51-2 | myristyl lignocerate | |
| Use(s): cosmetic agents | ||
| 42254-63-7 | heptyl oleate | |
| EC: 255-738-8 Use(s): information only not used for fragrances or flavors | ||
| 42286-84-0 | 5- | methyl coumarin |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 42288-75-5 | cyclohexyl phenyl acetate | |
| EC: 255-751-9 Use(s): fragrance agents | ||
| 42348-12-9 | 3- | ethyl-4-methyl cyclotene |
| EC: 255-767-6 FEMA: 3453 JECFA: 422 FLAVIS: 07.117 Use(s): flavor and fragrance agents | ||
| 42370-06-9 | dimethyl bicyclo-5-hepten-2-yl ethanone | |
| EC: 255-778-6 Use(s): fragrance agents | ||
| 42370-07-0 | herbal ethanone | |
| EC: 255-779-1 Use(s): fragrance agents | ||
| 42385-90-0 | tetraacetoxychalcone | |
| Use(s): cosmetic ingredient for skin protecting | ||
| 42405-01-6 | bis- | HEMA IPDI |
| Use(s): binding, film forming agents | ||
| 42415-80-5 | sodium oleoyl lactylate | |
| EC: 255-814-0 Use(s): emulsifiers, surfactants | ||
| 42436-07-7 | (Z)-3- | hexen-1-yl phenyl acetate |
| EC: 255-826-6 FEMA: 3633 JECFA: 1016 FLAVIS: 09.805 Use(s): flavor and fragrance agents | ||
| 42438-76-6 | nardofuran | |
| Use(s): natural substances and extractives | ||
| 42451-07-0 | 6- | ethyl-3-hydroxy-2-methyl pyridine |
| Use(s): information only not used for fragrances or flavors | ||
| 42463-54-7 | 2- | ethyl-5-methyl oxazole |
| Use(s): natural substances and extractives | ||
| 42474-44-2 | 2,3,5- | trithiahexane |
| FEMA: 4021 JECFA: 1299 FLAVIS: 12.198 Use(s): flavoring agents | ||
| 42492-22-8 | lauroyl arginine | |
| EC: 255-851-2 Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 42495-69-2 | (Z)-beta- | santalol |
| Use(s): natural substances and extractives | ||
| 42504-46-1 | MIPA-dodecylbenzenesulfonate | |
| EC: 255-854-9 Use(s): surfactant | ||
| 42529-06-6 | quercetagetinidin chloride | |
| Use(s): information only not used for fragrances or flavors | ||
| 42553-65-1 | crocetin digentiobiose ester | |
| EC: 255-881-6 Use(s): natural substances and extractives | ||
| 42576-02-3 | bifenox | |
| EC: 255-894-7 Use(s): herbicides / pesticides | ||
| 42594-17-2 | dimethylol tricyclodecane diacrylate | |
| EC: 255-901-3 Use(s): pharmaceuticals / chemical synthisis | ||
| 42598-96-9 | heptyl acetoacetate | |
| EC: 255-906-0 Use(s): information only not used for fragrances or flavors | ||
| 42604-12-6 | ambrene acetal | |
| EC: 255-908-1 Use(s): fragrance agents | ||
| 42612-19-1 | cafamarine | |
| Use(s): natural substances and extractives | ||
| 42612-52-2 | sodium laureth-4 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 42612-52-2 | sodium laureth-2 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 42762-46-9 | (E)-2- | phenyl-2-pentenal |
| Use(s): information only not used for fragrances or flavors | ||
| 42774-15-2 | N,N'-bis(2,2,6,6- | tetramethyl-4-piperidinyl) isophthalamide |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 42822-86-6 | geranium cyclohexane | |
| EC: 255-953-7 Use(s): fragrance agents | ||
| 42822-86-6 | para- | menthane-3,8-diol |
| EC: 255-953-7 FEMA: 4053 JECFA: 1416 FLAVIS: 02.246 Use(s): flavor and fragrance agents | ||
| 42824-62-4 | amber pentadecane | |
| EC: 255-957-9 Use(s): fragrance agents | ||
| 42832-47-3 | 1- | undecen-3-one |
| EC: 255-961-0 Use(s): natural substances and extractives | ||
| 42835-25-6 | flumequine | |
| EC: 255-962-6 Use(s): herbicides / pesticides | ||
| 42848-06-6 | (E)- | methyl 1-propenyl sulfide |
| Use(s): flavoring agents | ||
| 42866-91-1 | para- | cresyl acetaldehyde dimethyl acetal |
| EC: 255-976-2 Use(s): fragrance agents | ||
| 42874-03-3 | oxyfluorfen | |
| EC: 255-983-0 Use(s): herbicides / pesticides | ||
| 42908-61-2 | 3- | propyl furan |
| Use(s): natural substances and extractives | ||
| 42908-62-3 | 3- | methyl-2-pentyl furan |
| Use(s): natural substances and extractives | ||
| 42908-64-5 | 2- | ethyl-5-hexyl thiophene |
| Use(s): natural substances and extractives | ||
| 42919-64-2 | 4- | methyl thiobutyraldehyde |
| EC: 256-001-3 FEMA: 3414 JECFA: 468 FLAVIS: 12.061 Use(s): flavoring agents | ||
| 42966-30-3 | magnesium decanoate | |
| EC: 256-025-4 Use(s): multipurpose additives | ||
| 42968-14-9 | 3- | benzylidene-2-butanone |
| Use(s): flavor and fragrance agents | ||
| 42971-09-5 | vinpocetine | |
| EC: 256-028-0 Use(s): special dietary and nutritional additives | ||
| 42976-87-4 | 4- | octenal |
| Use(s): information only not used for fragrances or flavors | ||
| 42998-51-6 | benzyl ethyl malonate | |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 43039-98-1 | 2- | propionyl thiazole |
| FEMA: 3611 JECFA: 1042 FLAVIS: 15.027 Use(s): flavoring agents | ||
| 43040-01-3 | 3- | methyl-1,2,4-trithiane |
| EC: 256-056-3 FEMA: 3718 JECFA: 574 FLAVIS: 15.036 Use(s): flavoring agents | ||
| 43052-87-5 | alpha- | damascone |
| FEMA: 3659 JECFA: 385 FLAVIS: 07.134 Use(s): flavor and fragrance agents | ||
| 43101-48-0 | diethyl aspartate | |
| EC: 256-095-6 Use(s): antistatic and conditioning agents | ||
| 43108-58-3 | 2- | acetyl-5-ethyl pyrazine |
| FLAVIS: 14.083 Use(s): flavoring agents | ||
| 43112-32-9 | (R)-delta- | hexalactone |
| Use(s): information only not used for fragrances or flavors | ||
| 43119-47-7 | tocopheryl nicotinate | |
| EC: 256-101-7 Use(s): antioxidants, skin conditioning | ||
| 43126-21-2 | theaspirane B | |
| Use(s): natural substances and extractives | ||
| 43126-22-3 | theaspirane A | |
| Use(s): natural substances and extractives | ||
| 43154-85-4 | disodium oleamido MIPA-sulfosuccinate | |
| EC: 267-199-6 Use(s): cosmetic agents | ||
| 43160-78-7 | 4-oxo | decanal |
| Use(s): information only not used for fragrances or flavors | ||
| 43219-68-7 | 4- | acetyl-1,4-dimethyl-1-cyclohexene |
| EC: 256-150-4 FEMA: 3449 JECFA: 402 FLAVIS: 07.116 Use(s): flavoring agents | ||
| 44296-44-8 | 2- | methyl propane thioic S-acid |
| Use(s): information only not used for fragrances or flavors | ||
| 44601-24-3 | 4- | hydroxypentanal |
| Use(s): information only not used for fragrances or flavors | ||
| 44987-75-9 | iso | propyl sorbate |
| EC: 256-175-0 Use(s): antimicrobial agents | ||
| 45019-28-1 | 4- | methyl nonanoic acid |
| EC: 256-180-8 FEMA: 3574 JECFA: 274 FLAVIS: 08.062 Use(s): flavor and fragrance agents | ||
| 45023-83-4 | (S)-3- | hydroxynonanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 45103-58-0 | methoxydiglycol methacrylate | |
| EC: 256-190-2 Use(s): film forming agents | ||
| 45206-91-5 | 7- | hexadecanone |
| EC: 256-205-2 Use(s): information only not used for fragrances or flavors | ||
| 45236-96-2 | allyl myristate | |
| EC: 256-211-5 Use(s): pharmaceuticals / chemical synthisis | ||
| 45245-91-8 | laureth-1 phosphate | |
| Use(s): surfactant | ||
| 45259-30-1 | lauryl aspartic acid | |
| Use(s): cleansing, surfactants | ||
| 45267-19-4 | myristamidopropyl dimethylamine | |
| EC: 256-214-1 Use(s): cosmetic agents | ||
| 45298-00-8 | 2- | octyl linoleate |
| EC: 256-225-1 Use(s): information only not used for fragrances or flavors | ||
| 45657-12-3 | 5-(1- | hydroxyethyl)-4-methyl thiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 45731-99-5 | 5,5- | dimethyl-2-cyclohexene-1,4-dione |
| Use(s): natural substances and extractives | ||
| 45768-31-8 | disodium adenosine phosphate | |
| EC: 224-961-2 Use(s): cosmetic ingredient for skin conditioning | ||
| 45803-83-6 | 2- | methyl-4-vinyl phenol |
| Use(s): natural substances and extractives | ||
| 45848-87-1 | 3- | methyl salicylate |
| Use(s): natural substances and extractives | ||
| 46187-37-5 | 2,3,5- | trimethyl-6-isobutyl pyrazine |
| Use(s): flavoring agents | ||
| 46728-75-0 | mono | lithium 5-sulfoisophthalate |
| EC: 256-275-4 Use(s): indirect food additives: adhesives and components of coatings | ||
| 46830-22-2 | ethalkonium chloride acrylate/hema/styrene copolymer | |
| Use(s): opacifying agents | ||
| 47465-97-4 | 3,3-bis(3- | methyl-4-hydroxyphenyl)2-indolinone |
| EC: 256-318-7 Use(s): indirect food additives: adhesives and components of coatings | ||
| 48075-52-1 | lauroyl lactylic acid | |
| Use(s): surfactant | ||
| 49553-64-2 | iso | nonyl anthranilate |
| EC: 256-366-9 Use(s): information only not used for fragrances or flavors | ||
| 49553-76-6 | diglyceryl monooleate | |
| EC: 256-367-4 Use(s): emulsifiers | ||
| 49576-57-0 | (E)-2- | methyl-2-octenal |
| EC: 256-386-8 FEMA: 3711 FLAVIS: 05.126 Use(s): flavoring agents | ||
| 49622-16-4 | 2,5- | dimethyl-2-undecene |
| Use(s): natural substances and extractives | ||
| 49622-18-6 | 3,3,4- | trimethyl decane |
| Use(s): natural substances and extractives | ||
| 49624-66-0 | (S)- | angelicain |
| Use(s): natural substances and extractives | ||
| 49642-51-5 | (S)-2- | methyl hexanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 49719-60-0 | TEA-palmitate | |
| EC: 256-444-2 Use(s): emulsifiers, surfactants | ||
| 49744-73-2 | hydroxy methylphenylpyridinone | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 49763-69-1 | 4- | hexyl benzaldehyde |
| EC: 256-479-3 Use(s): information only not used for fragrances or flavors | ||
| 49773-24-2 | ethyl 2-methyl-2-(methyl thio) propionate | |
| EC: 256-483-5 Use(s): flavoring agents | ||
| 49776-58-1 | 5,6- | dihydro-4-methoxy-6-[2-(4-methoxyphenyl)ethyl]-2H-pyran-2-one |
| Use(s): natural substances and extractives | ||
| 49776-81-0 | 5- | hexenyl isothiocyanate |
| FEMA: 4421 JECFA: 1894 Use(s): flavoring agents | ||
| 49776-82-1 | 6- | heptenyl isothiocyanate |
| Use(s): natural substances and extractives | ||
| 49805-55-2 | 2- | methylbutanal oxime |
| Use(s): natural substances and extractives | ||
| 49831-79-0 | dehydroneryl isovalerate | |
| Use(s): natural substances and extractives | ||
| 50262-49-2 | 4- | formyl phenyl butyrate |
| Use(s): information only not used for fragrances or flavors | ||
| 50277-01-5 | parvisoflavone A | |
| Use(s): natural substances and extractives | ||
| 50277-31-1 | (E,E,Z)-1,3,5,8- | undecatetraene |
| EC: 256-521-0 Use(s): natural substances and extractives | ||
| 50277-34-4 | beta- | calacorene |
| Use(s): natural substances and extractives | ||
| 50281-45-3 | acoragermacrone | |
| Use(s): natural substances and extractives | ||
| 50297-39-7 | 1-(2,4- | dihydroxyphenyl)-3-(3-hydroxy-4-methoxyphenyl)propan-1-one |
| FEMA: 4764 JECFA: 2209 Use(s): flavor enhancers, bitter taste blockers | ||
| 50301-94-5 | 1alpha- | hydroxyarbusculin A |
| Use(s): natural substances and extractives | ||
| 50306-14-4 | (E)-1,5- | octadien-3-ol |
| Use(s): natural substances and extractives | ||
| 50306-18-8 | (Z)-1,5- | octadien-3-ol |
| Use(s): natural substances and extractives | ||
| 50343-36-7 | propylene glycol dihexanoate | |
| FEMA: 4470 JECFA: 1984 Use(s): solvents/deluents for flavor and/or fragrance agents | ||
| 50354-06-8 | 2,3- | dihydro-7-methoxy-2-(3-methoxy-4,5-methylenedioxyphenyl)-3-methyl-5-(1-propenyl)benzofuran |
| Use(s): natural substances and extractives | ||
| 50363-43-4 | 4- | methyl-1,3-dithiolane |
| Use(s): information only not used for fragrances or flavors | ||
| 50373-29-0 | (R)-2- | ethyl-1-hexanol |
| Use(s): information only not used for fragrances or flavors | ||
| 50373-36-9 | geranium cyclohexane | |
| EC: 256-557-7 Use(s): fragrance agents | ||
| 50376-42-6 | noriso | guaiacin |
| Use(s): natural substances and extractives | ||
| 50396-87-7 | (E)-4- | hexen-3-one |
| Use(s): flavoring agents | ||
| 50396-96-8 | (Z)-4- | hexen-3-one |
| Use(s): flavoring agents | ||
| 50405-95-3 | iso | propyl methyl pyranone |
| EC: 256-579-7 Use(s): fragrance agents | ||
| 50423-13-7 | 2- | methyl-5-(8-pentadecenyl)-1,3-benzenediol |
| Use(s): natural substances and extractives | ||
| 50423-14-8 | 2- | methyl-4-((7Z,10E)-pentadeca-7,10-dien-5-yl)benzene-1,3-diol |
| Use(s): natural substances and extractives | ||
| 50439-45-7 | L-trans-5- | hydroxy-2-piperidinecarboxylic acid |
| Use(s): natural substances and extractives | ||
| 50439-47-9 | 5,4'- | dihydroxy-3,6,7,8,3'-pentamethoxyflavone |
| Use(s): natural substances and extractives | ||
| 50448-95-8 | 2- | ethyl hexyl 3-mercaptopropionate |
| EC: 256-589-1 FEMA: 4588 JECFA: 1938 Use(s): flavoring agents | ||
| 50468-22-9 | iso | pentyldiol |
| EC: 256-597-5 Use(s): solvents | ||
| 50480-67-6 | 2- | hydroxy-6-oxo-6-phenyl hexa-2,4-dienoate |
| Use(s): natural substances and extractives | ||
| 50542-90-0 | geranyl cantabiline | |
| EC: 256-621-4 Use(s): fragrance agents | ||
| 50551-88-7 | 5- | methyl-5-hexen-2-ol |
| Use(s): natural substances and extractives | ||
| 50555-04-9 | (E)- | cinnamyl benzoate |
| Use(s): natural substances and extractives | ||
| 50563-36-5 | dimethachlor | |
| EC: 256-625-6 Use(s): herbicides / pesticides | ||
| 50565-25-8 | 4- | methyl dihydrothiophen-3(2H)-one |
| Use(s): information only not used for fragrances or flavors | ||
| 50598-50-0 | 3,5,5- | trimethyl-2(5H)-furanone |
| Use(s): natural substances and extractives | ||
| 50602-21-6 | methacrylic acid-divinylbenzene copolymer | |
| Use(s): carrier of vitamin B12 in foods for special dietary use | ||
| 50607-64-2 | green carboxylate | |
| EC: 256-650-2 Use(s): fragrance agents | ||
| 50622-20-3 | disodium lauroyl glutamate | |
| Use(s): cleansing, hair conditioning, skin conditioning | ||
| 50623-57-9 | butyl nonanoate | |
| EC: 256-661-2 FLAVIS: 09.334 Use(s): flavor and fragrance agents | ||
| 50626-02-3 | ethyl 2-phenyl-3-furoate | |
| EC: 256-663-3 FEMA: 3468 JECFA: 752 FLAVIS: 13.038 Use(s): flavoring agents | ||
| 50632-69-4 | peposterol | |
| Use(s): natural substances and extractives | ||
| 50638-95-4 | phenethyl prenyl ether | |
| EC: 256-673-8 Use(s): fragrance agents | ||
| 50643-20-4 | ceteth-10 phosphate | |
| Use(s): surfactant | ||
| 50643-20-4 | ceteth-20 phosphate | |
| Use(s): surfactant | ||
| 50643-20-4 | ceteth-8 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 50647-08-0 | panax ginseng berry extract | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng callus culture extract | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng flower extract | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng leaf/stem extract | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 50647-08-0 | panax ginseng root | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng root extract | |
| Use(s): cosmetic and flavor agents, dietary supplements | ||
| 50647-08-0 | panax ginseng root powder | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng root water | |
| Use(s): cosmetic and fragrance agents | ||
| 50647-08-0 | panax ginseng seed extract | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng seed powder | |
| Use(s): cosmetic agents | ||
| 50647-08-0 | panax ginseng root tincture | |
| Use(s): flavor and fragrance agents | ||
| 50647-08-0 | panax ginseng bud extract | |
| Use(s): humectants, skin conditioning | ||
| 50647-08-0 | panax ginseng callus extract | |
| Use(s): antioxidants, skin conditioning, skin protecting | ||
| 50647-08-0 | panax ginseng cambium cell culture | |
| Use(s): antimicrobial, antioxidants agents | ||
| 50647-08-0 | panax ginseng cambium cell culture extract | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 50647-08-0 | panax ginseng cambium cell extract | |
| Use(s): antioxidants, skin conditioning | ||
| 50647-08-0 | panax ginseng cell culture extract | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 50647-08-0 | panax ginseng leaf cell extract | |
| Use(s): antioxidants, skin protecting | ||
| 50647-08-0 | panax ginseng seed oil | |
| Use(s): emollients | ||
| 50649-56-4 | pentylphenyl octyloxybenzoate | |
| EC: 256-682-7 Use(s): cosmetic ingredient for skin conditioning | ||
| 50652-76-1 | lauryl p-cresol ketoxime | |
| Use(s): buffering agents | ||
| 50652-80-7 | methyl 3-methylhex-2-enoate | |
| Use(s): fragrance agents | ||
| 50657-19-7 | alpha- | zeacarotene |
| Use(s): natural substances and extractives | ||
| 50657-38-0 | acrylates/peg-4 dimethacrylate crosspolymer | |
| Use(s): film forming agents | ||
| 50717-86-7 | sodium ferrous citrate | |
| Use(s): information only not used for fragrances or flavors | ||
| 50722-38-8 | 3- | acetyl deoxynivalenol |
| Use(s): toxic natural substances | ||
| 50744-86-0 | bis | hydroxyethyl dihydroxypropyl stearammonium chloride |
| Use(s): antistatic agents | ||
| 50746-09-3 | 3- | mercapto-3-methyl-1-butyl acetate |
| FEMA: 4324 JECFA: 1706 Use(s): flavoring agents | ||
| 50746-10-6 | 3- | mercapto-3-methyl butyl formate |
| FEMA: 3855 JECFA: 549 FLAVIS: 12.138 Use(s): flavoring agents | ||
| 50763-67-2 | (S)- | nootkatol |
| Use(s): natural substances and extractives | ||
| 50763-72-9 | (6R,9R)- | vomifoliol |
| Use(s): information only not used for fragrances or flavors | ||
| 50764-55-1 | (1R,5S,7R)- | chrysanthenyl acetate |
| Use(s): natural substances and extractives | ||
| 50767-79-8 | (E,Z)-9,11- | tetradecadien-1-yl acetate |
| EC: 256-752-7 Use(s): natural substances and extractives | ||
| 50789-43-0 | methyl 3-phenoxybenzoate | |
| EC: 256-764-2 Use(s): information only not used for fragrances or flavors | ||
| 50809-53-5 | sorbitan hexanoate | |
| EC: 256-775-2 Use(s): information only not used for fragrances or flavors | ||
| 50813-16-6 | sodium metaphosphate | |
| EC: 256-779-4 Use(s): emulsifiers, sequestrants, texturizers, acidity regulators | ||
| 50816-18-7 | rose petal acetate | |
| EC: 256-784-1 Use(s): fragrance agents | ||
| 50816-24-5 | hastatoside | |
| Use(s): natural substances and extractives | ||
| 50854-94-9 | N- | undecyl benzene sulfonic acid |
| EC: 256-805-4 Use(s): used in washing or to assist in the peeling of fruits and vegetables | ||
| 50858-14-5 | methyl butan-1-ol | |
| EC: 256-810-1 Use(s): information only not used for fragrances or flavors | ||
| 50862-12-9 | heptyl 2-methyl butyrate | |
| EC: 256-811-7 FLAVIS: 09.387 Use(s): flavoring agents | ||
| 50865-01-5 | protoporphyrin disodium | |
| EC: 256-815-9 Use(s): information only not used for fragrances or flavors | ||
| 50887-69-9 | orotic acid monohydrate | |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 50888-62-5 | 3,5- | dimethyl-2-pentyl pyrazine |
| Use(s): natural substances and extractives | ||
| 50888-63-6 | 2- | butyl-3,5-dimethyl pyrazine |
| EC: 256-830-0 Use(s): flavoring agents | ||
| 50894-66-1 | (+)-alpha- | funebrene |
| Use(s): natural substances and extractives | ||
| 50906-68-8 | glyceryl arachidate | |
| Use(s): emollients, emulsifiers | ||
| 50915-66-7 | (E,Z)-2,4- | heptadienoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 50933-33-0 | (Z,Z)/(Z,E)-7-11- | hexadecadien-1-yl acetate |
| EC: 256-857-8 Use(s): natural substances and extractives | ||
| 50957-96-5 | sodium lauryl phosphate | |
| EC: 256-865-1 Use(s): emulsifiers, surfactants | ||
| 50978-31-9 | quaternium-30 | |
| Use(s): antistatic and conditioning agents | ||
| 50980-84-2 | propylene glycol dibutyrate | |
| EC: 256-888-7 FEMA: 4466 JECFA: 1980 Use(s): solvents/deluents for flavor and/or fragrance agents | ||
| 50984-52-6 | anisaldehyde | |
| EC: 256-891-3 Use(s): information only not used for fragrances or flavors | ||
| 51011-05-3 | 6"-O- | malonyl genistin |
| Use(s): natural substances and extractives | ||
| 51013-18-4 | 1- | methyl-2-pyrrolidinone |
| Use(s): solvents | ||
| 51015-28-2 | 3,4- | dihydro-8-methyl naphthalenone |
| EC: 256-912-6 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 51015-29-3 | 3,4- | dihydro-6-methyl naphthalenone |
| EC: 256-913-1 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 51019-43-3 | (R)- | acetyl mandelic acid |
| Use(s): buffering agents | ||
| 51033-31-9 | polyglyceryl-3 laurate | |
| Use(s): emulsifiers | ||
| 51033-35-3 | polyglyceryl-6 caprylate | |
| Use(s): emulsifiers | ||
| 51033-38-6 | polyglyceryl-6 laurate | |
| Use(s): emulsifiers | ||
| 51033-41-1 | polyglyceryl-10 caprylate | |
| Use(s): emulsifiers | ||
| 51059-65-5 | adlumidiceine | |
| Use(s): natural substances and extractives | ||
| 51068-94-1 | betavulgarin | |
| Use(s): natural substances and extractives | ||
| 51100-54-0 | 1- | decen-3-ol |
| EC: 256-967-6 FEMA: 3824 JECFA: 1153 FLAVIS: 02.136 Use(s): flavor and fragrance agents | ||
| 51115-63-0 | 2- | methyl butyl salicylate |
| EC: 256-972-3 FLAVIS: 09.852 Use(s): flavor and fragrance agents | ||
| 51115-64-1 | 2- | methyl butyl butyrate |
| EC: 256-973-9 FLAVIS: 09.659 Use(s): flavor and fragrance agents | ||
| 51115-67-4 | WS-23 | |
| EC: 256-974-4 FEMA: 3804 JECFA: 1595 FLAVIS: 16.053 Use(s): flavor and fragrance agents | ||
| 51115-70-9 | N- | ethyl-2,2-diisopropyl butanamide |
| EC: 256-978-6 FEMA: 4557 JECFA: 2005 Use(s): flavor enhancers | ||
| 51115-77-6 | N-(1,1- | dimethyl-2-hydroxyethyl)-2,2-diethyl butanamide |
| FEMA: 4603 JECFA: 2011 Use(s): flavor enhancers | ||
| 51115-88-9 | octahydrotrimethyl ethanonaphthoxirene | |
| EC: 256-991-7 Use(s): fragrance agents | ||
| 51117-19-2 | neryl 2-methyl butyrate | |
| EC: 256-994-3 Use(s): flavor and fragrance agents | ||
| 51117-36-3 | 2,6- | dimethyl-7-octen-3-one |
| Use(s): natural substances and extractives | ||
| 51122-89-5 | methyl 2-methylene-4-pentenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 51142-51-9 | peg-15 glyceryl ricinoleate | |
| Use(s): emulsifiers | ||
| 51142-51-9 | peg-20 glyceryl ricinoleate | |
| Use(s): emulsifiers, surfactants | ||
| 51148-68-6 | 11- | dodecenal |
| EC: 257-016-8 Use(s): natural substances and extractives | ||
| 51154-54-2 | (S)- | hawthorn carbinol |
| Use(s): information only not used for fragrances or flavors | ||
| 51154-96-2 | (R)- | massoia lactone |
| FEMA: 3744 JECFA: 246 Use(s): flavoring agents | ||
| 51158-08-8 | peg-5 glyceryl stearate | |
| Use(s): emulsifiers, surfactants | ||
| 51158-08-8 | peg-10 glyceryl stearate | |
| Use(s): emulsifiers | ||
| 51158-08-8 | peg-120 glyceryl stearate | |
| Use(s): surfactant | ||
| 51158-08-8 | peg-20 glyceryl stearate | |
| Use(s): emulsifiers | ||
| 51158-08-8 | peg-200 glyceryl stearate | |
| Use(s): surfactant | ||
| 51158-08-8 | peg-25 glyceryl stearate | |
| Use(s): emulsifiers, surfactants | ||
| 51158-08-8 | peg-30 glyceryl stearate | |
| Use(s): emulsifiers, surfactants | ||
| 51158-08-8 | peg-15 glyceryl stearate | |
| Use(s): emulsifiers | ||
| 51174-44-8 | 3- | methyl-4-penten-1-ol |
| Use(s): natural substances and extractives | ||
| 51192-09-7 | peg-15 glyceryl oleate | |
| Use(s): emulsifiers | ||
| 51193-77-2 | (Z)-3- | octen-2-one |
| Use(s): flavor and fragrance agents | ||
| 51193-78-3 | (E)-4- | heptenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 51193-80-7 | 2,4,6- | octatriynoic acid |
| Use(s): natural substances and extractives | ||
| 51196-11-3 | (±)-alpha- | vetispirene |
| Use(s): natural substances and extractives | ||
| 51200-86-3 | 6- | hydroxycarvone |
| FEMA: 4523 JECFA: 2244 Use(s): flavor and fragrance agents | ||
| 51200-87-4 | dimethyl oxazolidine | |
| EC: 257-048-2 Use(s): preservatives | ||
| 51210-01-6 | 2-( | hydroxymethyl) menthol |
| EC: 257-059-2 Use(s): information only not used for fragrances or flavors | ||
| 51227-32-8 | heneicosanol | |
| Use(s): natural substances and extractives | ||
| 51229-78-8 | quaternium-15 | |
| EC: 223-805-0 Use(s): indirect food additives: adhesives and components of coatings | ||
| 51267-48-2 | hydroxymethoxyphenyl propylmethylmethoxybenzofuran | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 51274-00-1 | yellow | iron oxide |
| EC: 257-098-5 Use(s): coloring agents | ||
| 51276-33-6 | 2,6- | dimethyl-1,7-octadiene-3,6-diol |
| Use(s): natural substances and extractives | ||
| 51276-34-7 | (E)-2,6- | dimethyl-3,7-octadiene-2,6-diol |
| Use(s): natural substances and extractives | ||
| 51276-47-2 | glufosinate | |
| EC: 257-102-5 Use(s): herbicides / pesticides | ||
| 51277-96-4 | palmitamidopropyltrimonium chloride | |
| EC: 257-104-6 Use(s): antistatic, hair conditioning | ||
| 51287-18-4 | glycidoxypropyl silanetriol | |
| Use(s): binding agents | ||
| 51288-07-4 | 2,2,4- | trimethyl-1,3-dithiane |
| Use(s): natural substances and extractives | ||
| 51289-08-8 | ethoxyethyl methacrylate | |
| EC: 219-135-3 Use(s): film forming agents | ||
| 51290-65-4 | 4-(para-tert- | butyl phenyl) butan-2-ol |
| EC: 257-114-0 Use(s): information only not used for fragrances or flavors | ||
| 51294-16-7 | per | fluoromethyldecalin |
| Use(s): cosmetic agents | ||
| 51325-37-2 | 2,4,7- | decatrienal |
| FEMA: 4089 JECFA: 1786 FLAVIS: 05.141 Use(s): flavoring agents | ||
| 51325-39-4 | stearamide DEA-distearate | |
| EC: 257-136-0 Use(s): opacifying agents | ||
| 51338-27-3 | dichlorfop-methyl | |
| EC: 257-141-8 Use(s): herbicides / pesticides | ||
| 51352-68-2 | 3- | nonen-4-olide |
| FEMA: 4323 JECFA: 1989 FLAVIS: 10.170 Use(s): flavor and fragrance agents | ||
| 51371-47-2 | globulol | |
| Use(s): natural substances and extractives | ||
| 51372-90-8 | shikimin | |
| Use(s): natural substances and extractives | ||
| 51395-96-1 | mannan | |
| Use(s): film forming agents | ||
| 51410-44-7 | 1'- | hydroxyestragole |
| Use(s): natural substances and extractives | ||
| 51411-24-6 | (±)-2,3- | dihydrofarnesol |
| FEMA: 4031 JECFA: 1830 Use(s): flavor and fragrance agents | ||
| 51414-25-6 | 3,4- | leerall |
| EC: 257-187-9 Use(s): fragrance agents | ||
| 51415-00-0 | batatasin I | |
| Use(s): natural substances and extractives | ||
| 51415-07-7 | momilactone A | |
| Use(s): natural substances and extractives | ||
| 51415-08-8 | momilactone B | |
| Use(s): natural substances and extractives | ||
| 51419-48-8 | hydnocarpin | |
| Use(s): natural substances and extractives | ||
| 51446-62-9 | phosphatidyl serine | |
| Use(s): special dietary and nutritional additives | ||
| 51446-64-1 | (E)- | geranyl citronellol |
| Use(s): natural substances and extractives | ||
| 51447-08-6 | (E,Z)-1,3,5- | undecatriene |
| EC: 257-214-4 Use(s): flavor and fragrance agents | ||
| 51468-85-0 | (Z,E)-4,6,8- | megastigmatriene |
| Use(s): natural substances and extractives | ||
| 51468-86-1 | (E,E)-4,6,8- | megastigmatriene |
| Use(s): natural substances and extractives | ||
| 51473-24-6 | iso | decyl myristate |
| EC: 257-227-5 Use(s): emollients | ||
| 51481-10-8 | deoxynivalenol | |
| Use(s): toxic natural substances | ||
| 51494-28-1 | 3- | nonen-1-ol |
| Use(s): natural substances and extractives | ||
| 51513-58-7 | (E)-3,7,11- | trimethyl-6,10-dodecadienal |
| Use(s): fragrance agents | ||
| 51519-65-4 | 4,4a,6,7,8,8a- | hexahydro-1,4-methanonaphthalen-5(1H)-one |
| EC: 257-251-6 Use(s): fragrance agents | ||
| 51532-26-4 | geranyl octanoate | |
| EC: 257-256-3 Use(s): flavor and fragrance agents | ||
| 51532-27-5 | (E,E)- | farnesyl butyrate |
| Use(s): natural substances and extractives | ||
| 51534-36-2 | 2- | tetradecenal |
| FEMA: 4209 JECFA: 1803 FLAVIS: 05.179 Use(s): flavor and fragrance agents | ||
| 51534-66-8 | methyl 2-(methyl thio) butyrate | |
| EC: 255-649-0 FEMA: 3708 Use(s): flavoring agents | ||
| 51546-63-5 | cardanoldiene | |
| Use(s): natural substances and extractives | ||
| 51556-30-0 | iso | propyl methyl butyrophenone |
| EC: 257-283-0 Use(s): fragrance agents | ||
| 51566-62-2 | citronellyl nitrile | |
| EC: 257-288-8 Use(s): fragrance agents | ||
| 51566-62-2 | citronellyl nitrile | |
| EC: 257-288-8 Use(s): fragrance agents | ||
| 51568-18-4 | succinyl acetone | |
| Use(s): information only not used for fragrances or flavors | ||
| 51568-37-7 | 1H- | pyrrolo[2,1-c][1,4]thiazine |
| Use(s): information only not used for fragrances or flavors | ||
| 51580-86-0 | sodium dichloroisocyanurate dihydrate | |
| Use(s): antimicrobial agent for use in drinking water systems | ||
| 51595-91-6 | alpha-iso | methyl ionol |
| EC: 257-310-6 Use(s): fragrance agents | ||
| 51598-96-0 | 4-( | methyl thio)-3-butenyl isothiocyanate |
| Use(s): natural substances and extractives | ||
| 51599-07-6 | aleuriaxanthin | |
| Use(s): natural substances and extractives | ||
| 51606-33-8 | glycereth-7/IPDI copolymer | |
| Use(s): film forming, viscosity controlling agents | ||
| 51608-18-5 | jasminone | |
| EC: 257-319-5 FEMA: 4284 JECFA: 2049 Use(s): flavor and fragrance agents | ||
| 51647-38-2 | 3- | methyl-1,2,4-trithiolane |
| FLAVIS: 15.083 Use(s): flavoring agents | ||
| 51652-47-2 | (Z)-5- | decen-1-ol |
| Use(s): natural substances and extractives | ||
| 51673-64-4 | methyl 3-oxoisobutyrate | |
| EC: 257-343-6 Use(s): information only not used for fragrances or flavors | ||
| 51677-68-0 | oleyl isovalerate | |
| EC: 257-345-7 Use(s): information only not used for fragrances or flavors | ||
| 51685-39-3 | (±)- | lilac aldehyde |
| FEMA: 4058 JECFA: 1457 Use(s): flavor and fragrance agents | ||
| 51685-40-6 | dextro- | linalyl acetate |
| EC: 257-347-8 Use(s): flavor and fragrance agents | ||
| 51703-97-0 | (R)-2- | methyl hexanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 51755-66-9 | 3-( | methyl thio) hexanol |
| EC: 257-380-8 FEMA: 3438 JECFA: 463 FLAVIS: 12.063 Use(s): flavor and fragrance agents | ||
| 51755-70-5 | (±)-3-( | methyl thio) heptanal |
| FEMA: 4183 JECFA: 1692 FLAVIS: 12.273 Use(s): flavoring agents | ||
| 51755-72-7 | 3- | mercaptohexanal |
| FEMA: 4585 JECFA: 1929 FLAVIS: 12.250 Use(s): flavoring agents | ||
| 51755-83-0 | 3- | thiohexanol |
| FEMA: 3850 JECFA: 545 FLAVIS: 12.217 Use(s): flavor and fragrance agents | ||
| 51755-85-2 | lychee mercaptan acetate | |
| FEMA: 3789 JECFA: 481 FLAVIS: 12.236 Use(s): flavor and fragrance agents | ||
| 51756-08-2 | methyl ethyl acetoacetate | |
| EC: 257-381-3 Use(s): flavor and fragrance agents | ||
| 51761-07-0 | 9H- | carbazole-3-carboxaldehyde |
| Use(s): natural substances and extractives | ||
| 51798-33-5 | poly(oxy(trifluoro(trifluoromethyl)-1,2-ethanediyl)), alpha-(1-carboxy-1,2,2,2-tetrafluoroethyl)-omega-(tetrafluoro(trifluoromethyl)ethoxy)- | |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 51812-80-7 | quaternium-22 | |
| EC: 257-440-3 Use(s): antistatic, film forming agents | ||
| 51819-92-2 | gummosin | |
| Use(s): natural substances and extractives | ||
| 51828-94-5 | calcium 3-methyl-2-oxobutyrate (1:2) | |
| EC: 257-456-0 Use(s): pharmaceuticals / chemical synthisis | ||
| 51828-97-8 | sodium 4-(methyl thio)-2-oxobutanoate | |
| FEMA: 3881 JECFA: 501 Use(s): flavoring agents | ||
| 51847-79-1 | junionone | |
| Use(s): natural substances and extractives | ||
| 51847-92-8 | licoricone | |
| Use(s): natural substances and extractives | ||
| 51851-37-7 | per | fluorooctyl triethoxysilane |
| EC: 257-473-3 Use(s): binding agents | ||
| 51856-79-2 | methyl 1-methyl-2-pyrrole acetate | |
| EC: 257-478-0 Use(s): information only not used for fragrances or flavors | ||
| 51859-60-0 | 2-(2- | furyl) thiazolidine |
| Use(s): information only not used for fragrances or flavors | ||
| 51863-60-6 | 3,5- | dihydroxyacetophenone |
| EC: 257-480-1 Use(s): pharmaceuticals / chemical synthisis | ||
| 51877-53-3 | manganese lactate | |
| EC: 257-492-7 Use(s): special dietary and nutritional additives | ||
| 51911-82-1 | 4,8- | dimethyl-1,3,7-nonatriene |
| EC: 257-509-8 Use(s): natural substances and extractives | ||
| 51931-23-8 | protease from bacillus subtilis | |
| EC: 257-520-8 Use(s): enzyme preparations and microorganisms | ||
| 51933-13-2 | 3,3- | diethoxy-2-butanone |
| FLAVIS: 07.152 Use(s): flavoring agents | ||
| 51937-00-9 | (Z,E)-9,12- | tetradecadien-1-ol |
| EC: 257-527-6 Use(s): natural substances and extractives | ||
| 51938-32-0 | schaftoside | |
| Use(s): natural substances and extractives | ||
| 51938-44-4 | sorbitan sesquistearate | |
| EC: 257-529-7 Use(s): emulsifiers | ||
| 51945-98-3 | 1,5- | heptadiene-3,4-diol |
| Use(s): natural substances and extractives | ||
| 51946-14-6 | sodium caprylyl PG-sulfonate | |
| Use(s): foam boosting, surfactant agents | ||
| 51978-15-5 | HEMA maleate | |
| EC: 257-569-5 Use(s): film forming agents | ||
| 51981-21-6 | tetrasodium glutamate diacetate | |
| EC: 257-573-7 Use(s): chelating agents | ||
| 52006-45-8 | iso | cetyl isostearate |
| EC: 257-598-3 Use(s): emollients, skin conditioning | ||
| 52009-14-0 | calcium pyruvate | |
| EC: 257-599-9 Use(s): dietary supplements | ||
| 52012-29-0 | iso | schaftoside |
| Use(s): natural substances and extractives | ||
| 52019-36-0 | deceth-4 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 52019-78-0 | (S)-(+)-2- | hexanol |
| Use(s): flavoring agents | ||
| 52047-59-3 | 2-(4- | dodecylphenyl)indole |
| EC: 257-624-3 Use(s): indirect food additives: adhesives and components of coatings | ||
| 52061-43-5 | furoeremophilone 1 | |
| Use(s): natural substances and extractives | ||
| 52061-45-7 | 1,10- | epoxygermacrone |
| Use(s): natural substances and extractives | ||
| 52077-55-1 | demethyloleuropein | |
| Use(s): natural substances and extractives | ||
| 52078-42-9 | (Z)-7- | tricosene |
| Use(s): natural substances and extractives | ||
| 52078-48-5 | 9- | tricosene |
| Use(s): natural substances and extractives | ||
| 52078-57-6 | 7- | tricosene |
| Use(s): information only not used for fragrances or flavors | ||
| 52089-54-0 | ethyl 2-hydroxybutanoate | |
| Use(s): natural substances and extractives | ||
| 52089-55-1 | ethyl 2-hydroxyhexanoate | |
| EC: 257-655-2 Use(s): flavor and fragrance agents | ||
| 52101-01-6 | magnesium dextro,leavo-aspartate | |
| EC: 257-662-0 Use(s): special dietary and nutritional additives | ||
| 52108-64-2 | carboxymethyl chitin | |
| Use(s): cosmetic agents | ||
| 52110-55-1 | mucidin | |
| Use(s): natural substances and extractives | ||
| 52117-69-8 | pinobanksin-3-acetate | |
| Use(s): natural substances and extractives | ||
| 52132-48-6 | cetyl betainate chloride | |
| Use(s): cosmetic ingredient for hair conditioning | ||
| 52147-29-2 | 2- | mercaptoethyl linoleate |
| EC: 257-690-3 Use(s): information only not used for fragrances or flavors | ||
| 52187-80-1 | luteolin-7,3'-di-O-gflucoside | |
| EC: 257-724-7 Use(s): natural substances and extractives | ||
| 52191-01-2 | 2',4'- | diethyl acetophenone |
| EC: 257-727-3 Use(s): fragrance agents | ||
| 52195-40-1 | (Z)- | methyl 1-propenyl sulfide |
| Use(s): flavoring agents | ||
| 52199-86-7 | tetrahydrocurcumin diacetate | |
| Use(s): antioxidant, bleaching, skin protecting | ||
| 52210-18-1 | alpha- | ionyl acetate |
| EC: 257-738-3 Use(s): fragrance agents | ||
| 52247-81-1 | (+)-cis-5,6- | dihydro-5-hydroxy-4-methoxy-6-(2-phenylethyl)-2H-pyran-2-one |
| Use(s): natural substances and extractives | ||
| 52255-49-9 | sodium acrylic acid/MA copolymer | |
| Use(s): viscosity controlling agents | ||
| 52286-18-7 | ammonium capryleth sulfate | |
| Use(s): surfactant | ||
| 52286-58-5 | ginsenoside Rf | |
| Use(s): natural substances and extractives | ||
| 52286-59-6 | ginsenoside Re | |
| EC: 257-814-6 Use(s): natural substances and extractives | ||
| 52286-74-5 | ginsenoside Rg2 | |
| Use(s): natural substances and extractives | ||
| 52292-17-8 | iso | steareth-12 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-22 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-50 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-10 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-2 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-20 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-3 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-15 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-16 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-25 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-5 |
| Use(s): emulsifiers, surfactants | ||
| 52292-17-8 | iso | steareth-8 |
| Use(s): emulsifiers, surfactants | ||
| 52304-07-1 | 3- | methyl octadecanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 52304-21-9 | ammonium myristyl sulfate | |
| EC: 257-834-5 Use(s): surfactant | ||
| 52304-36-6 | ethyl butylacetylaminopropionate | |
| EC: 257-835-0 Use(s): surfactant | ||
| 52305-06-3 | (±)- | sphaerosin |
| Use(s): natural substances and extractives | ||
| 52309-78-1 | hovenine A | |
| Use(s): natural substances and extractives | ||
| 52315-75-0 | lauroyl lysine | |
| EC: 257-843-4 Use(s): cosmetic agents | ||
| 52355-31-4 | methyl 6-octadecenoate | |
| Use(s): natural substances and extractives | ||
| 52363-24-3 | 2,2,3- | trimethyl cyclopentane ethanol |
| EC: 257-871-7 Use(s): information only not used for fragrances or flavors | ||
| 52363-43-6 | decyl hexanoate | |
| EC: 257-873-8 Use(s): fragrance agents | ||
| 52363-45-8 | glycerol 1,2-dioctacosanoate | |
| Use(s): natural substances and extractives | ||
| 52380-33-3 | methyl 11-octadecenoate | |
| Use(s): natural substances and extractives | ||
| 52387-14-1 | iso | valeryl shikonin |
| Use(s): natural substances and extractives | ||
| 52392-64-0 | butyl cinnamate | |
| Use(s): flavor and fragrance agents | ||
| 52406-22-1 | dodecyl acetoacetate | |
| EC: 257-896-3 Use(s): information only not used for fragrances or flavors | ||
| 52414-90-1 | 5- | butyl thiazole |
| Use(s): natural substances and extractives | ||
| 52414-91-2 | 4- | ethyl-5-methyl thiazole |
| EC: 257-904-5 FLAVIS: 15.069 Use(s): flavoring agents | ||
| 52435-37-7 | 2- | nonanone oxime |
| Use(s): information only not used for fragrances or flavors | ||
| 52437-39-5 | (+)-alpha- | campholenic alcohol |
| EC: 257-920-2 Use(s): information only not used for fragrances or flavors | ||
| 52438-12-7 | iso | butyryl shikonin |
| Use(s): natural substances and extractives | ||
| 52438-21-8 | (E)-1- | cinnamoylpyrrolidine |
| Use(s): natural substances and extractives | ||
| 52439-69-7 | sucrose tetrastearate triacetate | |
| EC: 257-922-3 Use(s): emollients, emulsifiers | ||
| 52457-54-2 | dipotassium azelate | |
| EC: 257-931-2 Use(s): viscosity controlling agents | ||
| 52467-63-7 | tricetylmonium chloride | |
| Use(s): antistatic, hair conditioning | ||
| 52474-60-9 | myrmac aldehyde | |
| EC: 257-941-7 Use(s): fragrance agents | ||
| 52475-86-2 | myrmac carboxaldehyde | |
| EC: 257-942-2 Use(s): fragrance agents | ||
| 52475-89-5 | 1- | formyl-3-isohexenyl-3-cyclohexene |
| EC: 257-943-8 Use(s): fragrance agents | ||
| 52483-21-3 | irisresorcinol | |
| Use(s): natural substances and extractives | ||
| 52486-39-2 | (R)- | campholenic acetate |
| EC: 257-952-7 Use(s): information only not used for fragrances or flavors | ||
| 52500-92-2 | sodium styrene/MA copolymer | |
| Use(s): emulsion stabilising, skin conditioning | ||
| 52501-07-2 | pei-14 peg-10/ppg-7 copolymer | |
| Use(s): surfactant | ||
| 52513-03-8 | 2- | methyl butyl benzoate |
| EC: 257-982-0 Use(s): flavoring agents | ||
| 52514-66-6 | vanillin hexylene glycol acetal | |
| EC: 257-986-2 Use(s): fragrance agents | ||
| 52514-67-7 | ethyl vanillin hexylene glycol acetal | |
| Use(s): fragrance agents | ||
| 52517-53-0 | 5- | ethyl-6,7-dihydro-5H-cyclopentapyrazine |
| FLAVIS: 14.113 Use(s): flavoring agents | ||
| 52517-54-1 | 5,6,7,8- | tetrahydro-5-methyl quinoxaline |
| FLAVIS: 14.148 Use(s): flavoring agents | ||
| 52517-67-6 | undecanal dimethyl acetal | |
| EC: 257-989-9 Use(s): fragrance agents | ||
| 52517-73-4 | 1,1- | dimethoxypentadecane |
| Use(s): information only not used for fragrances or flavors | ||
| 52525-63-0 | buntansin A | |
| Use(s): natural substances and extractives | ||
| 52557-31-0 | grayanol A | |
| Use(s): natural substances and extractives | ||
| 52557-97-8 | fir carboxylate | |
| EC: 258-005-0 Use(s): fragrance agents | ||
| 52558-73-3 | myristoyl sarcosine | |
| EC: 258-007-1 Use(s): cosmetic agents | ||
| 52558-99-3 | 4- | methyl-3-thiazoline |
| FEMA: 4644 JECFA: 2115 Use(s): flavoring agents | ||
| 52567-43-8 | methyl (1S)-2,6,6-trimethyl-2-cyclohexene-1-carboxylate | |
| Use(s): fragrance agents | ||
| 52581-71-2 | ppg-10 oleyl ether | |
| Use(s): emollients | ||
| 52581-71-2 | ppg-20 oleyl ether | |
| Use(s): emollients, skin conditioning | ||
| 52581-71-2 | ppg-23 oleyl ether | |
| Use(s): emollients, skin conditioning | ||
| 52581-71-2 | ppg-30 oleyl ether | |
| Use(s): emollients | ||
| 52581-71-2 | ppg-37 oleyl ether | |
| Use(s): emollients | ||
| 52581-71-2 | ppg-50 oleyl ether | |
| Use(s): emollients | ||
| 52591-03-4 | borjatriol | |
| Use(s): natural substances and extractives | ||
| 52591-05-6 | convallamaroside | |
| Use(s): natural substances and extractives | ||
| 52591-12-5 | gyrocyanin | |
| Use(s): natural substances and extractives | ||
| 52592-29-7 | aphidicol-16-ene | |
| Use(s): natural substances and extractives | ||
| 52611-78-6 | grayanol B | |
| Use(s): natural substances and extractives | ||
| 52617-32-0 | xanthochymol | |
| Use(s): natural substances and extractives | ||
| 52617-34-2 | cycloseychellene | |
| Use(s): natural substances and extractives | ||
| 52628-03-2 | methacryloylethyl phosphate | |
| EC: 258-053-2 Use(s): nail conditioning agents | ||
| 52628-25-8 | zinc ammonium chloride | |
| EC: 258-054-8 Use(s): information only not used for fragrances or flavors | ||
| 52645-53-1 | per | methrin |
| EC: 258-067-9 Use(s): antimicrobial agents | ||
| 52645-90-6 | aphidicol-15-ene | |
| Use(s): natural substances and extractives | ||
| 52659-55-9 | amphibine H | |
| Use(s): natural substances and extractives | ||
| 52662-38-1 | 2- | ethyldihydro-3(2H)-thiophenone |
| Use(s): information only not used for fragrances or flavors | ||
| 52667-15-9 | aluminum methionate | |
| EC: 258-085-7 Use(s): cosmetic agents | ||
| 52683-61-1 | sucrose oleate | |
| EC: 258-098-8 Use(s): emollients, emulsifiers, surfactants | ||
| 52687-98-6 | dipropyl tetrasulfide | |
| EC: 258-103-3 Use(s): natural substances and extractives | ||
| 52704-36-6 | 3- | hydroxy-3-penten-2-one |
| Use(s): natural substances and extractives | ||
| 52705-93-8 | ginsenoside Rd | |
| EC: 258-118-5 Use(s): natural substances and extractives | ||
| 52708-03-9 | (S)- | nonan-4-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 52713-58-3 | 4- | methyl-2-pentyl oxazole |
| Use(s): natural substances and extractives | ||
| 52715-93-2 | N-DL- | methionyl-DL-methionine |
| Use(s): special dietary and nutritional additives | ||
| 52745-93-4 | (R)-4- | methyl hexanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 52762-25-1 | ethyl propyl succinate | |
| Use(s): natural substances and extractives | ||
| 52786-29-5 | 1-(2- | furyl)-1,3-pentane dione |
| Use(s): information only not used for fragrances or flavors | ||
| 52788-71-3 | ethyl para-methyl-beta-phenyl glycidate | |
| EC: 258-180-3 Use(s): fragrance agents | ||
| 52789-73-8 | 1- | acetyl cyclohexyl acetate |
| EC: 258-186-6 FEMA: 3701 JECFA: 442 FLAVIS: 09.293 Use(s): flavoring agents | ||
| 52793-97-2 | camphor benzalkonium methosulfate | |
| EC: 258-190-8 Use(s): antimicrobial, antistatic agents | ||
| 52794-79-3 | iso | stearamide DEA |
| EC: 258-193-4 Use(s): antistatic, surfactant agents | ||
| 52809-09-3 | sebiferic acid | |
| Use(s): natural substances and extractives | ||
| 52829-98-8 | alpha- | methyl cyclopentane methanol |
| EC: 258-208-4 Use(s): natural substances and extractives | ||
| 52840-44-5 | 8- | methyl nonadecane |
| Use(s): natural substances and extractives | ||
| 52845-07-5 | iso | eicosane |
| Use(s): emollients, skin conditioning, solvents | ||
| 52845-08-6 | iso | heneicosane |
| Use(s): information only not used for fragrances or flavors | ||
| 52868-85-6 | 1- | propenyl propyl trisulfide |
| Use(s): natural substances and extractives | ||
| 52884-63-6 | 4- | methyl-1,3-dithiane |
| Use(s): information only not used for fragrances or flavors | ||
| 52888-80-9 | prosulfocarb | |
| Use(s): herbicides / pesticides | ||
| 52896-99-8 | 4- | ethyl-2,2-dimethyl hexane |
| Use(s): natural substances and extractives | ||
| 52898-98-3 | 14- | hydroxyguai-1,3,5,9,11-pentaene stearate |
| Use(s): natural substances and extractives | ||
| 52900-16-0 | 2- | hydroxy-22-methyltetracosanoic acid |
| Use(s): natural substances and extractives | ||
| 52906-93-1 | sodium starch octenyl succinate | |
| Use(s): absorbents | ||
| 52918-63-5 | deltamethrin | |
| Use(s): cosmetic agents | ||
| 52936-64-8 | caulophyllogenin | |
| EC: 258-265-5 Use(s): natural substances and extractives | ||
| 52945-73-0 | (R)-2- | butane thiol |
| Use(s): information only not used for fragrances or flavors | ||
| 52946-22-2 | galangal acetate | |
| Use(s): antimicrobial agents | ||
| 52957-12-7 | (E)-7- | decen-1-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 52957-16-1 | (E)-9- | tetradecen-1-ol |
| Use(s): natural substances and extractives | ||
| 52972-16-4 | iso | nonanal dimethyl acetal |
| EC: 258-283-3 Use(s): fragrance agents | ||
| 52992-82-2 | acetyl isocupressic acid | |
| Use(s): natural substances and extractives | ||
| 53003-10-4 | salinomycin | |
| EC: 258-290-1 Use(s): pharmaceuticals / chemical synthisis | ||
| 53004-93-6 | menthyl 2-methyl butyrate | |
| EC: 258-291-7 Use(s): fragrance agents | ||
| 53012-61-6 | 2,6- | dimethyl benzoxazole |
| Use(s): natural substances and extractives | ||
| 53018-24-9 | tropical indene | |
| EC: 258-296-4 Use(s): fragrance agents | ||
| 53026-85-0 | aluminum chlorohydrex | |
| EC: 258-309-3 Use(s): cosmetic agents | ||
| 53046-97-2 | (Z,Z)-3,6- | nonadien-1-ol |
| FEMA: 3885 JECFA: 1283 Use(s): flavor and fragrance agents | ||
| 53053-51-3 | methyl 4-(methyl thio) butyrate | |
| EC: 258-328-7 FEMA: 3412 JECFA: 474 FLAVIS: 12.060 Use(s): flavoring agents | ||
| 53082-57-8 | propyl angelate | |
| EC: 258-349-1 Use(s): natural substances and extractives | ||
| 53082-58-9 | 3- | methyl pentyl angelate |
| EC: 258-350-7 Use(s): fragrance agents | ||
| 53111-25-4 | gamma- | himachalene |
| Use(s): natural substances and extractives | ||
| 53112-28-0 | pyrimethanil | |
| Use(s): herbicides / pesticides | ||
| 53119-25-8 | 2- | pentanoyl thiophene |
| FLAVIS: 15.094 Use(s): flavoring agents | ||
| 53120-27-7 | (Z,Z)-3,13- | octadecadien-1-yl acetate |
| EC: 258-374-8 Use(s): natural substances and extractives | ||
| 53123-84-5 | starch food modified: acetylated | distarch glycerol |
| Use(s): food starch-modified | ||
| 53124-00-8 | starch food modified: | hydroxypropyl distarch phosphate |
| Use(s): food starch-modified | ||
| 53137-47-6 | 5- | hexadecene |
| Use(s): natural substances and extractives | ||
| 53152-43-5 | bipindogulomethyloside | |
| Use(s): natural substances and extractives | ||
| 53153-66-5 | citgrenile | |
| EC: 258-398-9 Use(s): cosmetic agents | ||
| 53153-67-6 | teamonyl | |
| EC: 258-399-4 Use(s): fragrance agents | ||
| 53155-25-2 | euscaphic acid | |
| Use(s): natural substances and extractives | ||
| 53158-73-9 | delphinidin-3-O-sambubioside chloride | |
| Use(s): natural substances and extractives | ||
| 53161-46-9 | pentaerythrityl monobehenate | |
| EC: 258-401-3 Use(s): information only not used for fragrances or flavors | ||
| 53163-97-6 | 2- | methyl-6-ethoxypyrazine |
| EC: 258-402-9 FEMA: 3569 Use(s): flavoring agents | ||
| 53170-93-7 | 3- | hydroxy-1-(4-hydroxyphenyl)-1-propanone |
| Use(s): natural substances and extractives | ||
| 53171-04-3 | lauroyl pg-trimonium chloride | |
| Use(s): antistatic, hair conditioning | ||
| 53172-10-4 | [6]- | dehydroparadol |
| Use(s): natural substances and extractives | ||
| 53172-59-1 | methyl 2,4-decadienoate | |
| Use(s): natural substances and extractives | ||
| 53179-04-7 | 10- | undecene nitrile |
| EC: 258-413-9 Use(s): fragrance agents | ||
| 53184-67-1 | nonyl propionate | |
| EC: 258-418-6 Use(s): information only not used for fragrances or flavors | ||
| 53185-12-9 | dextro- | fagomine |
| Use(s): food additive, dietary supplements | ||
| 53202-37-2 | aluminum dilinoleate | |
| Use(s): cosmetic agents | ||
| 53219-21-9 | dihydromyrcenol dihydro derivative | |
| EC: 258-432-2 Use(s): fragrance agents | ||
| 53227-91-1 | camelliagenin A | |
| Use(s): natural substances and extractives | ||
| 53238-80-5 | epi | glucan |
| EC: 258-443-2 Use(s): cosmetic agents | ||
| 53243-59-7 | (Z)- | citrus nitrile |
| EC: 258-446-9 Use(s): fragrance agents | ||
| 53243-60-0 | (E)- | citrus nitrile |
| EC: 258-447-4 Use(s): fragrance agents | ||
| 53250-50-3 | grandisin | |
| Use(s): natural substances and extractives | ||
| 53253-09-1 | (Z)-3- | hexen-1-yl-2-cyclopenten-1-one |
| Use(s): fragrance agents | ||
| 53254-50-5 | [4]- | gingerdiol 3,5-diacetate |
| Use(s): natural substances and extractives | ||
| 53254-77-6 | [10]- | gingerdiol |
| Use(s): natural substances and extractives | ||
| 53263-56-2 | 2- | hydroxy-3,5,5-trimethyl-2-cyclopenten-1-one |
| Use(s): natural substances and extractives | ||
| 53263-58-4 | 5- | ethyl-3-methyl cyclotene |
| EC: 258-451-6 FEMA: 3454 JECFA: 423 FLAVIS: 07.118 Use(s): flavoring agents | ||
| 53279-35-9 | demethoxyegonol | |
| Use(s): natural substances and extractives | ||
| 53282-12-5 | ethyl (E)-3-(2-furyl) acrylate | |
| FEMA: 4541 JECFA: 2103 Use(s): flavoring agents | ||
| 53282-26-1 | ethyl (Z)-3-(2-furyl) acrylate | |
| Use(s): information only not used for fragrances or flavors | ||
| 53318-09-5 | [6]- | gingerdiol |
| Use(s): natural substances and extractives | ||
| 53320-86-8 | lithium magnesium sodium silicate | |
| EC: 258-476-2 Use(s): bulking, viscosity controlling agents | ||
| 53338-05-9 | amber dioxepine | |
| EC: 258-487-2 Use(s): fragrance agents | ||
| 53338-06-0 | neo | pentanal butenylene glycol acetal |
| EC: 258-488-8 Use(s): fragrance agents | ||
| 53339-59-6 | citronellyl amine | |
| Use(s): natural substances and extractives | ||
| 53350-26-8 | tricetin-3',4',5',5,7-pentamethyl ether | |
| Use(s): natural substances and extractives | ||
| 53369-17-8 | (1S,2S,5S)-(-)- | myrtanol |
| EC: 258-499-8 Use(s): natural substances and extractives | ||
| 53398-76-8 | (E,Z)-2,4- | hexadienal |
| Use(s): natural substances and extractives | ||
| 53398-78-0 | (E)-2- | hexen-1-yl formate |
| EC: 258-512-7 FEMA: 3927 JECFA: 1376 FLAVIS: 09.397 Use(s): flavor and fragrance agents | ||
| 53398-80-4 | (E)-2- | hexen-1-yl propionate |
| EC: 258-513-2 FEMA: 3932 JECFA: 1378 FLAVIS: 09.395 Use(s): flavor and fragrance agents | ||
| 53398-81-5 | (E)-3- | hexen-1-yl propionate |
| EC: 258-514-8 Use(s): flavor and fragrance agents | ||
| 53398-83-7 | (E)-2- | hexen-1-yl butyrate |
| EC: 258-515-3 FEMA: 3926 JECFA: 1375 FLAVIS: 09.396 Use(s): flavor and fragrance agents | ||
| 53398-84-8 | (E)-3- | hexen-1-yl butyrate |
| EC: 258-516-9 Use(s): flavor and fragrance agents | ||
| 53398-85-9 | (Z)-3- | hexen-1-yl 2-methyl butyrate |
| EC: 258-517-4 FEMA: 3497 FLAVIS: 09.854 Use(s): flavor and fragrance agents | ||
| 53398-86-0 | (E)-2- | hexen-1-yl hexanoate |
| EC: 258-519-5 FEMA: 3983 JECFA: 1381 FLAVIS: 09.398 Use(s): flavor and fragrance agents | ||
| 53398-87-1 | (Z)-3- | hexen-1-yl (E)-2-hexenoate |
| FEMA: 3928 JECFA: 1279 FLAVIS: 09.568 Use(s): flavor and fragrance agents | ||
| 53398-88-2 | (E)-3- | hexen-1-yl (Z)-3-hexenoate |
| Use(s): information only not used for fragrances or flavors | ||
| 53398-90-6 | 6- | hydroxydihydrotheaspirane |
| Use(s): flavoring agents | ||
| 53399-81-8 | pineapple pentenoate | |
| EC: 258-520-0 FEMA: 3489 JECFA: 351 FLAVIS: 09.527 Use(s): flavor and fragrance agents | ||
| 53405-97-3 | undecanal diethyl acetal | |
| EC: 258-539-4 FLAVIS: 06.070 Use(s): flavor and fragrance agents | ||
| 53405-98-4 | dodecanal diethyl acetal | |
| EC: 258-541-5 FLAVIS: 06.062 Use(s): flavor and fragrance agents | ||
| 53408-95-0 | magnesium phosphate hydrate | |
| Use(s): special dietary and nutritional additives | ||
| 53434-79-0 | ethyl (E,E)-2,4-nonadienoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 53446-63-2 | iso | propyl indanone |
| EC: 258-558-8 Use(s): fragrance agents | ||
| 53447-45-3 | (2S,2'S,5'S)- | lilac aldehyde |
| Use(s): natural substances and extractives | ||
| 53447-46-4 | (2R,2'S,5'S)- | lilac aldehyde |
| Use(s): natural substances and extractives | ||
| 53447-47-5 | (2R,2'R,5'S)- | lilac aldehyde |
| Use(s): natural substances and extractives | ||
| 53447-48-6 | (2S,2'R,5'S)- | lilac aldehyde |
| Use(s): natural substances and extractives | ||
| 53448-06-9 | (Z)-3- | pentenal |
| Use(s): natural substances and extractives | ||
| 53448-07-0 | (E)-2- | undecenal |
| EC: 258-559-3 FEMA: 3423 FLAVIS: 05.184 Use(s): flavor and fragrance agents | ||
| 53448-53-6 | anhydroxylitol | |
| EC: 258-560-9 Use(s): humectants, skin conditioning | ||
| 53451-16-4 | iso | propyl 3,5,5-trimethyl hexanoate |
| EC: 258-563-5 Use(s): information only not used for fragrances or flavors | ||
| 53452-65-6 | butyl quinoline | |
| EC: 258-564-0 Use(s): fragrance agents | ||
| 53472-37-0 | laricitrin | |
| Use(s): natural substances and extractives | ||
| 53475-15-3 | dextro,laevo-3-( | methyl thio) butanone |
| EC: 258-576-6 FEMA: 4181 JECFA: 1688 FLAVIS: 12.285 Use(s): flavoring agents | ||
| 53484-50-7 | (E)-4- | methoxycinnamyl alcohol |
| Use(s): natural substances and extractives | ||
| 53488-14-5 | octyl oxyacetaldehyde | |
| EC: 258-582-9 Use(s): fragrance agents | ||
| 53496-15-4 | dextro-sec- | pentyl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 53498-30-9 | 2-iso | propyl-4,5-dimethyl thiazole |
| FLAVIS: 15.080 Use(s): flavoring agents | ||
| 53498-31-0 | 5- | ethyl-4-methyl-2-propan-2-yl-1,3-thiazole |
| Use(s): natural substances and extractives | ||
| 53498-32-1 | geranium thiazole | |
| EC: 258-586-0 FEMA: 4647 JECFA: 2109 FLAVIS: 15.078 Use(s): flavor and fragrance agents | ||
| 53510-18-2 | 5- | methyl-3-heptene |
| Use(s): information only not used for fragrances or flavors | ||
| 53526-64-0 | beta- | spathulene |
| Use(s): natural substances and extractives | ||
| 53527-49-4 | corosin | |
| Use(s): natural substances and extractives | ||
| 53529-60-5 | vinyl dimethicone | |
| Use(s): viscosity controlling agents | ||
| 53531-14-9 | (R)-2- | methyl valeraldehyde |
| Use(s): information only not used for fragrances or flavors | ||
| 53533-75-8 | disteareth-75 IPDI | |
| Use(s): cosmetic agents | ||
| 53533-75-8 | disteareth-100 IPDI | |
| Use(s): viscosity controlling agents | ||
| 53535-33-4 | heptanol | |
| EC: 258-615-7 Use(s): flavor and fragrance agents | ||
| 53538-27-5 | 2,4,6- | trimethyl-1,3-dithiane |
| Use(s): information only not used for fragrances or flavors | ||
| 53554-42-0 | 3- | hydroxyoctyl propionate |
| Use(s): information only not used for fragrances or flavors | ||
| 53562-86-0 | methyl (S)-3-hydroxybutyrate | |
| Use(s): natural substances and extractives | ||
| 53563-63-6 | glyceryl dimyristate | |
| EC: 258-629-3 Use(s): emollients | ||
| 53563-70-5 | capryleth-6 carboxylic acid | |
| Use(s): emulsifiers, surfactants | ||
| 53563-70-5 | capryleth-9 carboxylic acid | |
| Use(s): emulsifiers, surfactants | ||
| 53563-70-5 | capryleth-4 carboxylic acid | |
| Use(s): emulsifiers, surfactants | ||
| 53576-49-1 | TEA-lauroyl glutamate | |
| EC: 258-636-1 Use(s): surfactant | ||
| 53576-52-6 | myristoyl glutamic acid | |
| Use(s): cosmetic agents | ||
| 53584-43-3 | theogallin | |
| Use(s): natural substances and extractives | ||
| 53584-56-8 | (R)- | acetoin |
| Use(s): natural substances and extractives | ||
| 53585-13-0 | (E)-gamma- | bisabolene |
| Use(s): natural substances and extractives | ||
| 53587-16-9 | 4-iso | propyl guaiacol |
| Use(s): natural substances and extractives | ||
| 53605-94-0 | butyl 3-hydroxybutyrate | |
| EC: 258-658-1 Use(s): natural substances and extractives | ||
| 53608-75-6 | pancrelipase (amylase;lipase;protease) | |
| EC: 258-659-7 Use(s): enzyme preparations and microorganisms | ||
| 53625-18-6 | (-)- | maali oxide |
| Use(s): natural substances and extractives | ||
| 53626-94-1 | S- | prenyl thioisobutyrate |
| FEMA: 4760 FLAVIS: 12.196 Use(s): flavoring agents | ||
| 53633-54-8 | polyquaternium-11 | |
| Use(s): antistatic, film forming agents | ||
| 53643-07-5 | nootkatol | |
| EC: 258-681-7 Use(s): natural substances and extractives | ||
| 53651-69-7 | propyl laevo-lactate | |
| EC: 611-025-7 Use(s): information only not used for fragrances or flavors | ||
| 53655-22-4 | iso | prenyl hexanoate |
| FLAVIS: 09.898 Use(s): flavoring agents | ||
| 53657-29-7 | sitoindoside II | |
| Use(s): natural substances and extractives | ||
| 53670-54-5 | 3- | mercapto-2,5-hexane dione |
| Use(s): information only not used for fragrances or flavors | ||
| 53678-20-9 | (E)-3- | decenoic acid |
| EC: 258-695-3 Use(s): natural substances and extractives | ||
| 53685-77-1 | 4- | heptadecanone |
| EC: 258-705-6 Use(s): information only not used for fragrances or flavors | ||
| 53694-15-8 | sorbeth-20 | |
| EC: 500-121-3 Use(s): solvents | ||
| 53694-15-8 | sorbeth-30 | |
| EC: 500-121-3 Use(s): emulsifiers, humectants | ||
| 53694-15-8 | sorbeth-40 | |
| EC: 500-121-3 Use(s): emulsifiers, humectants | ||
| 53694-15-8 | sorbeth-6 | |
| EC: 500-121-3 Use(s): emulsifiers, viscosity controlling | ||
| 53694-17-0 | polyquaternium-22 | |
| Use(s): antistatic, film forming agents | ||
| 53696-23-4 | 4- | methyl hexadecanoic acid |
| Use(s): natural substances and extractives | ||
| 53715-85-8 | 2,4- | dimethyl benzofuran |
| Use(s): information only not used for fragrances or flavors | ||
| 53751-40-9 | rhodinyl acetate substitutes | |
| EC: 258-743-3 Use(s): flavor and fragrance agents | ||
| 53755-02-5 | (S,E)- | clovamide |
| Use(s): natural substances and extractives | ||
| 53755-03-6 | (S,Z)- | clovamide |
| Use(s): natural substances and extractives | ||
| 53760-19-3 | cytochalasin H | |
| Use(s): natural substances and extractives | ||
| 53767-86-5 | 7- | methoxy-3,7-dimethyl-1-octene |
| EC: 258-750-1 Use(s): fragrance agents | ||
| 53767-93-4 | dihydromyrcenyl acetate | |
| EC: 258-751-7 Use(s): fragrance agents | ||
| 53774-20-2 | 2- | methyl-3-butenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 53778-73-7 | 1- | methoxy-2-butanol |
| Use(s): natural substances and extractives | ||
| 53786-93-9 | 1,4- | undecadiene |
| Use(s): natural substances and extractives | ||
| 53811-56-6 | 6- | methylumbelliferone |
| Use(s): natural substances and extractives | ||
| 53823-02-2 | onitin | |
| Use(s): natural substances and extractives | ||
| 53823-06-6 | cycloeudesmol | |
| Use(s): natural substances and extractives | ||
| 53823-07-7 | africanol | |
| Use(s): natural substances and extractives | ||
| 53823-08-8 | cascaroside A | |
| Use(s): natural substances and extractives | ||
| 53823-09-9 | cascaroside C | |
| Use(s): natural substances and extractives | ||
| 53823-16-8 | delta- | patchoulene |
| Use(s): natural substances and extractives | ||
| 53824-77-4 | propylene glycol dicaprate | |
| EC: 258-814-9 Use(s): emollients | ||
| 53833-20-8 | 4- | ethyl-2-methyl oxazole |
| Use(s): natural substances and extractives | ||
| 53833-25-3 | 16- | hydroxy-10-oxohexadecanoic acid |
| Use(s): natural substances and extractives | ||
| 53833-28-6 | 4- | ethyl-5-methyl oxazole |
| Use(s): natural substances and extractives | ||
| 53833-29-7 | 5- | ethyl-2-methyl oxazole |
| Use(s): natural substances and extractives | ||
| 53833-30-0 | 2- | ethyl-4,5-dimethyl oxazole |
| EC: 258-815-4 FEMA: 3672 JECFA: 1555 FLAVIS: 13.091 Use(s): flavoring agents | ||
| 53833-31-1 | 5- | methyl-2-propyl oxazole |
| Use(s): natural substances and extractives | ||
| 53833-32-2 | 4,5- | dimethyl-2-propyl oxazole |
| EC: 258-817-5 FEMA: 4396 JECFA: 1569 FLAVIS: 13.112 Use(s): flavoring agents | ||
| 53833-33-3 | 4- | butyl thiazole |
| FLAVIS: 15.118 Use(s): flavoring agents | ||
| 53833-85-5 | (Z)- | sabinyl acetate |
| Use(s): natural substances and extractives | ||
| 53834-70-1 | (E)- | dehydrolinalool |
| EC: 258-818-0 FEMA: 3830 FLAVIS: 02.146 Use(s): flavor and fragrance agents | ||
| 53846-50-7 | 8- | prenyl naringenin |
| Use(s): natural substances and extractives | ||
| 53846-51-8 | leptophylloside | |
| Use(s): natural substances and extractives | ||
| 53848-05-8 | gentianal | |
| Use(s): natural substances and extractives | ||
| 53850-34-3 | thaumatin b-recombinant | |
| EC: 258-822-2 FEMA: 3814 Use(s): sweeteners, flavor enhancers | ||
| 53850-34-3 | thaumatin | |
| EC: 258-822-2 FEMA: 3732 Use(s): sweeteners, flavor enhancers | ||
| 53861-34-0 | cascaroside B | |
| Use(s): natural substances and extractives | ||
| 53861-35-1 | cascaroside D | |
| Use(s): natural substances and extractives | ||
| 53880-51-6 | (E,E)-8,10- | dodecadien-1-yl acetate |
| EC: 258-834-8 Use(s): natural substances and extractives | ||
| 53889-39-7 | 4- | freesia acetate |
| EC: 258-840-0 Use(s): fragrance agents | ||
| 53890-13-4 | ethylhexyloxyglyceryl palmitate | |
| EC: 258-841-6 Use(s): emollients, emulsifiers | ||
| 53890-24-7 | 1'- | acetoxyeugenol |
| Use(s): natural substances and extractives | ||
| 53897-26-0 | 5,6- | dihydro-2H-pyran-2-carbaldehyde |
| Use(s): natural substances and extractives | ||
| 53897-55-5 | 2,4,6- | trimethyl-1,3,5-dioxathiane |
| Use(s): information only not used for fragrances or flavors | ||
| 53897-57-7 | 2,4,6- | triethyl-1,3,5-oxadithiane |
| Use(s): information only not used for fragrances or flavors | ||
| 53897-58-8 | 2,4,6- | triethyl-1,3,5-trithiane |
| Use(s): information only not used for fragrances or flavors | ||
| 53897-59-9 | bis(1- | mercaptoethyl) sulfide |
| Use(s): natural substances and extractives | ||
| 53897-60-2 | bis(1- | mercaptopropyl) sulfide |
| FEMA: 4297 JECFA: 1709 FLAVIS: 12.284 Use(s): flavoring agents | ||
| 53897-63-5 | tetrahydro-2,4,6-trimethyl-1,3,5(2H)-thiadiazine | |
| FLAVIS: 15.129 Use(s): flavoring agents | ||
| 53897-66-8 | 4- | ethyl-2,3,5-trithiahexane |
| Use(s): natural substances and extractives | ||
| 53907-46-3 | methyl 2-mercaptopropionate | |
| EC: 258-856-8 FLAVIS: 12.266 Use(s): flavoring agents | ||
| 53907-72-5 | 7- | octen-4-ol |
| Use(s): natural substances and extractives | ||
| 53910-28-4 | disodium ascorbyl sulfate | |
| Use(s): antioxidants | ||
| 53936-56-4 | tetrahydropyranyloxy phenol | |
| Use(s): bleaching agents | ||
| 53939-27-8 | (Z)-9- | tetradecenal |
| EC: 258-875-1 Use(s): natural substances and extractives | ||
| 53939-28-9 | (Z)-11- | hexadecenal |
| EC: 258-876-7 Use(s): natural substances and extractives | ||
| 53939-81-4 | phenethyl levulinate | |
| EC: 258-877-2 Use(s): information only not used for fragrances or flavors | ||
| 53947-84-5 | N- | malonylanthranilic acid |
| Use(s): natural substances and extractives | ||
| 53947-89-0 | apterin | |
| Use(s): natural substances and extractives | ||
| 53947-91-4 | amorphol | |
| Use(s): natural substances and extractives | ||
| 53947-95-8 | nummularine A | |
| Use(s): natural substances and extractives | ||
| 53947-96-9 | nummularine B | |
| Use(s): natural substances and extractives | ||
| 53950-58-6 | phytyl palmitate | |
| EC: 258-884-0 Use(s): natural substances and extractives | ||
| 53950-85-9 | 2,4,4,6- | tetramethyl cyclohexa-2,5-diene-1-one |
| Use(s): fragrance agents | ||
| 53956-04-0 | ammonium glycyrrhizate | |
| EC: 258-887-7 FEMA: 2528 FLAVIS: 16.060 Use(s): licorice and licorice derivatives | ||
| 53963-43-2 | ginsenoside F1 | |
| Use(s): natural substances and extractives | ||
| 53966-36-2 | ethyl isopropyl disulfide | |
| Use(s): information only not used for fragrances or flavors | ||
| 53966-51-1 | 4- | ethyl-3-octene |
| Use(s): natural substances and extractives | ||
| 53973-98-1 | hydrolyzed | carrageenan |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 53980-88-4 | cyclocarboxypropyloleic acid | |
| EC: 258-897-1 Use(s): viscosity controlling agents | ||
| 54004-29-4 | methyl (E)-4-heptenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 54004-43-2 | 2- | pentyl propionate |
| Use(s): natural substances and extractives | ||
| 54043-73-1 | 5-iso | propenyl-beta,2-dimethyl cyclopent-1-ene-1-propyl acetate |
| EC: 258-934-1 Use(s): fragrance agents | ||
| 54051-19-3 | methyl 3-mercaptobutanoate | |
| FEMA: 4167 JECFA: 1674 FLAVIS: 12.290 Use(s): flavoring agents | ||
| 54056-51-8 | butyl senecioate | |
| EC: 258-939-9 Use(s): information only not used for fragrances or flavors | ||
| 54063-53-5 | propafenone | |
| Use(s): cosmetic ingredient for skin protecting | ||
| 54074-85-0 | ethyl 3-hydroxypentanoate | |
| Use(s): natural substances and extractives | ||
| 54075-09-1 | (E)- | cocoa butenal |
| Use(s): natural substances and extractives | ||
| 54075-10-4 | (Z)- | cocoa butenal |
| Use(s): natural substances and extractives | ||
| 54082-68-7 | muguet undecadienal | |
| EC: 258-966-6 Use(s): fragrance agents | ||
| 54089-83-7 | muguet nitrile | |
| EC: 258-969-2 Use(s): fragrance agents | ||
| 54096-45-6 | thiiranepropane nitrile | |
| Use(s): natural substances and extractives | ||
| 54105-66-7 | undecyl cyclohexane | |
| EC: 258-976-0 Use(s): natural substances and extractives | ||
| 54120-64-8 | 5- | methyl phthalide |
| Use(s): natural substances and extractives | ||
| 54135-80-7 | 2,3,4- | trichloroanisole |
| EC: 258-990-7 Use(s): natural substances and extractives | ||
| 54140-20-4 | sorbitan tripalmitate | |
| EC: 258-994-9 Use(s): indirect food additives: adhesives and components of coatings | ||
| 54151-38-1 | 1-(1- | pyrrolidinyl)-2-propanone |
| Use(s): natural substances and extractives | ||
| 54164-91-9 | cis-para-2- | menthene-1,8-diol |
| EC: 259-007-4 Use(s): natural substances and extractives | ||
| 54182-58-0 | aluminum sucrose octasulfate | |
| EC: 259-018-4 Use(s): cosmetic agents | ||
| 54193-36-1 | sodium polymethacrylate | |
| Use(s): boiler water additives used in the preparation of steam that will contact food | ||
| 54200-50-9 | abietyl acetate | |
| EC: 259-025-2 Use(s): fragrance agents | ||
| 54264-04-9 | heptadecadiene | |
| Use(s): natural substances and extractives | ||
| 54266-38-5 | MEA-thiolactate | |
| EC: 259-050-9 Use(s): cosmetic agents | ||
| 54274-73-6 | 1-epi- | bicyclosesquiphellandrene |
| Use(s): natural substances and extractives | ||
| 54276-35-6 | methacrylic acid, sulphopropyl ester | |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 54286-88-3 | 2- | methyl butyraldehyde dimethyl acetal |
| Use(s): information only not used for fragrances or flavors | ||
| 54290-12-9 | 7- | heptadecene |
| Use(s): natural substances and extractives | ||
| 54300-07-1 | 5- | ethyl-2-propyl thiazole |
| Use(s): natural substances and extractives | ||
| 54300-08-2 | 2- | acetyl-3,5-dimethyl pyrazine |
| EC: 259-076-0 FEMA: 3327 JECFA: 786 FLAVIS: 14.055 Use(s): flavor and fragrance agents | ||
| 54300-09-3 | 2- | acetyl-3,6-dimethyl pyrazine |
| EC: 259-077-6 JECFA: 786 Use(s): flavor and fragrance agents | ||
| 54300-10-6 | 5- | acetyl-2,3-dimethyl pyrazine |
| FLAVIS: 14.081 Use(s): flavor and fragrance agents | ||
| 54300-11-7 | 2-(2- | furyl)-3,5-dimethyl pyrazine |
| Use(s): information only not used for fragrances or flavors | ||
| 54300-12-8 | 3-(2- | furyl)-2,5-dimethyl pyrazine |
| Use(s): information only not used for fragrances or flavors | ||
| 54300-19-5 | 2- | ethyl oxazole |
| Use(s): natural substances and extractives | ||
| 54300-20-8 | 4- | ethyl oxazole |
| Use(s): information only not used for fragrances or flavors | ||
| 54306-00-2 | 2- | hexenal diethyl acetal |
| EC: 259-086-5 FLAVIS: 06.031 Use(s): flavoring agents | ||
| 54306-03-5 | 2,4- | tetradecadienal |
| Use(s): natural substances and extractives | ||
| 54323-26-1 | 4-(4- | methyl-3-pentenyl)-3-cyclohexene-1-carboxaldehyde |
| EC: 259-101-5 Use(s): information only not used for fragrances or flavors | ||
| 54324-03-7 | bicyclosesquiphellandrene | |
| Use(s): natural substances and extractives | ||
| 54324-99-1 | chrysanthenyl acetate | |
| Use(s): natural substances and extractives | ||
| 54340-70-4 | ethyl (E)-4-heptenoate | |
| EC: 259-113-0 Use(s): natural substances and extractives | ||
| 54340-72-6 | ethyl (E)-2-heptenoate | |
| FLAVIS: 09.374 Use(s): flavoring agents | ||
| 54340-90-8 | acetaldehyde methyl hexyl acetal | |
| EC: 259-114-6 Use(s): fragrance agents | ||
| 54340-93-1 | 2- | pentyl isobutyrate |
| Use(s): natural substances and extractives | ||
| 54344-61-5 | 2,6,10,10- | tetramethyl-1-oxaspiro[4.5]deca-3,6-diene |
| EC: 259-116-7 Use(s): information only not used for fragrances or flavors | ||
| 54355-74-7 | iso | valeraldehyde glyceryl acetal |
| FEMA: 4380 JECFA: 1733 Use(s): flavoring agents | ||
| 54381-08-7 | HC orange no. 1 | |
| EC: 259-132-4 Use(s): hair dyeing agents | ||
| 54381-16-7 | N,N-bis(2- | hydroxyethyl)-p-phenylenediamine sulfate |
| EC: 259-134-5 Use(s): hair dyeing agents | ||
| 54383-66-3 | jasmolone | |
| Use(s): natural substances and extractives | ||
| 54392-27-7 | sorbitan triisostearate | |
| EC: 259-141-3 Use(s): emulsifiers | ||
| 54393-36-1 | (Z)-4- | octen-1-ol |
| FEMA: 4354 JECFA: 1625 FLAVIS: 02.244 Use(s): flavor and fragrance agents | ||
| 54396-97-3 | 2- | ethoxyethyl isobutyrate |
| EC: 259-146-0 Use(s): information only not used for fragrances or flavors | ||
| 54398-03-7 | S- | lactoylglutathione |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 54401-85-3 | ethyl 4-pyridyl acetate | |
| EC: 259-150-2 Use(s): information only not used for fragrances or flavors | ||
| 54410-83-2 | 2,3- | dimethyl-5-isobutyl pyrazine |
| Use(s): flavoring agents | ||
| 54410-94-5 | 3-iso | pentenyl isovalerate |
| EC: 259-156-5 Use(s): flavor and fragrance agents | ||
| 54411-06-2 | 2- | butyl-5-ethyl thiophene |
| FLAVIS: 15.043 Use(s): flavoring agents | ||
| 54411-16-4 | butyl (E)-2-hexenoate | |
| Use(s): natural substances and extractives | ||
| 54422-45-6 | 2- | oleamido-1,3-octadecanediol |
| Use(s): cosmetic agents | ||
| 54440-17-4 | saffron indenone | |
| FEMA: 4556 JECFA: 2047 Use(s): flavor and fragrance agents | ||
| 54446-78-5 | 1-(2- | butoxyethoxy) ethanol |
| Use(s): natural substances and extractives | ||
| 54453-03-1 | copper ethylenediaminetetraacetate | |
| EC: 259-169-6 Use(s): indirect food additives: adhesives and components of coatings | ||
| 54460-99-0 | 4- | ethyl-2,6-dimethyl-4-heptanol |
| Use(s): natural substances and extractives | ||
| 54464-57-2 | patchouli ethanone | |
| EC: 259-174-3 Use(s): cosmetic and fragrance agents | ||
| 54464-57-2 | patchouli ethanone | |
| EC: 259-174-3 Use(s): cosmetic and fragrance agents | ||
| 54464-59-4 | 1-(1,2,3,4,5,6,7,8- | octahydro-2,3,5,5-tetramethyl-2-naphthalenyl) ethanone |
| EC: 259-175-9 Use(s): fragrance agents | ||
| 54484-66-1 | acetaldehyde ethyl (E)-2-hexen-1-yl acetal | |
| EC: 259-183-2 Use(s): information only not used for fragrances or flavors | ||
| 54484-73-0 | earthy acetal | |
| EC: 259-184-8 FLAVIS: 06.082 Use(s): flavor and fragrance agents | ||
| 54491-17-7 | 3- | ethyl hexahydro-3H-benzofuran-2-one |
| EC: 259-185-3 Use(s): fragrance agents | ||
| 54510-13-3 | rubraflavone A | |
| Use(s): natural substances and extractives | ||
| 54533-29-8 | 2- | buten-1-one, 2-methyl-1-(1-piperidinyl)- |
| EC: 259-204-5 Use(s): fragrance agents | ||
| 54536-43-5 | iso | stearamide MEA |
| Use(s): surfactant, viscosity controlling agents | ||
| 54542-33-5 | ethyl (E,E)-2,4-heptadienoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 54542-51-7 | quercetin-3-O-glucose-6''-acetate | |
| Use(s): information only not used for fragrances or flavors | ||
| 54546-22-4 | ethyl 9-hexadecenoate | |
| Use(s): natural substances and extractives | ||
| 54546-26-8 | herbal acetal | |
| EC: 259-210-8 Use(s): fragrance agents | ||
| 54549-25-6 | decyl glucoside | |
| EC: 259-218-1 Use(s): emulsion stabilising, surfactant agents | ||
| 54562-24-2 | 2,3,5- | trimethyl-2-cyclopenten-1-one |
| Use(s): natural substances and extractives | ||
| 54571-67-4 | sodium pyroglutamate | |
| EC: 259-234-9 Use(s): cosmetic agents | ||
| 54590-52-2 | MIPA-dodecylbenzenesulfonate | |
| EC: 259-249-0 Use(s): surfactant | ||
| 54615-63-3 | 2- | ethoxybenzene thiol |
| Use(s): information only not used for fragrances or flavors | ||
| 54617-29-7 | palmitoyl isoleucine | |
| Use(s): cosmetic ingredient for skin protecting | ||
| 54630-50-1 | 5- | methyl-2-heptanol |
| Use(s): natural substances and extractives | ||
| 54632-04-1 | albicanol | |
| Use(s): natural substances and extractives | ||
| 54644-28-9 | (±)-3,5- | diethyl-1,2,4-trithiolane |
| FEMA: 4030 JECFA: 1686 FLAVIS: 15.049 Use(s): flavoring agents | ||
| 54644-28-9 | 3,6- | diethyl-1,2,4,5-tetrathiane and 3,5-diethyl-1,2,4-trithiolane mixture 1% in vegetable oil triglycerides |
| FEMA: 4030 JECFA: 1686 FLAVIS: 12.274 Use(s): flavoring agents | ||
| 54653-25-7 | ethyl 5-hexenoate | |
| FEMA: 3976 JECFA: 1273 FLAVIS: 09.921 Use(s): flavor and fragrance agents | ||
| 54657-08-8 | (-)-sec- | butyl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 54675-77-3 | (Z)-2- | hexen-1-yl isovalerate |
| Use(s): natural substances and extractives | ||
| 54684-78-5 | stearyl stearoyl stearate | |
| Use(s): emollients, viscosity controlling | ||
| 54689-35-9 | sucrose pentastearate | |
| EC: 259-295-1 Use(s): information only not used for fragrances or flavors | ||
| 54702-13-5 | iso | prenyl butyrate |
| FLAVIS: 09.897 Use(s): flavor and fragrance agents | ||
| 54707-45-8 | cacalonol | |
| Use(s): natural substances and extractives | ||
| 54707-49-2 | grevilline D | |
| Use(s): natural substances and extractives | ||
| 54712-38-8 | iso | sclerone |
| Use(s): natural substances and extractives | ||
| 54717-12-3 | 3,6- | diethyl-1,2,4,5-tetrathiane and 3,5-diethyl-1,2,4-trithiolane mixture 1% in vegetable oil triglycerides |
| FEMA: 4094 JECFA: 1687 FLAVIS: 12.274 Use(s): flavoring agents | ||
| 54717-13-4 | 2(4)- | ethyl-4(2),6-dimethyl dihydro-1,3,5-dithiazine (mixture of isomers) |
| FEMA: 4667 Use(s): flavoring agents | ||
| 54717-14-5 | 2(4)- | ethyl-4(2),6-dimethyl dihydro-1,3,5-dithiazine (mixture of isomers) |
| FEMA: 4667 JECFA: 2116 FLAVIS: 15.135 Use(s): flavoring agents | ||
| 54717-17-8 | 2,4,6- | triethyl tetrahydro-1,3,5-dithiazine |
| FEMA: 4748 JECFA: 2205 FLAVIS: 15.054 Use(s): flavoring agents | ||
| 54723-19-2 | butyl 5-oxohexanoate | |
| EC: 259-305-4 Use(s): information only not used for fragrances or flavors | ||
| 54724-00-4 | curdlan | |
| Use(s): formulation aids, processing aids, stabilizers, thickeners, texturizers | ||
| 54750-69-5 | (Z)- | dehydroxylinalool oxide |
| Use(s): flavor and fragrance agents | ||
| 54750-70-8 | (E)- | dehydroxylinalool oxide |
| Use(s): flavor and fragrance agents | ||
| 54783-36-7 | 2- | hydroxy-3-(isopropyl)-6-methyl-2-cyclohexen-1-one |
| EC: 259-345-2 Use(s): information only not used for fragrances or flavors | ||
| 54789-45-6 | 1-(2,3,6- | trimethylphenyl)-3-buten-2-one |
| Use(s): natural substances and extractives | ||
| 54794-69-3 | (E,E)-N-iso | butyl-2,4-hexadecadienamide |
| Use(s): natural substances and extractives | ||
| 54794-70-6 | (E,E)-N-iso | butyl-2,4-octadecadienamide |
| Use(s): natural substances and extractives | ||
| 54797-11-4 | pterosin N | |
| Use(s): natural substances and extractives | ||
| 54798-95-7 | 2- | butyl benzothiazole |
| Use(s): natural substances and extractives | ||
| 54809-53-9 | (±)- | ipsdienol |
| Use(s): natural substances and extractives | ||
| 54812-86-1 | 2- | mercapto-3-butanol |
| Use(s): flavoring agents | ||
| 54814-64-1 | massoia lactone | |
| EC: 259-359-9 FEMA: 3744 FLAVIS: 10.037 Use(s): flavoring agents | ||
| 54815-13-3 | nonanal diethyl acetal | |
| EC: 259-360-4 FLAVIS: 06.065 Use(s): flavor and fragrance agents | ||
| 54830-99-8 | tricyclo(5.2.1.02,6)dec-3-enyl acetate | |
| EC: 259-367-2 Use(s): fragrance agents | ||
| 54833-23-7 | 10- | methyl eicosane |
| Use(s): natural substances and extractives | ||
| 54833-48-6 | 2,6,10,15- | tetramethyl heptadecane |
| Use(s): natural substances and extractives | ||
| 54835-66-4 | rubraflavone D | |
| Use(s): natural substances and extractives | ||
| 54835-67-5 | rubraflavone C | |
| Use(s): natural substances and extractives | ||
| 54835-68-6 | rubraflavone B | |
| Use(s): natural substances and extractives | ||
| 54835-71-1 | osmundalin | |
| Use(s): natural substances and extractives | ||
| 54844-65-4 | (Z)-6- | heneicosen-11-one |
| Use(s): information only not used for fragrances or flavors | ||
| 54845-33-9 | 2,5- | diisobutyl thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 54845-35-1 | 2- | butyl-5-isobutyl thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 54849-38-6 | mono | methyltin tris(isooctyl mercaptoacetate) |
| EC: 259-374-0 Use(s): indirect food additives: adhesives and components of coatings | ||
| 54852-64-1 | benzyl octyl ether | |
| FLAVIS: 03.012 Use(s): flavor and fragrance agents | ||
| 54854-91-0 | sanshodiol | |
| Use(s): natural substances and extractives | ||
| 54867-60-6 | farnisin | |
| Use(s): natural substances and extractives | ||
| 54868-50-7 | cupresol | |
| Use(s): natural substances and extractives | ||
| 54878-25-0 | solavetivone | |
| Use(s): natural substances and extractives | ||
| 54889-48-4 | octanal diethyl acetal | |
| EC: 259-385-0 FLAVIS: 06.066 Use(s): flavor and fragrance agents | ||
| 54889-49-5 | 1- | ethoxy-1-octoxyethane |
| Use(s): natural substances and extractives | ||
| 54932-78-4 | 4-(2,2,3,3- | tetramethyl butyl) phenol |
| Use(s): natural substances and extractives | ||
| 54933-91-4 | nor | davanone |
| Use(s): natural substances and extractives | ||
| 54934-99-5 | 3,5- | diisopropyl-1,2,4-trithiolane |
| FLAVIS: 15.048 Use(s): flavoring agents | ||
| 54940-97-5 | citrulline malate | |
| Use(s): special dietary and nutritional additives | ||
| 54947-74-9 | 4- | methyl octanoic acid |
| EC: 259-404-2 FEMA: 3575 JECFA: 271 FLAVIS: 08.063 Use(s): flavor and fragrance agents | ||
| 54952-43-1 | shikalkin | |
| Use(s): natural substances and extractives | ||
| 54954-14-2 | wyerone acid | |
| Use(s): natural substances and extractives | ||
| 54957-02-7 | roasted butanol | |
| FEMA: 3509 JECFA: 547 FLAVIS: 12.036 Use(s): flavoring agents | ||
| 54963-30-3 | artemidiol | |
| Use(s): natural substances and extractives | ||
| 54963-35-8 | capsicosin | |
| Use(s): natural substances and extractives | ||
| 54977-89-8 | methyl 2E,4Z-hexadecadienoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 54982-76-2 | ethyl 4-terpinenyl ether | |
| EC: 259-422-0 Use(s): information only not used for fragrances or flavors | ||
| 54982-83-1 | ethylene dodecanoate | |
| EC: 259-423-6 Use(s): fragrance agents | ||
| 54984-93-9 | acetyl shikonin | |
| Use(s): natural substances and extractives | ||
| 54990-68-0 | farnesiferol B | |
| Use(s): natural substances and extractives | ||
| 54992-90-4 | 3- | buten-2-one, 4-(2,2,3,6-tetramethylcyclohexyl)- |
| Use(s): fragrance agents | ||
| 54992-91-5 | irone | |
| EC: 259-427-8 Use(s): fragrance agents | ||
| 54993-30-5 | cyclogeranyl acetate | |
| FLAVIS: 09.342 Use(s): flavor and fragrance agents | ||
| 54999-56-3 | capsicoside A | |
| Use(s): natural substances and extractives | ||
| 55013-32-6 | cis- | oak lactone |
| Use(s): natural substances and extractives | ||
| 55030-62-1 | 4,8- | dimethyl tridecane |
| Use(s): natural substances and extractives | ||
| 55031-15-7 | 3,5(6)- | cocoa pyrazine |
| FEMA: 3149 JECFA: 789 FLAVIS: 14.100 Use(s): flavoring agents | ||
| 55031-88-4 | iso | butylene/sodium maleate copolymer |
| Use(s): film forming, viscosity controlling agents | ||
| 55041-85-5 | acetyl pyrrolizine | |
| Use(s): natural substances and extractives | ||
| 55041-86-6 | 5- | acetyl-2,3-dihydro-6-methyl-1H-pyrrolizine |
| Use(s): natural substances and extractives | ||
| 55041-87-7 | 2,3- | dihydro-6-methyl-1H-pyrrolizine-5-carbaldehyde |
| Use(s): natural substances and extractives | ||
| 55044-77-4 | 2- | hexyl octyl cyclopentane |
| Use(s): natural substances and extractives | ||
| 55045-10-8 | 6- | propyl tridecane |
| Use(s): natural substances and extractives | ||
| 55045-11-9 | 5- | propyl tridecane |
| Use(s): natural substances and extractives | ||
| 55045-14-2 | 4- | ethyl tetradecane |
| Use(s): natural substances and extractives | ||
| 55050-40-3 | exo-iso | citral |
| EC: 259-457-1 Use(s): flavor and fragrance agents | ||
| 55056-80-9 | protodioscin | |
| Use(s): natural substances and extractives | ||
| 55064-20-5 | campesteryl stearate | |
| Use(s): natural substances and extractives | ||
| 55066-45-0 | 3- | methyl-5-phenyl pent-1-en-3-ol |
| EC: 259-460-8 Use(s): information only not used for fragrances or flavors | ||
| 55066-48-3 | rose absolute pentanol | |
| EC: 259-461-3 Use(s): fragrance agents | ||
| 55066-49-4 | lily pentanal | |
| EC: 433-900-0 Use(s): fragrance agents | ||
| 55066-53-0 | ethyl ricinoleate | |
| EC: 259-462-9 Use(s): fragrance agents | ||
| 55066-54-1 | fenchyl benzoate | |
| EC: 259-463-4 Use(s): fragrance agents | ||
| 55066-56-3 | para- | cresyl isovalerate |
| EC: 259-465-5 FEMA: 3387 JECFA: 702 FLAVIS: 09.518 Use(s): flavor and fragrance agents | ||
| 55069-02-8 | fenugreekine | |
| Use(s): natural substances and extractives | ||
| 55085-47-7 | 5,6,7- | trimethoxycoumarin |
| Use(s): natural substances and extractives | ||
| 55107-03-4 | 1-(2- | furyl)-2-heptanone |
| Use(s): natural substances and extractives | ||
| 55123-21-2 | (E)-beta- | bergamotene |
| Use(s): natural substances and extractives | ||
| 55124-81-7 | 6- | methyl docosane |
| Use(s): natural substances and extractives | ||
| 55127-94-1 | whole grain | rice oil waxoline yellow |
| Use(s): information only not used for fragrances or flavors | ||
| 55138-62-0 | 2- | methyl-3-(2-propenyl)pyrazine |
| Use(s): information only not used for fragrances or flavors | ||
| 55138-63-1 | 2- | methyl-5-(2-propenyl)pyrazine |
| Use(s): natural substances and extractives | ||
| 55138-68-6 | 2,3- | dimethyl-5-(2-propenyl)pyrazine |
| Use(s): natural substances and extractives | ||
| 55138-69-7 | 2,5- | dimethyl-3-(2-propenyl)pyrazine |
| Use(s): natural substances and extractives | ||
| 55138-71-1 | trimethyl-2-propenylpyrazine | |
| Use(s): information only not used for fragrances or flavors | ||
| 55145-28-3 | 3- | methyl-1-hexen-3-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 55145-34-1 | 2- | ethyl butyl 2-ethyl butyrate |
| EC: 259-500-4 Use(s): information only not used for fragrances or flavors | ||
| 55179-31-2 | bitertanol | |
| EC: 259-513-5 Use(s): herbicides / pesticides | ||
| 55193-30-1 | 2- | pentyl octanoate |
| Use(s): natural substances and extractives | ||
| 55194-05-3 | iso | hexyl laurate |
| EC: 259-520-3 Use(s): emollients | ||
| 55194-07-5 | methylheptyl laurate | |
| Use(s): emollients, skin conditioning | ||
| 55194-25-7 | 3- | methyl octacosane |
| Use(s): natural substances and extractives | ||
| 55194-44-0 | methylheptyl myristate | |
| Use(s): emollients, skin conditioning | ||
| 55194-81-5 | methylheptyl palmitate | |
| Use(s): emollients, skin conditioning | ||
| 55194-91-7 | iso | hexyl palmitate |
| Use(s): emollients | ||
| 55195-08-9 | 2- | pentyl palmitate |
| Use(s): information only not used for fragrances or flavors | ||
| 55195-19-2 | 2- | methyl butyl laurate |
| FLAVIS: 09.307 Use(s): flavoring agents | ||
| 55195-23-8 | (S)-2- | methyl butyl decanoate |
| FLAVIS: 09.660 Use(s): information only not used for fragrances or flavors | ||
| 55195-26-1 | 2- | pentyl decanoate |
| Use(s): natural substances and extractives | ||
| 55219-65-3 | triadimenol | |
| EC: 259-537-6 Use(s): herbicides / pesticides | ||
| 55221-73-3 | moreollin | |
| Use(s): natural substances and extractives | ||
| 55249-73-5 | para-( | ethoxymethyl) anisole |
| EC: 259-548-6 Use(s): information only not used for fragrances or flavors | ||
| 55253-28-6 | (Z,Z)- | photocitral A |
| FEMA: 3645 JECFA: 968 FLAVIS: 05.123 Use(s): flavoring agents | ||
| 55258-21-4 | distearyl lauroyl glutamate | |
| Use(s): emollients, hair conditioning | ||
| 55277-47-9 | 3-iso | propyl-1,2-cyclopentane dione |
| Use(s): natural substances and extractives | ||
| 55285-14-8 | carbosulfan | |
| EC: 259-565-9 Use(s): herbicides / pesticides | ||
| 55290-63-6 | atractylodin | |
| Use(s): natural substances and extractives | ||
| 55297-13-7 | penmacric acid | |
| Use(s): natural substances and extractives | ||
| 55297-87-5 | falcarindiol | |
| Use(s): flavoring agents | ||
| 55301-15-7 | 2- | ethyl-3,5-dimethyl pyrazine and 2-ethyl-3,6-dimethyl pyrazine mixture |
| Use(s): flavoring agents | ||
| 55302-96-0 | 2- | methyl-5-hydroxyethylaminophenol |
| EC: 259-583-7 Use(s): cosmetic agents | ||
| 55303-95-2 | artoflavanone | |
| Use(s): natural substances and extractives | ||
| 55306-03-1 | sericic acid | |
| Use(s): natural substances and extractives | ||
| 55306-04-2 | sericoside | |
| EC: 259-586-3 Use(s): cosmetic agents | ||
| 55320-96-2 | (E)-5- | phenyl-2-pentenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 55335-06-3 | triclopyr | |
| Use(s): herbicides / pesticides | ||
| 55349-01-4 | hexamethylene bis-hydroxystearamide | |
| Use(s): hair conditioning, humectants, skin conditioning | ||
| 55355-31-2 | glycereth-25 PCA isostearate | |
| Use(s): emulsifiers, skin conditioning | ||
| 55365-63-4 | gangaleoidin | |
| Use(s): natural substances and extractives | ||
| 55395-12-5 | 2- | cyclotetradecen-1-one |
| Use(s): information only not used for fragrances or flavors | ||
| 55399-93-4 | hydroxyisoleucine | |
| Use(s): humectants, skin conditioning | ||
| 55406-53-6 | iodopropynyl butylcarbamate | |
| EC: 259-627-5 Use(s): preservatives | ||
| 55418-52-5 | heliotropyl acetone | |
| EC: 259-630-1 FEMA: 2701 JECFA: 2048 FLAVIS: 07.031 Use(s): flavor and fragrance agents | ||
| 55444-65-0 | (Z)-3- | hexenal dimethyl acetal |
| Use(s): information only not used for fragrances or flavors | ||
| 55446-15-6 | araloside C | |
| Use(s): natural substances and extractives | ||
| 55449-44-0 | methyl (R)-2-methyl butyrate | |
| Use(s): natural substances and extractives | ||
| 55452-65-8 | morellinol | |
| Use(s): natural substances and extractives | ||
| 55454-22-3 | (Z)-2- | hepten-1-ol |
| Use(s): flavor and fragrance agents | ||
| 55465-97-9 | mascaroside | |
| Use(s): natural substances and extractives | ||
| 55466-04-1 | jujuboside A | |
| Use(s): natural substances and extractives | ||
| 55468-88-7 | phenoxyethyl paraben | |
| EC: 259-654-2 Use(s): antimicrobial agents | ||
| 55486-06-1 | nepetoidin B | |
| Use(s): natural substances and extractives | ||
| 55487-20-2 | 3- | methyl-1,2-dithiolane |
| Use(s): information only not used for fragrances or flavors | ||
| 55505-28-7 | 9- | methyl decan-1-ol |
| EC: 259-679-9 Use(s): flavor and fragrance agents | ||
| 55512-33-9 | pyridate | |
| EC: 259-686-7 Use(s): herbicides / pesticides | ||
| 55514-48-2 | ethyl tiglate | |
| EC: 259-688-8 Use(s): flavor and fragrance agents | ||
| 55528-90-0 | valeranone | |
| Use(s): natural substances and extractives | ||
| 55546-11-7 | 4- | methyl-2-(2-methyl-1-propenyl)-1,3-dioxane |
| EC: 259-702-2 Use(s): information only not used for fragrances or flavors | ||
| 55563-79-6 | (S)-(+)-4- | penten-2-ol |
| Use(s): flavoring agents | ||
| 55589-62-3 | acesulfame potassium | |
| EC: 259-715-3 Use(s): sweeteners, flavor enhancers | ||
| 55590-83-5 | 2- | methyl butyl valerate |
| EC: 259-716-9 Use(s): natural substances and extractives | ||
| 55610-01-0 | cepharadione A | |
| Use(s): natural substances and extractives | ||
| 55610-02-1 | cepharadione B | |
| Use(s): natural substances and extractives | ||
| 55627-02-6 | nojigiku acetate | |
| Use(s): natural substances and extractives | ||
| 55636-50-5 | polydiethyleneglycol adipate/IPDI copolymer | |
| Use(s): film forming agents | ||
| 55638-41-0 | muquketone | |
| Use(s): natural substances and extractives | ||
| 55659-42-2 | 6- | camphenone |
| Use(s): natural substances and extractives | ||
| 55664-77-2 | methyl furfuryl alcohol | |
| Use(s): natural substances and extractives | ||
| 55682-88-7 | methyl 11,14,17-eicosatrienoate | |
| Use(s): natural substances and extractives | ||
| 55682-92-3 | methyl octacosanoate | |
| EC: 259-754-6 Use(s): natural substances and extractives | ||
| 55692-59-6 | cyclovariegatin | |
| Use(s): natural substances and extractives | ||
| 55695-36-8 | 1-(2,2,4- | trimethyl-3-cyclohexen-1-yl) ethanone |
| EC: 259-760-9 Use(s): information only not used for fragrances or flavors | ||
| 55704-78-4 | meaty dithiane | |
| EC: 259-770-3 FEMA: 3450 JECFA: 562 FLAVIS: 15.006 Use(s): flavor and fragrance agents | ||
| 55708-38-8 | para-3,8- | menthadien-1-ol |
| Use(s): natural substances and extractives | ||
| 55717-54-9 | N- | acetyl-9-O-acetylneuraminic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 55719-85-2 | phenethyl tiglate | |
| EC: 259-774-5 FEMA: 2870 JECFA: 997 FLAVIS: 09.496 Use(s): flavor and fragrance agents | ||
| 55722-59-3 | iso | citral |
| EC: 259-777-1 Use(s): fragrance agents | ||
| 55722-60-6 | cis- | chrysanthenol |
| Use(s): natural substances and extractives | ||
| 55738-53-9 | iso | stearamide MIPA |
| EC: 259-782-9 Use(s): cosmetic agents | ||
| 55739-89-4 | 2- | ethyl-4,4-dimethyl cyclohexanone |
| Use(s): fragrance agents | ||
| 55750-84-0 | crocin 2 | |
| Use(s): natural substances and extractives | ||
| 55750-85-1 | crocin 3 | |
| Use(s): natural substances and extractives | ||
| 55750-86-2 | crocin 4 | |
| Use(s): natural substances and extractives | ||
| 55764-18-6 | 8-oxa | tricyclo[5.3.1.02,6]undecan-9-one |
| EC: 259-798-6 Use(s): information only not used for fragrances or flavors | ||
| 55764-22-2 | S-(2,5- | dimethyl-3-furyl) ethane thioate |
| EC: 259-799-1 FEMA: 4034 JECFA: 1523 FLAVIS: 13.116 Use(s): flavoring agents | ||
| 55764-23-3 | 2,5- | dimethyl-3-furan thiol |
| EC: 259-800-5 FEMA: 3451 JECFA: 1063 FLAVIS: 13.071 Use(s): flavoring agents | ||
| 55764-25-5 | S-(2- | methyl-3-furyl) ethane thioate |
| EC: 259-801-0 FEMA: 3973 JECFA: 1069 FLAVIS: 13.153 Use(s): flavoring agents | ||
| 55764-28-8 | 2,5- | dimethyl-3-thioisovaleryl furan |
| EC: 259-802-6 FEMA: 3482 JECFA: 1070 FLAVIS: 13.041 Use(s): flavoring agents | ||
| 55764-31-3 | 3-(2- | furoyl thio)-2,5-dimethyl furan |
| FEMA: 3481 Use(s): flavoring agents | ||
| 55764-42-6 | 4-oxo-2- | heptenal |
| Use(s): information only not used for fragrances or flavors | ||
| 55781-50-5 | acora-3,9-diene | |
| Use(s): natural substances and extractives | ||
| 55790-53-9 | 1-(10,10- | dimethyl-2,6-bis(methylene) bicyclo(7.2.0)undec-5-yl) ethan-1-one |
| EC: 259-819-9 Use(s): information only not used for fragrances or flavors | ||
| 55806-42-3 | 2,6- | dimethoxy-4-phenanthrenol |
| Use(s): natural substances and extractives | ||
| 55819-53-9 | stearamidopropyl dimethyl amine lactate | |
| EC: 259-837-7 Use(s): cosmetic agents | ||
| 55819-54-0 | stearamidoethyl diethanolamine | |
| EC: 259-838-2 Use(s): antistatic and conditioning agents | ||
| 55837-25-7 | buflomedil | |
| EC: 259-851-3 Use(s): pharmaceuticals / chemical synthisis | ||
| 55840-13-6 | glyceryl stearate citrate | |
| EC: 259-855-5 Use(s): edible emulsifier for modern O/W creams and lotions | ||
| 55852-13-6 | stearamidopropyl morpholine | |
| Use(s): antistatic and conditioning agents | ||
| 55852-14-7 | stearamidopropyl morpholine lactate | |
| EC: 259-860-2 Use(s): antistatic and conditioning agents | ||
| 55852-15-8 | iso | stearamidopropyl dimethylamine lactate |
| Use(s): antistatic and conditioning agents | ||
| 55881-96-4 | sclareol glycol | |
| EC: 259-880-1 Use(s): fragrance agents | ||
| 55894-36-5 | (Z)-2- | methyl-3-pentenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 55894-37-6 | (E)-2- | methyl-3-pentenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 55895-85-7 | diethyl DL-glutamate | |
| Use(s): antistatic and conditioning agents | ||
| 55898-33-4 | lysocellin | |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 55901-20-7 | TEA-PCA | |
| EC: 259-883-8 Use(s): humectants | ||
| 55910-09-3 | propyl cyclohexyl acetate | |
| EC: 259-891-1 Use(s): information only not used for fragrances or flavors | ||
| 55912-03-3 | 4- | hydroxyderricin |
| Use(s): natural substances and extractives | ||
| 55915-70-3 | citronellyl methyl ether | |
| EC: 259-903-5 Use(s): flavor and fragrance agents | ||
| 55921-65-8 | pyrrolidinyl diaminopyrimidine oxide | |
| Use(s): cosmetic agents | ||
| 55925-49-0 | nojigiku alcohol | |
| Use(s): natural substances and extractives | ||
| 55928-65-9 | ethyl (Z)-2-dodecenoate | |
| Use(s): natural substances and extractives | ||
| 55934-93-5 | ppg-3 butyl ether | |
| EC: 259-910-3 Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 55955-74-3 | methyl 2,8-dimethyl undecanoate | |
| Use(s): natural substances and extractives | ||
| 55955-76-5 | methyl 2,4,6-trimethyl undecanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 55955-78-7 | methyl 2-methyl tridecanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 55956-45-1 | 1- | methoxy-3-methylene-2-pentanone |
| Use(s): natural substances and extractives | ||
| 55963-33-2 | distarch phosphate | |
| Use(s): food starch-modified | ||
| 55965-13-4 | ammonium phosphatides | |
| Use(s): emulsifiers | ||
| 55965-23-6 | (1-3,1-4)-beta- | glucan |
| Use(s): food additive | ||
| 55965-84-9 | kathon 886 | |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 55968-41-7 | (Z)-5- | octen-2-ol |
| EC: 259-925-5 Use(s): natural substances and extractives | ||
| 55968-42-8 | 2- | ethyl-5,6,7,8-tetrahydroquinoxaline |
| Use(s): natural substances and extractives | ||
| 55969-57-8 | 5- | hydroxy-7-methoxy-6-methylflavone |
| Use(s): natural substances and extractives | ||
| 55976-14-2 | (Z)-1,4- | undecadiene |
| Use(s): information only not used for fragrances or flavors | ||
| 56001-43-5 | (±)- | nerolidyl acetate |
| EC: 259-941-2 FLAVIS: 09.671 Use(s): flavor and fragrance agents | ||
| 56002-14-3 | peg-10 isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 56002-14-3 | peg-12 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-4 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-6 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-8 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-2 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-20 isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 56002-14-3 | peg-3 isostearate | |
| Use(s): emulsifiers | ||
| 56002-14-3 | peg-30 isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 56002-14-3 | peg-40 isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 56002-14-3 | peg-9 isostearate | |
| Use(s): emulsifiers | ||
| 56005-10-8 | 5-O- | methyl embelin |
| Use(s): natural substances and extractives | ||
| 56006-48-5 | (R)-2- | ethyl hexanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 56009-31-5 | methyl 3-hydroxypentanoate | |
| Use(s): natural substances and extractives | ||
| 56009-40-6 | methyl 2-hydroxytetradecanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 56011-02-0 | green ether | |
| EC: 259-943-3 FEMA: 4635 JECFA: 2136 Use(s): flavor and fragrance agents | ||
| 56014-69-8 | (E)-3-(2- | methylpropylidene)-1(3H)-isobenzofuranone |
| Use(s): natural substances and extractives | ||
| 56038-13-2 | sucralose | |
| EC: 259-952-2 Use(s): sweeteners, flavor enhancers | ||
| 56039-58-8 | benzylidene camphor sulfonic acid | |
| Use(s): cosmetic UV absorber, UV filters | ||
| 56045-79-5 | dictagymnin | |
| Use(s): natural substances and extractives | ||
| 56052-15-4 | para- | anisyl heptanoate |
| Use(s): information only not used for fragrances or flavors | ||
| 56053-84-0 | butyl 2-thenoate | |
| EC: 259-970-0 Use(s): information only not used for fragrances or flavors | ||
| 56057-93-3 | 5-iso | propenyl-2-methyl pyridine |
| EC: 259-971-6 Use(s): fragrance agents | ||
| 56058-69-6 | (E)- | ocimene quintoxide |
| EC: 259-974-2 Use(s): flavor and fragrance agents | ||
| 56058-70-9 | (Z)- | ocimene quintoxide |
| EC: 259-975-8 Use(s): flavor and fragrance agents | ||
| 56078-38-7 | lauryl 2-ethyl hexanoate | |
| EC: 259-982-6 Use(s): emollients, skin conditioning | ||
| 56078-97-8 | 5- | methyl-3-furanthiol |
| Use(s): information only not used for fragrances or flavors | ||
| 56079-02-8 | 4- | mercapto-2-methyl-4,5-dihydrothiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 56090-54-1 | polyglycerin-3 | |
| EC: 259-986-8 Use(s): humectants | ||
| 56090-69-8 | peg/ppg-15/15 allyl ether acetate | |
| Use(s): emulsifiers, surfactants | ||
| 56105-46-5 | iso | butyl linalool |
| EC: 259-994-1 Use(s): fragrance agents | ||
| 56107-04-1 | para-tert- | butyl phenyl isobutanol |
| EC: 259-996-2 Use(s): fragrance agents | ||
| 56134-03-3 | (Z,Z)- | heptadeca-1,8,11-triene |
| EC: 260-005-0 Use(s): natural substances and extractives | ||
| 56134-05-5 | neroli aldehyde | |
| EC: 260-006-6 FLAVIS: 05.143 Use(s): flavor and fragrance agents | ||
| 56143-68-1 | tricyclodehydroisohumulone | |
| Use(s): natural substances and extractives | ||
| 56144-22-0 | cytochalasin J | |
| Use(s): natural substances and extractives | ||
| 56144-27-5 | trans-beta-sesqui | phellandrol |
| Use(s): natural substances and extractives | ||
| 56158-55-5 | dimethyl fukiic acid | |
| Use(s): natural substances and extractives | ||
| 56172-46-4 | geranyl crotonate | |
| EC: 260-027-0 Use(s): fragrance agents | ||
| 56180-94-0 | acarbose | |
| EC: 260-030-7 Use(s): natural substances and extractives | ||
| 56192-70-2 | (Z)-alpha- | atlantone |
| Use(s): natural substances and extractives | ||
| 56195-37-0 | 10- | undecen-1-yl butyrate |
| Use(s): information only not used for fragrances or flavors | ||
| 56196-53-3 | ethyl 4-methyl octanoate | |
| EC: 260-051-1 Use(s): flavoring agents | ||
| 56216-28-5 | 2,6- | dimethoxy-3,5-pyridine diamine HCl |
| EC: 260-062-1 Use(s): hair dyeing agents | ||
| 56218-64-5 | (E)-8- | tetradecen-1-yl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 56218-72-5 | (E)-11- | hexadecen-1-yl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 56218-79-2 | (Z)-9- | tetradecen-1-yl formate |
| EC: 260-063-7 Use(s): natural substances and extractives | ||
| 56219-04-6 | (Z)-9- | hexadecenal |
| EC: 260-064-2 Use(s): natural substances and extractives | ||
| 56219-10-4 | ethyl palmitoleate | |
| EC: 260-065-8 Use(s): natural substances and extractives | ||
| 56235-92-8 | dioctyl malate | |
| EC: 260-070-5 Use(s): emollients, skin conditioning | ||
| 56239-91-9 | iso | jasmol |
| EC: 260-074-7 Use(s): information only not used for fragrances or flavors | ||
| 56252-02-9 | hydroxyanigorufone | |
| Use(s): natural substances and extractives | ||
| 56252-04-1 | 4- | phenyl-1H,3H-naphtho[1,8-cd]pyran-1,3-dione |
| Use(s): natural substances and extractives | ||
| 56252-32-5 | anigorufone | |
| Use(s): natural substances and extractives | ||
| 56253-91-9 | hexadecyl eicosanoic acid | |
| EC: 260-078-9 Use(s): viscosity controlling agents | ||
| 56255-31-3 | palmitoyl alanine | |
| Use(s): cosmetic ingredient for skin protecting | ||
| 56255-48-2 | 2,3- | butane diol monoacetate |
| Use(s): natural substances and extractives | ||
| 56257-28-4 | 4',7- | dihydroxy-2'-methoxy-3'-prenylisoflavan |
| Use(s): natural substances and extractives | ||
| 56265-06-6 | arginine PCA | |
| EC: 260-081-5 Use(s): humectants | ||
| 56269-22-8 | 2,4,6- | nonatrienal |
| FEMA: 4187 JECFA: 1785 FLAVIS: 05.173 Use(s): flavoring agents | ||
| 56275-01-5 | trimethylsiloxysilicate | |
| Use(s): antifoaming, emollient agents | ||
| 56275-39-9 | ubiquinol | |
| Use(s): cosmetic agents | ||
| 56277-00-0 | iso | jasmyl acetate |
| EC: 260-090-4 Use(s): information only not used for fragrances or flavors | ||
| 56283-67-1 | lucernic acid | |
| Use(s): natural substances and extractives | ||
| 56292-66-1 | 2,5- | dimethyl tridecane |
| Use(s): natural substances and extractives | ||
| 56297-79-1 | (S)-5,7- | dihydroxy-6,8-dimethylflavanone |
| Use(s): natural substances and extractives | ||
| 56298-90-9 | 4- | methyl-2-heptanol |
| Use(s): natural substances and extractives | ||
| 56316-35-9 | agavasaponin C | |
| Use(s): natural substances and extractives | ||
| 56329-42-1 | zinc methionine sulfate | |
| EC: 260-113-8 Use(s): special dietary and nutritional additives | ||
| 56343-26-1 | helichrysoside | |
| Use(s): natural substances and extractives | ||
| 56345-05-2 | shisool acetate | |
| Use(s): information only not used for fragrances or flavors | ||
| 56353-15-2 | acetyl carnosine | |
| EC: 260-123-2 Use(s): cosmetic ingredient for skin protecting | ||
| 56374-21-1 | 7- | methoxycitronellic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 56388-43-3 | disodium oleamido peg-2 sulfosuccinate | |
| EC: 260-143-1 Use(s): cosmetic agents | ||
| 56388-44-4 | disodium lauramido peg-2 sulfosuccinate | |
| Use(s): cosmetic agents | ||
| 56422-50-5 | neo | dihydrocarvyl acetate |
| FLAVIS: 09.355 Use(s): flavoring agents | ||
| 56423-40-6 | benzyl 2-methyl butyrate | |
| EC: 260-169-3 FLAVIS: 09.313 Use(s): flavor and fragrance agents | ||
| 56423-43-9 | heptyl isovalerate | |
| EC: 260-170-9 FLAVIS: 09.392 Use(s): flavor and fragrance agents | ||
| 56423-45-1 | carvone 8,9-oxide | |
| Use(s): natural substances and extractives | ||
| 56423-47-3 | dehydrocarvacrol | |
| Use(s): information only not used for fragrances or flavors | ||
| 56423-48-4 | 5- | hydroxycarvone |
| Use(s): natural substances and extractives | ||
| 56424-97-6 | methyl (E,E)-2,4-heptadienoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 56425-91-3 | flurprimidol | |
| Use(s): herbicides / pesticides | ||
| 56426-65-4 | 2-iso | propenyl benzofuran |
| Use(s): information only not used for fragrances or flavors | ||
| 56438-09-6 | heptylidene diacetate | |
| EC: 260-182-4 Use(s): fragrance agents | ||
| 56449-05-9 | ppg-6-sorbeth-245 | |
| EC: 500-132-3 Use(s): binding, emollient agents | ||
| 56449-05-9 | ppg-6-sorbeth-500 | |
| EC: 500-132-3 Use(s): binding, emulsifier agents | ||
| 56449-50-4 | sucrose polybehenate | |
| EC: 297-409-1 Use(s): emollients, emulsifiers, skin conditioning, surfactants | ||
| 56449-51-5 | sucrose polylinoleate | |
| EC: 260-188-7 Use(s): emollients, emulsifiers, surfactants | ||
| 56469-39-7 | (2R,5S)- | linalool oxide(5) acetate |
| FLAVIS: 13.189 Use(s): flavor and fragrance agents | ||
| 56484-24-3 | 5,8- | epoxydaucane |
| Use(s): natural substances and extractives | ||
| 56486-94-3 | nor | artocarpanone |
| Use(s): natural substances and extractives | ||
| 56491-53-3 | polyglycerin-4 | |
| Use(s): humectants | ||
| 56495-82-0 | irisquinone | |
| Use(s): natural substances and extractives | ||
| 56496-89-0 | 2,6- | dimethyl-p-phenylenediamine HCl |
| EC: 260-223-6 Use(s): hair dyeing agents | ||
| 56497-92-8 | sagittariol | |
| Use(s): natural substances and extractives | ||
| 56505-80-7 | decanoyl acetaldehyde | |
| Use(s): natural substances and extractives | ||
| 56518-48-0 | 4- | chloro-3,5-dimethoxybenzaldehyde |
| Use(s): natural substances and extractives | ||
| 56519-71-2 | 1,3- | propanediol dicaprylate |
| Use(s): emollients | ||
| 56522-15-7 | obtusilactone A | |
| Use(s): natural substances and extractives | ||
| 56522-16-8 | iso | obtusilactone A |
| Use(s): natural substances and extractives | ||
| 56532-40-2 | MEA undecylenate | |
| EC: 260-247-7 Use(s): preservatives | ||
| 56539-66-3 | methoxymethyl butanol | |
| EC: 260-252-4 Use(s): solvents | ||
| 56554-53-1 | triisononanoin | |
| EC: 260-257-1 Use(s): cosmetic agents, light ester for improved skin and color cosmetics | ||
| 56554-87-1 | 16- | octadecenal |
| FLAVIS: 05.218 Use(s): information only not used for fragrances or flavors | ||
| 56565-66-3 | trioleth-8 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 56577-25-4 | (R)- | tetrahydrolinalool |
| Use(s): flavor and fragrance agents | ||
| 56578-18-8 | (E)-5- | decen-1-ol |
| EC: 260-267-6 Use(s): natural substances and extractives | ||
| 56578-35-9 | (E)-4- | methyl cinnamaldehyde |
| Use(s): flavor and fragrance agents | ||
| 56614-57-4 | camphanediol | |
| Use(s): cosmetic agents | ||
| 56617-66-4 | desmethoxyviridiol | |
| Use(s): natural substances and extractives | ||
| 56630-76-3 | ethyl 2-ethyl-3-methyl-3-phenyl glycidate | |
| Use(s): flavor and fragrance agents | ||
| 56633-28-4 | alpha- | panasinsene |
| Use(s): natural substances and extractives | ||
| 56639-51-1 | aluminum dimyristate | |
| EC: 260-305-1 Use(s): cosmetic agents | ||
| 56640-69-8 | 1- | buten-1-ol |
| Use(s): natural substances and extractives | ||
| 56645-02-4 | pectin amide | |
| Use(s): thickeners, gelling agents, stabalizers and emulsifiers | ||
| 56645-88-6 | aloinoside A | |
| Use(s): natural substances and extractives | ||
| 56681-06-2 | 4-(2,3,6- | trimethyl phenyl)-3-buten-2-one |
| FLAVIS: 07.206 Use(s): flavoring agents | ||
| 56683-54-6 | (Z)-11- | hexadecen-1-ol |
| EC: 260-337-6 Use(s): natural substances and extractives | ||
| 56684-69-9 | beta-neo | clovene |
| Use(s): natural substances and extractives | ||
| 56684-87-8 | batatasin III | |
| Use(s): natural substances and extractives | ||
| 56684-97-0 | beta- | panasinsene |
| Use(s): natural substances and extractives | ||
| 56687-75-3 | 8alpha,13R- | epoxy-14-labden-19-oic acid |
| Use(s): natural substances and extractives | ||
| 56700-78-8 | (E,E)-2,4- | nonadiene |
| FEMA: 4292 JECFA: 2192 FLAVIS: 01.078 Use(s): flavoring agents | ||
| 56709-13-8 | polymethoxy bicyclic oxazolidine | |
| Use(s): antimicrobial agents | ||
| 56718-71-9 | 4-(2- | methoxyethyl) phenol |
| EC: 260-354-9 Use(s): pharmaceuticals / chemical synthisis | ||
| 56722-23-7 | 1,5- | undecadien-3-ol |
| FLAVIS: 02.211 Use(s): natural substances and extractives | ||
| 56746-86-2 | hexyl methicone | |
| Use(s): emollients, skin conditioning | ||
| 56747-96-7 | caryophyllene alcohol | |
| EC: 260-364-3 FEMA: 4410 Use(s): flavor and fragrance agents | ||
| 56752-50-2 | (E)- | linalool oxide(6) acetate |
| Use(s): natural substances and extractives | ||
| 56758-73-7 | 2- | methyl-2,3-pentadienoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 56767-18-1 | (E,E)-2,6- | octadienal |
| EC: 260-372-7 FEMA: 3466 JECFA: 1182 FLAVIS: 05.111 Use(s): flavoring agents | ||
| 56770-25-3 | (E)-3- | undecenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 56775-64-5 | benzyl gentiobioside | |
| Use(s): natural substances and extractives | ||
| 56776-10-4 | (E)-9- | tetradecen-1-yl formate |
| Use(s): information only not used for fragrances or flavors | ||
| 56779-64-7 | (Z)- | linalool oxide(6) acetate |
| Use(s): natural substances and extractives | ||
| 56780-58-6 | starch hydroxypropyltrimonium chloride | |
| Use(s): cosmetic agents | ||
| 56795-51-8 | 7- | acetoxy-6-methoxycoumarin |
| Use(s): natural substances and extractives | ||
| 56796-91-9 | 7- | methyl hexadecanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 56797-40-1 | (Z)-7- | hexadecenal |
| Use(s): natural substances and extractives | ||
| 56797-41-2 | (Z)-8- | heptadecenal |
| Use(s): natural substances and extractives | ||
| 56797-42-3 | (Z,Z)-8,11- | heptadecadienal |
| Use(s): natural substances and extractives | ||
| 56797-43-4 | (Z,Z,Z)-7,10,13- | hexadecatrienal |
| Use(s): natural substances and extractives | ||
| 56797-44-5 | (Z,Z,Z)-8,11,14- | heptadecatrienal |
| Use(s): natural substances and extractives | ||
| 56798-34-6 | flavokawain C | |
| Use(s): natural substances and extractives | ||
| 56805-23-3 | (E,Z)-3,6- | nonadien-1-ol |
| FEMA: 3884 JECFA: 1284 FLAVIS: 02.243 Use(s): flavor and fragrance agents | ||
| 56816-01-4 | (S)- | grape butyrate |
| EC: 260-393-1 Use(s): information only not used for fragrances or flavors | ||
| 56827-95-3 | tricetyl phosphate | |
| Use(s): film forming, plasticiser agents | ||
| 56836-93-2 | muguet butanol | |
| EC: 260-398-9 Use(s): fragrance agents | ||
| 56842-80-9 | manganese adenosine triphosphate | |
| Use(s): antioxidants, skin conditioning | ||
| 56851-34-4 | 5- | methyl-2-undecene |
| Use(s): natural substances and extractives | ||
| 56857-65-9 | agavoside A | |
| Use(s): natural substances and extractives | ||
| 56857-66-0 | agavoside B | |
| Use(s): natural substances and extractives | ||
| 56862-62-5 | 10- | methyl nonadecane |
| Use(s): natural substances and extractives | ||
| 56863-02-6 | linoleamide DEA | |
| EC: 260-410-2 Use(s): cosmetic agents | ||
| 56882-00-9 | turbinaric acid | |
| Use(s): natural substances and extractives | ||
| 56889-98-6 | (Z)-6- | nonen-2-one |
| Use(s): natural substances and extractives | ||
| 56891-99-7 | 5- | bean pyrazine |
| FEMA: 3358 Use(s): flavor and fragrance agents | ||
| 56898-37-4 | methyl 2-methyl nonanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 56915-02-7 | 3- | hydroxy-beta-damascone |
| EC: 260-430-1 Use(s): natural substances and extractives | ||
| 56922-72-6 | amyl senecioate | |
| EC: 260-436-4 Use(s): information only not used for fragrances or flavors | ||
| 56922-73-7 | iso | amyl senecioate |
| EC: 260-438-5 Use(s): flavoring agents | ||
| 56922-74-8 | (E)-2- | hexen-1-yl valerate |
| EC: 260-439-0 FEMA: 3935 JECFA: 1379 Use(s): flavor and fragrance agents | ||
| 56922-75-9 | (Z)-2- | hexen-1-yl acetate |
| EC: 260-440-6 Use(s): natural substances and extractives | ||
| 56922-76-0 | (Z)-2- | hexen-1-yl propionate |
| Use(s): information only not used for fragrances or flavors | ||
| 56922-77-1 | (Z)-2- | hexen-1-yl butyrate |
| Use(s): natural substances and extractives | ||
| 56922-79-3 | (Z)-2- | hexen-1-yl hexanoate |
| EC: 260-441-1 Use(s): natural substances and extractives | ||
| 56922-80-6 | (E)-3- | hexen-1-yl formate |
| EC: 260-442-7 FLAVIS: 09.562 Use(s): flavoring agents | ||
| 56922-81-7 | (E)-3- | hexen-1-yl valerate |
| EC: 260-443-2 Use(s): flavor and fragrance agents | ||
| 56922-82-8 | (E)-3- | hexen-1-yl hexanoate |
| EC: 260-444-8 FLAVIS: 09.855 Use(s): flavor and fragrance agents | ||
| 56933-26-7 | glycerol tritetracosanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 56941-91-4 | methyl (E)-14-methyl-8-hexadecenoate | |
| EC: 260-456-3 Use(s): natural substances and extractives | ||
| 56961-73-0 | 1- | phenethyl isovalerate |
| EC: 260-474-1 Use(s): fragrance agents | ||
| 56973-41-2 | withanolide B | |
| Use(s): natural substances and extractives | ||
| 56973-85-4 | galbascone (IFF) | |
| EC: 260-486-7 Use(s): fragrance agents | ||
| 56973-87-6 | dimethyl cyclohexyl 3-butenyl ketone | |
| Use(s): fragrance agents | ||
| 56986-88-0 | 2- | ethyl-3-methyl pyridine |
| Use(s): natural substances and extractives | ||
| 56994-83-3 | 2- | cinnamoyl-1-galloyl-beta-D-glucopyranose |
| Use(s): natural substances and extractives | ||
| 57006-69-6 | (E,E)- | sorbyl acetate |
| Use(s): flavoring agents | ||
| 57006-87-8 | acetaldehyde butyl ethyl acetal | |
| FLAVIS: 06.050 Use(s): flavoring agents | ||
| 57018-04-9 | tolclofos-methyl | |
| EC: 260-515-3 Use(s): herbicides / pesticides | ||
| 57018-52-7 | propylene glycol tert-butyl ether | |
| Use(s): solvents | ||
| 57018-53-8 | (E,E,E)-2,4,6- | nonatrienal |
| FEMA: 4187 JECFA: 1785 FLAVIS: 05.173 Use(s): flavoring agents | ||
| 57022-38-5 | decarboxy carnosine HCl | |
| EC: 415-470-6 Use(s): antistatic, hair conditioning, skin conditioning | ||
| 57067-07-9 | 2- | methylthiolane-3-thiol |
| Use(s): information only not used for fragrances or flavors | ||
| 57069-86-0 | dehydrodihydroionol | |
| FEMA: 3446 JECFA: 397 FLAVIS: 02.092 Use(s): flavor and fragrance agents | ||
| 57069-87-1 | alpha,6,6- | trimethyl-2-methylene cyclohex-3-ene-1-propan-1-ol |
| EC: 260-538-9 Use(s): fragrance agents | ||
| 57074-34-7 | trans- | buchu mercaptan acetate |
| EC: 260-546-2 FEMA: 3809 JECFA: 506 Use(s): flavor and fragrance agents | ||
| 57074-35-8 | S- | buchu mercaptan acetate |
| EC: 260-547-8 Use(s): information only not used for fragrances or flavors | ||
| 57074-37-0 | (Z)-4- | decen-1-ol |
| EC: 260-548-3 FEMA: 4349 JECFA: 1633 Use(s): flavor and fragrance agents | ||
| 57082-24-3 | beta- | caryophyllene alcohol acetate |
| EC: 260-555-1 Use(s): flavor and fragrance agents | ||
| 57092-32-7 | 12- | methyl-13-tridecanolide |
| Use(s): natural substances and extractives | ||
| 57093-94-4 | propionaldehyde dimethylthio acetal | |
| Use(s): information only not used for fragrances or flavors | ||
| 57094-35-6 | iso | valeraldehyde dimethyl acetal |
| Use(s): information only not used for fragrances or flavors | ||
| 57094-40-3 | herbal undecanol | |
| EC: 260-558-8 Use(s): fragrance agents | ||
| 57095-92-8 | 10,11- | dihydro-6-oxoatlantone |
| Use(s): natural substances and extractives | ||
| 57103-47-6 | epi | heterodendrin |
| Use(s): natural substances and extractives | ||
| 57103-57-8 | glyceollins | |
| Use(s): skin conditioning, skin protecting | ||
| 57105-48-3 | indoleacetyl glutamic acid | |
| Use(s): cosmetic ingredient for skin protecting | ||
| 57105-50-7 | indol acetyl phenylalanine | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 57107-97-8 | peg-12 glyceryl dioleate | |
| Use(s): emulsifiers | ||
| 57107-97-8 | peg-5 glyceryl sesquioleate | |
| Use(s): emulsifiers | ||
| 57124-87-5 | 2- | methyl-3-tetrahydrofuran thiol |
| EC: 260-572-4 FEMA: 3787 JECFA: 1090 FLAVIS: 13.160 Use(s): flavoring agents | ||
| 57129-09-6 | trans-iso | pulegone |
| Use(s): natural substances and extractives | ||
| 57129-12-1 | (1R,4S)- | buchu mercaptan acetate |
| EC: 260-576-6 Use(s): flavor and fragrance agents | ||
| 57130-28-6 | cis- | piperitone oxide |
| Use(s): natural substances and extractives | ||
| 57160-72-2 | 5- | methyl nonadecane |
| Use(s): natural substances and extractives | ||
| 57160-73-3 | 6- | methyl nonadecane |
| Use(s): information only not used for fragrances or flavors | ||
| 57160-74-4 | 7- | methyl nonadecane |
| Use(s): natural substances and extractives | ||
| 57194-69-1 | (Z)- | cinnamaldehyde |
| Use(s): flavor and fragrance agents | ||
| 57197-36-1 | ethyl levulinate ethylene glycol ketal | |
| Use(s): information only not used for fragrances or flavors | ||
| 57203-01-7 | (S)- | tetrahydrofurfuryl alcohol |
| Use(s): information only not used for fragrances or flavors | ||
| 57233-03-1 | N- | WS-12 |
| Use(s): information only not used for fragrances or flavors | ||
| 57246-59-0 | 4- | butyl-5-propylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 57246-60-3 | 4- | butyl-5-methyl thiazole |
| EC: 260-645-0 Use(s): flavor and fragrance agents | ||
| 57246-61-4 | 4- | ethyl-5-propyl thiazole |
| EC: 260-646-6 Use(s): natural substances and extractives | ||
| 57246-62-5 | 4- | butyl-5-ethylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 57246-63-6 | 5- | butyl-4-ethylthiazole |
| Use(s): information only not used for fragrances or flavors | ||
| 57266-86-1 | (Z)-2- | heptenal |
| Use(s): natural substances and extractives | ||
| 57282-49-2 | laevo- | lysine acetate |
| EC: 260-664-4 Use(s): special dietary and nutritional additives | ||
| 57283-79-1 | (E)-5-iso | propyl-3-hepten-2-one |
| Use(s): natural substances and extractives | ||
| 57302-28-0 | 2- | methyl thioethyl acetamide |
| Use(s): information only not used for fragrances or flavors | ||
| 57345-19-4 | amber oxepin | |
| EC: 260-686-4 Use(s): fragrance agents | ||
| 57350-34-2 | epsilon- | damascone |
| Use(s): information only not used for fragrances or flavors | ||
| 57361-71-4 | coroloside | |
| Use(s): natural substances and extractives | ||
| 57371-42-3 | benzyl eugenol | |
| EC: 260-703-5 Use(s): flavor and fragrance agents | ||
| 57378-68-4 | delta- | damascone |
| EC: 260-709-8 FEMA: 3622 JECFA: 386 FLAVIS: 07.130 Use(s): flavor and fragrance agents | ||
| 57378-84-4 | ethyl (Z,Z)-3,7,11-trimethyl-2,4-dodecadienoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 57396-75-5 | 3,4- | dimethyl-2,4,6-octatriene |
| Use(s): natural substances and extractives | ||
| 57402-36-5 | docosanal | |
| Use(s): natural substances and extractives | ||
| 57403-32-4 | butyl heptine carbonate | |
| EC: 260-720-8 FLAVIS: 09.335 Use(s): flavoring agents | ||
| 57414-16-1 | myristyl mercaptoacetate | |
| EC: 260-726-0 Use(s): information only not used for fragrances or flavors | ||
| 57448-83-6 | allantoin ascorbate | |
| EC: 260-739-1 Use(s): antioxidants, skin conditioning | ||
| 57450-97-2 | aminoethylacrylate phosphate/acrylates copolymer | |
| Use(s): antistatic, film forming agents | ||
| 57455-37-5 | ci 77007 | |
| Use(s): coloring agents | ||
| 57458-57-8 | stigmast-4-ene-3,6-dione | |
| Use(s): natural substances and extractives | ||
| 57459-42-4 | potamogetonin | |
| Use(s): natural substances and extractives | ||
| 57461-21-9 | (E)- | trimethyl phenyl butenone |
| Use(s): flavor and fragrance agents | ||
| 57462-46-1 | vestitone | |
| Use(s): natural substances and extractives | ||
| 57472-68-1 | dipropylene glycol diacrylate | |
| Use(s): film forming agents | ||
| 57486-09-6 | sodium oleth-7 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 57486-09-6 | sodium oleth-8 phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 57491-33-5 | (E)-11- | hexadecenal |
| EC: 260-765-3 Use(s): natural substances and extractives | ||
| 57494-10-7 | 4-iso | propyl-6-methyl tetral-1-one |
| Use(s): natural substances and extractives | ||
| 57499-41-9 | 2,3- | dehydrosilychristin |
| Use(s): natural substances and extractives | ||
| 57500-00-2 | methyl furfuryl disulfide | |
| EC: 260-773-7 FEMA: 3362 JECFA: 1078 FLAVIS: 13.064 Use(s): flavor and fragrance agents | ||
| 57533-90-1 | diisocetyl adipate | |
| EC: 260-799-9 Use(s): cosmetic agents | ||
| 57539-47-6 | magnesium palmitoyl glutamate | |
| EC: 260-800-2 Use(s): cosmetic ingredient for skin conditioning | ||
| 57548-36-4 | (±)-4- | hydroxy-6-methyl-2-heptanone |
| FEMA: 4784 Use(s): flavoring agents | ||
| 57556-08-8 | 3- | methoxy-2,5-dimethyl thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 57556-12-4 | 3- | methoxy-2,5-dimethyl furan |
| Use(s): information only not used for fragrances or flavors | ||
| 57566-47-9 | iso | furanodiene |
| Use(s): natural substances and extractives | ||
| 57568-20-4 | octyldodecyl lactate | |
| Use(s): emollients | ||
| 57568-60-2 | spicy acrolein | |
| FEMA: 3586 JECFA: 1502 Use(s): flavor and fragrance agents | ||
| 57569-40-1 | bis(2-(1,1- | dimethylethyl)-6-((3-(1,1-dimethylethyl)-2-hydroxy-5-methylphenyl)methyl)-4-methylphenyl) terephthalate |
| EC: 260-815-4 Use(s): indirect food additives: adhesives and components of coatings | ||
| 57569-76-3 | glycereth-7 triacetate | |
| Use(s): emollients | ||
| 57576-09-7 | iso | pulegyl acetate |
| EC: 260-820-1 FEMA: 2965 JECFA: 756 FLAVIS: 09.219 Use(s): flavor and fragrance agents | ||
| 57576-14-4 | alpha- | cyclogeranyl nitrile |
| EC: 260-821-7 Use(s): information only not used for fragrances or flavors | ||
| 57582-42-0 | cetyl acetoacetate | |
| EC: 260-825-9 Use(s): information only not used for fragrances or flavors | ||
| 57582-46-4 | cinnamyl acetoacetate | |
| EC: 260-826-4 Use(s): flavor and fragrance agents | ||
| 57583-34-3 | mono | methyltin tris(ethylhexyl mercaptoacetate) |
| EC: 260-828-5 Use(s): indirect food additives: adhesives and components of coatings | ||
| 57583-35-4 | dimethyltin bis(ethylhexyl mercaptoacetate) | |
| EC: 260-829-0 Use(s): indirect food additives: adhesives and components of coatings | ||
| 57593-01-8 | magnesium diicosanoate | |
| EC: 260-840-0 Use(s): food additive | ||
| 57593-78-9 | beta- | citraurol |
| Use(s): natural substances and extractives | ||
| 57601-56-6 | disodium azacycloheptane diphosphonate | |
| EC: 260-083-6 Use(s): chelating agents | ||
| 57602-94-5 | (E)-4- | decenoic acid |
| EC: 260-843-7 Use(s): information only not used for fragrances or flavors | ||
| 57606-04-9 | sodium alginate | |
| Use(s): thickeners, gelling agents, stabalizers and emulsifiers | ||
| 57609-01-5 | copper laevo-aspartate | |
| Use(s): special dietary and nutritional additives | ||
| 57635-48-0 | akypo ro 50 | |
| Use(s): cleansing, surfactants | ||
| 57635-48-0 | oleth-10 carboxylic acid | |
| Use(s): cleansing, surfactants | ||
| 57635-48-0 | oleth-3 carboxylic acid | |
| Use(s): cleansing, surfactants | ||
| 57643-02-4 | (Z)-2- | penten-3-ol |
| Use(s): natural substances and extractives | ||
| 57648-55-2 | (E)-3- | octen-2-ol |
| Use(s): natural substances and extractives | ||
| 57661-23-1 | 6- | hexadecanone |
| EC: 260-885-6 Use(s): information only not used for fragrances or flavors | ||
| 57675-44-2 | trimethylolpropane trioleate | |
| EC: 260-895-0 Use(s): information only not used for fragrances or flavors | ||
| 57681-53-5 | 5- | propyl furan-2(5H)-one |
| EC: 260-902-7 Use(s): flavoring agents | ||
| 57683-45-1 | iso | stearyl oleate |
| Use(s): information only not used for fragrances or flavors | ||
| 57696-89-6 | 3,5,5- | trimethyl cyclohexane-1,2-dione |
| Use(s): natural substances and extractives | ||
| 57710-57-3 | heptelidic acid | |
| Use(s): natural substances and extractives | ||
| 57717-97-2 | (R)-(+)- | perillyl alcohol |
| Use(s): flavor and fragrance agents | ||
| 57726-26-8 | 4- | hydroxybenzyl ethyl ether |
| EC: 260-918-4 FLAVIS: 04.091 Use(s): flavoring agents | ||
| 57726-27-9 | 4-( | butoxymethyl)phenol |
| Use(s): natural substances and extractives | ||
| 57743-63-2 | wine lactone | |
| FEMA: 4140 JECFA: 2223 FLAVIS: 10.057 Use(s): flavor and fragrance agents | ||
| 57753-66-9 | ethyl 4-hydroxyoctanoate | |
| Use(s): natural substances and extractives | ||
| 57789-30-7 | cymbopogone | |
| Use(s): natural substances and extractives | ||
| 57799-95-8 | 10- | acetoxyligustroside |
| Use(s): natural substances and extractives | ||
| 57800-41-6 | vignafuran | |
| Use(s): natural substances and extractives | ||
| 57803-73-3 | (S)-(+)-5- | methyl heptan-1-ol |
| Use(s): natural substances and extractives | ||
| 57817-89-7 | enzyme modified | steviol glycosides |
| EC: 260-975-5 FEMA: 4876 Use(s): sweeteners, flavor enhancers | ||
| 57817-89-7 | stevioside | |
| EC: 260-975-5 FEMA: 4763 Use(s): sweeteners, flavor enhancers | ||
| 57818-36-7 | 3,4- | dimethyl-5-pentyl-2-furanundecanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 57818-39-0 | 10,13- | epoxy-11-methyl octadeca-10,12-dienoic acid |
| Use(s): natural substances and extractives | ||
| 57818-40-3 | 3,4- | dimethyl-5-pentyl-2-furannonanoic acid |
| Use(s): natural substances and extractives | ||
| 57829-61-5 | sodium steareth-4 phosphate | |
| Use(s): emulsifiers | ||
| 57856-81-2 | allyl decanoate | |
| EC: 260-992-8 Use(s): flavor and fragrance agents | ||
| 57859-47-9 | 3- | hexenyl isobutyrate |
| EC: 260-993-3 Use(s): natural substances and extractives | ||
| 57866-08-7 | tetracosanal | |
| Use(s): natural substances and extractives | ||
| 57877-72-2 | 5- | methyl-2-octyl-3(2H)-furanone |
| Use(s): natural substances and extractives | ||
| 57893-27-3 | 6- | acetoxydihydrotheaspirane |
| EC: 261-005-3 FEMA: 3651 JECFA: 1647 FLAVIS: 13.087 Use(s): flavor and fragrance agents | ||
| 57897-70-8 | 7- | methyl-1-benzofuran-2-carbaldehyde |
| Use(s): information only not used for fragrances or flavors | ||
| 57934-97-1 | rose carboxylate | |
| EC: 261-020-5 Use(s): fragrance agents | ||
| 57943-67-6 | phenethyl nonanoate | |
| EC: 261-029-4 Use(s): flavor and fragrance agents | ||
| 57960-19-7 | acequinocyl | |
| Use(s): herbicides / pesticides | ||
| 57963-77-6 | (Z)- | octahydrotrimethyl-4a-naphthalenol |
| Use(s): fragrance agents | ||
| 57966-95-7 | cymoxanil | |
| EC: 261-043-0 Use(s): herbicides / pesticides | ||
| 57967-68-7 | (2R,5S,6S)-6- | hydroxydihydrotheaspirane |
| EC: 261-044-6 FEMA: 3549 FLAVIS: 13.076 Use(s): flavor and fragrance agents | ||
| 57967-69-8 | (2R,5S,6R)-6- | hydroxydihydrotheaspirane |
| EC: 261-045-1 Use(s): information only not used for fragrances or flavors | ||
| 57967-70-1 | (2R,5R,6R)-6- | hydroxydihydrotheaspirane |
| EC: 261-046-7 Use(s): information only not used for fragrances or flavors | ||
| 57967-71-2 | (2R,5R,6S)-6- | hydroxydihydrotheaspirane |
| EC: 261-047-2 Use(s): information only not used for fragrances or flavors | ||
| 57967-72-3 | 6- | acetoxydihydrotheaspirane |
| EC: 261-048-8 Use(s): flavor and fragrance agents | ||
| 57967-73-4 | 6- | acetoxydihydrotheaspirane |
| EC: 261-049-3 Use(s): flavor and fragrance agents | ||
| 57967-74-5 | 6- | acetoxydihydrotheaspirane |
| EC: 261-050-9 Use(s): flavor and fragrance agents | ||
| 58001-88-0 | (E)- | waxy undecadienol |
| EC: 261-070-8 Use(s): fragrance agents | ||
| 58019-21-9 | madlongiside D | |
| Use(s): natural substances and extractives | ||
| 58031-03-1 | hexyl 2-methyl-4-pentenoate | |
| FEMA: 3693 Use(s): flavor and fragrance agents | ||
| 58066-86-7 | 1-(2- | furfuryl thio) propanone |
| FEMA: 4676 JECFA: 2096 FLAVIS: 13.135 Use(s): flavoring agents | ||
| 58069-11-7 | quaternium 52 | |
| Use(s): antistatic, surfactant agents | ||
| 58096-46-1 | caryophyllene formate | |
| EC: 261-117-2 Use(s): flavor and fragrance agents | ||
| 58096-47-2 | decahydro-1,1,7-trimethyl-3a,7-methano-3ah-cyclopentacyclooct-3-yl formate | |
| EC: 261-118-8 Use(s): fragrance agents | ||
| 58102-02-6 | alpha- | methyl ional |
| EC: 261-121-4 FLAVIS: 05.198 Use(s): flavor and fragrance agents | ||
| 58115-08-5 | melanettin | |
| Use(s): natural substances and extractives | ||
| 58124-18-8 | 2- | hydroxynaringenin |
| Use(s): natural substances and extractives | ||
| 58128-22-6 | polyhydroxystearic acid | |
| EC: 500-140-7 Use(s): emulsifiers | ||
| 58130-93-1 | thiiraneacetonitrile | |
| Use(s): natural substances and extractives | ||
| 58130-94-2 | 5,6-epi | thiohexane nitrile |
| Use(s): natural substances and extractives | ||
| 58139-12-1 | carinol | |
| Use(s): natural substances and extractives | ||
| 58141-94-9 | 12,14- | nonacosane dione |
| Use(s): natural substances and extractives | ||
| 58186-27-9 | idebenone | |
| Use(s): antioxidants | ||
| 58196-32-0 | 9- | methyl-2-decenal |
| Use(s): natural substances and extractives | ||
| 58203-65-9 | 4- | methyl-4-decen-1-ol |
| Use(s): natural substances and extractives | ||
| 58206-95-4 | (1S)-alpha- | terpinyl acetate |
| EC: 261-165-4 Use(s): fragrance agents | ||
| 58213-36-8 | delphinidin 3-glucosylglucoside | |
| Use(s): natural substances and extractives | ||
| 58214-38-3 | sodium malate | |
| EC: 261-169-6 Use(s): buffering agents, humectants | ||
| 58214-93-0 | 8- | methyl thiononanonitrile |
| Use(s): natural substances and extractives | ||
| 58214-94-1 | 9- | methyl thiononanonitrile |
| Use(s): natural substances and extractives | ||
| 58214-96-3 | phenoxyethyl isovalerate | |
| EC: 261-170-1 Use(s): fragrance agents | ||
| 58214-97-4 | 2- | phenoxyethyl formate |
| Use(s): fragrance agents | ||
| 58223-46-4 | 7- | methyl nonanal |
| Use(s): natural substances and extractives | ||
| 58228-72-1 | 3- | ethyl-2-hydroxy-5-methyl-2-cyclopenten-1-one |
| Use(s): information only not used for fragrances or flavors | ||
| 58231-97-3 | arvensoside D | |
| Use(s): natural substances and extractives | ||
| 58231-98-4 | calenduloside D | |
| Use(s): natural substances and extractives | ||
| 58231-99-5 | Acutoside A | |
| Use(s): natural substances and extractives | ||
| 58243-85-9 | formyl ethyl tetramethyl tetralin | |
| EC: 261-182-7 Use(s): fragrance agents | ||
| 58244-29-4 | para- | tolualdehyde propylene glycol acetal |
| EC: 261-183-2 FEMA: 4628 JECFA: 2067 Use(s): flavor and fragrance agents | ||
| 58253-27-3 | gingerol | |
| Use(s): natural substances and extractives | ||
| 58257-11-7 | oleyl formate | |
| Use(s): information only not used for fragrances or flavors | ||
| 58260-78-9 | tetramethyl-4,8-decadiene nitrile | |
| EC: 261-191-6 Use(s): fragrance agents | ||
| 58265-74-0 | MS 3 | |
| Use(s): natural substances and extractives | ||
| 58274-56-9 | kakkalide | |
| Use(s): natural substances and extractives | ||
| 58296-81-4 | 8- | undecenal |
| EC: 261-202-4 Use(s): fragrance agents | ||
| 58319-04-3 | sesqui | sabinene |
| Use(s): natural substances and extractives | ||
| 58319-05-4 | (Z)-sesqui | sabinene hydrate |
| Use(s): natural substances and extractives | ||
| 58319-06-5 | sesqui | thujene |
| Use(s): natural substances and extractives | ||
| 58334-55-7 | zingiberenol | |
| Use(s): natural substances and extractives | ||
| 58368-66-4 | 2- | pentyl formate |
| Use(s): natural substances and extractives | ||
| 58374-38-2 | sodium acrylate/vinyl alcohol copolymer | |
| Use(s): antistatic, binding agents | ||
| 58374-69-9 | ammonium acryloyldimethyltaurate/vinyl formamide copolymer | |
| Use(s): emulsion stabilising, viscosity controlling agents | ||
| 58384-57-9 | 3,3- | dimethyl-1,2-dithiolane |
| Use(s): natural substances and extractives | ||
| 58396-29-5 | (R)-1- | cyclohexyl ethyl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 58409-60-2 | 4- | menthen-8-ol |
| EC: 261-239-6 Use(s): information only not used for fragrances or flavors | ||
| 58430-94-7 | nonisyl acetate | |
| EC: 261-245-9 FLAVIS: 09.819 Use(s): flavor and fragrance agents | ||
| 58437-69-7 | (E)- | patchenyl acetate |
| EC: 261-250-6 Use(s): fragrance agents | ||
| 58437-70-0 | (Z)- | patchenyl acetate |
| EC: 261-251-1 Use(s): fragrance agents | ||
| 58437-71-1 | (E)- | patchouli ethanol |
| EC: 261-252-7 Use(s): fragrance agents | ||
| 58437-72-2 | (Z)- | patchouli ethanol |
| EC: 261-253-2 Use(s): fragrance agents | ||
| 58446-52-9 | stearoylbenzoylmethane | |
| EC: 261-257-4 Use(s): indirect food additives: adhesives and components of coatings | ||
| 58461-27-1 | lavandulol | |
| EC: 261-264-2 Use(s): fragrance agents | ||
| 58474-80-9 | 3- | decenal |
| Use(s): information only not used for fragrances or flavors | ||
| 58475-04-0 | (±)-4- | ethyl octanal |
| FEMA: 4117 JECFA: 1819 FLAVIS: 05.223 Use(s): flavor and fragrance agents | ||
| 58479-55-3 | iso | bornyl butyrate |
| EC: 261-281-5 Use(s): flavor and fragrance agents | ||
| 58479-68-8 | platycodin D | |
| Use(s): cosmetic agents | ||
| 58493-47-3 | N- | vanillyl octanamide |
| Use(s): natural substances and extractives | ||
| 58511-73-2 | glucogallin | |
| Use(s): natural substances and extractives | ||
| 58543-16-1 | rebaudioside A | |
| FEMA: 4601 FLAVIS: 16.113 Use(s): sweeteners, flavor enhancers | ||
| 58543-17-2 | rebaudioside B | |
| Use(s): natural substances and extractives | ||
| 58546-17-1 | agavasaponin C' | |
| Use(s): natural substances and extractives | ||
| 58546-18-2 | agavasaponin D | |
| Use(s): natural substances and extractives | ||
| 58546-19-3 | agavasaponin E | |
| Use(s): natural substances and extractives | ||
| 58546-20-6 | agavoside G | |
| Use(s): natural substances and extractives | ||
| 58546-21-7 | agavasaponin H | |
| Use(s): natural substances and extractives | ||
| 58546-54-6 | gomisin A | |
| Use(s): natural substances and extractives | ||
| 58555-74-1 | dextro- | limonene |
| Use(s): flavor and fragrance agents | ||
| 58555-74-1 | dextro- | limonene |
| Use(s): flavor and fragrance agents | ||
| 58556-55-1 | 2-(4- | hydroxyphenyl) ethyl acetate |
| Use(s): natural substances and extractives | ||
| 58567-11-6 | amber decane | |
| EC: 261-332-1 Use(s): fragrance agents | ||
| 58569-25-8 | alpha- | copaen-8-ol |
| Use(s): natural substances and extractives | ||
| 58572-18-2 | agavoside F | |
| Use(s): natural substances and extractives | ||
| 58594-45-9 | (Z)-13- | octadecenal |
| EC: 261-349-4 Use(s): natural substances and extractives | ||
| 58605-97-3 | iso | butyl citral |
| Use(s): information only not used for fragrances or flavors | ||
| 58615-39-7 | iso | piperitone |
| Use(s): natural substances and extractives | ||
| 58625-89-1 | (Z)- | cherry pentenoate |
Use(s): flavor and fragrance agents | ||
| 58625-95-9 | hexyl (E)-2-methyl-3-pentenoate | |
| FEMA: 3693 JECFA: 352 FLAVIS: 09.546 Use(s): flavor and fragrance agents | ||
| 58625-96-0 | ethyl 2-methyl-2-pentenoate | |
| EC: 261-367-2 Use(s): fragrance agents | ||
| 58641-29-5 | dextro-iso | menthyl benzoate |
| EC: 261-374-0 Use(s): information only not used for fragrances or flavors | ||
| 58670-89-6 | decyl tetradecanol | |
| EC: 261-385-0 Use(s): cosmetic agents | ||
| 58725-33-0 | sodium palmitoyl proline | |
| EC: 261-406-3 Use(s): cosmetic ingredient for skin conditioning | ||
| 58725-39-6 | lauroyl proline | |
| EC: 261-407-9 Use(s): cosmetic agents | ||
| 58725-47-6 | palmitoyl arginine | |
| Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 58727-01-8 | sodium bischlorophenyl sulfamine | |
| Use(s): viscosity controlling agents | ||
| 58735-64-1 | roquefortine | |
| Use(s): natural substances and extractives | ||
| 58748-27-9 | propylene glycol dicaprylate/dicaprate | |
| Use(s): cosmetic agents | ||
| 58748-38-2 | VA/crotonates/vinyl neodecanoate copolymer | |
| Use(s): antistatic, film forming agents | ||
| 58749-22-7 | licochalcone A | |
| Use(s): natural substances and extractives | ||
| 58749-23-8 | licochalcone B | |
| Use(s): natural substances and extractives | ||
| 58762-96-2 | pinostilbenoside | |
| Use(s): natural substances and extractives | ||
| 58786-39-3 | eupolauridine | |
| Use(s): natural substances and extractives | ||
| 58809-73-7 | 2- | methyl thiopropionic acid |
| EC: 261-450-3 FLAVIS: 12.182 Use(s): flavoring agents | ||
| 58864-81-6 | alpha- | tocotrienol |
| Use(s): natural substances and extractives | ||
| 58879-39-3 | 1- | dodecen-3-one |
| Use(s): natural substances and extractives | ||
| 58882-17-0 | ethyl dihydroxypropyl PABA | |
| EC: 261-482-8 Use(s): cosmetic UV absorber | ||
| 58891-19-3 | adipic acid/fumaric acid/tricyclodecane dimethanol copolymer | |
| Use(s): binding agents | ||
| 58911-05-0 | methyl 1,4-dimethyl-3-cyclohexene-1-carboxylate | |
| EC: 261-494-3 Use(s): fragrance agents | ||
| 58917-25-2 | (R)-gamma- | valerolactone |
| Use(s): natural substances and extractives | ||
| 58921-10-1 | 2- | hydroxypropyl 2-ethyl hexanoate |
| EC: 261-499-0 Use(s): natural substances and extractives | ||
| 58927-81-4 | (E)-4- | hepten-2-ol |
| EC: 261-500-4 Use(s): flavor and fragrance agents | ||
| 58936-30-4 | 2,3- | epoxyheptanal |
| FEMA: 4658 JECFA: 2148 Use(s): flavoring agents | ||
| 58943-39-8 | neomycin phosphotransferase II | |
| Use(s): enzyme preparations and microorganisms | ||
| 58944-89-1 | starch food modified: | distarch glycerol |
| Use(s): food starch-modified | ||
| 58947-97-0 | beta- | citraurinene |
| Use(s): natural substances and extractives | ||
| 58956-32-4 | potassium stearoyl glutamate | |
| Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 58958-60-4 | iso | stearyl neopentanoate |
| EC: 261-521-9 Use(s): emollients, skin conditioning | ||
| 58985-02-7 | dihydroterpineol | |
| EC: 261-542-3 Use(s): fragrance agents | ||
| 58985-18-5 | dihydroterpinyl acetate | |
| EC: 261-543-9 FLAVIS: 09.617 Use(s): flavor and fragrance agents | ||
| 58989-20-1 | (E)-4- | methoxy-2-(1-propenyl)-phenyl 2-methylbutanoate |
| Use(s): natural substances and extractives | ||
| 59000-59-8 | dihydrocholesteryl butyrate | |
| Use(s): emollients, skin conditioning | ||
| 59000-86-1 | (E)-alpha-2,5- | dimethyl-3-furylethylidene(isopropylidene)succinic anhydride |
| Use(s): information only not used for fragrances or flavors | ||
| 59000-87-2 | (Z)-alpha-2,5- | dimethyl-3-furylethylidene(isopropylidene)succinic anhydride |
| Use(s): information only not used for fragrances or flavors | ||
| 59007-89-5 | methional propylene glycol acetal | |
| Use(s): information only not used for fragrances or flavors | ||
| 59012-60-1 | dodecyl tetradecanol | |
| Use(s): emollients | ||
| 59014-02-7 | oxepahyperforin | |
| Use(s): natural substances and extractives | ||
| 59020-78-9 | vinyl (4-methyl-thiazolyl-2) carbinol | |
| Use(s): information only not used for fragrances or flavors | ||
| 59020-84-7 | furfuryl-2-butenoate | |
| FLAVIS: 13.129 Use(s): flavoring agents | ||
| 59020-85-8 | furfuryl thiopropionate | |
| EC: 261-562-2 FEMA: 3347 JECFA: 1075 FLAVIS: 13.063 Use(s): flavoring agents | ||
| 59020-90-5 | S- | furfuryl thioformate |
| FEMA: 3158 JECFA: 1073 FLAVIS: 13.051 Use(s): flavor and fragrance agents | ||
| 59021-02-2 | 2- | mercaptomethyl pyrazine |
| FEMA: 3299 JECFA: 794 FLAVIS: 14.053 Use(s): flavoring agents | ||
| 59021-03-3 | pyrazinyl methyl methyl sulfide | |
Use(s): flavoring agents | ||
| 59021-05-5 | (( | furfuryl thio)methyl) pyrazine |
| EC: 261-564-3 Use(s): information only not used for fragrances or flavors | ||
| 59035-98-2 | 2- | methyl-3(or 5 or 6)-(furfuryl thio) pyrazine |
| FEMA: 3189 Use(s): flavoring agents | ||
| 59052-82-3 | cyclododecyl formate | |
| EC: 261-575-3 Use(s): fragrance agents | ||
| 59056-62-1 | acetoxymethyl isolongifolene | |
| EC: 261-579-5 Use(s): fragrance agents | ||
| 59056-64-3 | hydroxymethyl isolongifolene 50% in dpg | |
| EC: 261-580-0 Use(s): fragrance agents | ||
| 59056-70-1 | formoxymethyl isolongifolene | |
| EC: 261-582-1 Use(s): fragrance agents | ||
| 59056-71-2 | 1-(1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-8-yl) ethan-1-one |
| EC: 261-583-7 Use(s): information only not used for fragrances or flavors | ||
| 59070-56-3 | peg-12 glyceryl laurate | |
| Use(s): emulsifiers | ||
| 59070-56-3 | peg-15 glyceryl laurate | |
| Use(s): emulsifiers | ||
| 59070-56-3 | peg-20 glyceryl laurate | |
| Use(s): emulsifiers, surfactants | ||
| 59070-56-3 | peg-23 glyceryl laurate | |
| Use(s): emulsifiers, surfactants | ||
| 59070-56-3 | peg-30 glyceryl laurate | |
| Use(s): emulsifiers, surfactants | ||
| 59070-56-3 | peg-8 glyceryl laurate | |
| Use(s): emulsifiers | ||
| 59086-94-1 | gravacridonetriol | |
| Use(s): natural substances and extractives | ||
| 59104-83-5 | propylene glycol linoleate | |
| Use(s): surfactant | ||
| 59113-36-9 | diglycerin | |
| EC: 261-605-5 Use(s): cosmetic agents | ||
| 59121-25-4 | 5-( | methyl thio) valeronitrile |
| Use(s): natural substances and extractives | ||
| 59121-26-5 | (Z,E)-2,4- | heptadienal |
| Use(s): natural substances and extractives | ||
| 59122-93-9 | neoiso | liquiritin |
| Use(s): natural substances and extractives | ||
| 59130-69-7 | cetyl ethylhexanoate | |
| EC: 261-619-1 Use(s): emollients, unique emollient providing outstanding skin suppleness | ||
| 59130-70-0 | stearyl ethylhexanoate | |
| EC: 261-620-7 Use(s): emollients, skin conditioning | ||
| 59151-19-8 | autumn carboxylate | |
| EC: 261-629-6 Use(s): fragrance agents | ||
| 59184-43-9 | acetaldehyde ethyl amyl acetal | |
| FLAVIS: 06.085 Use(s): flavoring agents | ||
| 59186-41-3 | sodium cetearyl sulfate | |
| Use(s): solubilizing and dispersing agents | ||
| 59191-78-5 | hydroxymethyl hexyl ethyl ketone | |
| EC: 261-652-1 FEMA: 3292 JECFA: 1839 FLAVIS: 07.097 Use(s): flavor and fragrance agents | ||
| 59204-74-9 | egomaketone | |
| Use(s): natural substances and extractives | ||
| 59219-65-7 | darutoside | |
| Use(s): cosmetic agents | ||
| 59219-71-5 | iso | nonyl isononanoate |
| EC: 261-665-2 Use(s): emollients | ||
| 59227-89-3 | laurocapram | |
| EC: 261-668-9 Use(s): cosmetic agents | ||
| 59227-98-4 | 1- | bromo-3-iodo-2-propanone |
| Use(s): natural substances and extractives | ||
| 59227-99-5 | 1,1- | dibromo-3-iodo-2-propanone |
| Use(s): natural substances and extractives | ||
| 59230-57-8 | cuminyl acetate | |
| EC: 261-671-5 FLAVIS: 09.611 Use(s): flavor and fragrance agents | ||
| 59231-33-3 | iso | decyl palmitate |
| EC: 261-672-0 Use(s): emollients | ||
| 59231-34-4 | iso | decyl oleate |
| EC: 261-673-6 Use(s): cosmetic agents | ||
| 59231-35-5 | iso | decyl isononanoate |
| EC: 261-674-1 Use(s): cosmetic agents | ||
| 59231-37-7 | iso | tridecyl isononanoate |
| EC: 261-675-7 Use(s): emollients, skin conditioning | ||
| 59252-47-0 | acetyl gastrodin | |
| Use(s): natural substances and extractives | ||
| 59252-86-7 | chikusetsusaponin Ia | |
| Use(s): natural substances and extractives | ||
| 59252-88-9 | campesterol 6'-hexadecanoylglucoside | |
| Use(s): natural substances and extractives | ||
| 59259-38-0 | laevo- | menthyl lactate |
| EC: 261-678-3 FEMA: 3748 JECFA: 433 FLAVIS: 09.551 Use(s): flavor and fragrance agents, active cooling ingredient | ||
| 59259-90-4 | heliotropyl dimethyl acetal | |
| EC: 261-679-9 Use(s): fragrance agents | ||
| 59272-84-3 | myristamidopropyl betaine | |
| EC: 261-684-6 Use(s): cosmetic agents | ||
| 59277-89-3 | acyclovir | |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 59279-63-9 | glucose glutamate | |
| Use(s): cosmetic agents | ||
| 59285-67-5 | (S)-delta- | decalactone |
| Use(s): flavor and fragrance agents | ||
| 59300-38-8 | nor | tricycloekasantalal |
| Use(s): natural substances and extractives | ||
| 59300-39-9 | teresantalal | |
| Use(s): natural substances and extractives | ||
| 59300-40-2 | exo-2- | methyl-3-methylenebicyclo[2.2.1]heptan-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-03-6 | 3- | methyl-2-propionyl-thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-05-8 | methyl furfuryl thiol | |
| FEMA: 4697 JECFA: 2090 FLAVIS: 13.149 Use(s): flavoring agents | ||
| 59303-07-0 | 2- | methyl-3-furfuryl thiopyrazine |
| EC: 261-690-9 Use(s): flavoring agents | ||
| 59303-09-2 | 2- | methyl-6-(furfuryl thio) pyrazine |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-12-7 | 2-( | methoxymethyl)-6-methyl pyridine |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-13-8 | 5- | methyl-2-propanoyl thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-16-1 | 1- | propanoyl pyrrole |
| Use(s): information only not used for fragrances or flavors | ||
| 59303-17-2 | 2- | acetyl-5-methyl thiazole |
| FLAVIS: 15.039 Use(s): flavoring agents | ||
| 59303-19-4 | propyl 2-thenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 59323-76-1 | cis- | galbanum oxathiane |
| EC: 261-699-8 FEMA: 3578 Use(s): flavor and fragrance agents | ||
| 59323-81-8 | (±)-(Z+E)-2- | pentyl-4-propyl-1,3-oxathiane |
| FEMA: 4499 JECFA: 1943 FLAVIS: 16.114 Use(s): flavoring agents | ||
| 59324-17-3 | trans- | galbanum oxathiane |
| EC: 261-700-1 FEMA: 3578 FLAVIS: 16.062 Use(s): flavor and fragrance agents | ||
| 59331-82-7 | beta- | santalal |
| Use(s): natural substances and extractives | ||
| 59331-83-8 | (Z)-alpha- | santalal |
| Use(s): natural substances and extractives | ||
| 59354-71-1 | dimethyl benzyl carbinyl isobutyrate | |
| EC: 261-715-3 Use(s): fragrance agents | ||
| 59355-61-2 | peg-3 lauramine oxide | |
| Use(s): surfactant | ||
| 59373-32-9 | methyl 2,2-dimethyl-4,6-dioxocyclohexane carboxylate | |
| EC: 261-720-0 Use(s): information only not used for fragrances or flavors | ||
| 59376-58-8 | 2,4- | undecadien-1-ol |
| EC: 261-722-1 Use(s): fragrance agents | ||
| 59417-62-8 | 3,5- | dimethyl-2-vinyl furan |
| Use(s): natural substances and extractives | ||
| 59419-60-2 | starch food modified: | hydroxypropyl distarch glycerol |
| Use(s): food starch-modified | ||
| 59432-92-7 | santene hydrate | |
| Use(s): natural substances and extractives | ||
| 59440-97-0 | echinolone | |
| Use(s): natural substances and extractives | ||
| 59441-32-6 | palmitoyl proline | |
| EC: 261-763-5 Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 59462-26-9 | dihydropyrocurzerenone | |
| Use(s): natural substances and extractives | ||
| 59471-80-6 | tetrahydrocarvone | |
| FEMA: 3176 Use(s): flavor and fragrance agents | ||
| 59529-75-8 | 5- | octen-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 59554-11-9 | griseucin A | |
| Use(s): natural substances and extractives | ||
| 59557-05-0 | laevo- | menthyl acetoacetate |
| FEMA: 4327 JECFA: 1854 Use(s): flavoring agents | ||
| 59558-23-5 | para- | cresyl caprylate |
| EC: 261-803-1 FEMA: 3733 JECFA: 703 FLAVIS: 09.301 Use(s): flavor and fragrance agents | ||
| 59558-23-5 | para- | cresyl caprylate |
| EC: 261-803-1 FEMA: 3733 JECFA: 703 FLAVIS: 09.301 Use(s): flavor and fragrance agents | ||
| 59576-26-0 | 2- | acetyl-4-methylpyridine |
| Use(s): natural substances and extractives | ||
| 59587-44-9 | 2- | octyl nonanoate |
| EC: 261-819-9 Use(s): emollients | ||
| 59599-54-1 | potassium glycol sulfate | |
| Use(s): viscosity controlling agents | ||
| 59599-56-3 | myreth-3 caprate | |
| Use(s): emollients, skin conditioning | ||
| 59599-61-0 | pyridoxine dioctenoate | |
| Use(s): antistatic, hair conditioning, skin conditioning | ||
| 59632-85-8 | trans-beta- | terpinyl acetate |
| EC: 261-828-8 Use(s): flavor and fragrance agents | ||
| 59637-35-3 | (E)-4- | nonen-2-ol |
| Use(s): natural substances and extractives | ||
| 59643-85-5 | guaiacyl lactate | |
| EC: 261-837-7 Use(s): information only not used for fragrances or flavors | ||
| 59646-18-3 | 2- | hexyl-5 or 6-keto-1,4-dioxane |
| JECFA: 1486 Use(s): flavoring agents | ||
| 59647-78-8 | 2- | phenyl propionaldehyde oxime |
| EC: 261-839-8 Use(s): information only not used for fragrances or flavors | ||
| 59650-68-9 | ethylene/zinc acrylate copolymer | |
| Use(s): film forming agents | ||
| 59652-88-9 | 2,4,6- | triethoxybenzaldehyde |
| Use(s): information only not used for fragrances or flavors | ||
| 59672-05-8 | bornyl isovalerate | |
| EC: 261-849-2 Use(s): flavor and fragrance agents | ||
| 59686-68-9 | myreth-2 myristate | |
| Use(s): emollients, skin conditioning | ||
| 59686-68-9 | myreth-3 myristate | |
| Use(s): cosmetic agents | ||
| 59726-40-8 | diethyl allyl isobutyl malonate | |
| EC: 261-886-4 Use(s): information only not used for fragrances or flavors | ||
| 59739-63-8 | (Z)-beta- | damascenone |
| Use(s): fragrance agents | ||
| 59742-39-1 | cascarilladiene | |
| Use(s): natural substances and extractives | ||
| 59742-40-4 | cascarillone | |
| Use(s): natural substances and extractives | ||
| 59792-81-3 | aluminum PCA | |
| EC: 261-931-8 Use(s): astringent, skin conditioning | ||
| 59802-60-7 | beta- | cyperone |
| Use(s): natural substances and extractives | ||
| 59820-43-8 | HC yellow no 4 | |
| EC: 428-840-7 Use(s): hair dyeing agents | ||
| 59820-63-2 | 3- | methylamino-4-nitrophenoxyethanol |
| EC: 261-940-7 Use(s): hair dyeing agents | ||
| 59861-08-4 | alpha- | bisabolol oxide C |
| Use(s): natural substances and extractives | ||
| 59866-70-5 | MEA salicylate | |
| EC: 261-963-2 Use(s): preservatives | ||
| 59870-68-7 | glabridin | |
| Use(s): natural substances and extractives | ||
| 59902-01-1 | methialdol | |
| EC: 261-978-4 FEMA: 3483 JECFA: 471 FLAVIS: 12.065 Use(s): flavoring agents | ||
| 59917-40-7 | 5,7- | dihydroxy-3,6-dimethoxyflavone |
| Use(s): natural substances and extractives | ||
| 59938-97-5 | quassimarin | |
| Use(s): natural substances and extractives | ||
| 59950-58-2 | (Z)-1,11- | tridecadiene-3,5,7,9-tetrayne |
| Use(s): natural substances and extractives | ||
| 59952-97-5 | carlinoside | |
| Use(s): natural substances and extractives | ||
| 59958-20-2 | 2- | pentadecylfuran |
| Use(s): natural substances and extractives | ||
| 59970-10-4 | steareth-4 | |
| Use(s): emulsifiers, surfactants | ||
| 59995-49-2 | 4- | hydroxy-2-cyclopentenone |
| Use(s): natural substances and extractives | ||
| 60008-02-8 | glabrone | |
| Use(s): natural substances and extractives | ||
| 60026-10-0 | 2,6- | nonadienoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 60031-93-8 | elemoyl acetate | |
| Use(s): information only not used for fragrances or flavors | ||
| 60034-28-8 | crotonyl isothiocyanate | |
| Use(s): natural substances and extractives | ||
| 60037-58-3 | (Z)-13- | octadecen-1-yl acetate |
| Use(s): natural substances and extractives | ||
| 60041-32-9 | (±)-3- | methyl-3-buten-2-ol |
| Use(s): natural substances and extractives | ||
| 60044-74-8 | 4- | ethoxy-2-butanone |
| Use(s): natural substances and extractives | ||
| 60045-26-3 | 3- | phenyl propyl benzoate |
| FLAVIS: 09.836 Use(s): flavor and fragrance agents | ||
| 60045-27-4 | 3- | phenyl propyl 3-phenyl propionate |
| EC: 262-036-5 FLAVIS: 09.837 Use(s): flavor and fragrance agents | ||
| 60046-25-5 | glucoheptonolactone | |
| EC: 262-037-0 Use(s): cosmetic ingredient for skin conditioning | ||
| 60047-17-8 | linalool oxide (furanoid) | |
| EC: 262-038-6 FEMA: 3746 Use(s): flavor and fragrance agents | ||
| 60063-90-3 | ammonium carrageenan | |
| Use(s): thickeners, gelling agents, stabalizers and emulsifiers | ||
| 60063-90-3 | ammonium carrageenan with polysorbate 80 | |
| Use(s): chewing gum bases and related substances | ||
| 60066-88-8 | beta- | sinensal |
| EC: 262-043-3 FEMA: 3141 JECFA: 1227 Use(s): flavor and fragrance agents | ||
| 60102-38-7 | epi | dihydrophaseic acid |
| Use(s): natural substances and extractives | ||
| 60102-80-9 | (Z)-3- | penten-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 60111-46-8 | propyl trimethicone | |
| Use(s): cosmetic agents | ||
| 60113-43-1 | pinane carbaldehyde | |
| EC: 262-062-7 Use(s): fragrance agents | ||
| 60121-04-2 | methyl 4-acetoxyoctanoate | |
| Use(s): natural substances and extractives | ||
| 60125-24-8 | (E)-2- | methoxycinnamaldehyde |
| Use(s): natural substances and extractives | ||
| 60132-69-6 | betagarin | |
| Use(s): natural substances and extractives | ||
| 60138-22-9 | glycerol 1,3-didodecanoate 2-decanoate | |
| Use(s): natural substances and extractives | ||
| 60160-17-0 | heptyl decanoate | |
| EC: 262-089-4 Use(s): flavor and fragrance agents | ||
| 60169-66-6 | 5,6,7,8- | tetrahydro-2,4-dimethylquinoline |
| Use(s): natural substances and extractives | ||
| 60175-30-6 | glycerol 1,2-didodecanoate 3-tetradecanoate | |
| Use(s): natural substances and extractives | ||
| 60177-36-8 | sorbitan caprylate | |
| EC: 262-098-3 Use(s): emulsifiers | ||
| 60177-39-1 | poly(divinyl benzene-co-trimethyl(vinyl benzyl)ammonium chloride) | |
| Use(s): decolorizing and clarification agents for treatment of refinery sugar liquors | ||
| 60197-60-6 | licoflavonol | |
| Use(s): natural substances and extractives | ||
| 60207-90-1 | propiconazole | |
| EC: 262-104-4 Use(s): herbicides / pesticides | ||
| 60209-70-3 | stearamide DIBA-stearate | |
| Use(s): foam boosting, viscosity controlling agents | ||
| 60209-82-7 | iso | decyl neopentanoate |
| EC: 262-108-6 Use(s): cosmetic agents | ||
| 60218-42-0 | 5- | methyl octanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 60219-68-3 | polyglyceryl-2 dioleate | |
| Use(s): film forming agents | ||
| 60234-72-2 | ethyl 5,5,7-trimethyl-1-oxaspirooctane-2-carboxylate | |
| EC: 262-113-3 Use(s): fragrance agents | ||
| 60237-69-6 | asparagoside B | |
| Use(s): natural substances and extractives | ||
| 60241-52-3 | alpha- | ethyl-2,2,6-trimethyl cyclohexane propanol |
| EC: 262-115-4 Use(s): fragrance agents | ||
| 60241-53-4 | violet propanol | |
| EC: 262-117-5 Use(s): fragrance agents | ||
| 60241-55-6 | iso | methyl tetrahydroionyl acetate |
| EC: 262-118-0 Use(s): fragrance agents | ||
| 60241-69-2 | timber pentanone | |
| EC: 262-120-1 Use(s): information only not used for fragrances or flavors | ||
| 60263-07-2 | jacaranone | |
| Use(s): natural substances and extractives | ||
| 60267-23-4 | asparagoside C | |
| Use(s): natural substances and extractives | ||
| 60267-24-5 | asparagoside D | |
| Use(s): natural substances and extractives | ||
| 60267-25-6 | asparagoside E | |
| Use(s): natural substances and extractives | ||
| 60267-26-7 | asparagoside F | |
| Use(s): natural substances and extractives | ||
| 60267-27-8 | asparagoside G | |
| Use(s): natural substances and extractives | ||
| 60267-28-9 | asparagoside H | |
| Use(s): natural substances and extractives | ||
| 60270-33-9 | behenamidopropyl dimethylamine | |
| EC: 262-134-8 Use(s): antistatic, emulsifier agents | ||
| 60297-83-8 | licarin C | |
| Use(s): natural substances and extractives | ||
| 60308-75-0 | (Z)-4- | ethyl-2-octenoic acid |
| EC: 262-155-2 Use(s): flavor and fragrance agents | ||
| 60308-76-1 | (E)-4- | ethyl-2-octenoic acid |
| EC: 262-156-8 Use(s): flavor and fragrance agents | ||
| 60308-82-9 | 3- | methyl decanoic acid |
| Use(s): natural substances and extractives | ||
| 60329-20-6 | 1,5- | dimethyl bicyclo(3.2.1)octan-8-ol |
| EC: 262-174-6 Use(s): information only not used for fragrances or flavors | ||
| 60335-71-9 | floral pyran | |
| EC: 262-187-7 Use(s): fragrance agents | ||
| 60337-65-7 | 2,4- | diamino-5,6-dihydroxypyrimidine |
| Use(s): natural substances and extractives | ||
| 60343-69-3 | L- | lysine sulfate |
| Use(s): special dietary and nutritional additives | ||
| 60347-67-3 | batatasin IV | |
| Use(s): natural substances and extractives | ||
| 60362-71-2 | 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 60372-77-2 | ethyl lauroyl arginate | |
| EC: 434-630-6 Use(s): preservatives | ||
| 60375-07-7 | jubanine A | |
| Use(s): natural substances and extractives | ||
| 60375-08-8 | jubanine B | |
| Use(s): natural substances and extractives | ||
| 60375-16-8 | wyerone epoxide | |
| Use(s): natural substances and extractives | ||
| 60388-02-5 | zinc orotate | |
| EC: 262-207-4 Use(s): nutrient supplements, EFSA concludes: use is of safety concern. | ||
| 60405-50-7 | 5- | phenyl-3-hexen-2-one |
| EC: 262-221-0 Use(s): fragrance agents | ||
| 60415-61-4 | 2- | pentyl butyrate |
| EC: 262-226-8 FEMA: 3893 JECFA: 1142 FLAVIS: 09.658 Use(s): flavor and fragrance agents | ||
| 60416-24-2 | 3- | cyclohexyl propyl acetate |
| EC: 262-227-3 Use(s): information only not used for fragrances or flavors | ||
| 60433-66-1 | asparasaponin II | |
| Use(s): natural substances and extractives | ||
| 60435-70-3 | 2- | methyl-1-heptanol |
| Use(s): natural substances and extractives | ||
| 60437-21-0 | 12- | tridecen-2-one |
| FLAVIS: 07.201 Use(s): flavoring agents | ||
| 60466-73-1 | benzyl tetrahydropyran | |
| Use(s): deodorants | ||
| 60478-69-5 | asparasaponin I | |
| Use(s): natural substances and extractives | ||
| 60478-70-8 | yamogenintetroside B | |
| Use(s): natural substances and extractives | ||
| 60487-81-2 | cinnamaldehyde dicinnamyl acetal | |
| EC: 262-260-3 Use(s): information only not used for fragrances or flavors | ||
| 60503-15-3 | tuberolactone | |
| Use(s): natural substances and extractives | ||
| 60512-85-8 | iso | propyl cinnamate |
| Use(s): flavor and fragrance agents | ||
| 60512-85-8 | iso | propyl cinnamate |
| Use(s): flavor and fragrance agents | ||
| 60523-21-9 | berry pentadienoate | |
| EC: 262-278-1 FEMA: 3678 JECFA: 353 FLAVIS: 09.540 Use(s): flavor and fragrance agents | ||
| 60539-23-3 | oleoside 11-methyl ester | |
| Use(s): natural substances and extractives | ||
| 60544-70-9 | TEA-EDTA | |
| EC: 262-286-5 Use(s): chelating agents | ||
| 60551-23-7 | (E)- | dairy lactone |
| Use(s): natural substances and extractives | ||
| 60555-57-9 | benzyl PCA | |
| EC: 262-291-2 Use(s): humectants | ||
| 60563-13-5 | ethyl homovanillate | |
| EC: 262-298-0 FEMA: 4810 Use(s): flavoring agents | ||
| 60609-53-2 | 14- | methyl-(Z)-8-hexadecenal |
| EC: 262-326-1 Use(s): natural substances and extractives | ||
| 60616-95-7 | sodium carrageenan | |
| Use(s): thickeners, gelling agents, stabalizers and emulsifiers | ||
| 60628-96-8 | bifonazole | |
| EC: 262-336-6 Use(s): antidandruff, antimicrobial agents | ||
| 60633-22-9 | 5- | ethyl-2,4-dimethyl-3-oxazoline |
| Use(s): information only not used for fragrances or flavors | ||
| 60633-23-0 | 4- | ethyl-2,5-dimethyl-3-oxazoline |
| Use(s): information only not used for fragrances or flavors | ||
| 60633-24-1 | 2,4,5- | trimethyl-3-thiazoline |
| Use(s): natural substances and extractives | ||
| 60642-67-3 | bis(2- | mercaptoethyl) succinate |
| EC: 262-340-8 Use(s): information only not used for fragrances or flavors | ||
| 60650-88-6 | sericin | |
| Use(s): antistatic, hair conditioning, skin conditioning | ||
| 60650-89-7 | sericin | |
| Use(s): antistatic, hair conditioning, skin conditioning | ||
| 60656-87-3 | benzyl oxyacetaldehyde | |
| EC: 262-349-7 Use(s): information only not used for fragrances or flavors | ||
| 60671-71-8 | 3- | octenal |
| Use(s): natural substances and extractives | ||
| 60671-72-9 | 5- | decenal |
| Use(s): natural substances and extractives | ||
| 60671-73-0 | (E)-6- | undecenal |
| Use(s): natural substances and extractives | ||
| 60671-78-5 | 9- | tetradecenal |
| Use(s): natural substances and extractives | ||
| 60671-80-9 | 10- | pentadecenal |
| Use(s): natural substances and extractives | ||
| 60687-87-8 | peg-2 stearmonium chloride | |
| Use(s): antistatic, emulsifier agents | ||
| 60687-93-6 | laccaic acid | |
| Use(s): natural substances and extractives | ||
| 60752-63-8 | thenoyl methionate | |
| Use(s): antistatic and conditioning agents | ||
| 60755-05-7 | 2,4- | dimethyl-3-thiazoline |
| EC: 262-405-0 FLAVIS: 15.060 Use(s): flavoring agents | ||
| 60763-40-8 | (E)- | leaf acetal |
| EC: 262-412-9 Use(s): fragrance agents | ||
| 60763-41-9 | alpha- | amyl cinnamaldehyde diethyl acetal |
| EC: 262-413-4 Use(s): fragrance agents | ||
| 60763-42-0 | 3,6- | dimethyl-3-octyl acetate |
| EC: 262-415-5 Use(s): fragrance agents | ||
| 60763-44-2 | linalyl methyl ether | |
| EC: 262-416-0 Use(s): fragrance agents | ||
| 60770-00-5 | ethyl 4-methyl salicylate | |
| FLAVIS: 09.362 Use(s): flavor and fragrance agents | ||
| 60779-24-0 | methyl butyl disulfide | |
| FLAVIS: 12.151 Use(s): flavoring agents | ||
| 60784-31-8 | (Z)-2- | nonenal |
| EC: 262-428-6 Use(s): natural substances and extractives | ||
| 60788-25-2 | citronellyl ethoxalate | |
| EC: 262-433-3 Use(s): fragrance agents | ||
| 60791-47-1 | oxyiso | cyclointegrin |
| Use(s): natural substances and extractives | ||
| 60791-48-2 | Cyclointegrin | |
| Use(s): natural substances and extractives | ||
| 60791-49-3 | integrin | |
| Use(s): natural substances and extractives | ||
| 60816-70-8 | lithium gluconate | |
| EC: 262-443-8 Use(s): cosmetic ingredient for skin conditioning | ||
| 60816-94-6 | cymbopogonol | |
| Use(s): natural substances and extractives | ||
| 60826-15-5 | nonan-3-yl acetate | |
| EC: 262-444-3 FEMA: 4007 JECFA: 1145 FLAVIS: 09.925 Use(s): flavor and fragrance agents | ||
| 60828-78-6 | iso | laureth-10 |
| Use(s): emulsifiers, surfactants | ||
| 60828-78-6 | iso | laureth-3 |
| Use(s): emulsifiers, surfactants | ||
| 60828-78-6 | iso | laureth-6 |
| Use(s): emollients, emulsifiers, surfactants | ||
| 60837-57-2 | anoxomer | |
| Use(s): antioxidant in food | ||
| 60856-83-9 | ethyl (R)-2-hydroxy-4-methyl pentanoate | |
| Use(s): fragrance agents | ||
| 60856-85-1 | ethyl (S)-2-hydroxy-4-methyl pentanoate | |
| Use(s): fragrance agents | ||
| 60877-02-3 | ananasic acid | |
| Use(s): natural substances and extractives | ||
| 60899-29-8 | 1- | ethyl-1,3,3-trimethyl indan |
| EC: 262-520-6 Use(s): information only not used for fragrances or flavors | ||
| 60948-91-6 | 2- | hexyl octanoic acid |
| EC: 262-534-2 Use(s): cosmetic agents | ||
| 60958-23-8 | iso | eugenyl isovalerate |
| EC: 262-537-9 FLAVIS: 09.894 Use(s): flavor and fragrance agents | ||
| 60998-24-5 | 2,4- | tridecadienal |
| EC: 262-554-1 Use(s): information only not used for fragrances or flavors | ||
| 61012-45-1 | methyl (Z)-8-tetradecenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 61020-70-0 | cajanol | |
| Use(s): natural substances and extractives | ||
| 61041-75-6 | iso | butyl sorbate |
| EC: 262-567-2 Use(s): information only not used for fragrances or flavors | ||
| 61080-23-7 | glyceollins | |
| Use(s): skin conditioning, skin protecting | ||
| 61099-36-3 | methoxycitronellene lactone | |
| EC: 262-607-9 Use(s): information only not used for fragrances or flavors | ||
| 61099-53-4 | dimethyl-4-hexenyl dihydrofuranone | |
| EC: 262-608-4 Use(s): fragrance agents | ||
| 61114-23-6 | iso | eugenyl isovalerate |
| Use(s): flavor and fragrance agents | ||
| 61114-24-7 | eugenyl isovalerate | |
| EC: 262-613-1 FEMA: 4118 JECFA: 1532 FLAVIS: 09.878 Use(s): flavor and fragrance agents | ||
| 61122-71-2 | S- | methyl 4-methyl pentane thioate |
| FEMA: 3867 JECFA: 488 FLAVIS: 12.148 Use(s): flavoring agents | ||
| 61133-60-6 | 5- | imino-2-methyl-1-cyclopenten-1-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 61135-91-9 | (6aR,11aR)-3,9- | dihydroxypterocarpan |
| Use(s): natural substances and extractives | ||
| 61142-36-7 | 3- | ethyl-2-methyl-1,3-hexadiene |
| Use(s): natural substances and extractives | ||
| 61163-33-5 | mono- and - | diglycerides ethoxylated (20 moles) |
| Use(s): emulsifiers | ||
| 61167-58-6 | 2-tert- | butyl-6-(3-tert-butyl-2-hydroxy-5-methyl benzyl)-4-methyl phenyl acrylate |
| EC: 262-634-6 Use(s): indirect food additives: adhesives and components of coatings | ||
| 61168-10-3 | 1- | nonen-4-one |
| Use(s): natural substances and extractives | ||
| 61181-29-1 | lauryl methacrylate/glycol dimethacrylate crosspolymer | |
| Use(s): film forming, hair fixing agents | ||
| 61197-06-6 | 2,5- | dimethyl-3-(methyl dithio) furan |
| FLAVIS: 13.113 Use(s): flavoring agents | ||
| 61197-07-7 | 3-( | ethyl dithio)-2-methyl furan |
| EC: 262-649-8 Use(s): information only not used for fragrances or flavors | ||
| 61197-09-9 | propyl 2-methyl-3-furyl disulfide | |
| EC: 262-650-3 FEMA: 3607 JECFA: 1065 FLAVIS: 13.082 Use(s): flavoring agents | ||
| 61213-25-0 | flurochloridone | |
| EC: 262-661-3 Use(s): herbicides / pesticides | ||
| 61229-09-2 | dinorcapsaicin | |
| Use(s): natural substances and extractives | ||
| 61229-18-3 | heliantriol B2 | |
| Use(s): natural substances and extractives | ||
| 61248-42-8 | 4alpha,5alpha- | epoxy-11-eudesmen-3a-ol |
| Use(s): natural substances and extractives | ||
| 61248-45-1 | (S)- | massoia lactone |
| Use(s): information only not used for fragrances or flavors | ||
| 61263-48-7 | occidol acetate | |
| Use(s): natural substances and extractives | ||
| 61269-61-2 | N,N'-bis(2,2,6,6- | tetramethyl-4-piperidyl)hexamethylenediamine-1,2-dibromoethane, copolymer |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 61276-17-3 | verbascoside | |
| Use(s): cosmetic agents | ||
| 61281-38-7 | deoxyschizandrin | |
| Use(s): natural substances and extractives | ||
| 61295-41-8 | 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| EC: 262-690-1 FEMA: 3570 JECFA: 1085 FLAVIS: 13.077 Use(s): flavoring agents | ||
| 61295-44-1 | (±)-3-((2- | methyl-3-furyl)thio)-2-butanone |
| FEMA: 4056 JECFA: 1525 FLAVIS: 13.190 Use(s): flavoring agents | ||
| 61295-50-9 | 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| EC: 262-691-7 FEMA: 3571 JECFA: 1087 FLAVIS: 13.078 Use(s): flavoring agents | ||
| 61295-51-0 | 2,6- | dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone |
| EC: 262-692-2 FEMA: 3538 JECFA: 1086 FLAVIS: 13.075 Use(s): flavoring agents | ||
| 61301-33-5 | schizandrin C | |
| Use(s): natural substances and extractives | ||
| 61301-56-2 | (E)-11- | hexadecen-1-ol |
| EC: 262-704-6 Use(s): information only not used for fragrances or flavors | ||
| 61312-35-4 | para- | anisyl acetoacetate |
| Use(s): flavor and fragrance agents | ||
| 61315-75-1 | 4-(4- | methyl-3-penten-1-yl)-2(5H)-furanone |
| FEMA: 4868 Use(s): flavoring agents | ||
| 61323-24-8 | 2-iso | butyl-4-methyl thiazole |
| EC: 262-709-3 FLAVIS: 15.115 Use(s): flavoring agents | ||
| 61328-41-4 | neo | schaftoside |
| Use(s): natural substances and extractives | ||
| 61366-76-5 | methyl S-2-(methyl thio) propionate | |
| Use(s): information only not used for fragrances or flavors | ||
| 61372-91-6 | dibehenyl methylamine | |
| EC: 262-740-2 Use(s): antistatic and conditioning agents | ||
| 61389-12-6 | (E,Z)-4,7- | tridecen-1-yl acetate |
| EC: 262-757-5 Use(s): information only not used for fragrances or flavors | ||
| 61407-00-9 | 2,6- | dipropyl-5,6-dihydro-2H-thiopyran-3-carboxaldehyde |
| FEMA: 4822 Use(s): flavoring agents | ||
| 61415-11-0 | methyl cyclotridecanone | |
| EC: 262-772-7 Use(s): fragrance agents | ||
| 61417-49-0 | iso | propyl titanium triisostearate |
| EC: 262-774-8 Use(s): emollients, emulsifiers | ||
| 61419-46-3 | peg/ppg-14/7 dimethyl ether | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61419-46-3 | peg/ppg-3/6 dimethyl ether | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61419-46-3 | peg/ppg-9/2 dimethyl ether | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61434-67-1 | (Z)- | resveratrol |
| Use(s): natural substances and extractives | ||
| 61444-37-9 | (E)-3- | hexen-1-yl (E)-3-hexenoate |
| Use(s): information only not used for fragrances or flavors | ||
| 61444-38-0 | (Z)-3- | hexen-1-yl (Z)-3-hexenoate |
| EC: 262-797-3 FEMA: 3689 JECFA: 336 FLAVIS: 09.291 Use(s): flavor and fragrance agents | ||
| 61444-39-1 | (Z)-3- | hexen-1-yl heptanoate |
| EC: 262-798-9 FLAVIS: 09.575 Use(s): flavor and fragrance agents | ||
| 61444-41-5 | (Z)-3- | hexen-1-yl octanoate |
| EC: 262-799-4 FLAVIS: 09.569 Use(s): flavor and fragrance agents | ||
| 61474-16-6 | moracetin | |
| Use(s): natural substances and extractives | ||
| 61478-53-3 | aginoside progenin | |
| Use(s): natural substances and extractives | ||
| 61480-99-7 | 1-(5'- | methylfurfuryl)pyrrolidine |
| Use(s): information only not used for fragrances or flavors | ||
| 61481-02-5 | 5-(1- | pyrrolidinylmethyl)-2-furanmethanol |
| Use(s): natural substances and extractives | ||
| 61490-17-3 | nevskm | |
| Use(s): natural substances and extractives | ||
| 61499-22-7 | chavicyl acetate | |
| Use(s): natural substances and extractives | ||
| 61512-76-3 | SH- | oligopeptide-6 |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61517-87-1 | (E)- | arachidin II |
| Use(s): natural substances and extractives | ||
| 61517-88-2 | (Z)- | arachidin II |
| Use(s): natural substances and extractives | ||
| 61531-45-1 | amyl nonanoate | |
| EC: 262-831-7 Use(s): flavor and fragrance agents | ||
| 61548-34-3 | verbasoside | |
| Use(s): natural substances and extractives | ||
| 61573-60-2 | copper orotate | |
| EC: 262-855-8 Use(s): nutrient supplements, EFSA concludes: use is of safety concern. | ||
| 61586-52-5 | vulgarole | |
| Use(s): natural substances and extractives | ||
| 61597-96-4 | iso | butyl (R)-lactate |
| Use(s): information only not used for fragrances or flavors | ||
| 61630-32-8 | acetoxyandrostenedione | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61633-02-1 | disodium oleyl phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 61675-72-7 | 3-( | methyl thio) methyl thiophene |
| FEMA: 4184 JECFA: 1765 FLAVIS: 15.126 Use(s): flavoring agents | ||
| 61682-73-3 | pentaerythrityl tetrabehenate | |
| EC: 262-895-6 Use(s): emollients, viscosity controlling | ||
| 61683-99-6 | heliotropyl propylene glycol acetal | |
| EC: 262-897-7 FEMA: 4622 Use(s): flavor and fragrance agents | ||
| 61691-82-5 | 1'- | acetoxyestragole |
| Use(s): information only not used for fragrances or flavors | ||
| 61692-76-0 | iso | propyl angelate |
| EC: 262-899-8 Use(s): information only not used for fragrances or flavors | ||
| 61692-77-1 | 2- | methyl butyl angelate |
| Use(s): natural substances and extractives | ||
| 61692-78-2 | methyl allyl angelate | |
| EC: 262-901-7 Use(s): fragrance agents | ||
| 61692-79-3 | beta- | phenethyl angelate |
| EC: 262-902-2 Use(s): information only not used for fragrances or flavors | ||
| 61692-81-7 | 3- | methyl pentyl 2-methyl crotonate |
| EC: 262-904-3 Use(s): information only not used for fragrances or flavors | ||
| 61692-83-9 | propyl tiglate | |
| EC: 262-906-4 Use(s): flavor and fragrance agents | ||
| 61692-84-0 | iso | butyl tiglate |
| EC: 262-908-5 Use(s): flavor and fragrance agents | ||
| 61693-08-1 | hydrogenated | polyisobutene |
| Use(s): emollients, skin conditioning, viscosity controlling | ||
| 61693-42-3 | 3- | amino-2,4-dichlorophenol |
| EC: 262-909-0 Use(s): hair dyeing agents | ||
| 61693-43-4 | 3- | amino-2,4-dichlorophenol HCl |
| Use(s): hair dyeing agents | ||
| 61699-38-5 | herbal carbonate | |
| EC: 262-912-7 Use(s): fragrance agents | ||
| 61702-91-8 | para-tert- | butyl quinoline |
| EC: 262-927-9 Use(s): fragrance agents | ||
| 61710-63-2 | ppg-9 diglyceryl ether | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 61732-96-5 | heptanal butene-1,4-glycol acetal | |
| EC: 262-939-4 Use(s): information only not used for fragrances or flavors | ||
| 61752-68-9 | sorbitan tetraoctadecanoate | |
| EC: 262-958-8 Use(s): indirect food additives: adhesives and components of coatings | ||
| 61757-59-3 | sodium trideceth-12 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-6 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-7 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-8 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-3 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-4 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-15 carboxylate | |
| Use(s): surfactant | ||
| 61757-59-3 | sodium trideceth-19 carboxylate | |
| Use(s): surfactant | ||
| 61758-03-0 | thionerol | |
| EC: 262-959-3 Use(s): flavor and fragrance agents | ||
| 61759-51-1 | (E,E)-2,5- | nonadien-4-one |
| Use(s): natural substances and extractives | ||
| 61759-64-6 | geranyl acetoacetate | |
Use(s): flavor and fragrance agents | ||
| 61774-47-8 | grewinol | |
| Use(s): natural substances and extractives | ||
| 61781-98-4 | 5- | hexyltetrahydro-2-furanoctanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 61788-05-0 | castor oil hydrogenated ethoxylated | |
| Use(s): cosmetic and fragrance agents | ||
| 61788-40-7 | acrylic acid/acrylonitrogens copolymer | |
| Use(s): binding, film forming agents | ||
| 61788-45-2 | hydrogenated | tallow amine |
| EC: 262-976-6 Use(s): cosmetic agents | ||
| 61788-46-3 | cocamine | |
| EC: 262-977-1 Use(s): antistatic, emulsifier agents | ||
| 61788-47-4 | coconut acid | |
| EC: 262-978-7 Use(s): emulsifiers, surfactants | ||
| 61788-48-5 | lanolin acetate | |
| EC: 262-979-2 Use(s): cosmetic agents | ||
| 61788-49-6 | acetylated | lanolin alcohol |
| EC: 262-980-8 Use(s): cosmetic agents | ||
| 61788-55-4 | bioflavonoids | |
| Use(s): soothing agents | ||
| 61788-59-8 | methyl cocoate | |
| EC: 262-988-1 Use(s): emollients, skin conditioning | ||
| 61788-62-3 | methyl dicocamine | |
| EC: 262-990-2 Use(s): antistatic agents | ||
| 61788-63-4 | dihydrogenated | tallow methylamine |
| EC: 262-991-8 Use(s): emulsifiers, surfactants | ||
| 61788-66-7 | vegetable oil fatty acids | |
| EC: 262-994-4 Use(s): natural substances and extractives | ||
| 61788-78-1 | hydrogenated | tallowtrimonium chloride |
| EC: 263-005-9 Use(s): cosmetic agents | ||
| 61788-81-6 | iron tallate | |
| EC: 263-009-0 Use(s): food contact resinous and polymeric coatings | ||
| 61788-85-0 | peg-40 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-100 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-60 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-25 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-45 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-5 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-10 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emollients, emulsifiers | ||
| 61788-85-0 | peg-200 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-7 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-16 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-20 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-30 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-35 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-54 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-80 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-2 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers | ||
| 61788-85-0 | peg-55 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-6 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-65 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-50 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-85-0 | peg-8 hydrogenated castor oil | |
| EC: 500-147-5 Use(s): emulsifiers, surfactants | ||
| 61788-88-3 | tall oil fatty acids sesquiesters with diethylene glycol | |
| EC: 263-015-3 Use(s): cosmetic agents | ||
| 61788-89-4 | fatty acids C18-unsatd. dimers | |
| EC: 500-148-0 Use(s): indirect food additives: adhesives and components of coatings | ||
| 61788-90-7 | cocamine oxide | |
| EC: 263-016-9 Use(s): emulsifiers and foaming agents | ||
| 61788-91-8 | dimethyl soyamine | |
| EC: 263-017-4 Use(s): antistatic, emulsifier agents | ||
| 61788-92-9 | disoydimonium chloride | |
| EC: 263-019-5 Use(s): antistatic, surfactant agents | ||
| 61788-93-0 | dimethyl cocamine | |
| EC: 263-020-0 Use(s): cosmetic agents | ||
| 61788-94-1 | hydrogenated | tallowamine oxide |
| EC: 263-021-6 Use(s): cosmetic agents | ||
| 61789-03-5 | ammonium cocomonoglyceride sulfate | |
| Use(s): foam boosting, surfactant agents | ||
| 61789-04-6 | sodium cocomonoglyceride sulfate | |
| EC: 263-026-3 Use(s): surfactant | ||
| 61789-05-7 | glyceryl cocoate | |
| EC: 263-027-9 Use(s): emollients, emulsifiers | ||
| 61789-07-9 | hydrogenated | cottonseed glyceride |
| EC: 263-028-4 Use(s): emollients, skin conditioning | ||
| 61789-08-0 | glyceryl hydrogenated soyate | |
| EC: 263-030-5 Use(s): emollients | ||
| 61789-09-1 | hydrogenated | tallow glyceride |
| EC: 263-031-0 Use(s): cosmetic agents | ||
| 61789-10-4 | lard glyceride | |
| EC: 263-032-6 Use(s): emulsifiers, skin conditioning | ||
| 61789-13-7 | glyceryl tallowate | |
| EC: 263-035-2 Use(s): emollients, emulsifiers, skin conditioning, surfactants | ||
| 61789-17-1 | guaiacwood acetates | |
| Use(s): fragrance agents | ||
| 61789-18-2 | cocotrimonium chloride | |
| EC: 263-038-9 Use(s): cosmetic agents | ||
| 61789-19-3 | cocamide | |
| EC: 263-039-4 Use(s): cosmetic agents | ||
| 61789-23-9 | potassium cornate | |
| EC: 263-044-1 Use(s): emulsifiers, surfactants | ||
| 61789-25-1 | corn oil peg-6 esters | |
| Use(s): cosmetic agents | ||
| 61789-25-1 | corn oil peg-8 esters | |
| Use(s): cosmetic agents | ||
| 61789-30-8 | potassium cocoate | |
| EC: 263-049-9 Use(s): emulsifiers, surfactants | ||
| 61789-31-9 | sodium cocoate | |
| EC: 263-050-4 Use(s): emulsifiers, surfactants | ||
| 61789-32-0 | sodium cocoyl isethionate | |
| EC: 263-052-5 Use(s): surfactant | ||
| 61789-40-0 | cocamidopropyl betaine | |
| EC: 263-058-8 Use(s): cosmetic agents | ||
| 61789-42-2 | cedarwood acetate | |
| Use(s): fragrance agents | ||
| 61789-47-7 | acetylated | citronella oil |
| Use(s): fragrance agents | ||
| 61789-53-5 | coco nitriles | |
| EC: 263-066-1 Use(s): fragrance agents | ||
| 61789-56-8 | potassium peanutate | |
| EC: 263-069-8 Use(s): emulsifiers | ||
| 61789-57-9 | sodium peanutate | |
| EC: 263-070-3 Use(s): emulsifiers, surfactants | ||
| 61789-71-7 | cocoalkonium chloride | |
| EC: 263-107-3 Use(s): antistatic and conditioning agents | ||
| 61789-72-8 | hydrogenated | tallowalkonium chloride |
| EC: 263-081-3 Use(s): preservatives | ||
| 61789-73-9 | dihydrogenated | tallow benzylmonium chloride |
| EC: 263-082-9 Use(s): antistatic, surfactant agents | ||
| 61789-75-1 | tallowalkonium chloride | |
| EC: 263-085-5 Use(s): antistatic, surfactant agents | ||
| 61789-77-3 | dicoconut dimethyl ammonium chloride | |
| EC: 263-087-6 Use(s): single and repeated use food contact surfaces | ||
| 61789-79-5 | hydrogenated | ditallowamine |
| EC: 263-089-7 Use(s): antistatic and conditioning agents | ||
| 61789-80-8 | quaternium-18 | |
| EC: 263-090-2 Use(s): cosmetic agents | ||
| 61789-81-9 | quaternium-18 methosulfate | |
| EC: 263-091-8 Use(s): antistatic agents | ||
| 61789-88-6 | olive oil fatty acids sodium salts | |
| EC: 263-096-5 Use(s): surfactant, viscosity controlling agents | ||
| 61789-89-7 | sodium palm kernelate | |
| EC: 263-097-0 Use(s): cosmetic agents | ||
| 61789-91-1 | hydrogenated | jojoba oil |
| EC: 307-351-1 Use(s): abrasives, skin conditioning | ||
| 61789-92-2 | mastic gum resin | |
| Use(s): fragrance agents | ||
| 61789-92-2 | mastic absolute | |
| Use(s): flavor and fragrance agents | ||
| 61789-92-2 | mastic resinoid | |
| EC: 263-098-6 Use(s): fragrance agents | ||
| 61789-92-2 | mastic oil | |
| EC: 263-098-6 Use(s): flavor and fragrance agents | ||
| 61789-92-2 | pistacia lentiscus gum water | |
| EC: 263-098-6 Use(s): cosmetic and fragrance agents | ||
| 61789-92-2 | pistacia lentiscus resin extract | |
| EC: 263-098-6 Use(s): fragrance agents | ||
| 61789-92-2 | pistacia lentiscus gum oil | |
| Use(s): antidandruff, antimicrobial agents | ||
| 61789-97-7 | tallow | |
| EC: 263-099-1 Use(s): food-contact surface of paper and paperboard | ||
| 61789-99-9 | lard | |
| EC: 263-100-5 Use(s): multiple purpose GRAS food substances | ||
| 61790-12-3 | tall oil acid | |
| EC: 263-107-3 Use(s): cosmetic agents | ||
| 61790-18-9 | soyamine | |
| EC: 263-112-0 Use(s): antistatic, emulsifier agents | ||
| 61790-24-7 | potassium soyate | |
| EC: 263-116-2 Use(s): cosmetic agents | ||
| 61790-25-8 | sodium soyate | |
| EC: 263-117-8 Use(s): emulsifiers, surfactants | ||
| 61790-31-6 | hydrogenated | tallow amide |
| EC: 263-123-0 Use(s): cosmetic agents | ||
| 61790-32-7 | potassium tallowate | |
| EC: 263-124-6 Use(s): emulsifiers, surfactants | ||
| 61790-33-8 | tallow amine | |
| EC: 263-125-1 Use(s): emulsifiers, surfactants | ||
| 61790-37-2 | tallow acid | |
| EC: 263-129-3 Use(s): cosmetic agents | ||
| 61790-38-3 | hydrogenated | tallow acid |
| EC: 263-130-9 Use(s): emollients, emulsifiers, surfactants | ||
| 61790-41-8 | soytrimonium chloride | |
| EC: 263-134-0 Use(s): emulsifiers, surfactants | ||
| 61790-44-1 | tall oil fatty acids potassium salts | |
| EC: 263-136-1 Use(s): emulsifiers, surfactants | ||
| 61790-45-2 | sodium tallate | |
| EC: 263-137-7 Use(s): emulsifiers, surfactants | ||
| 61790-53-2 | diatomaceous earth | |
| Use(s): multipurpose additives | ||
| 61790-64-5 | TEA-cocoate | |
| EC: 263-155-5 Use(s): emulsifiers, surfactants | ||
| 61790-65-5 | TEA-rosinate | |
| EC: 263-156-0 Use(s): cleansing, surfactants | ||
| 61790-79-2 | sodium palmate | |
| EC: 263-162-3 Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-27 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-40 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-20 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-75 lanolin | |
| Use(s): emollients, emulsifiers, surfactants | ||
| 61790-81-6 | peg-30 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-150 lanolin | |
| Use(s): emulsifiers | ||
| 61790-81-6 | peg-24 lanolin | |
| Use(s): emulsifiers | ||
| 61790-81-6 | peg-35 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-5 lanolin | |
| Use(s): emulsifiers | ||
| 61790-81-6 | peg-50 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-55 lanolin | |
| Use(s): emulsifiers | ||
| 61790-81-6 | peg-60 lanolin | |
| Use(s): emulsifiers | ||
| 61790-81-6 | peg-85 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-81-6 | peg-10 lanolin | |
| Use(s): emollients, emulsifiers | ||
| 61790-81-6 | peg-100 lanolin | |
| Use(s): emulsifiers, surfactants | ||
| 61790-85-0 | peg-10 tallow aminopropyl amine | |
| EC: 500-149-6 Use(s): emulsifiers | ||
| 61790-85-0 | peg-15 tallow aminopropyl amine | |
| EC: 500-149-6 Use(s): emulsifiers | ||
| 61791-00-2 | peg-20 tallate | |
| EC: 500-150-1 Use(s): emulsifiers, surfactants | ||
| 61791-00-2 | peg-4 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-5 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-10 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-12 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-16 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-8 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-14 tallate | |
| Use(s): emulsifiers | ||
| 61791-00-2 | peg-15 tallate | |
| Use(s): emulsifiers | ||
| 61791-01-3 | peg-12 ditallate | |
| Use(s): emulsifiers | ||
| 61791-01-3 | peg-8 ditallate | |
| Use(s): emulsifiers | ||
| 61791-08-0 | peg-6 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-08-0 | peg-11 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-08-0 | peg-20 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers | ||
| 61791-08-0 | peg-3 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-08-0 | peg-5 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-08-0 | peg-7 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-08-0 | peg-2 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers | ||
| 61791-08-0 | peg-4 cocamide | |
| EC: 500-211-2 Use(s): emulsifiers, surfactants | ||
| 61791-10-4 | peg-15 cocomonium chloride | |
| Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-35 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-40 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-200 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-75 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-80 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-36 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-55 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers | ||
| 61791-12-6 | peg-10 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-100 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-20 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-50 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-11 castor oil | |
| EC: 500-151-7 Use(s): emollients, emulsifiers | ||
| 61791-12-6 | peg-15 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-26 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers | ||
| 61791-12-6 | peg-29 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-3 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-33 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-4 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-5 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-54 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers | ||
| 61791-12-6 | peg-60 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-8 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-9 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-16 castor oil | |
| EC: 500-151-7 Use(s): emollients, emulsifiers | ||
| 61791-12-6 | peg-2 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-25 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-12-6 | peg-44 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers | ||
| 61791-12-6 | peg-30 castor oil | |
| EC: 500-151-7 Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-7 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-8 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-10 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-3 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-5 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-20 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-25 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-13-7 | coceth-6 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-14-8 | peg-15 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers, surfactants | ||
| 61791-14-8 | peg-2 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers | ||
| 61791-14-8 | peg-12 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers, surfactants | ||
| 61791-14-8 | peg-10 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers, surfactants | ||
| 61791-14-8 | peg-20 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers, surfactants | ||
| 61791-14-8 | peg-3 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers | ||
| 61791-14-8 | peg-5 cocamine | |
| EC: 500-152-2 Use(s): emulsifiers | ||
| 61791-20-6 | laneth-60 | |
| Use(s): cosmetic agents | ||
| 61791-20-6 | laneth-16 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-20-6 | laneth-25 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-20-6 | laneth-50 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-20-6 | laneth-75 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-20-6 | laneth-10 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-20-6 | laneth-15 | |
| Use(s): surfactant, viscosity controlling agents | ||
| 61791-20-6 | laneth-20 | |
| Use(s): cosmetic agents | ||
| 61791-20-6 | laneth-40 | |
| Use(s): cosmetic agents | ||
| 61791-20-6 | poe-5 lanolin alcohols | |
| Use(s): emulsifiers, surfactants | ||
| 61791-24-0 | peg-10 soyamine | |
| Use(s): emulsifiers, surfactants | ||
| 61791-24-0 | peg-15 soyamine | |
| Use(s): emulsifiers, surfactants | ||
| 61791-24-0 | peg-2 soyamine | |
| Use(s): emulsifiers, surfactants | ||
| 61791-24-0 | peg-5 soyamine | |
| Use(s): emulsifiers, surfactants | ||
| 61791-24-0 | peg-8 soyamine | |
| Use(s): emulsifiers, surfactants | ||
| 61791-25-1 | dihydroxyethyl tallow glycinate | |
| Use(s): antistatic, foam boosting agents | ||
| 61791-26-2 | peg-15 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers, surfactants | ||
| 61791-26-2 | peg-2 tallow amine | |
| EC: 500-153-8 Use(s): antistatic and conditioning agents | ||
| 61791-26-2 | peg-5 tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers | ||
| 61791-26-2 | peg-10 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers | ||
| 61791-26-2 | peg-20 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): antistatic and conditioning agents | ||
| 61791-26-2 | peg-8 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers | ||
| 61791-26-2 | peg-30 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers, surfactants | ||
| 61791-26-2 | peg-40 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers, surfactants | ||
| 61791-26-2 | peg-50 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers, surfactants | ||
| 61791-26-2 | peg-11 tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers | ||
| 61791-26-2 | peg-2 hydrogenated tallow amine | |
| EC: 500-153-8 Use(s): emulsifiers, surfactants | ||
| 61791-26-2 | peg-22 tallow amine | |
| EC: 500-153-8 Use(s): cosmetic ingredient for hair conditioning | ||
| 61791-26-2 | peg-7 tallow amine | |
| EC: 500-153-8 Use(s): antistatic, emulsifier agents | ||
| 61791-28-4 | talloweth-4 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-28-4 | talloweth-6 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-28-4 | talloweth-18 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-28-4 | talloweth-5 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-28-4 | talloweth-7 | |
| Use(s): emulsifiers, surfactants | ||
| 61791-29-5 | peg-9 cocoate | |
| Use(s): emulsifiers | ||
| 61791-29-5 | peg-15 cocoate | |
| Use(s): emulsifiers | ||
| 61791-29-5 | peg-5 cocoate | |
| Use(s): emulsifiers | ||
| 61791-29-5 | peg-8 cocoate | |
| Use(s): emulsifiers | ||
| 61791-29-5 | peg-10 cocoate | |
| Use(s): emulsifiers | ||
| 61791-31-9 | cocamide DEA | |
| EC: 263-163-9 Use(s): information only not used for fragrances or flavors | ||
| 61791-38-6 | cocoyl hydroxyethyl imidazoline | |
| EC: 263-170-7 Use(s): antistatic, surfactant agents | ||
| 61791-39-7 | tall oil hydroxyethyl imidazoline | |
| EC: 263-171-2 Use(s): antistatic, hair conditioning | ||
| 61791-42-2 | sodium methyl cocoyl taurate | |
| EC: 263-174-9 Use(s): surfactant | ||
| 61791-46-6 | dihydroxyethyl tallowamine oxide | |
| EC: 263-179-6 Use(s): cosmetic agents | ||
| 61791-47-7 | dihydroxyethyl cocamine oxide | |
| EC: 263-180-1 Use(s): cosmetic agents | ||
| 61791-52-4 | cocoyl benzyl hydroxyethyl imidazolinium chloride | |
| EC: 263-185-9 Use(s): antistatic, surfactant agents | ||
| 61791-56-8 | disodium tallowiminodipropionate | |
| EC: 263-190-6 Use(s): cosmetic agents | ||
| 61791-59-1 | sodium cocoyl sarcosinate | |
| EC: 263-193-2 Use(s): surfactant | ||
| 61791-98-8 | TEA-myristaminopropionate | |
| EC: 263-210-3 Use(s): antistatic, surfactant agents | ||
| 61792-11-8 | homo | geranyl nitrile |
| EC: 263-214-5 Use(s): fragrance agents | ||
| 61792-12-9 | cinnamyl tiglate | |
| EC: 263-215-0 FLAVIS: 09.339 Use(s): fragrance agents | ||
| 61792-31-2 | lauramidopropyl amine oxide | |
| EC: 263-218-7 Use(s): cosmetic agents | ||
| 61800-40-6 | 2- | octyl acetoxystearate |
| EC: 263-233-9 Use(s): information only not used for fragrances or flavors | ||
| 61810-55-7 | phenethyl decanoate | |
| EC: 263-237-0 FEMA: 4314 FLAVIS: 09.685 Use(s): flavor and fragrance agents | ||
| 61826-52-6 | hexahydrotetramethyl methanonaphthalene-8-methyl formate | |
| EC: 263-250-1 Use(s): fragrance agents | ||
| 61826-53-7 | hexahydrotetramethyl methanonaphthalene-8-methanol | |
| EC: 263-251-7 Use(s): fragrance agents | ||
| 61826-54-8 | (2S)-1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8-carbaldehyde |
| EC: 263-252-2 Use(s): information only not used for fragrances or flavors | ||
| 61826-56-0 | hexahydrotetramethyl methanonaphthalene-8-methyl acetate | |
| EC: 263-253-8 Use(s): fragrance agents | ||
| 61827-42-7 | polyoxyethylene isodecyl ether | |
| Use(s): information only not used for fragrances or flavors | ||
| 61828-53-3 | 2-(2- | phenyl ethyl) chromone |
| Use(s): natural substances and extractives | ||
| 61837-77-2 | 1- | methyl thio-3-octanone |
| FEMA: 4707 JECFA: 2086 FLAVIS: 12.247 Use(s): flavoring agents | ||
| 61847-80-1 | 3- | ethyl-4-methyl-1-pentene |
| Use(s): information only not used for fragrances or flavors | ||
| 61849-72-7 | ppg-10 methyl glucose ether | |
| Use(s): cosmetic ingredient for skin and hair care | ||
| 61849-72-7 | ppg-20 methyl glucose ether | |
| Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 61866-40-8 | (R)-2- | methyl octanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 61871-71-4 | gingerdione | |
| Use(s): natural substances and extractives | ||
| 61886-48-4 | iso | nonamidopropyl ethyldimonium ethosulfate |
| Use(s): antistatic and conditioning agents | ||
| 61886-53-1 | ammonium phenolsulfonate | |
| EC: 263-293-6 Use(s): antimicrobial agents | ||
| 61886-59-7 | TEA-tridecylbenzenesulfonate | |
| EC: 263-296-2 Use(s): surfactant | ||
| 61886-66-6 | 3- | eicosyne |
| Use(s): natural substances and extractives | ||
| 61889-11-0 | 2- | methyl butyl phenyl acetate |
| EC: 263-299-9 Use(s): information only not used for fragrances or flavors | ||
| 61893-12-7 | 1- | furfurylpyrrolidine |
| Use(s): information only not used for fragrances or flavors | ||
| 61901-01-7 | sodium lauroamphopropionate | |
| EC: 263-311-2 Use(s): cosmetic agents | ||
| 61920-45-4 | verdoxan | |
| EC: 263-322-2 Use(s): fragrance agents | ||
| 61923-56-6 | 1- | penten-2-ol |
| Use(s): natural substances and extractives | ||
| 61925-49-3 | (S)-3- | nonanol |
| Use(s): information only not used for fragrances or flavors | ||
| 61925-50-6 | (R)-3- | nonanol |
| Use(s): information only not used for fragrances or flavors | ||
| 61928-63-0 | 6,7- | dihydro-2,6-dimethyl-5H-cyclopen |
| Use(s): natural substances and extractives | ||
| 61931-68-8 | 2- | methyl-5-phenyl benzoxazole |
| EC: 263-330-6 Use(s): pharmaceuticals / chemical synthisis | ||
| 61931-80-4 | ethyl linalyl acetate | |
| EC: 263-336-9 Use(s): fragrance agents | ||
| 61931-81-5 | (Z)-3- | hexen-1-yl lactate |
| EC: 263-337-4 FEMA: 3690 JECFA: 934 FLAVIS: 09.545 Use(s): flavor and fragrance agents | ||
| 61949-23-3 | laevo- | menthyl formate |
| EC: 263-345-8 Use(s): flavor and fragrance agents | ||
| 62003-27-4 | magnesium pidolate | |
| EC: 263-365-7 Use(s): nutrient supplements | ||
| 62006-39-7 | sedanenolide | |
| Use(s): natural substances and extractives | ||
| 62008-04-2 | heteronemin | |
| Use(s): natural substances and extractives | ||
| 62014-87-3 | helichrysetin | |
| Use(s): natural substances and extractives | ||
| 62016-37-9 | 2,4,6- | trimethyl octane |
| Use(s): natural substances and extractives | ||
| 62023-90-9 | juncusol | |
| Use(s): natural substances and extractives | ||
| 62025-49-4 | ginsenoside F2 | |
| Use(s): natural substances and extractives | ||
| 62025-50-7 | ginsenoside F3 | |
| Use(s): natural substances and extractives | ||
| 62028-96-0 | iso | hexadecanal |
| EC: 263-377-2 Use(s): natural substances and extractives | ||
| 62030-39-1 | propyl 2-pentenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 62030-40-4 | propyl 3-pentenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 62030-41-5 | iso | propyl 3-pentenoate |
| Use(s): information only not used for fragrances or flavors | ||
| 62030-43-7 | propyl 4-pentenoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 62030-44-8 | iso | propyl 4-pentenoate |
| Use(s): information only not used for fragrances or flavors | ||
| 62062-85-5 | 2- | butyl-5,6-dihydro-2,4-dimethyl-2H-pyran |
| EC: 263-394-5 Use(s): fragrance agents | ||
| 62065-10-5 | vulgarone A | |
| Use(s): natural substances and extractives | ||
| 62065-26-3 | pentalenene | |
| Use(s): natural substances and extractives | ||
| 62079-29-2 | 1-oxa | spiro-4,7-dodecane |
| Use(s): fragrance agents | ||
| 62105-65-1 | 2,6- | dimethyl-2-heptenal |
| Use(s): natural substances and extractives | ||
| 62107-03-3 | ent-7alpha,12beta- | dihydroxy-16-kauren-19,6beta-olide |
| Use(s): natural substances and extractives | ||
| 62108-25-2 | 2,6,7- | trimethyldecane |
| Use(s): natural substances and extractives | ||
| 62108-26-3 | 2,6,8- | trimethyldecane |
| Use(s): natural substances and extractives | ||
| 62108-31-0 | 4- | ethyl-2,2,6,6-tetramethyl heptane |
| Use(s): natural substances and extractives | ||
| 62117-57-1 | triethoxysilylpropyl steardimonium chloride | |
| Use(s): antimicrobial agents | ||
| 62121-29-3 | hymenolane | |
| Use(s): natural substances and extractives | ||
| 62125-22-8 | pentaerythrityl tetraisostearate | |
| EC: 263-423-1 Use(s): emollients, emulsifiers, surfactants | ||
| 62147-49-3 | 1,3- | dihydroxyacetone (dimer) |
| FEMA: 4033 JECFA: 1716 Use(s): flavoring agents | ||
| 62151-56-8 | muscol | |
| EC: 263-436-2 Use(s): fragrance agents | ||
| 62152-14-1 | ammonium polyacryloyldimethyl taurate | |
| Use(s): emulsion stabilising, viscosity controlling agents | ||
| 62154-77-2 | 3- | ethyl benzene thiol |
| Use(s): information only not used for fragrances or flavors | ||
| 62181-90-2 | iso-3- | thujyl acetate |
| Use(s): natural substances and extractives | ||
| 62181-91-3 | neo-iso-3- | thujyl acetate |
| Use(s): natural substances and extractives | ||
| 62203-47-8 | cinnzeylanine | |
| Use(s): natural substances and extractives | ||
| 62213-14-3 | xylanase, beta-glucanase enzyme preparation, produced by a strain of hunicola insolens | |
| EC: 263-462-4 Use(s): enzyme preparations and microorganisms | ||
| 62218-08-0 | epsilon- | viniferin |
| Use(s): natural substances and extractives | ||
| 62218-13-7 | alpha- | viniferin |
| Use(s): natural substances and extractives | ||
| 62235-06-7 | (E,E)-4,8,12- | trimethyl-1,3,7,11-tridecatetraene |
| Use(s): natural substances and extractives | ||
| 62237-90-5 | 2,5- | heptadien-1-ol |
| Use(s): natural substances and extractives | ||
| 62237-98-3 | 2,2,4- | trimethyldecane |
| Use(s): natural substances and extractives | ||
| 62238-00-0 | 2,2,9- | trimethyl decane |
| Use(s): natural substances and extractives | ||
| 62238-01-1 | 2,2,8- | trimethyl decane |
| Use(s): natural substances and extractives | ||
| 62238-34-0 | 4- | heptenal |
| FEMA: 3289 Use(s): natural substances and extractives | ||
| 62238-37-3 | 2- | methyl-3-penten-1-ol |
| Use(s): natural substances and extractives | ||
| 62251-98-3 | coronafacic acid | |
| Use(s): information only not used for fragrances or flavors | ||
| 62252-10-2 | 5,7- | dihydroxy-3',4',5'-trimethoxyflavanone |
| Use(s): natural substances and extractives | ||
| 62258-49-5 | methylbutene/methylstyrene/piperylene copolymer | |
| EC: 612-976-0 Use(s): depilatory agents | ||
| 62268-43-3 | artemidinol | |
| Use(s): natural substances and extractives | ||
| 62308-60-5 | 2- | methylthiolane-2-thiol |
| Use(s): information only not used for fragrances or flavors | ||
| 62311-70-0 | acorusnol | |
| Use(s): natural substances and extractives | ||
| 62322-84-3 | (E)- | gondoic acid |
| Use(s): natural substances and extractives | ||
| 62333-08-8 | lappaol A | |
| Use(s): natural substances and extractives | ||
| 62338-07-2 | 3- | ethyl-2,5-dimethyl-1,3-hexadiene |
| Use(s): natural substances and extractives | ||
| 62345-86-2 | 2-O- | feruloylhydroxycitric acid |
| Use(s): natural substances and extractives | ||
| 62345-87-3 | 2-O- | caffeoylhydroxycitric acid |
| Use(s): natural substances and extractives | ||
| 62346-96-7 | 2,4- | dimethyl benzyl acetate |
| EC: 263-518-8 Use(s): fragrance agents | ||
| 62362-49-6 | steareth-3 phosphate | |
| EC: 500-155-9 Use(s): surfactant | ||
| 62362-49-6 | steareth-2 phosphate | |
| EC: 500-155-9 Use(s): emulsifiers | ||
| 62393-99-1 | mulberranol | |
| Use(s): natural substances and extractives | ||
| 62394-04-1 | cinnzeylanol | |
| Use(s): natural substances and extractives | ||
| 62394-07-4 | momilactone C | |
| Use(s): natural substances and extractives | ||
| 62395-45-3 | terpinyl propionate | |
| EC: 263-530-3 Use(s): flavor and fragrance agents | ||
| 62395-45-3 | terpinyl propionate | |
| EC: 263-530-3 Use(s): flavor and fragrance agents | ||
| 62406-73-9 | opalal | |
| EC: 424-030-2 Use(s): fragrance agents | ||
| 62429-57-6 | 3-(4- | methyl-3-pentenyl) thiophene |
| Use(s): information only not used for fragrances or flavors | ||
| 62435-71-6 | tetrahydrofurfuryl ethyl ester | |
| Use(s): information only not used for fragrances or flavors | ||
| 62439-41-2 | methoxymelonal | |
| EC: 263-545-5 FEMA: 4745 Use(s): flavor and fragrance agents | ||
| 62442-62-0 | (Z)-11- | eicosen-1-ol |
| Use(s): natural substances and extractives | ||
| 62450-06-0 | tryptophan-P-1 | |
| Use(s): information only not used for fragrances or flavors | ||
| 62450-07-1 | tryptophan-P-2 | |
| Use(s): information only not used for fragrances or flavors | ||
| 62458-61-1 | anhydroencecalinol | |
| Use(s): natural substances and extractives | ||
| 62458-64-4 | 1-(5- | acetyl-2-hydroxyphenyl)-3-methyl-1-butanone |
| Use(s): natural substances and extractives | ||
| 62462-05-9 | methyl 5-methoxy-3-oxopentanoate | |
| EC: 263-553-9 Use(s): information only not used for fragrances or flavors | ||
| 62462-35-5 | lansiol | |
| Use(s): natural substances and extractives | ||
| 62472-85-9 | (Z)-8- | tetradecenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 62479-36-1 | diisostearyl adipate | |
| Use(s): emollients, plasticisers | ||
| 62488-24-8 | iso | amyl myristate |
| EC: 263-570-1 FLAVIS: 09.602 Use(s): flavor and fragrance agents | ||
| 62488-50-0 | ethyl 1,2-dithiolane-4-carboxylate | |
| Use(s): natural substances and extractives | ||
| 62488-53-3 | 3,4- | dihydro-3-vinyl-1,2-dithiin |
| Use(s): natural substances and extractives | ||
| 62488-55-5 | 2,4- | heptadien-1-ol |
| Use(s): flavoring agents | ||
| 62488-56-6 | 2,4- | nonadien-1-ol |
| EC: 263-571-7 FEMA: 3951 JECFA: 1183 FLAVIS: 02.188 Use(s): flavor and fragrance agents | ||
| 62498-83-3 | oleanderolide 3-acetate | |
| Use(s): natural substances and extractives | ||
| 62499-11-0 | iso | masticadienonalic acid |
| Use(s): natural substances and extractives | ||
| 62499-27-8 | gastrodin | |
| Use(s): cosmetic agents | ||
| 62501-24-0 | acetyl carene | |
| EC: 263-574-3 Use(s): flavor and fragrance agents | ||
| 62518-65-4 | meta-tert- | butyl phenyl isobutyraldehyde |
| EC: 263-580-6 Use(s): fragrance agents | ||
| 62563-80-8 | vetiveryl acetate | |
| EC: 263-597-9 Use(s): flavor and fragrance agents | ||
| 62568-11-0 | sorbitan monodocosanoate | |
| EC: 263-600-3 Use(s): indirect food additives: adhesives and components of coatings | ||
| 62574-18-9 | ineketone | |
| Use(s): natural substances and extractives | ||
| 62574-21-4 | 1,2,3- | trithiane-5-carboxylic acid |
| Use(s): natural substances and extractives | ||
| 62593-13-9 | methyl 5-hydroxyhexanoate | |
| Use(s): natural substances and extractives | ||
| 62596-29-6 | morusin | |
| Use(s): natural substances and extractives | ||
| 62596-34-3 | cyclomorusin A | |
| Use(s): natural substances and extractives | ||
| 62637-93-8 | trimethylamine oxide dihydrate | |
| Use(s): humectants | ||
| 62649-65-4 | disperse violet 15 | |
| EC: 263-672-6 Use(s): hair dyeing agents | ||
| 62682-11-5 | kievitone hydrate | |
| Use(s): natural substances and extractives | ||
| 62696-17-7 | dihydro-beta-ionene | |
| Use(s): natural substances and extractives | ||
| 62697-46-5 | trans- | methylbixin |
| Use(s): natural substances and extractives | ||
| 62701-49-9 | (R)-3- | heptanol |
| Use(s): information only not used for fragrances or flavors | ||
| 62726-18-5 | filfiline | |
| Use(s): natural substances and extractives | ||
| 62745-67-9 | obtusaquinone | |
| Use(s): natural substances and extractives | ||
| 62755-21-9 | magnesium laureth sulfate | |
| Use(s): surfactant | ||
| 62755-21-9 | magnesium laureth-16 sulfate | |
| Use(s): cleansing, surfactants | ||
| 62755-21-9 | magnesium laureth-5 sulfate | |
| Use(s): cleansing, surfactants | ||
| 62755-21-9 | magnesium laureth-8 sulfate | |
| Use(s): cleansing, surfactants | ||
| 62756-44-9 | nicomethanol hydrofluoride | |
| Use(s): cosmetic agents | ||
| 62820-28-4 | glyzarin | |
| Use(s): natural substances and extractives | ||
| 62824-37-7 | blennin B | |
| Use(s): natural substances and extractives | ||
| 62824-38-8 | lactaronecatorin A | |
| Use(s): natural substances and extractives | ||
| 62860-40-6 | blennin A | |
| Use(s): natural substances and extractives | ||
| 62868-75-1 | austroinulin | |
| Use(s): natural substances and extractives | ||
| 62924-70-3 | flumetralin | |
| Use(s): herbicides / pesticides | ||
| 62949-76-2 | xanthoangelol | |
| Use(s): natural substances and extractives | ||
| 62949-77-3 | kuwanon A | |
| Use(s): natural substances and extractives | ||
| 62949-78-4 | kuwanon B | |
| Use(s): natural substances and extractives | ||
| 62949-79-5 | mulberrin | |
| Use(s): natural substances and extractives | ||
| 62949-93-3 | Morusinol | |
| Use(s): natural substances and extractives | ||
| 62953-03-1 | 3,4',5,6,8- | pentamethoxyflavone |
| Use(s): natural substances and extractives | ||
| 63006-48-4 | cajanone | |
| Use(s): natural substances and extractives | ||
| 63012-97-5 | 2- | methyl 3-(methyl thio) furan |
| FEMA: 3949 JECFA: 1061 FLAVIS: 13.152 Use(s): flavoring agents | ||
| 63019-46-5 | cholesteryl isoheptylate | |
| Use(s): information only not used for fragrances or flavors | ||
| 63038-10-8 | (S)- | sencyunolide |
| Use(s): natural substances and extractives | ||
| 63059-79-0 | sorbitan monotetradecanoate | |
| EC: 263-834-6 Use(s): information only not used for fragrances or flavors | ||
| 63060-52-6 | 4- | methyl octadecanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 63084-98-0 | p- | aminophenol sulfate |
| EC: 263-847-7 Use(s): hair dyeing agents | ||
| 63088-78-8 | L-cis-5- | hydroxy-2-piperidinecarboxylic acid |
| Use(s): natural substances and extractives | ||
| 63089-86-1 | sorbeth-30 tetraoleate | |
| Use(s): emulsifiers | ||
| 63089-86-1 | sorbeth-40 tetraoleate | |
| Use(s): emulsifiers | ||
| 63089-86-1 | sorbeth-60 tetraoleate | |
| Use(s): emulsifiers | ||
| 63089-86-1 | sorbeth-6 tetraoleate | |
| Use(s): emulsifiers | ||
| 63095-33-0 | (Z)-gamma- | jasmolactone |
| EC: 263-852-4 FLAVIS: 10.039 Use(s): fragrance agents | ||
| 63095-34-1 | 3-(10- | undecen-1-yl oxy) propionitrile |
| EC: 263-854-5 Use(s): information only not used for fragrances or flavors | ||
| 63148-58-3 | phenyl methicone | |
| Use(s): emollients | ||
| 63148-61-8 | polydiethylsiloxane | |
| Use(s): emollients | ||
| 63148-62-9 | polydimethylsiloxanes | |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 63148-65-2 | polyvinyl butyral | |
| Use(s): binding, film forming, viscosity controlling agents | ||
| 63177-57-1 | methyl 2,5-dihydroxycinnamate | |
| Use(s): natural substances and extractives | ||
| 63179-81-7 | zinc lactate dihydrate | |
| Use(s): special dietary and nutritional additives | ||
| 63187-91-7 | dextro,laevo- | menthone glycerine acetal |
| FEMA: 3808 JECFA: 446 FLAVIS: 06.120 Use(s): flavor and fragrance agents | ||
| 63196-63-4 | (E)-6- | octenal |
| FEMA: 4787 JECFA: 2240 FLAVIS: 05.061 Use(s): flavor and fragrance agents | ||
| 63196-64-5 | (Z)-6- | octenal |
| EC: 263-994-7 Use(s): information only not used for fragrances or flavors | ||
| 63223-86-9 | ginsenoside Rh1 | |
| Use(s): natural substances and extractives | ||
| 63231-60-7 | petrolatum wax microcrystalline | |
| EC: 264-038-1 Use(s): chewing gum bases, protective coatings, defoaming agents, surface finishing agents | ||
| 63231-63-0 | RNA | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 63250-25-9 | iso | propyl dibenzoylmethane |
| EC: 264-043-9 Use(s): cosmetic UV absorber | ||
| 63253-24-7 | vanillin 2,3-butylene glycol acetal | |
| FEMA: 4023 JECFA: 960 FLAVIS: 06.132 Use(s): flavor and fragrance agents | ||
| 63270-14-4 | 1,3- | nonane diyl diacetate |
| EC: 264-060-1 Use(s): flavor and fragrance agents | ||
| 63279-13-0 | rebaudioside D | |
| Use(s): sweeteners, flavor enhancers | ||
| 63279-14-1 | rebaudioside E | |
| Use(s): natural substances and extractives | ||
| 63302-64-7 | 2- | octyl 3-cyclohexene carboxylate |
| EC: 264-084-2 Use(s): information only not used for fragrances or flavors | ||
| 63321-70-0 | 2- | octyl octanoate (ethylhexyl) |
| EC: 264-098-9 Use(s): information only not used for fragrances or flavors | ||
| 63347-43-3 | rothindin | |
| Use(s): natural substances and extractives | ||
| 63357-95-9 | (R)-gamma- | hexalactone |
| Use(s): information only not used for fragrances or flavors | ||
| 63357-96-0 | (R)-gamma- | nonalactone |
| Use(s): flavor and fragrance agents | ||
| 63357-97-1 | (S)-gamma- | nonalactone |
| Use(s): flavor and fragrance agents | ||
| 63359-63-7 | 2,5- | dimethyl-3-(methyl thiol) furan |
| FLAVIS: 13.114 Use(s): flavoring agents | ||
| 63393-82-8 | C12-15 alcohols | |
| EC: 264-118-6 Use(s): emollients, emulsifiers | ||
| 63393-89-5 | coumarone-indene resins | |
| Use(s): protective coating for grapefruit, lemons, limes, oranges, tangelos, and tangerines | ||
| 63393-93-1 | iso | propyl lanolate |
| EC: 264-119-1 Use(s): emulsifiers, surfactants | ||
| 63394-02-5 | polysilicone-11 | |
| EC: 613-211-3 Use(s): film forming agents | ||
| 63397-60-4 | bis(2- | carbobutoxyethyl)tin-bis(isooctyl mercaptoacetate) |
| EC: 264-122-8 Use(s): indirect food additives: adhesives and components of coatings | ||
| 63408-88-8 | nonan-3-yl propionate | |
| EC: 264-131-7 Use(s): information only not used for fragrances or flavors | ||
| 63409-16-5 | nopalinic acid | |
| Use(s): natural substances and extractives | ||
| 63428-82-0 | beauveria bassiana | |
| Use(s): herbicides / pesticides | ||
| 63429-28-7 | (E)-beta- | methyl ionone |
| EC: 264-140-6 FEMA: 2712 Use(s): flavor and fragrance agents | ||
| 63438-80-2 | (2- | carbobutoxyethyl)tin-tris(isooctyl mercaptoacetate) |
| EC: 264-144-8 Use(s): indirect food additives: adhesives and components of coatings | ||
| 63449-41-2 | C8-18- | benzalkonium chloride |
| EC: 264-151-6 Use(s): cosmetic agents | ||
| 63449-64-9 | acetaldehyde di-(Z)-3-hexen-1-yl acetal | |
| EC: 264-154-2 FEMA: 4381 JECFA: 1747 Use(s): cosmetic, flavor and fragrance agents | ||
| 63449-68-3 | beta- | naphthyl anthranilate |
| EC: 264-155-8 FEMA: 2767 JECFA: 1544 FLAVIS: 09.801 Use(s): flavor and fragrance agents | ||
| 63449-88-7 | 1- | cyclohexyl ethyl butyrate |
| EC: 264-158-4 Use(s): fragrance agents | ||
| 63449-89-8 | turboxan | |
| EC: 264-160-5 Use(s): fragrance agents | ||
| 63449-95-6 | iso | propyl cyclohexyl propionate |
| EC: 264-165-2 Use(s): fragrance agents | ||
| 63450-30-6 | methoxymethyl pyrazine | |
| EC: 264-168-9 FEMA: 3183 Use(s): flavor and fragrance agents | ||
| 63450-57-7 | glucose pentaisovalerate | |
| Use(s): humectants | ||
| 63450-95-3 | 2- | chloro-3-ethyl pyrazine |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 63451-27-4 | polyquaternium-2 | |
| Use(s): antistatic, film forming agents | ||
| 63458-78-6 | 3- | mercapto-4-heptanone |
| EC: 264-210-6 Use(s): information only not used for fragrances or flavors | ||
| 63458-80-0 | 4- | mercapto-5-nonanone |
| Use(s): information only not used for fragrances or flavors | ||
| 63458-81-1 | 4- | mercapto-5-nonanol |
| Use(s): information only not used for fragrances or flavors | ||
| 63468-05-3 | 4- | methyl-2-penten-4-ol |
| Use(s): natural substances and extractives | ||
| 63493-28-7 | 2- | pentanamine |
| Use(s): natural substances and extractives | ||
| 63500-71-0 | floral pyranol | |
| EC: 405-040-6 Use(s): fragrance agents | ||
| 63500-71-0 | floral pyranol | |
| EC: 405-040-6 Use(s): fragrance agents | ||
| 63500-72-1 | rose pyran alcohol | |
| EC: 264-277-1 Use(s): information only not used for fragrances or flavors | ||
| 63511-92-2 | (E)- | crotonaldehyde diethyl acetal |
| Use(s): information only not used for fragrances or flavors | ||
| 63511-93-3 | (E)- | cinnamaldehyde dimethyl acetal |
| Use(s): flavor and fragrance agents | ||
| 63521-37-9 | 3- | methyl pentane-2,3-diol |
| EC: 264-294-4 Use(s): information only not used for fragrances or flavors | ||
| 63527-49-1 | (R)-2- | methyl-4-pentenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 63529-14-6 | 3- | dehydronobilin |
| Use(s): natural substances and extractives | ||
| 63534-56-5 | polyester-24 | |
| Use(s): antistatic, binding agents | ||
| 63550-99-2 | rebaudioside C | |
| FEMA: 4720 Use(s): sweeteners, flavor enhancers | ||
| 63550-99-2 | rebaudioside C 30% | |
| FEMA: 4796 Use(s): flavoring agents | ||
| 63556-21-8 | sodium myristoamphoacetate | |
| EC: 264-311-5 Use(s): antistatic, surfactant agents | ||
| 63558-43-0 | cofaryloside | |
| Use(s): natural substances and extractives | ||
| 63566-37-0 | iso | stearamidopropyl betaine |
| Use(s): cosmetic agents | ||
| 63592-16-5 | magnesium thioglycolate | |
| EC: 264-358-1 Use(s): cosmetic agents | ||
| 63601-33-2 | peg-15 tallow polyamine | |
| Use(s): emulsifiers | ||
| 63623-64-3 | dioctyldodecyl malate | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 63644-62-2 | coniferyl ferulate | |
| Use(s): natural substances and extractives | ||
| 63649-50-3 | 1-(2,2,4- | trimethyl-4-cyclohexenyl)ethyl acetate |
| EC: 264-380-1 Use(s): fragrance agents | ||
| 63649-51-4 | tetramethyl-3-cyclohexene-1-methyl formate | |
| EC: 264-381-7 Use(s): fragrance agents | ||
| 63663-10-5 | myristamidopropyl hydroxysultaine | |
| Use(s): antistatic, foam boosting agents | ||
| 63663-21-8 | dibutyl lauroyl glutamide | |
| EC: 264-391-1 Use(s): film forming, hair conditioning, skin conditioning | ||
| 63697-00-7 | iso | propyl (S)-(-)-lactate |
| EC: 264-417-1 Use(s): information only not used for fragrances or flavors | ||
| 63705-03-3 | polyglyceryl-10 diisostearate | |
| Use(s): emulsifiers | ||
| 63759-55-7 | 2- | pentyl-1-buten-3-one |
| EC: 264-448-0 FEMA: 3725 JECFA: 1149 Use(s): flavoring agents | ||
| 63767-86-2 | muguet ethanol | |
| Use(s): fragrance agents | ||
| 63785-57-9 | 3'- | hydroxysafrole |
| Use(s): natural substances and extractives | ||
| 63793-60-2 | ppg-3 myristyl ether | |
| Use(s): emollients, skin conditioning | ||
| 63793-60-2 | ppg-4 myristyl ether | |
| Use(s): emollients, skin conditioning | ||
| 63798-35-6 | starch food modified: acetylated | distarch adipate |
| Use(s): food starch-modified, thickener, emulsifier, stabilizer, bulking agent | ||
| 63799-53-1 | propylene glycol isostearate | |
| Use(s): surfactant, skin conditioning | ||
| 63800-37-3 | sepiolite | |
| EC: 264-465-3 Use(s): viscosity controlling agents | ||
| 63808-23-1 | graveobioside A | |
| Use(s): natural substances and extractives | ||
| 63826-25-5 | 6- | octenal |
| Use(s): natural substances and extractives | ||
| 63851-40-1 | (Z)-7- | dodecenal |
| Use(s): natural substances and extractives | ||
| 63883-69-2 | (E)-2- | ethyl-2-butenal |
| Use(s): information only not used for fragrances or flavors | ||
| 63885-09-6 | 6- | methyl heptanal |
| FEMA: 4498 JECFA: 2174 FLAVIS: 05.225 Use(s): flavor and fragrance agents | ||
| 63891-61-2 | rosifoliol | |
| Use(s): natural substances and extractives | ||
| 63892-00-2 | (E)-5- | octenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 63910-76-9 | 1,8- | heptadecadiene-4,6-diyne-3,10-diol |
| Use(s): natural substances and extractives | ||
| 63938-14-7 | melilotic anhydride | |
| Use(s): natural substances and extractives | ||
| 63968-64-9 | artemisinin | |
| Use(s): antimicrobial, skin conditioning | ||
| 63969-46-0 | 2,2'- | methylenebis-4-aminophenol |
| EC: 440-850-3 Use(s): hair dyeing agents | ||
| 63986-03-8 | butyl ethyl disulfide | |
| FEMA: 4027 JECFA: 1698 FLAVIS: 12.254 Use(s): flavoring agents | ||
| 64001-15-6 | tricyclodecyl acetate | |
| EC: 264-598-7 Use(s): fragrance agents | ||
| 64026-45-5 | dihydro-2,5-dimethyl furan-3(2H)-one | |
| EC: 264-613-7 Use(s): information only not used for fragrances or flavors | ||
| 64042-18-8 | 2,4- | heptadecanedione |
| Use(s): natural substances and extractives | ||
| 64044-51-5 | lactose monohydrate | |
| Use(s): information only not used for fragrances or flavors | ||
| 64058-40-8 | hexyl carbonate tetrahydrofurfuryl lactate | |
| Use(s): information only not used for fragrances or flavors | ||
| 64069-53-0 | juzirine | |
| Use(s): natural substances and extractives | ||
| 64091-05-0 | (R)- | juziphine |
| Use(s): natural substances and extractives | ||
| 64095-60-9 | longistylin A | |
| Use(s): natural substances and extractives | ||
| 64125-60-6 | longistylin C | |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 64142-78-5 | 8- | hydroxylinalool |
| Use(s): flavor and fragrance agents | ||
| 64147-40-6 | castor oil, dehydrated | |
| EC: 264-705-7 Use(s): indirect food additives: adhesives and components of coatings | ||
| 64161-55-3 | barogenin | |
| Use(s): natural substances and extractives | ||
| 64165-18-0 | 6- | hydroxyoctanoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 64165-57-7 | rose undecene | |
| EC: 264-716-7 Use(s): fragrance agents | ||
| 64166-14-9 | cerasinone | |
| Use(s): natural substances and extractives | ||
| 64180-68-3 | vulgarone B | |
| Use(s): natural substances and extractives | ||
| 64187-83-3 | ethyl (Z)-3-hexenoate | |
| EC: 264-724-0 FEMA: 4112 JECFA: 1626 FLAVIS: 09.939 Use(s): flavor and fragrance agents | ||
| 64190-80-3 | hexadecyl ferulate | |
| Use(s): natural substances and extractives | ||
| 64190-81-4 | octadecyl ferulate | |
| Use(s): natural substances and extractives | ||
| 64190-82-5 | icosyl ferulate | |
| Use(s): natural substances and extractives | ||
| 64200-22-2 | cerasidin | |
| Use(s): natural substances and extractives | ||
| 64216-20-2 | 1,3-bis(2- | benzothiazolyl mercaptomethyl) urea |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 64236-23-3 | 2',3'- | dihydrophytomenadione |
| Use(s): natural substances and extractives | ||
| 64236-38-0 | petasol | |
| Use(s): natural substances and extractives | ||
| 64248-79-9 | sodium isostearate | |
| EC: 264-754-4 Use(s): emulsifiers, surfactants | ||
| 64265-41-4 | lauroamphodipropionic acid | |
| Use(s): cosmetic agents | ||
| 64271-10-9 | margaritene | |
| Use(s): natural substances and extractives | ||
| 64271-11-0 | iso | margaritene |
| Use(s): natural substances and extractives | ||
| 64275-73-6 | (Z)-5- | octen-1-ol |
| EC: 264-764-9 FEMA: 3722 JECFA: 322 FLAVIS: 02.113 Use(s): flavor and fragrance agents | ||
| 64280-22-4 | ovalitenone | |
| Use(s): natural substances and extractives | ||
| 64280-32-6 | 2,4- | difurfuryl furan |
| FEMA: 4095 JECFA: 1496 FLAVIS: 13.107 Use(s): flavoring agents | ||
| 64290-91-1 | galactopinitol A | |
| Use(s): natural substances and extractives | ||
| 64303-47-5 | 8- | methyl-2-nonanone |
| Use(s): natural substances and extractives | ||
| 64309-03-1 | rescalure | |
| Use(s): herbicides / pesticides | ||
| 64317-66-4 | capsiamide | |
| Use(s): natural substances and extractives | ||
| 64334-59-4 | polyoxymethylene glycol urea | |
| Use(s): preservatives | ||
| 64340-33-6 | anastreptene | |
| Use(s): natural substances and extractives | ||
| 64364-10-9 | sorbeth-30 tetraisostearate | |
| Use(s): emulsifiers, surfactants | ||
| 64365-06-6 | iso | paraffinic petroleum hydrocarbons |
| Use(s): multipurpose additives | ||
| 64365-11-3 | carbon, activated | |
| Use(s): closures with sealing gaskets for food containers | ||
| 64365-17-9 | pentaerythrityl hydrogenated rosinate | |
| EC: 264-848-5 Use(s): film forming agents | ||
| 64366-24-1 | potassium carrageenan | |
| Use(s): thickeners, gelling agents, stabalizers and emulsifiers | ||
| 64366-24-1 | potassium carrageenan with polysorbate 80 | |
| Use(s): chewing gum bases and related substances | ||
| 64366-70-7 | ppg-9-ethylhexeth-5 | |
| Use(s): emulsifiers, surfactants | ||
| 64391-39-5 | 1- | undecen-2-ol |
| Use(s): natural substances and extractives | ||
| 64396-81-2 | mangiferadiol | |
| Use(s): natural substances and extractives | ||
| 64421-25-6 | ortho- | anisyl benzoate |
| Use(s): information only not used for fragrances or flavors | ||
| 64425-88-3 | quaternium-16 | |
| EC: 264-890-4 Use(s): antistatic and conditioning agents | ||
| 64432-06-0 | dulcoside A | |
| Use(s): natural substances and extractives | ||
| 64452-96-6 | chromium nicotinate | |
| Use(s): special dietary and nutritional additives | ||
| 64461-99-0 | (E)-2- | tetradecenal |
| FEMA: 4209 Use(s): flavor and fragrance agents | ||
| 64462-00-6 | 2- | pentadecenal |
| Use(s): natural substances and extractives | ||
| 64474-51-7 | iso | mucronulatol |
| Use(s): natural substances and extractives | ||
| 64519-44-4 | menthyl pyrrolidone carboxylate | |
| EC: 264-935-8 Use(s): flavoring agents | ||
| 64519-82-0 | iso | malt |
| Use(s): sweeteners, bulking agents, anticaking agents, glazing agents | ||
| 64536-06-7 | styrene, limonene copolymer | |
| Use(s): information only not used for fragrances or flavors | ||
| 64549-15-1 | 3- | methylthio-4-heptanone |
| Use(s): information only not used for fragrances or flavors | ||
| 64576-90-5 | (E,E)-2,4- | nonadien-1-ol |
| EC: 264-947-3 Use(s): information only not used for fragrances or flavors | ||
| 64577-91-9 | acetaldehyde butyl phenethyl acetal | |
| EC: 264-948-9 FEMA: 3125 JECFA: 1001 FLAVIS: 06.036 Use(s): flavor and fragrance agents | ||
| 64584-92-5 | (R)-(-)-4- | penten-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 64608-59-9 | 1- | methyl pyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64608-60-2 | 4- | methyl pyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64608-61-3 | 3- | methyl pyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64608-62-4 | 1,3- | dimethyl pyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64608-63-5 | 1,4- | dimethyl pyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64608-64-6 | 3,4- | dimethylpyrrolo[1,2-a]pyrazine |
| Use(s): natural substances and extractives | ||
| 64611-81-0 | peg-5 oleammonium methosulfate | |
| Use(s): cosmetic ingredient for hair conditioning | ||
| 64611-88-7 | 10,11- | dihydronerolidol |
| Use(s): information only not used for fragrances or flavors | ||
| 64628-44-0 | triflumuron | |
| Use(s): herbicides / pesticides | ||
| 64644-32-2 | 2- | melozol formate |
| EC: 264-990-8 Use(s): fragrance agents | ||
| 64644-34-4 | 2- | melozol acetate |
| EC: 264-991-3 Use(s): fragrance agents | ||
| 64644-36-6 | octahydro-4,7-methano-1H-indene-2-methanol | |
| EC: 264-992-9 Use(s): fragrance agents | ||
| 64660-84-0 | cetyl myristoleate | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 64661-54-7 | 6- | hydroxy-2,6-dimethyl-2,7-octadien-4-one |
| Use(s): natural substances and extractives | ||
| 64670-94-6 | diosmetinidin chloride | |
| Use(s): information only not used for fragrances or flavors | ||
| 64677-46-9 | 1,5- | undecadien-4-ol |
| EC: 265-007-5 Use(s): information only not used for fragrances or flavors | ||
| 64677-48-1 | 1,5- | undecadien-4-yl acetate |
| EC: 265-008-0 Use(s): information only not used for fragrances or flavors | ||
| 64677-61-8 | 1-(2- | furyl)-2-buten-1-one |
| Use(s): information only not used for fragrances or flavors | ||
| 64703-85-1 | kanokoside A | |
| Use(s): natural substances and extractives | ||
| 64703-87-3 | kanokoside C | |
| Use(s): natural substances and extractives | ||
| 64703-88-4 | kanokoside D | |
| Use(s): natural substances and extractives | ||
| 64703-98-6 | 4-(2- | propenyl)phenyl-beta-dextro-glucopyranoside |
| FEMA: 4548 JECFA: 2018 Use(s): sweeteners, flavor enhancers | ||
| 64723-18-8 | potassium polyaspartate | |
| Use(s): food additive | ||
| 64741-65-7 | naphtha (petroleum) heavy alkylate | |
| EC: 265-067-2 Use(s): information only not used for fragrances or flavors | ||
| 64741-66-8 | naphtha (petroleum) light alkylate | |
| EC: 265-068-8 Use(s): information only not used for fragrances or flavors | ||
| 64741-76-0 | C14-19 alkane | |
| EC: 265-077-7 Use(s): solvents | ||
| 64742-33-2 | ozokerite | |
| EC: 265-134-6 Use(s): cosmetic agents | ||
| 64742-46-7 | C13-15 alkane | |
| EC: 265-148-2 Use(s): solvents | ||
| 64742-48-9 | C10-12 alkane/cycloalkane | |
| EC: 265-150-3 Use(s): solvents | ||
| 64742-49-0 | C8-9 alkane/cycloalkane | |
| EC: 265-151-9 Use(s): solvents | ||
| 64742-49-0 | C9-10 alkane/cycloalkane | |
| EC: 265-151-9 Use(s): solvents | ||
| 64742-49-0 | C9-11 alkane/cycloalkane | |
| EC: 265-151-9 Use(s): solvents | ||
| 64742-51-4 | paraffin waxes (petroleum) hydrotreated | |
| EC: 265-154-5 Use(s): cosmetic agents | ||
| 64742-55-8 | C16-23 alkane | |
| EC: 265-158-7 Use(s): emollients, skin conditioning | ||
| 64742-55-8 | C21-28 alkane | |
| EC: 265-158-7 Use(s): emollients, skin conditioning | ||
| 64742-60-5 | hydrogenated microcrystalline | wax hydrotreated |
| EC: 265-163-4 Use(s): binding, emulsion stabilising agents | ||
| 64742-82-1 | C8-10 alkane/cycloalkane/aromatic hydrocarbons | |
| EC: 265-185-4 Use(s): solvents | ||
| 64742-94-5 | C12-15- | alkane/cycloalkane/aromatic hydrocarbons |
| EC: 265-198-5 Use(s): solvents | ||
| 64742-95-6 | C9-10 aromatic hydrocarbons | |
| EC: 265-199-0 Use(s): solvents | ||
| 64743-02-8 | poly(C20-28 olefin) | |
| EC: 265-207-2 Use(s): binding, film forming agents | ||
| 64771-95-5 | acrylates/ethylhexyl acrylate/hema copolymer | |
| Use(s): film forming agents | ||
| 64776-96-1 | betulalbuside A | |
| Use(s): natural substances and extractives | ||
| 64820-99-1 | vitexin 2-O-rhamnoside | |
| Use(s): natural substances and extractives | ||
| 64825-20-3 | 2- | ethylidene decanal |
| EC: 265-244-4 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 64825-84-9 | oxido | himachalene |
| Use(s): natural substances and extractives | ||
| 64835-96-7 | 4-( | furfuryl thio)-4-methyl-2-pentanone |
| EC: 265-249-1 Use(s): flavoring agents | ||
| 64849-39-4 | rubusoside | |
| Use(s): humectants, skin conditioning | ||
| 64855-00-1 | lappaol C | |
| Use(s): natural substances and extractives | ||
| 64855-01-2 | lappaol D | |
| Use(s): natural substances and extractives | ||
| 64855-91-0 | arginine PCA | |
| EC: 265-253-3 Use(s): humectants | ||
| 64880-73-5 | 2,4,5- | trimethyl furan-3(2H)-one |
| Use(s): natural substances and extractives | ||
| 64896-70-4 | iso | sorbide dicaprylate |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 64929-15-3 | armexifolin | |
| Use(s): natural substances and extractives | ||
| 64935-38-2 | (E)-2- | butyl-2-octenal |
| Use(s): natural substances and extractives | ||
| 64979-94-8 | cinncassiol C3 | |
| Use(s): natural substances and extractives | ||
| 64988-06-3 | ortho- | methoxybenzyl ethyl ether |
| EC: 265-301-3 Use(s): fragrance agents | ||
| 65001-62-9 | 3- | buten-2-yl benzoate |
| Use(s): natural substances and extractives | ||
| 65016-61-7 | 3- | heptyl thiophene |
| Use(s): flavoring agents | ||
| 65018-14-6 | gamma- | costol |
| Use(s): natural substances and extractives | ||
| 65018-15-7 | alpha- | costol |
| Use(s): natural substances and extractives | ||
| 65025-62-9 | soulattrolide | |
| Use(s): natural substances and extractives | ||
| 65028-59-3 | potassium pectinate | |
| Use(s): emulsifiers | ||
| 65059-61-2 | quaternium-82 | |
| EC: 265-339-0 Use(s): antistatic and conditioning agents | ||
| 65060-02-8 | cetrimonium methosulfate | |
| EC: 265-352-1 Use(s): cosmetic agents | ||
| 65071-98-9 | laneth-10 acetate | |
| Use(s): emollients, emulsifiers | ||
| 65072-00-6 | casein hydrolysate | |
| EC: 265-363-1 Use(s): food additive and cosmetic agents | ||
| 65072-01-7 | yeast amino acids | |
| Use(s): humectants | ||
| 65072-01-7 | corn gluten amino acids | |
| Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 65104-36-1 | DEA-lauraminopropionate | |
| EC: 265-417-4 Use(s): cosmetic agents | ||
| 65113-42-0 | (E)-4- | hepten-3-one |
| Use(s): information only not used for fragrances or flavors | ||
| 65113-95-3 | sandal pentenone | |
| EC: 265-450-4 Use(s): fragrance agents | ||
| 65113-99-7 | sandal pentanol | |
| EC: 265-453-0 Use(s): fragrance agents | ||
| 65114-02-5 | 2- | ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-butenal |
| EC: 265-455-1 Use(s): information only not used for fragrances or flavors | ||
| 65114-03-6 | alpha,2,2,3- | tetramethyl cyclopent-3-ene-1-butyraldehyde |
| EC: 265-456-7 Use(s): fragrance agents | ||
| 65115-74-4 | succinyl acetoacetate | |
| Use(s): information only not used for fragrances or flavors | ||
| 65128-08-7 | rotundene | |
| Use(s): natural substances and extractives | ||
| 65128-96-3 | (Z)-7- | tetradecenal |
| EC: 265-493-9 Use(s): natural substances and extractives | ||
| 65128-99-6 | methyl cyclopentapyrazine | |
| Use(s): information only not used for fragrances or flavors | ||
| 65140-91-2 | 3,5- | di-tert-butyl-4-hydroxybenzylphosphonic acid, monoethyl ester, calcium salt |
| EC: 265-512-0 Use(s): indirect food additives: adhesives and components of coatings | ||
| 65150-81-4 | ppg-4 trideceth-6 | |
| Use(s): emollients, emulsifiers | ||
| 65155-45-5 | nonisyl propionate | |
| EC: 265-573-3 Use(s): fragrance agents | ||
| 65155-46-6 | iso | nonyl formate |
| EC: 265-574-9 Use(s): information only not used for fragrances or flavors | ||
| 65195-50-8 | scutigeral | |
| Use(s): natural substances and extractives | ||
| 65208-41-5 | calcium thioglycolate hydroxide | |
| Use(s): depilatory agents | ||
| 65213-86-7 | 1,5- | octadien-3-one |
| FEMA: 4405 JECFA: 1848 FLAVIS: 07.190 Use(s): flavoring agents | ||
| 65215-54-5 | diphenylmethyl piperazinylbenzimidazole | |
| Use(s): antimicrobial agents | ||
| 65230-04-8 | anhydrocinnzeylanol | |
| Use(s): natural substances and extractives | ||
| 65235-31-6 | 3- | nitro-p-hydroxyethylaminophenol |
| EC: 265-648-0 Use(s): hair dyeing agents | ||
| 65242-64-0 | glyzaglabrin | |
| Use(s): natural substances and extractives | ||
| 65277-42-1 | ketoconazole | |
| EC: 265-667-4 Use(s): pharmaceuticals / chemical synthisis | ||
| 65277-53-4 | trilauryl citrate | |
| EC: 265-671-6 Use(s): emollients, skin conditioning | ||
| 65277-54-5 | disodium ricinoleamido MEA-sulfosuccinate | |
| EC: 265-672-1 Use(s): cosmetic agents | ||
| 65277-59-0 | disodium stearyl sulfosuccinate | |
| EC: 265-673-7 Use(s): cosmetic agents | ||
| 65291-43-2 | diisobutyl thiomalate | |
| EC: 265-677-9 Use(s): information only not used for fragrances or flavors | ||
| 65293-09-6 | p- | mentha-1(7),2-dien-8-ol |
| Use(s): natural substances and extractives | ||
| 65330-49-6 | strawberry furanone ethyl ether | |
| EC: 265-701-8 FEMA: 4104 JECFA: 2231 FLAVIS: 13.117 Use(s): flavoring agents | ||
| 65349-31-7 | 1-(2,4- | dihydroxy-6-methoxy-3,5-dimethylphenyl)-3-phenyl-2-propen-1-one |
| Use(s): natural substances and extractives | ||
| 65349-37-3 | myrigalone E | |
| Use(s): natural substances and extractives | ||
| 65378-76-9 | 1,2,4,4- | tetramethyl cyclopentene |
| Use(s): natural substances and extractives | ||
| 65381-09-1 | caprylic/capric triglyceride | |
| EC: 265-724-3 Use(s): solvents/deluents for flavoring agents | ||
| 65383-57-5 | 3- | ethoxy-4-methoxyphenol |
| EC: 265-725-9 Use(s): natural substances and extractives | ||
| 65405-67-6 | para- | methoxy-alpha-methyl cinnamaldehyde |
| EC: 265-737-4 FEMA: 3182 JECFA: 689 FLAVIS: 05.051 Use(s): flavor and fragrance agents | ||
| 65405-68-7 | 3- | octanon-1-ol |
| EC: 265-739-5 FEMA: 2804 JECFA: 604 Use(s): flavor and fragrance agents | ||
| 65405-69-8 | cyclohexyl cyclopentenyl acetate | |
| EC: 265-740-0 Use(s): fragrance agents | ||
| 65405-70-1 | (E)-4- | decenal |
| EC: 265-741-6 FEMA: 3264 Use(s): flavor and fragrance agents | ||
| 65405-72-3 | amber formate | |
| EC: 265-742-1 Use(s): fragrance agents | ||
| 65405-73-4 | (E)- | geranyl oxyacetaldehyde |
| EC: 265-743-7 Use(s): fragrance agents | ||
| 65405-76-7 | (Z)-3- | hexen-1-yl anthranilate |
| EC: 265-744-2 FEMA: 3925 JECFA: 1538 FLAVIS: 09.561 Use(s): flavor and fragrance agents | ||
| 65405-77-8 | (Z)-3- | hexen-1-yl salicylate |
| EC: 265-745-8 FEMA: 4750 FLAVIS: 09.570 Use(s): flavor and fragrance agents | ||
| 65405-77-8 | (Z)-3- | hexen-1-yl salicylate |
| EC: 265-745-8 FEMA: 4750 FLAVIS: 09.570 Use(s): flavor and fragrance agents | ||
| 65405-80-3 | (Z)-3- | hexen-1-yl (E)-crotonate |
| EC: 265-746-3 FEMA: 3982 JECFA: 1276 FLAVIS: 09.566 Use(s): flavor and fragrance agents | ||
| 65405-84-7 | 2(1)- | orris butanal |
| EC: 265-747-9 Use(s): flavor and fragrance agents | ||
| 65416-14-0 | maltyl isobutyrate | |
| EC: 265-755-2 FEMA: 3462 JECFA: 1482 FLAVIS: 09.525 Use(s): flavor and fragrance agents | ||
| 65416-17-3 | 3,5- | diethyl dimethyl cyclohexenone |
| EC: 265-758-9 Use(s): fragrance agents | ||
| 65416-20-8 | phenyl acetaldehyde isohexylene glycol cyclic acetal | |
| EC: 265-759-4 Use(s): fragrance agents | ||
| 65416-21-9 | bicycloheptenyl ethanone oxime | |
| EC: 265-761-5 Use(s): fragrance agents | ||
| 65416-24-2 | benzyl crotonate | |
| EC: 265-764-1 FLAVIS: 09.314 Use(s): flavoring agents | ||
| 65416-26-4 | beta- | ionyl ethyl ether |
| EC: 265-765-7 Use(s): fragrance agents | ||
| 65416-28-6 | (Z)-3- | hexen-1-yl senecioate |
| EC: 265-766-2 Use(s): flavoring agents | ||
| 65416-30-0 | dehydro beta-linalyl propionate | |
| Use(s): information only not used for fragrances or flavors | ||
| 65416-59-3 | vitispirane | |
| FLAVIS: 16.054 Use(s): flavoring agents | ||
| 65423-25-8 | 11- | dodecenoic acid |
| FEMA: 4355 JECFA: 1635 Use(s): flavoring agents | ||
| 65442-31-1 | iso | butyl quinoline |
| EC: 265-777-2 Use(s): fragrance agents | ||
| 65443-14-3 | fruity cyclopentanone | |
| EC: 265-779-3 Use(s): fragrance agents | ||
| 65447-77-0 | 1-(2- | hydroxyethyl)-4-hydroxy-2,2,6,6-tetramethyl piperidine-succinic acid, dimethyl ester, copolymer |
| Use(s): indirect food additives: adhesives and components of coatings | ||
| 65466-10-6 | (Z)-2- | penten-1-yl benzoate |
| EC: 265-788-2 Use(s): information only not used for fragrances or flavors | ||
| 65497-29-2 | guar hydroxypropyl trimonium chloride | |
| Use(s): cosmetic agents | ||
| 65501-41-9 | sylpin | |
| Use(s): natural substances and extractives | ||
| 65504-45-2 | 2- | butyl-5- or 6-keto-1,4-dioxane |
| FEMA: 2204 FLAVIS: 13.028 Use(s): flavoring agents | ||
| 65504-93-0 | 1- | phenyl-3(5)-propyl pyrazole |
| FEMA: 3727 JECFA: 1568 FLAVIS: 14.029 Use(s): flavoring agents | ||
| 65504-94-1 | methyl ethoxypyrazine | |
| EC: 265-794-5 FEMA: 3569 JECFA: 793 FLAVIS: 14.067 Use(s): flavoring agents | ||
| 65504-95-2 | 5(or 6)- | butyl-1,4-dioxan-2-one |
| FEMA: 2204 JECFA: 1484 FLAVIS: 13.028 Use(s): flavoring agents | ||
| 65504-96-3 | 2- | amyl-5 or 6-keto-1,4-dioxane |
| FEMA: 2076 JECFA: 1485 FLAVIS: 13.027 Use(s): flavoring agents | ||
| 65504-97-4 | 2- | hexyl-5 or 6-keto-1,4-dioxane |
| FEMA: 2574 JECFA: 1486 Use(s): flavoring agents | ||
| 65505-16-0 | 2,5- | dimethyl-3-thiofuroyl furan |
| EC: 265-796-6 JECFA: 1071 FLAVIS: 13.040 Use(s): flavoring agents | ||
| 65505-17-1 | methyl 2-methyl-3-furyl disulfide | |
| EC: 265-797-1 FEMA: 3573 JECFA: 1064 FLAVIS: 13.079 Use(s): flavoring agents | ||
| 65505-18-2 | 2,4- | dimethyl-5-vinyl thiazole |
| FEMA: 3145 JECFA: 1039 FLAVIS: 15.005 Use(s): flavoring agents | ||
| 65505-24-0 | iso | butyl methyl anthranilate |
| EC: 265-798-7 FEMA: 4149 JECFA: 1548 FLAVIS: 09.769 Use(s): flavor and fragrance agents | ||
| 65505-25-1 | tetrahydrofurfuryl cinnamate | |
| EC: 265-799-2 FEMA: 3320 JECFA: 1447 FLAVIS: 13.060 Use(s): flavor and fragrance agents | ||
| 65515-53-9 | benzyl anisate | |
| EC: 265-804-8 Use(s): information only not used for fragrances or flavors | ||
| 65518-46-9 | (E,E)-2,4- | heptadienoic acid |
| Use(s): natural substances and extractives | ||
| 65520-45-8 | dibutyl carbityl succinate | |
| EC: 265-806-9 Use(s): information only not used for fragrances or flavors | ||
| 65530-53-2 | 2- | methyl-3-,5 or 6-(furfuryl thio) pyrazine |
| FEMA: 3189 JECFA: 1082 FLAVIS: 13.151 Use(s): flavor and fragrance agents | ||
| 65530-70-3 | ammonium C6-16 perfluoroalkylethyl phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 65530-71-4 | ammonium C6-16 perfluoroalkylethyl phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 65530-72-5 | ammonium C6-16 perfluoroalkylethyl phosphate | |
| Use(s): emulsifiers, surfactants | ||
| 65545-81-5 | (E)- | spicy acrolein |
| JECFA: 1502 FLAVIS: 13.137 Use(s): flavoring agents | ||
| 65546-85-2 | evening primrose seed oil | |
| Use(s): emollients | ||
| 65546-85-2 | oenothera biennis seed oil CO2 extract | |
| Use(s): cosmetic agents | ||
| 65548-54-1 | 7,8- | dimethoxyflavone |
| Use(s): information only not used for fragrances or flavors | ||
| 65548-55-2 | 3',4',7,8- | tetramethoxyflavone |
| Use(s): natural substances and extractives | ||
| 65556-51-6 | heliangolide | |
| Use(s): natural substances and extractives | ||
| 65557-98-4 | 14- | acetoxycedrol |
| Use(s): natural substances and extractives | ||
| 65563-96-4 | 1,5,5,8- | tetramethyl-12-thiabicyclo[9.1.0]dodeca-3,7-diene |
| Use(s): natural substances and extractives | ||
| 65582-53-8 | europine-N-oxide | |
| Use(s): natural substances and extractives | ||
| 65588-69-4 | ambroxide | |
| Use(s): flavor and fragrance agents | ||
| 65589-70-0 | acriflavine | |
| Use(s): coloring agents, antioxidants | ||
| 65591-12-0 | eugenyl butyrate | |
| EC: 265-838-3 Use(s): information only not used for fragrances or flavors | ||
| 65591-14-2 | arachidyl propionate | |
| EC: 265-839-9 Use(s): emollients, skin conditioning | ||
| 65618-21-5 | tricetinidin chloride | |
| Use(s): natural substances and extractives | ||
| 65620-50-0 | 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| FEMA: 3549 JECFA: 1648 FLAVIS: 13.076 Use(s): flavor and fragrance agents | ||
| 65644-60-2 | 2- | methyl dodecane nitrile |
| EC: 265-850-9 Use(s): information only not used for fragrances or flavors | ||
| 65649-36-7 | esculentoside E | |
| Use(s): natural substances and extractives | ||
| 65652-28-0 | methyl 1-methyl-3-(4-methyl-3-pentenyl) cyclohex-3-ene-1-carboxylate | |
| EC: 265-854-0 Use(s): fragrance agents | ||
| 65652-33-7 | hexyl (Z)-tiglate | |
| EC: 265-857-7 Use(s): flavor and fragrance agents | ||
| 65684-27-7 | undecylenic glycerides | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 65694-10-2 | stearamidopropalkonium chloride | |
| EC: 265-880-2 Use(s): antistatic and conditioning agents | ||
| 65694-19-1 | fasciculol C | |
| Use(s): natural substances and extractives | ||
| 65694-20-4 | fasciculol E | |
| Use(s): natural substances and extractives | ||
| 65694-21-5 | fasciculol F | |
| Use(s): natural substances and extractives | ||
| 65718-88-9 | 2- | hexyl benzothiazole |
| Use(s): natural substances and extractives | ||
| 65725-11-3 | lactupicrin | |
| Use(s): natural substances and extractives | ||
| 65731-84-2 | beta- | cypermethrin |
| EC: 265-898-0 Use(s): herbicides / pesticides | ||
| 65732-10-7 | copper laevo-aspartate | |
| Use(s): special dietary and nutritional additives | ||
| 65737-52-2 | octen-1-yl cyclopentanone | |
| EC: 265-901-5 FEMA: 3889 JECFA: 1116 Use(s): flavor and fragrance agents | ||
| 65767-22-8 | (Z)-1,5- | octadien-3-one |
| Use(s): natural substances and extractives | ||
| 65781-38-6 | 3- | methyl undecanoic acid |
| EC: 265-925-6 Use(s): information only not used for fragrances or flavors | ||
| 65792-05-4 | agrimophol | |
| Use(s): natural substances and extractives | ||
| 65813-53-8 | 2- | phenyl propyl isobutyrate |
| EC: 265-931-9 FEMA: 2892 JECFA: 1470 FLAVIS: 09.485 Use(s): flavor and fragrance agents | ||
| 65817-24-5 | dimethyl benzofuranone | |
| FEMA: 3863 JECFA: 1167 FLAVIS: 10.072 Use(s): flavoring agents | ||
| 65819-74-1 | (E,E)- | di-(1-propanyl) sulfide |
| FLAVIS: 12.298 Use(s): information only not used for fragrances or flavors | ||
| 65820-52-2 | 3- | methyl tetracosane |
| Use(s): natural substances and extractives | ||
| 65820-56-6 | 3- | methyl hexacosane |
| Use(s): natural substances and extractives | ||
| 65848-36-4 | 6- | methyl eicosane |
| Use(s): information only not used for fragrances or flavors | ||
| 65883-48-9 | germanicol cinnamate | |
| Use(s): natural substances and extractives | ||
| 65887-08-3 | alpha- | benzylidene methional |
| FEMA: 3717 JECFA: 505 FLAVIS: 12.087 Use(s): flavoring agents | ||
| 65887-09-4 | 2-(( | methyl thio)methyl)-3-(5-methyl furfuryl) propenal |
| Use(s): information only not used for fragrances or flavors | ||
| 65892-84-4 | falcarindione | |
| Use(s): natural substances and extractives | ||
| 65894-82-8 | 2-(2- | butyl)-4,5-dimethyl-3-thiazoline |
| EC: 265-968-0 FEMA: 3619 JECFA: 1059 FLAVIS: 15.029 Use(s): flavoring agents | ||
| 65894-83-9 | yeast thiazoline | |
| EC: 265-969-6 FEMA: 3621 JECFA: 1045 FLAVIS: 15.032 Use(s): flavoring agents | ||
| 65899-13-0 | 3- | methyl nonanal |
| EC: 265-972-2 Use(s): information only not used for fragrances or flavors | ||
| 65907-30-4 | furathiocarb | |
| EC: 265-974-3 Use(s): herbicides / pesticides | ||
| 65909-91-3 | (Z,Z)-2,4- | decadienal |
| Use(s): flavoring agents | ||
| 65914-17-2 | polydatin | |
| Use(s): antioxidants | ||
| 65915-75-5 | 3- | ethoxy-2-pentanone |
| Use(s): natural substances and extractives | ||
| 65954-19-0 | (Z)-4- | tridecen-1-yl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 65963-40-8 | chlorophylls, copper complexes | |
| Use(s): coloring agents | ||
| 65982-77-6 | omega- | benzoyl oxyphloracetophenone |
| Use(s): information only not used for fragrances or flavors | ||
| 65995-51-9 | citrusin D | |
| Use(s): natural substances and extractives | ||
| 65995-63-3 | punicalagin | |
| Use(s): natural substances and extractives | ||
| 65995-64-4 | punicalin | |
| Use(s): natural substances and extractives | ||
| 65996-61-4 | pulp, cellulose | |
| EC: 265-995-8 Use(s): food-contact surface of paper and paperboard | ||
| 65996-62-5 | starch food modified: oxidized starches | |
| Use(s): food starch-modified | ||
| 65996-63-6 | starch acid modified | |
| Use(s): food starch-modified | ||
| 65996-64-7 | starch, enzyme-hydrolyzed | |
| Use(s): food additive | ||
| 65996-98-7 | terpenes and terpenoids | |
| EC: 266-034-5 Use(s): fragrance agents | ||
| 65996-99-8 | turpentine oil terpenes limonene fraction | |
| EC: 266-035-0 Use(s): fragrance agents, solvents | ||
| 65997-05-9 | dimer rosin | |
| EC: 500-163-2 Use(s): cosmetic agents | ||
| 65997-06-0 | hydrogenated | rosin |
| EC: 266-041-3 Use(s): cosmetic and fragrance agents | ||
| 65997-07-1 | rosin/formaldehyde copolymer | |
| Use(s): depilatory agents | ||
| 65997-11-7 | rosin fumarated-pentaerythritol copolymer | |
| EC: 500-164-8 Use(s): diluents in color additive mixtures | ||
| 65997-13-9 | glyceryl hydrogenated rosinate | |
| EC: 266-042-9 Use(s): film forming agents | ||
| 65997-17-3 | calcium aluminum borosilicate | |
| EC: 266-046-0 Use(s): bulking agents | ||
| 66008-65-9 | 3- | methyl-3-octyl acetate |
| EC: 266-056-5 Use(s): fragrance agents | ||
| 66008-66-0 | methyl octenyl acetate | |
| EC: 266-057-0 Use(s): fragrance agents | ||
| 66009-41-4 | stearyl heptanoate | |
| EC: 266-065-4 Use(s): emollients, emollient with well-developed consistency giving properties | ||
| 66036-38-2 | (±)- | equol |
| Use(s): natural substances and extractives | ||
| 66056-19-7 | licoisoflavone A | |
| Use(s): natural substances and extractives | ||
| 66062-78-0 | herbal norbornane | |
| EC: 266-095-8 Use(s): fragrance agents | ||
| 66063-05-6 | pencycuron | |
| EC: 266-096-3 Use(s): herbicides / pesticides | ||
| 66068-84-6 | sandal cyclohexanol | |
| EC: 266-100-3 Use(s): fragrance agents | ||
| 66070-58-4 | hydrogenated | styrene / butadiene copolymer |
| Use(s): film forming, viscosity controlling agents | ||
| 66070-87-9 | polyglyceryl phthalate ester of coconut oil fatty acids | |
| Use(s): adjuvants for pesticide use dilutions | ||
| 66071-80-5 | MEA-cocoate | |
| EC: 266-105-0 Use(s): surfactant | ||
| 66071-94-1 | corn steep liquor | |
| EC: 266-113-4 Use(s): substances under the Food Additives Amendment added directly to feed | ||
| 66071-96-3 | corn glutens | |
| EC: 266-116-0 Use(s): food starch-modified | ||
| 66071-96-3 | zea mays cob meal | |
| EC: 266-116-0 Use(s): abrasives, binding agents | ||
| 66072-07-9 | palm oil fatty acids potassium salts | |
| EC: 266-119-7 Use(s): cosmetic agents | ||
| 66072-32-0 | (R)- | sandal hexanol |
| EC: 266-122-3 Use(s): fragrance agents | ||
| 66082-42-6 | polyglyceryl-3 diisostearate | |
| Use(s): cosmetic agents | ||
| 66082-43-7 | polyglyceryl-3 triisostearate | |
| Use(s): emollients, emulsifiers | ||
| 66085-00-5 | glyceryl isostearate | |
| EC: 266-124-4 Use(s): emollients, emulsifiers | ||
| 66095-81-6 | 2- | hydroxyethylamino-5-nitroanisole |
| EC: 266-138-0 Use(s): hair dyeing agents | ||
| 66101-64-2 | ppg-35/ppg-51 glyceryl ether/IPDI crosspolymer | |
| Use(s): plasticizers | ||
| 66141-11-5 | gamma1- | cadinene |
| Use(s): natural substances and extractives | ||
| 66161-52-2 | oleyl behenate | |
| EC: 266-186-2 Use(s): information only not used for fragrances or flavors | ||
| 66161-60-2 | TIPA-lauryl sulfate | |
| EC: 266-195-1 Use(s): emulsifiers, surfactants | ||
| 66161-62-4 | sodium lauroamphoacetate | |
| EC: 266-197-2 Use(s): cosmetic agents | ||
| 66169-00-4 | methyl furfuryl trisulfide | |
| FLAVIS: 13.146 Use(s): flavoring agents | ||
| 66170-10-3 | sodium ascorbyl phosphate | |
| Use(s): food additive and cosmetic agents | ||
| 66215-27-8 | cyromazine | |
| EC: 266-257-8 Use(s): herbicides / pesticides | ||
| 66219-01-0 | calamol | |
| Use(s): natural substances and extractives | ||
| 66222-24-0 | acetaldehyde benzyl ethyl acetal | |
| Use(s): flavoring agents | ||
| 66230-04-4 | esfenvalerate | |
| Use(s): herbicides / pesticides | ||
| 66246-88-6 | penconazole | |
| EC: 266-275-6 Use(s): herbicides / pesticides | ||
| 66256-48-2 | 2,5,6- | trimethyl-2-heptanol |
| Use(s): information only not used for fragrances or flavors | ||
| 66267-50-6 | chitosan lactate | |
| Use(s): cosmetic agents | ||
| 66267-52-5 | chitosan formate | |
| Use(s): film forming agents | ||
| 66274-43-9 | ximenic acid | |
| Use(s): natural substances and extractives | ||
| 66274-45-1 | subulin | |
| Use(s): natural substances and extractives | ||
| 66322-32-5 | 12alpha- | hydroxyerosone |
| Use(s): natural substances and extractives | ||
| 66322-34-7 | meso- | dihydroguaiaretic acid |
| Use(s): natural substances and extractives | ||
| 66324-75-2 | 2- | butyl indan |
| Use(s): natural substances and extractives | ||
| 66327-54-6 | green carbaldehyde | |
| EC: 266-314-7 Use(s): fragrance agents | ||
| 66332-96-5 | flutolanil | |
| Use(s): herbicides / pesticides | ||
| 66389-06-8 | cuprenenol | |
| Use(s): natural substances and extractives | ||
| 66402-68-4 | sodium potassium aluminum silicate | |
| EC: 266-340-9 Use(s): bulking agents | ||
| 66408-78-4 | citral ethylene glycol acetal | |
| EC: 266-344-0 Use(s): fragrance agents | ||
| 66422-95-5 | 2,4- | diaminophenoxyethanol HCl |
| EC: 266-357-1 Use(s): hair dyeing agents | ||
| 66427-21-2 | 5- | mercapto-6-undecanone |
| Use(s): information only not used for fragrances or flavors | ||
| 66427-22-3 | 5- | mercapto-6-undecanol |
| Use(s): information only not used for fragrances or flavors | ||
| 66455-14-9 | C12-13 pareth-15 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-23 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-3 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-4 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-7 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-9 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-6 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-10 | |
| Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-2 | |
| EC: 500-165-3 Use(s): emulsifiers, surfactants | ||
| 66455-14-9 | C12-13 pareth-5 | |
| Use(s): emulsifiers, surfactants | ||
| 66455-17-2 | alcohols C9-11 | |
| EC: 266-367-6 Use(s): emollients, emulsion stabilising | ||
| 66455-21-8 | oligosaccharides | |
| Use(s): food additive | ||
| 66456-45-9 | tromethamine magnesium aluminum silicate | |
| Use(s): viscosity controlling agents | ||
| 66465-22-3 | heterodendrin | |
| Use(s): natural substances and extractives | ||
| 66465-62-1 | (8,Z)-2,5- | epoxymegastigma-6,8-diene |
| Use(s): natural substances and extractives | ||
| 66471-49-6 | 2,7- | dimethyl-6-octen-4-one |
| EC: 266-374-4 Use(s): fragrance agents | ||
| 66472-04-6 | dihydro-7-hydroxymyoporone | |
| Use(s): natural substances and extractives | ||
| 66486-85-9 | ethylhexylglyceryl behenate | |
| EC: 266-379-1 Use(s): emulsifiers | ||
| 66512-37-6 | ethyl (R)-N-(1-phenylethyl)glycinate | |
| EC: 266-385-4 Use(s): pharmaceuticals / chemical synthisis | ||
| 66512-56-9 | khusiol | |
| Use(s): natural substances and extractives | ||
| 66537-39-1 | (2S,5S)- | theaspirane A |
| Use(s): natural substances and extractives | ||
| 66537-40-4 | (2R,5S)- | theaspirane B |
| Use(s): natural substances and extractives | ||
| 66555-11-1 | dipentaerythritol stearate | |
| EC: 266-404-6 Use(s): food contact resinous and polymeric coatings | ||
| 66575-29-9 | colforsin | |
| EC: 266-410-9 Use(s): pharmaceuticals / chemical synthisis | ||
| 66576-71-4 | iso | propyl 2-methyl butyrate |
| EC: 266-411-4 FEMA: 3699 JECFA: 210 FLAVIS: 09.547 Use(s): flavor and fragrance agents | ||
| 66577-04-6 | 4- | ethyl-2-methyl thiophene |
| Use(s): natural substances and extractives | ||
| 66577-59-1 | 1,17- | heptadecanediol |
| Use(s): natural substances and extractives | ||
| 66587-45-9 | 10- | eicosene |
| Use(s): natural substances and extractives | ||
| 66587-54-0 | zea mays oil unsaponifiables | |
| EC: 266-416-1 Use(s): emollients, hair conditioning, skin conditioning | ||
| 66607-74-7 | heleniamarin | |
| Use(s): natural substances and extractives | ||
| 66610-38-6 | (+)-sec- | butyl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 66612-11-1 | hydroxyphenyl dihydroxybenzamide | |
| EC: 266-424-5 Use(s): antioxidants | ||
| 66618-63-1 | (E,E)-2,5- | heptadien-1-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 66634-12-6 | niacinamide salicylate | |
| Use(s): cosmetic ingredient for skin conditioning | ||
| 66634-44-4 | rauhimbine | |
| EC: 266-430-8 Use(s): natural substances and extractives | ||
| 66634-97-7 | 2,4- | dimethyl-2-pentenoic acid |
| FEMA: 3143 JECFA: 1211 Use(s): flavoring agents | ||
| 66642-85-1 | 4- | hepten-2-ol |
| Use(s): flavoring agents | ||
| 66642-86-2 | (E,E,Z)-2,4,7- | decatrienal |
| FEMA: 4089 Use(s): flavoring agents | ||
| 66648-43-9 | moupinamide | |
| Use(s): natural substances and extractives | ||
| 66648-50-8 | ethyl (E)-caffeate | |
| Use(s): information only not used for fragrances or flavors | ||
| 66671-82-7 | 2- | methoxy-p-phenylenediamine sulfate |
| EC: 266-443-9 Use(s): hair dyeing agents | ||
| 66717-34-8 | (E,Z)-2,4- | undecadiene |
| Use(s): natural substances and extractives | ||
| 66719-06-0 | 2-(2- | furyl)-5(or 6)-methyl pyrazine |
| Use(s): information only not used for fragrances or flavors | ||
| 66735-69-1 | 1-( | methyl thio)-3-pentanone |
| FLAVIS: 12.181 Use(s): flavoring agents | ||
| 66779-68-8 | 3-(3,4,5- | trimethoxyphenyl)propyl acetate |
| Use(s): information only not used for fragrances or flavors | ||
| 66793-76-8 | N- | ethyl heptyl amine |
| Use(s): pharmaceuticals / chemical synthisis | ||
| 66794-58-9 | peg-20 sorbitan isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 66794-58-9 | peg-5 sorbitan isostearate | |
| Use(s): emulsifiers | ||
| 66794-58-9 | peg-2 sorbitan isostearate | |
| Use(s): emulsifiers, surfactants | ||
| 66828-20-4 | sorbeth-6 hexastearate | |
| Use(s): emulsifiers | ||
| 66829-29-6 | starch food modified: | starch sodium octenyl succinate |
| Use(s): food starch-modified | ||
| 66835-10-7 | myrtine | |
| Use(s): natural substances and extractives | ||
| 66844-27-7 | sucrose tetrastearate | |
| EC: 266-495-2 Use(s): information only not used for fragrances or flavors | ||
| 66844-30-2 | sucrose heptalaurate | |
| EC: 266-496-8 Use(s): information only not used for fragrances or flavors | ||
| 66848-40-6 | tonkavert | |
| EC: 266-497-3 Use(s): fragrance agents | ||
| 66848-41-7 | 2,4- | dimethyl cyclohexene carbonitrile |
| EC: 266-498-9 Use(s): fragrance agents | ||
| 66873-37-8 | columellarin | |
| Use(s): natural substances and extractives | ||
| 66893-81-0 | pyridyloxide t-butylnitrone | |
| EC: 266-512-3 Use(s): antioxidants | ||
| 66912-24-1 | hexyl oxyacetonitrile | |
| Use(s): information only not used for fragrances or flavors | ||
| 66917-61-1 | iso | butyl 2-methyl-2-butenoate |
| Use(s): information only not used for fragrances or flavors | ||
| 66964-62-3 | callitrisin | |
| Use(s): natural substances and extractives | ||
| 66964-63-4 | callitrin | |
| Use(s): natural substances and extractives | ||
| 66983-88-8 | 3a,4- | dihydro-3-isobutylidene phthalide |
| Use(s): natural substances and extractives | ||
| 66988-04-3 | sodium isostearoyl lactylate | |
| EC: 266-533-8 Use(s): emulsifiers, surfactants | ||
| 67019-89-0 | violet nitrile | |
| EC: 266-545-3 Use(s): fragrance agents | ||
| 67024-46-8 | iso | propyl 2-ethyl hexanoate |
| EC: 266-549-5 Use(s): information only not used for fragrances or flavors | ||
| 67027-57-0 | sorbyl decanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67028-40-4 | cherry oxyacetate | |
| EC: 266-554-2 FEMA: 3157 JECFA: 1027 FLAVIS: 09.797 Use(s): flavor and fragrance agents | ||
| 67060-84-8 | tributoxysiloxy)methylsilane | |
| Use(s): emollients, skin conditioning | ||
| 67114-38-9 | 7- | decen-4-olide |
| FEMA: 4439 JECFA: 1992 FLAVIS: 10.038 Use(s): flavor and fragrance agents | ||
| 67116-22-7 | 8- | hydroxy-1-methoxy-3-methylanthraquinone |
| Use(s): natural substances and extractives | ||
| 67121-39-5 | 2- | methyl butyl octanoate |
| FLAVIS: 09.664 Use(s): flavoring agents | ||
| 67129-08-2 | metazachlor | |
| EC: 266-583-0 Use(s): herbicides / pesticides | ||
| 67167-66-2 | 2- | methyl decane alkanes |
| EC: 230-236-1 Use(s): solvents/deluents for cosmetic and fragrance agents | ||
| 67172-84-3 | kuwanon D | |
| Use(s): natural substances and extractives | ||
| 67183-30-6 | sodium potassium hexametaphosphate | |
| Use(s): sequestrants, antimold and antirope agents, stabilizers, buffering agents | ||
| 67204-66-4 | (+)-cis-12-oxo- | phytodienoic acid |
| Use(s): natural substances and extractives | ||
| 67231-93-0 | nonyl 3-mercaptopropionate | |
| EC: 266-614-8 Use(s): information only not used for fragrances or flavors | ||
| 67233-85-6 | sodium 5-nitroguaiacolate | |
| Use(s): herbicides / pesticides | ||
| 67233-89-0 | (E)-6- | undecen-2-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 67233-90-3 | (Z)-6- | undecen-2-ol |
| Use(s): natural substances and extractives | ||
| 67233-91-4 | ethyl 9-decenoate | |
| FLAVIS: 09.370 Use(s): flavoring agents | ||
| 67233-92-5 | butyl ethyl succinate | |
| Use(s): natural substances and extractives | ||
| 67234-04-2 | propionaldehyde ethyl isobutyl acetal | |
| FLAVIS: 06.044 Use(s): flavor and fragrance agents | ||
| 67254-73-3 | mono- and - | diglycerides |
| Use(s): dough strengtheners, emulsifiers, formulation aids | ||
| 67254-79-9 | fatty acids | |
| Use(s): multipurpose additives | ||
| 67258-70-2 | madlongiside C | |
| Use(s): natural substances and extractives | ||
| 67270-85-3 | (E)-5- | undecenoic acid |
| Use(s): information only not used for fragrances or flavors | ||
| 67329-09-3 | lumequic acid | |
| Use(s): natural substances and extractives | ||
| 67355-38-8 | nonisyl formate | |
| EC: 266-661-4 Use(s): fragrance agents | ||
| 67363-95-5 | 3- | ethyl furan |
| Use(s): natural substances and extractives | ||
| 67370-97-2 | alloathyriol | |
| Use(s): natural substances and extractives | ||
| 67392-15-8 | methyl 4-isopropyl-1-methyl bicyclo(2.2.2)oct-5-ene-2-carboxylate | |
| EC: 266-678-7 Use(s): fragrance agents | ||
| 67399-73-9 | 2- | acetyl thiazolidine |
| Use(s): information only not used for fragrances or flavors | ||
| 67401-25-6 | cis- | megastigma-5,8-diene-4-one |
| EC: 266-682-9 Use(s): natural substances and extractives | ||
| 67401-26-7 | trans- | megastigma-5,8-diene-4-one |
| EC: 266-683-4 Use(s): natural substances and extractives | ||
| 67401-27-8 | 5,8- | megastigmadien-4-one |
| EC: 266-685-5 Use(s): flavoring agents | ||
| 67411-27-2 | 3,6- | dimethyl-1,2,4,5-tetrathiane |
| FLAVIS: 15.056 Use(s): flavoring agents | ||
| 67416-61-9 | 3-O- | acetyl-11-keto-beta-boswellic acid |
| Use(s): natural substances and extractives | ||
| 67421-83-4 | methyl isobutyl disulfide | |
| Use(s): flavoring agents | ||
| 67446-07-5 | (Z)-5- | decen-1-yl acetate |
| EC: 266-693-9 Use(s): natural substances and extractives | ||
| 67452-27-1 | (Z)-4- | decen-1-yl acetate |
| FEMA: 3967 JECFA: 1288 FLAVIS: 09.918 Use(s): flavor and fragrance agents | ||
| 67467-45-2 | 2,4- | dihydroxy-6,7-dimethoxy-2H-1,4-benzoxazin-3(4H)-one |
| Use(s): natural substances and extractives | ||
| 67479-27-0 | aloe gum | |
| EC: 266-698-6 Use(s): information only not used for fragrances or flavors | ||
| 67492-31-3 | 3'- | hydroxydihydroformononetin |
| Use(s): natural substances and extractives | ||
| 67526-82-3 | 4'- | hydroxy-2-biphenylcarboxylic acid |
| Use(s): natural substances and extractives | ||
| 67528-13-6 | potassium magnesium aspartate | |
| Use(s): buffering agents | ||
| 67564-91-4 | fenpropimorph | |
| EC: 266-719-9 Use(s): herbicides / pesticides | ||
| 67583-77-1 | herbal cyclohexane | |
| EC: 266-722-5 Use(s): fragrance agents | ||
| 67594-73-4 | colubrinic acid | |
| Use(s): natural substances and extractives | ||
| 67601-05-2 | (S)- | citronellyl acetate |
| EC: 266-767-0 Use(s): flavor and fragrance agents | ||
| 67633-57-2 | iso | stearyl ethylimidazolinium ethosulfate |
| Use(s): antistatic, hair conditioning | ||
| 67633-59-4 | iso | stearamidopropalkonium chloride |
| EC: 266-777-5 Use(s): antistatic and conditioning agents | ||
| 67633-63-0 | iso | stearamidopropyl ethyldimonium ethosulfate |
| EC: 266-778-0 Use(s): antistatic and conditioning agents | ||
| 67633-92-5 | licorice diethyl acetal | |
| EC: 266-793-2 Use(s): fragrance agents | ||
| 67633-93-6 | 6- | diethoxymethyl hexahydromethano-1H-indene |
| EC: 266-794-8 Use(s): fragrance agents | ||
| 67633-94-7 | reseda acetal | |
| EC: 266-795-3 Use(s): fragrance agents | ||
| 67633-95-8 | ethyl hydroxyheptyl ketone | |
| EC: 266-796-9 Use(s): fragrance agents | ||
| 67633-96-9 | (Z)-3- | hexen-1-yl methyl carbonate |
| EC: 266-797-4 FLAVIS: 09.838 Use(s): flavor and fragrance agents | ||
| 67633-97-0 | 3- | mercapto-2-pentanone |
| EC: 266-799-5 FEMA: 3300 JECFA: 560 FLAVIS: 12.031 Use(s): flavoring agents | ||
| 67633-98-1 | santalyl butyrate | |
| EC: 266-800-9 Use(s): fragrance agents | ||
| 67633-99-2 | santalyl butyrate | |
| EC: 266-801-4 Use(s): flavor and fragrance agents | ||
| 67634-00-8 | allyl amyl glycolate | |
| EC: 266-803-5 Use(s): fragrance agents | ||
| 67634-00-8 | allyl amyl glycolate | |
| EC: 266-803-5 Use(s): fragrance agents | ||
| 67634-01-9 | allyl 2-methyl butoxyacetate | |
| EC: 266-804-0 Use(s): fragrance agents | ||
| 67634-02-0 | phenyl acetaldehyde digeranyl acetal | |
| EC: 266-805-6 Use(s): fragrance agents | ||
| 67634-03-1 | iso | propyl-beta-methyl cyclohexane ethanol |
| EC: 266-806-1 Use(s): fragrance agents | ||
| 67634-04-2 | phenyl acetaldehyde dihydrogeranyl acetal | |
| EC: 266-807-7 Use(s): fragrance agents | ||
| 67634-05-3 | 2,4,6- | trimethyl cyclohexyl methyl acetate |
| EC: 266-808-2 Use(s): fragrance agents | ||
| 67634-06-4 | 8-tert- | butyl quinoline |
| EC: 266-809-8 Use(s): fragrance agents | ||
| 67634-07-5 | 3,5,6-neo | cyclocitral |
| EC: 266-810-3 Use(s): fragrance agents | ||
| 67634-08-6 | tetrahydropentyl furfuryl acetate | |
| EC: 266-811-9 Use(s): fragrance agents | ||
| 67634-09-7 | methyl octanediyl diacetate | |
| EC: 266-812-4 Use(s): fragrance agents | ||
| 67634-11-1 | patchouli cyclohexanol | |
| EC: 266-815-0 Use(s): fragrance agents | ||
| 67634-12-2 | leerall / methyl anthranilate schiff's base | |
| EC: 266-816-6 Use(s): fragrance agents | ||
| 67634-14-4 | ozone propanal | |
| EC: 266-818-7 Use(s): fragrance agents | ||
| 67634-15-5 | ozone propanal | |
| EC: 266-819-2 Use(s): fragrance agents | ||
| 67634-16-6 | 2,4- | dimethyl-3-cyclohexene-1-methanol |
| EC: 266-820-8 Use(s): fragrance agents | ||
| 67634-17-7 | 2,4- | dimethyl-3-cyclohexene-1-methanol |
| EC: 266-821-3 Use(s): fragrance agents | ||
| 67634-20-2 | tricyclodecenyl isobutyrate | |
| EC: 266-825-5 Use(s): fragrance agents | ||
| 67634-21-3 | cuminyl formate | |
| EC: 266-826-0 Use(s): information only not used for fragrances or flavors | ||
| 67634-22-4 | 2,4- | dimethyl cyclohexyl methyl acetate |
| EC: 266-827-6 Use(s): fragrance agents | ||
| 67634-23-5 | melon acetal | |
| EC: 266-828-1 FEMA: 4595 JECFA: 2215 Use(s): flavor and fragrance agents | ||
| 67634-24-6 | hexahydromethanoinden-5-yl propionate | |
| EC: 266-829-7 Use(s): fragrance agents | ||
| 67634-25-7 | 2,4- | dimethyl-3-cyclohexene-1-methanyl acetate |
| EC: 266-830-2 Use(s): fragrance agents | ||
| 67634-26-8 | 2,4- | dimethyl cyclohex-3-ene-1-methyl acetate |
| EC: 266-831-8 Use(s): fragrance agents | ||
| 67643-70-3 | pepperwood | |
| Use(s): fragrance agents | ||
| 67649-65-4 | mono-n- | dodecyltin tris(isooctyl mercaptoacetate) |
| EC: 266-836-5 Use(s): indirect food additives: adhesives and components of coatings | ||
| 67662-96-8 | phenethyl pivalate | |
| EC: 266-841-2 Use(s): flavor and fragrance agents | ||
| 67663-01-8 | (±)-3- | methyl-gamma-decalactone |
| EC: 266-847-5 FEMA: 3999 JECFA: 1158 FLAVIS: 10.069 Use(s): flavor and fragrance agents | ||
| 67663-03-0 | 3- | butyl-4-methyl phenyl methyl ketone |
| EC: 266-849-6 Use(s): fragrance agents | ||
| 67663-04-1 | amyl 2-nonenoate | |
| EC: 266-850-1 Use(s): information only not used for fragrances or flavors | ||
| 67663-05-2 | 1- | ethyl cyclohexane-1,4-dimethanol |
| EC: 266-851-7 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 67674-26-4 | disperse blue 377 | |
| EC: 266-865-3 Use(s): hair dyeing agents | ||
| 67674-36-6 | (E,Z)-2,6- | nonadienal diethyl acetal |
| EC: 266-874-2 FEMA: 3378 JECFA: 946 FLAVIS: 06.025 Use(s): flavor and fragrance agents | ||
| 67674-37-7 | (Z,Z)-2,6- | nonadienal diethyl acetal |
| EC: 266-875-8 Use(s): flavor and fragrance agents | ||
| 67674-40-2 | (E,Z)-2,6- | nonadien-1-yl formate |
| EC: 266-878-4 Use(s): information only not used for fragrances or flavors | ||
| 67674-41-3 | benzyl tiglate | |
| EC: 266-880-5 FLAVIS: 09.858 Use(s): flavor and fragrance agents | ||
| 67674-42-4 | linalool oxide acetate (pyranoid) | |
| EC: 266-881-0 Use(s): natural substances and extractives | ||
| 67674-46-8 | grapefruit acetal | |
| EC: 266-885-2 Use(s): fragrance agents | ||
| 67674-46-8 | grapefruit acetal | |
| EC: 266-885-2 Use(s): fragrance agents | ||
| 67674-47-9 | (E,E)-2,6- | nonadien-1-yl acetate |
| EC: 266-886-8 Use(s): fragrance agents | ||
| 67685-22-7 | anhydroglycinol | |
| Use(s): natural substances and extractives | ||
| 67689-50-3 | linalool oxide acetates | |
| EC: 266-907-0 Use(s): flavor and fragrance agents | ||
| 67690-48-6 | (+)- | sabinone |
| Use(s): natural substances and extractives | ||
| 67701-01-3 | fatty acids C12-18 | |
| EC: 266-925-9 Use(s): information only not used for fragrances or flavors | ||
| 67701-02-4 | fatty acids C14-18 | |
| EC: 266-926-4 Use(s): information only not used for fragrances or flavors | ||
| 67701-03-5 | fatty acids C16-18 | |
| EC: 266-928-5 Use(s): information only not used for fragrances or flavors | ||
| 67701-05-7 | fatty acids C8-18 and C18-unsatd. | |
| EC: 266-929-0 Use(s): information only not used for fragrances or flavors | ||
| 67701-06-8 | fatty acids C14-18 and C16-18-unsatd. | |
| EC: 266-930-6 Use(s): information only not used for fragrances or flavors | ||
| 67701-08-0 | fatty acids C16-18 and C18-unsatd. | |
| EC: 266-932-7 Use(s): information only not used for fragrances or flavors | ||
| 67701-20-6 | sodium dilinoleate | |
| Use(s): emulsifiers, surfactants | ||
| 67701-26-2 | C12-18- | acid triglyceride |
| EC: 266-944-2 Use(s): cosmetic agents | ||
| 67701-27-3 | glycerides C14-18 | |
| EC: 266-945-8 Use(s): information only not used for fragrances or flavors | ||
| 67701-30-8 | glycerides C16-18 and C18-unsatd | |
| EC: 266-948-4 Use(s): information only not used for fragrances or flavors | ||
| 67701-32-0 | glycerides, C14-18 and C16-18-unsatd. mono- and di- | |
| EC: 266-951-0 Use(s): carrier solvents, encapsulating agent for food additives, flavorings, stabilizers and absorbents | ||
| 67701-33-1 | glycerides C14-18 mono- and di- | |
| EC: 266-952-6 FEMA: 4186 Use(s): solvents/deluents for flavor and/or fragrance agents | ||
| 67707-75-9 | ethyl 3,5,5-trimethyl hexanoate | |
| EC: 266-959-4 Use(s): fragrance agents | ||
| 67710-71-8 | hexahydrotetramethyl epoxymethanoazulene | |
| EC: 266-961-5 Use(s): fragrance agents | ||
| 67715-79-1 | 1,2- | di((1-ethoxy)ethoxy) propane |
| EC: 266-979-3 FEMA: 3534 JECFA: 927 FLAVIS: 06.039 Use(s): flavor and fragrance agents | ||
| 67715-80-4 | 2- | tropical oxathiane |
| FEMA: 3578 JECFA: 464 FLAVIS: 16.030 Use(s): flavor and fragrance agents | ||
| 67715-81-5 | 1,4- | nonane diol diacetate |
| FEMA: 3579 JECFA: 609 FLAVIS: 09.280 Use(s): flavor and fragrance agents | ||
| 67715-82-6 | acetaldehyde ethyl glyceryl mixed acetal | |
| FEMA: 3593 JECFA: 913 FLAVIS: 06.040 Use(s): flavor and fragrance agents | ||
| 67739-11-1 | methyl sandal | |
| EC: 415-990-3 Use(s): fragrance agents | ||
| 67746-08-1 | poly(linseed oil) | |
| Use(s): cosmetic agents | ||
| 67746-25-2 | butyl (methyl thio) acetate | |
| EC: 266-987-7 Use(s): information only not used for fragrances or flavors | ||
| 67746-30-9 | (E)-2- | hexenal diethyl acetal |
| EC: 266-989-8 FEMA: 4047 JECFA: 1383 Use(s): flavoring agents | ||
| 67747-09-5 | prochloraz | |
| EC: 266-994-5 Use(s): herbicides / pesticides | ||
| 67749-11-5 | hexadecyl neodecanoate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67760-89-8 | 5- | methyl-5-hexen-3-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 67760-91-2 | 2,5- | dimethyl-5-hexen-3-ol |
| Use(s): natural substances and extractives | ||
| 67762-26-9 | fatty acids C14-18 and C16-18-unsatd. me esters | |
| EC: 267-007-0 Use(s): information only not used for fragrances or flavors | ||
| 67762-27-0 | cetostearyl alcohol | |
| EC: 267-008-6 Use(s): cosmetic agents | ||
| 67762-30-5 | alcohols C14-18 | |
| EC: 267-009-1 Use(s): cosmetic agents | ||
| 67762-35-0 | peg-9 cocoglycerides | |
| Use(s): emollients, emulsifiers | ||
| 67762-36-1 | fatty acids C6-12 | |
| EC: 267-013-3 Use(s): information only not used for fragrances or flavors | ||
| 67762-38-3 | methyl soyate (C16-18 and C18-unsatd.) | |
| EC: 267-015-4 Use(s): cosmetic agents | ||
| 67762-40-7 | (C10-C16) alkylcarboxylic acid methyl ester | |
| EC: 267-018-0 Use(s): flavoring agents | ||
| 67762-41-8 | alcohols C10-16 | |
| EC: 267-019-6 Use(s): pharmaceuticals / chemical synthisis | ||
| 67762-52-1 | dipentaerythrityl hexa C5-9 acid esters | |
| EC: 267-021-7 Use(s): plasticizers | ||
| 67762-53-2 | pentaerythrityl tetra C5-9 acid esters | |
| EC: 267-022-2 Use(s): plasticizers | ||
| 67762-80-5 | TEA-diethanolaminoethyl polyisobutenylsuccinate | |
| Use(s): emulsifiers, surfactants | ||
| 67762-82-7 | phenethyl dimethicone | |
| Use(s): emollients | ||
| 67762-83-8 | stearyl dimethicone | |
| Use(s): emollients, skin conditioning | ||
| 67762-85-0 | peg/ppg-20/22 methyl ether dimethicone | |
| Use(s): emulsifiers | ||
| 67762-87-2 | peg/ppg-20/22 butyl ether dimethicone | |
| Use(s): cosmetic ingredient for skin and hair conditioning | ||
| 67762-87-2 | peg/ppg-24/18 butyl ether dimethicone | |
| Use(s): emulsifiers, surfactants | ||
| 67763-18-2 | diisostearyl malate | |
| EC: 267-041-6 Use(s): emollients, skin conditioning | ||
| 67770-79-0 | costus valerolactone | |
| EC: 267-048-4 Use(s): fragrance agents | ||
| 67784-77-4 | bis- | hydroxyethyl tallowmonium chloride |
| EC: 267-052-6 Use(s): antistatic agents | ||
| 67784-79-6 | propylene glycol soyate | |
| EC: 267-054-7 Use(s): surfactant, skin conditioning | ||
| 67784-80-9 | soybean oil methyl ester | |
| EC: 267-055-2 Use(s): information only not used for fragrances or flavors | ||
| 67784-82-1 | polyglyceryl-6 octastearate | |
| Use(s): emulsifiers | ||
| 67784-83-2 | propylene glycol cocoate | |
| EC: 267-056-8 Use(s): surfactant | ||
| 67784-96-7 | C12-15 pareth-12 oleate | |
| Use(s): emollients, skin conditioning | ||
| 67785-56-2 | potassium aluminum polyacrylate | |
| Use(s): absorbents, viscosity controlling agents | ||
| 67785-66-4 | nonisyl isobutyrate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67785-67-5 | arosa | |
| Use(s): fragrance agents | ||
| 67785-68-6 | 1-(10- | undecen-1-yl oxy)-10-undecen-1-ol |
| Use(s): information only not used for fragrances or flavors | ||
| 67785-69-7 | alpha- | amyl cinnamaldehyde digeranyl acetal |
| EC: 267-067-8 Use(s): fragrance agents | ||
| 67785-71-1 | amyl cinnamaldehyde dilinalyl acetal | |
| EC: 267-068-3 Use(s): fragrance agents | ||
| 67785-72-2 | cuminaldehyde dimethyl acetal | |
| Use(s): information only not used for fragrances or flavors | ||
| 67785-74-4 | 10- | undecen-1-al digeranyl acetal |
| Use(s): fragrance agents | ||
| 67785-76-6 | phenyl acetaldehyde / methyl anthranilate schiff's base | |
| EC: 267-070-4 Use(s): fragrance agents | ||
| 67785-77-7 | dimethyl benzyl carbinyl propionate | |
| EC: 267-072-5 Use(s): fragrance agents | ||
| 67799-04-6 | iso | stearamidopropyl dimethyl amine |
| EC: 267-101-1 Use(s): antistatic and conditioning agents | ||
| 67800-80-0 | methyl methyl undecylidene aminobenzoate | |
| EC: 267-104-8 Use(s): fragrance agents | ||
| 67800-85-5 | 5-(1,3- | dimethyl-1-butenyl)-dihydrofuran-2(3H)-one |
| EC: 267-110-0 Use(s): information only not used for fragrances or flavors | ||
| 67800-86-6 | ethyl fenchyl ether | |
| EC: 267-111-6 Use(s): fragrance agents | ||
| 67801-16-5 | dihydrogeranylidene bisindole | |
| EC: 267-136-2 Use(s): fragrance agents | ||
| 67801-17-6 | 2- | furfurylene octanal |
| EC: 267-137-8 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 67801-20-1 | sandal pentenol | |
| EC: 267-140-4 FEMA: 4775 JECFA: 2220 Use(s): flavor and fragrance agents | ||
| 67801-23-4 | iso | propyl methyl cyclohexyl tiglate |
| EC: 267-144-6 Use(s): fragrance agents | ||
| 67801-27-8 | 2,3,6- | trimethyl cyclohexyl methyl acetate |
| EC: 267-147-2 Use(s): fragrance agents | ||
| 67801-29-0 | methyl iritone (IFF) | |
| EC: 267-149-3 Use(s): fragrance agents | ||
| 67801-30-3 | 2,4,6- | trimethyl-3-cyclohexenyl-4-penten-3-one |
| EC: 267-150-9 Use(s): fragrance agents | ||
| 67801-31-4 | 3- | methyl-4-(3,5,6-trimethyl-3-cyclohexenyl)-3-buten-2-one |
| EC: 267-151-4 Use(s): fragrance agents | ||
| 67801-32-5 | 3,5,6- | trimethyl-3-cyclohexenyl-4-penten-3-one |
| EC: 267-153-5 Use(s): fragrance agents | ||
| 67801-33-6 | herbal ketone | |
| EC: 267-154-0 Use(s): fragrance agents | ||
| 67801-36-9 | indolall | |
| EC: 267-156-1 Use(s): fragrance agents | ||
| 67801-37-0 | phenyl ethylidene bisindole | |
| EC: 267-157-7 Use(s): fragrance agents | ||
| 67801-38-1 | orris butenone | |
| EC: 267-158-2 Use(s): fragrance agents | ||
| 67801-39-2 | trimethyl-3-cyclohexenyl-3-buten-2-one | |
| EC: 267-159-8 Use(s): fragrance agents | ||
| 67801-40-5 | methyl methyl propenyl octenone | |
| EC: 267-160-3 Use(s): fragrance agents | ||
| 67801-41-6 | trimethyl-5,7-decadien-2-one | |
| EC: 267-161-9 Use(s): fragrance agents | ||
| 67801-42-7 | iso | nonanal / methyl anthranilate schiff's base |
| EC: 267-162-4 Use(s): fragrance agents | ||
| 67801-43-8 | para- | cresyl 3-oxo-3-phenyl propionate |
| EC: 267-164-5 Use(s): fragrance agents | ||
| 67801-44-9 | octanal / methyl anthranilate schiff's base | |
| EC: 267-165-0 Use(s): fragrance agents | ||
| 67801-45-0 | 3- | heptenyl isobutyrate |
| EC: 267-166-6 FEMA: 3494 Use(s): flavor and fragrance agents | ||
| 67801-46-1 | hydroxynonanone | |
| EC: 267-167-1 Use(s): fragrance agents | ||
| 67801-47-2 | citral / methyl anthranilate schiff's base | |
| EC: 267-168-7 Use(s): fragrance agents | ||
| 67801-61-0 | oleamidopropyl dimethyl amine propionate | |
| EC: 267-181-8 Use(s): cosmetic agents | ||
| 67801-62-1 | lauramidopropyl dimethylamine propionate | |
| EC: 267-182-3 Use(s): antistatic and conditioning agents | ||
| 67801-64-3 | spicy carbonate | |
| EC: 267-184-4 Use(s): fragrance agents | ||
| 67801-65-4 | 3,6- | ivy carbaldehyde |
| EC: 267-186-5 FEMA: 4505 Use(s): flavor and fragrance agents | ||
| 67806-10-4 | myristamidopropylamine oxide | |
| EC: 267-191-2 Use(s): cosmetic agents | ||
| 67806-12-6 | palmitamidopropylamine oxide | |
| Use(s): cosmetic agents | ||
| 67806-13-7 | palmitamidopropyl diethylamine | |
| Use(s): antistatic and conditioning agents | ||
| 67828-19-7 | methoxyphenyl methyl butanone | |
| EC: 267-240-8 Use(s): fragrance agents | ||
| 67828-62-0 | ethyl 2,4-dihydroxyphenyl acetate | |
| EC: 267-281-1 Use(s): natural substances and extractives | ||
| 67828-71-1 | 5- | acetyl-2-((2-furanyl methyl)thio) dihydro-2,5-dimethyl-3(2H)-furanone |
| EC: 267-290-0 Use(s): information only not used for fragrances or flavors | ||
| 67845-28-7 | 2- | methyl-6-propoxypyrazine |
| EC: 267-306-6 Use(s): flavoring agents | ||
| 67845-30-1 | bark carbaldehyde | |
| EC: 267-308-7 Use(s): fragrance agents | ||
| 67845-31-2 | fenchyl butyrate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67845-32-3 | fenchyl isobutyrate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67845-34-5 | 2- | methyl-5-ethoxypyrazine |
| EC: 267-309-2 FEMA: 3569 Use(s): flavoring agents | ||
| 67845-36-7 | 2-iso | bornyl-6-methoxycyclohexanol |
| EC: 267-310-8 Use(s): information only not used for fragrances or flavors | ||
| 67845-37-8 | chamomile acetate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67845-42-5 | citronellal / methyl anthranilate schiff's base | |
| EC: 267-312-9 Use(s): fragrance agents | ||
| 67845-45-8 | cedryl isoprenyl ether | |
| EC: 267-316-0 Use(s): information only not used for fragrances or flavors | ||
| 67845-46-9 | para- | methyl phenoxyacetaldehyde |
| EC: 267-317-6 Use(s): fragrance agents | ||
| 67845-50-5 | (E+Z)-4,8- | dimethyl-3,7-nonadien-2-ol |
| EC: 267-321-8 FEMA: 4102 JECFA: 1841 FLAVIS: 02.252 Use(s): flavor and fragrance agents | ||
| 67845-52-7 | methyl dihydroisojasmonate | |
| EC: 267-323-9 Use(s): information only not used for fragrances or flavors | ||
| 67845-58-3 | tarragol acetate | |
| EC: 267-330-7 Use(s): fragrance agents | ||
| 67845-59-4 | alpha- | hexyl cinnamaldehyde diethyl acetal |
| EC: 267-331-2 Use(s): fragrance agents | ||
| 67845-79-8 | o- | aminophenol sulfate |
| EC: 267-335-4 Use(s): hair dyeing agents | ||
| 67845-93-6 | cetyl 3,5-di-tert-butyl-4-hydroxybenzoate | |
| EC: 267-342-2 Use(s): indirect food additives: adhesives and components of coatings | ||
| 67846-16-6 | stearamidopropyl ethyldimonium ethosulfate | |
| EC: 267-360-0 Use(s): antistatic and conditioning agents | ||
| 67846-47-3 | bis- | peg-18 methyl ether dimethyl silane |
| Use(s): emollients, humectants | ||
| 67846-68-8 | distearoylethyl dimonium chloride | |
| EC: 267-382-0 Use(s): antistatic and conditioning agents | ||
| 67859-54-5 | methyl 3-(hexyl thio) propionate | |
| EC: 267-401-2 Use(s): information only not used for fragrances or flavors | ||
| 67859-96-5 | homo | menthyl acetate |
| EC: 267-430-0 FEMA: 4512 JECFA: 2053 Use(s): flavor and fragrance agents | ||
| 67859-97-6 | herbal cyclohexane phenyl acetate | |
| EC: 267-431-6 Use(s): information only not used for fragrances or flavors | ||
| 67859-99-8 | neryl anthranilate | |
| EC: 267-433-7 Use(s): information only not used for fragrances or flavors | ||
| 67860-00-8 | 8,8-bis(1H- | indol-3-yl)-2,6-dimethyl-2-octanol |
| EC: 267-434-2 Use(s): fragrance agents | ||
| 67860-01-9 | maltyl butyrate | |
| EC: 267-435-8 Use(s): flavor and fragrance agents | ||
| 67860-02-0 | maltyl lactate | |
| EC: 267-436-3 Use(s): information only not used for fragrances or flavors | ||
| 67860-04-2 | 1,2- | epoxynonadecane |
| EC: 267-438-4 Use(s): natural substances and extractives | ||
| 67860-11-1 | fenchyl propionate | |
| Use(s): information only not used for fragrances or flavors | ||
| 67860-38-2 | 4- | acetyl-2-methyl pyrimidine |
| FEMA: 3654 JECFA: 1565 FLAVIS: 14.070 Use(s): flavoring agents | ||
| 67874-38-8 | iso | octyl linoleate |
| EC: 267-467-2 Use(s): information only not used for fragrances or flavors | ||
| 67874-65-1 | glyceryl thiopropionate | |
| EC: 267-492-9 Use(s): cosmetic agents | ||
| 67874-67-3 | decanal / methyl anthranilate schiff's base | |
| EC: 267-495-5 Use(s): fragrance agents | ||
| 67874-68-4 | phenoxyacetaldehyde dimethyl acetal | |
| EC: 267-496-0 Use(s): fragrance agents | ||
| 67874-69-5 | geranyl anthranilate | |
| EC: 267-497-6 Use(s): fragrance agents | ||
| 67874-72-0 | conifer acetate | |
| EC: 267-500-0 Use(s): fragrance agents | ||
| 67874-73-1 | 4-tert- | amyl cyclohexyl formate |
| EC: 267-501-6 Use(s): fragrance agents | ||
| 67874-74-2 | 4-tert- | amyl cyclohexyl propionate |
| EC: 267-502-1 Use(s): fragrance agents | ||
| 67874-76-4 | para- | cresyl 10-undecylenate |
| EC: 267-504-2 Use(s): information only not used for fragrances or flavors | ||
| 67874-77-5 | dihydrocitronellyl phenyl acetate | |
| EC: 267-505-8 Use(s): fragrance agents | ||
| 67874-78-6 | apricot isobutyrate | |
| EC: 267-506-3 Use(s): fragrance agents | ||
| 67874-80-0 | dihydrocitronellyl butyrate | |
| EC: 267-508-4 Use(s): fragrance agents | ||
| 67874-81-1 | cedryl methyl ether | |
| EC: 267-510-5 Use(s): fragrance agents | ||
| 67874-82-2 | 1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl formate |
| EC: 267-511-0 Use(s): information only not used for fragrances or flavors | ||
| 67874-96-8 | acrylates/diethylaminoethyl methacrylate/ethylhexyl acrylate copolymer | |
| Use(s): film forming agents | ||
| 67879-58-7 | mono | caffeyl tartaric acid |
| Use(s): natural substances and extractives | ||
| 67879-60-1 | iso | butyraldehyde propylene glycol acetal |
| EC: 267-550-3 FEMA: 4287 JECFA: 1713 Use(s): flavoring agents | ||
| 67880-32-4 | eleganolone | |
| Use(s): natural substances and extractives | ||
| 67881-99-6 | polyphosphorylcholine glycol acrylate | |
| Use(s): film forming agents | ||
| 67882-99-9 | 10- | methyl-2-undecanone |
| Use(s): natural substances and extractives | ||
| 67883-77-6 | cinnamyl 2-methyl butyrate | |
| EC: 267-552-4 Use(s): information only not used for fragrances or flavors | ||
| 67883-79-8 | (Z)-3- | hexen-1-yl tiglate |
| EC: 267-554-5 FEMA: 3931 JECFA: 1277 FLAVIS: 09.559 Use(s): flavor and fragrance agents | ||
| 67890-79-3 | iso | propyl methyl bicyclooctene carbaldehyde |
| EC: 267-559-2 Use(s): fragrance agents | ||
| 67892-25-5 | candida lipolytica | |
| Use(s): enzyme preparations and microorganisms | ||
| 67892-79-9 | polyacrylate-17 | |
| Use(s): film forming agents | ||
| 67892-91-5 | polyacrylate-15 | |
| Use(s): film forming agents | ||
| 67893-02-1 | methyl dihydroabietate | |
| EC: 267-605-1 Use(s): viscosity controlling agents | ||
| 67893-42-9 | disodium ricinoleamido MEA-sulfosuccinate | |
| EC: 265-672-1 Use(s): cosmetic agents | ||
| 67905-40-2 | prune glycidate | |
| EC: 267-660-1 Use(s): fragrance agents | ||
| 67919-67-9 | musk dodecane | |
| EC: 267-753-7 Use(s): fragrance agents | ||
| 67920-37-0 | cis- | coutaric acid |
| Use(s): natural substances and extractives | ||
| 67920-63-2 | (±)- | lilac aldehyde |
| Use(s): flavor and fragrance agents | ||
| 67920-94-9 | 1-iso | propyl-4-methyl bicyclooctene-2-carbaldehyde |
| EC: 267-755-8 Use(s): cosmetic fragrance agents and aromatic raw materials | ||
| 67923-07-3 | amodimethicone/silsesquioxane copolymer | |
| Use(s): film forming, hair conditioning agents | ||
| 67923-51-7 | nonisyl nonanoate | |
| EC: 267-767-3 Use(s): information only not used for fragrances or flavors | ||
| 67923-53-9 | orris butenol | |
| EC: 267-768-9 Use(s): information only not used for fragrances or flavors | ||
| 67923-58-4 | bornyl lactate | |
| EC: 267-774-1 Use(s): information only not used for fragrances or flavors | ||
| 67923-79-9 | iso | octanal diisotridecyl acetal |
| EC: 267-785-1 Use(s): fragrance agents | ||
| 67923-82-4 | citronellal diisotridecyl acetal | |
| EC: 267-786-7 Use(s): fragrance agents | ||
| 67923-83-5 | iso | nonanal diethyl acetal |
| EC: 267-787-2 Use(s): fragrance agents | ||
| 67923-84-6 | iso | nonanal / methyl anthranilate schiff's base |
| EC: 267-788-8 Use(s): fragrance agents | ||
| 67923-85-7 | hydroxycitronellal diisotridecyl acetal | |
| EC: 267-789-3 Use(s): fragrance agents | ||
| 67923-86-8 | citral diisotridecyl acetal | |
| EC: 267-790-9 Use(s): fragrance agents | ||
| 67924-13-4 | alpha- | amyl cinnamaldehyde / methyl anthranilate schiff's base |
| EC: 267-798-2 Use(s): fragrance agents | ||
| 67924-14-5 | methyl dodecylidene aminobenzoate | |
| EC: 267-799-8 Use(s): fragrance agents | ||
| 67924-34-9 | butylphenoxy epoxy resin | |
| Use(s): film forming agents | ||
| 67936-13-4 | 2-iso | propyl-4-methyl-3-thiazoline |
| EC: 267-816-9 FEMA: 4767 JECFA: 2206 Use(s): flavor enhancers | ||
| 67938-21-0 | polyglyceryl-2 diisostearate | |
| EC: 267-821-6 Use(s): emulsifiers | ||
| 67939-32-6 | butyl distearyl citrate | |
| EC: 267-833-1 Use(s): information only not used for fragrances or flavors | ||
| 67952-38-9 | raspberry alcohol | |
| EC: 267-891-8 Use(s): information only not used for fragrances or flavors | ||
| 67952-39-0 | para- | cresyl 2-methyl butyrate |
| EC: 267-892-3 Use(s): information only not used for fragrances or flavors | ||
| 67952-57-2 | 1,5- | dimethyl hexyl acetate |
| EC: 267-911-5 Use(s): fragrance agents | ||
| 67952-58-3 | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-6(5H)-one | |
| EC: 267-912-0 Use(s): information only not used for fragrances or flavors | ||
| 67952-59-4 | 2-iso | propyl-3-(methyl thio) pyrazine |
| EC: 267-913-6 FLAVIS: 14.122 Use(s): flavoring agents | ||
| 67952-60-7 | cocoa propanal | |
| EC: 267-914-1 FEMA: 3866 JECFA: 580 FLAVIS: 12.168 Use(s): flavoring agents | ||
| 67952-65-2 | 2- | methyl thio-3,5 or 6-methyl pyrazine |
| EC: 267-918-3 FEMA: 3208 JECFA: 797 FLAVIS: 14.035 Use(s): flavor and fragrance agents | ||
| 67952-68-5 | 2- | ethyl fenchol + arbanol |
| EC: 267-922-5 Use(s): fragrance agents | ||
| 67965-56-4 | polyglyceryl-2 dioleate | |
| Use(s): film forming agents | ||
| 67990-17-4 | sodium butoxyethoxyacetate | |
| EC: 268-040-3 Use(s): buffering agents | ||
| 67996-61-6 | gamma- | eudesmol acetate |
| Use(s): natural substances and extractives | ||
| 67999-48-8 | (Z)- | chrysanthenyl acetate |
| Use(s): natural substances and extractives | ||
| 67999-56-8 | iso | longifolene epoxide |
| EC: 268-066-5 Use(s): fragrance agents | ||
| 67999-56-8 | iso | longifolene epoxide |
| EC: 268-066-5 Use(s): fragrance agents | ||
| 67999-57-9 | disodium nonoxynol-10 sulfosuccinate | |
| Use(s): cosmetic agents | ||
| 68002-19-7 | butylated | polyoxymethylene urea |
| Use(s): film forming agents | ||
| 68002-20-0 | methoxypolyoxymethylene melamine | |
| Use(s): binding, film forming agents | ||
| 68002-60-8 | cocotrimonium methosulfate | |
| EC: 268-073-3 Use(s): antistatic and conditioning agents | ||
| 68002-62-0 | ceteartrimonium chloride | |
| EC: 268-075-4 Use(s): antistatic, hair conditioning | ||
| 68002-71-1 | glyceryl palmitate/stearate | |
| EC: 268-084-3 Use(s): emollients | ||
| 68002-88-0 | fatty acids C16-22 | |
| EC: 268-103-5 Use(s): information only not used for fragrances or flavors | ||
| 68002-94-8 | alcohols C16-18 and C18-unsatd. | |
| EC: 268-106-1 Use(s): information only not used for fragrances or flavors | ||
| 68002-97-1 | ethoxylated | C10-16 alcohols |
| EC: 500-182-6 Use(s): cosmetic agents | ||
| 68003-13-4 | MIPA-borate | |
| EC: 268-109-8 Use(s): cosmetic agents | ||
| 68003-46-3 | ammonium lauroyl sarcosinate | |
| EC: 268-130-2 Use(s): antistatic, surfactant agents | ||
| 68004-11-5 | polyglyceryl-4 stearate | |
| Use(s): emulsifiers | ||
| 68036-99-7 | ammonia-epichlorohydrin copolymer reacted with methyl chloride | |
| Use(s): ion-exchange resins | ||
| 68037-01-4 | hydrogenated 1- | decene homopolymer |
| EC: 500-183-1 Use(s): glazing agents, release agents | ||